DE1593963A1 - Verfahren zur Herstellung von aliphatischen acylierten Amin-Hydrochloriden und deren entsprechenden Isocyanaten - Google Patents
Verfahren zur Herstellung von aliphatischen acylierten Amin-Hydrochloriden und deren entsprechenden IsocyanatenInfo
- Publication number
- DE1593963A1 DE1593963A1 DE19671593963 DE1593963A DE1593963A1 DE 1593963 A1 DE1593963 A1 DE 1593963A1 DE 19671593963 DE19671593963 DE 19671593963 DE 1593963 A DE1593963 A DE 1593963A DE 1593963 A1 DE1593963 A1 DE 1593963A1
- Authority
- DE
- Germany
- Prior art keywords
- amino
- carbon atoms
- group
- acid
- mol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- -1 amine hydrochlorides Chemical class 0.000 title claims description 29
- 238000000034 method Methods 0.000 title claims description 16
- 238000002360 preparation method Methods 0.000 title claims description 5
- 239000012948 isocyanate Substances 0.000 title description 16
- 150000002513 isocyanates Chemical class 0.000 title description 12
- 125000001931 aliphatic group Chemical group 0.000 title description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 59
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 31
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 claims description 31
- 229910000041 hydrogen chloride Inorganic materials 0.000 claims description 31
- 238000006243 chemical reaction Methods 0.000 claims description 23
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 17
- 125000004432 carbon atom Chemical group C* 0.000 claims description 15
- 150000001413 amino acids Chemical class 0.000 claims description 14
- 239000011541 reaction mixture Substances 0.000 claims description 13
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 claims description 11
- 230000032050 esterification Effects 0.000 claims description 11
- 238000005886 esterification reaction Methods 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- 150000003951 lactams Chemical class 0.000 claims description 9
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 8
- 150000001298 alcohols Chemical class 0.000 claims description 6
- 125000005842 heteroatom Chemical group 0.000 claims description 6
- 150000003840 hydrochlorides Chemical class 0.000 claims description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 5
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- 239000001301 oxygen Substances 0.000 claims description 5
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 4
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 4
- 229910052717 sulfur Inorganic materials 0.000 claims description 4
- 239000011593 sulfur Substances 0.000 claims description 4
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- 150000001875 compounds Chemical class 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- GIAFURWZWWWBQT-UHFFFAOYSA-N 2-(2-aminoethoxy)ethanol Chemical compound NCCOCCO GIAFURWZWWWBQT-UHFFFAOYSA-N 0.000 claims description 2
- BKMMTJMQCTUHRP-UHFFFAOYSA-N 2-aminopropan-1-ol Chemical compound CC(N)CO BKMMTJMQCTUHRP-UHFFFAOYSA-N 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims 2
- 150000001735 carboxylic acids Chemical class 0.000 claims 2
- 125000002947 alkylene group Chemical group 0.000 claims 1
- 150000002148 esters Chemical class 0.000 claims 1
- 150000002431 hydrogen Chemical class 0.000 claims 1
- 230000000977 initiatory effect Effects 0.000 claims 1
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 claims 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 36
- 239000000203 mixture Substances 0.000 description 32
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 24
- 239000000460 chlorine Substances 0.000 description 20
- 239000000047 product Substances 0.000 description 20
- 239000002253 acid Substances 0.000 description 18
- 238000002844 melting Methods 0.000 description 16
- 230000008018 melting Effects 0.000 description 16
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 15
- 229940024606 amino acid Drugs 0.000 description 15
- 235000001014 amino acid Nutrition 0.000 description 14
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 229960004592 isopropanol Drugs 0.000 description 12
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 11
- 238000010992 reflux Methods 0.000 description 11
- 238000001953 recrystallisation Methods 0.000 description 10
- 238000004458 analytical method Methods 0.000 description 9
- 239000007788 liquid Substances 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- 125000003277 amino group Chemical group 0.000 description 8
- 150000002009 diols Chemical class 0.000 description 7
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 7
- 230000009257 reactivity Effects 0.000 description 7
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- 239000007789 gas Substances 0.000 description 6
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate group Chemical group [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- 239000012429 reaction media Substances 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- 125000005442 diisocyanate group Chemical group 0.000 description 5
- 150000003839 salts Chemical class 0.000 description 5
- CFXQEHVMCRXUSD-UHFFFAOYSA-N 1,2,3-Trichloropropane Chemical compound ClCC(Cl)CCl CFXQEHVMCRXUSD-UHFFFAOYSA-N 0.000 description 4
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 4
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 4
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 238000004821 distillation Methods 0.000 description 4
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 4
- 229940031098 ethanolamine Drugs 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 125000001424 substituent group Chemical group 0.000 description 4
- 239000007795 chemical reaction product Substances 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- ALYNCZNDIQEVRV-UHFFFAOYSA-N 4-aminobenzoic acid Chemical compound NC1=CC=C(C(O)=O)C=C1 ALYNCZNDIQEVRV-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical group CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- 150000008065 acid anhydrides Chemical class 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000000538 analytical sample Substances 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- UCMIRNVEIXFBKS-UHFFFAOYSA-N beta-alanine Chemical compound NCCC(O)=O UCMIRNVEIXFBKS-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- 239000004009 herbicide Substances 0.000 description 2
- RRAMGCGOFNQTLD-UHFFFAOYSA-N hexamethylene diisocyanate Chemical compound O=C=NCCCCCCN=C=O RRAMGCGOFNQTLD-UHFFFAOYSA-N 0.000 description 2
- XXMIOPMDWAUFGU-UHFFFAOYSA-N hexane-1,6-diol Chemical compound OCCCCCCO XXMIOPMDWAUFGU-UHFFFAOYSA-N 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 239000002917 insecticide Substances 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 150000002540 isothiocyanates Chemical class 0.000 description 2
- QWVGKYWNOKOFNN-UHFFFAOYSA-N o-cresol Chemical compound CC1=CC=CC=C1O QWVGKYWNOKOFNN-UHFFFAOYSA-N 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 238000003822 preparative gas chromatography Methods 0.000 description 2
- 239000000523 sample Substances 0.000 description 2
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 2
- 239000010409 thin film Substances 0.000 description 2
- KBCPMQUSOLSAQO-UHFFFAOYSA-N (4-carboxyphenyl)azanium;chloride Chemical compound Cl.NC1=CC=C(C(O)=O)C=C1 KBCPMQUSOLSAQO-UHFFFAOYSA-N 0.000 description 1
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 1
- LRHPLDYGYMQRHN-UHFFFAOYSA-N 1-butanol Substances CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 1
- VOZKAJLKRJDJLL-UHFFFAOYSA-N 2,4-diaminotoluene Chemical compound CC1=CC=C(N)C=C1N VOZKAJLKRJDJLL-UHFFFAOYSA-N 0.000 description 1
- VVLMVJGZXFBSPZ-UHFFFAOYSA-N 2-aminoethyl 3-aminopropanoate;dihydrochloride Chemical compound Cl.Cl.NCCOC(=O)CCN VVLMVJGZXFBSPZ-UHFFFAOYSA-N 0.000 description 1
- PMUNIMVZCACZBB-UHFFFAOYSA-N 2-hydroxyethylazanium;chloride Chemical compound Cl.NCCO PMUNIMVZCACZBB-UHFFFAOYSA-N 0.000 description 1
- VPBHZJRYYNAHLZ-UHFFFAOYSA-N 6-(3-amino-3-methylbutanoyl)oxyhexyl 3-amino-3-methylbutanoate;dihydrochloride Chemical compound Cl.Cl.CC(C)(N)CC(=O)OCCCCCCOC(=O)CC(C)(C)N VPBHZJRYYNAHLZ-UHFFFAOYSA-N 0.000 description 1
- XCZWKRPJTSFMIK-UHFFFAOYSA-N 6-(6-aminohexanoyloxy)hexyl 6-aminohexanoate;dihydrochloride Chemical compound Cl.Cl.NCCCCCC(=O)OCCCCCCOC(=O)CCCCCN XCZWKRPJTSFMIK-UHFFFAOYSA-N 0.000 description 1
- IOKGEQYDIDASIT-UHFFFAOYSA-N 6-aminohexanoic acid;dihydrochloride Chemical compound Cl.Cl.NCCCCCC(O)=O IOKGEQYDIDASIT-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 235000016936 Dendrocalamus strictus Nutrition 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- 239000005057 Hexamethylene diisocyanate Substances 0.000 description 1
- AHLPHDHHMVZTML-BYPYZUCNSA-N L-Ornithine Chemical compound NCCC[C@H](N)C(O)=O AHLPHDHHMVZTML-BYPYZUCNSA-N 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- AGPKZVBTJJNPAG-WHFBIAKZSA-N L-isoleucine Chemical compound CC[C@H](C)[C@H](N)C(O)=O AGPKZVBTJJNPAG-WHFBIAKZSA-N 0.000 description 1
- FFEARJCKVFRZRR-BYPYZUCNSA-N L-methionine Chemical compound CSCC[C@H](N)C(O)=O FFEARJCKVFRZRR-BYPYZUCNSA-N 0.000 description 1
- COLNVLDHVKWLRT-QMMMGPOBSA-N L-phenylalanine Chemical compound OC(=O)[C@@H](N)CC1=CC=CC=C1 COLNVLDHVKWLRT-QMMMGPOBSA-N 0.000 description 1
- JHWNWJKBPDFINM-UHFFFAOYSA-N Laurolactam Chemical compound O=C1CCCCCCCCCCCN1 JHWNWJKBPDFINM-UHFFFAOYSA-N 0.000 description 1
- AHLPHDHHMVZTML-UHFFFAOYSA-N Orn-delta-NH2 Natural products NCCCC(N)C(O)=O AHLPHDHHMVZTML-UHFFFAOYSA-N 0.000 description 1
- UTJLXEIPEHZYQJ-UHFFFAOYSA-N Ornithine Natural products OC(=O)C(C)CCCN UTJLXEIPEHZYQJ-UHFFFAOYSA-N 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- WUGQZFFCHPXWKQ-UHFFFAOYSA-N Propanolamine Chemical compound NCCCO WUGQZFFCHPXWKQ-UHFFFAOYSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 229920001807 Urea-formaldehyde Polymers 0.000 description 1
- 241000700605 Viruses Species 0.000 description 1
- YIMQCDZDWXUDCA-UHFFFAOYSA-N [4-(hydroxymethyl)cyclohexyl]methanol Chemical compound OCC1CCC(CO)CC1 YIMQCDZDWXUDCA-UHFFFAOYSA-N 0.000 description 1
- UKLDJPRMSDWDSL-UHFFFAOYSA-L [dibutyl(dodecanoyloxy)stannyl] dodecanoate Chemical compound CCCCCCCCCCCC(=O)O[Sn](CCCC)(CCCC)OC(=O)CCCCCCCCCCC UKLDJPRMSDWDSL-UHFFFAOYSA-L 0.000 description 1
- 150000008043 acidic salts Chemical class 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- 125000002723 alicyclic group Chemical group 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000001414 amino alcohols Chemical class 0.000 description 1
- 229960004050 aminobenzoic acid Drugs 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 125000001204 arachidyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000002511 behenyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 235000010980 cellulose Nutrition 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 239000003431 cross linking reagent Substances 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 238000010908 decantation Methods 0.000 description 1
- 239000012975 dibutyltin dilaurate Substances 0.000 description 1
- 229940117389 dichlorobenzene Drugs 0.000 description 1
- 150000001993 dienes Chemical class 0.000 description 1
- 239000003822 epoxy resin Substances 0.000 description 1
- 229940073579 ethanolamine hydrochloride Drugs 0.000 description 1
- 239000010408 film Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 229960000310 isoleucine Drugs 0.000 description 1
- AGPKZVBTJJNPAG-UHFFFAOYSA-N isoleucine Natural products CCC(C)C(N)C(O)=O AGPKZVBTJJNPAG-UHFFFAOYSA-N 0.000 description 1
- DWPCPZJAHOETAG-UHFFFAOYSA-N meso-lanthionine Natural products OC(=O)C(N)CSCC(N)C(O)=O DWPCPZJAHOETAG-UHFFFAOYSA-N 0.000 description 1
- 229930182817 methionine Natural products 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 238000000199 molecular distillation Methods 0.000 description 1
- 230000036651 mood Effects 0.000 description 1
- 229940078552 o-xylene Drugs 0.000 description 1
- 229960003104 ornithine Drugs 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- COLNVLDHVKWLRT-UHFFFAOYSA-N phenylalanine Natural products OC(=O)C(N)CC1=CC=CC=C1 COLNVLDHVKWLRT-UHFFFAOYSA-N 0.000 description 1
- 125000004344 phenylpropyl group Chemical group 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 239000005056 polyisocyanate Substances 0.000 description 1
- 229920001228 polyisocyanate Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 235000019422 polyvinyl alcohol Nutrition 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000002271 resection Methods 0.000 description 1
- 238000007142 ring opening reaction Methods 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 238000004513 sizing Methods 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- ZWZVWGITAAIFPS-UHFFFAOYSA-N thiophosgene Chemical compound ClC(Cl)=S ZWZVWGITAAIFPS-UHFFFAOYSA-N 0.000 description 1
- 231100000167 toxic agent Toxicity 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 125000002889 tridecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000003673 urethanes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C265/00—Derivatives of isocyanic acid
- C07C265/02—Derivatives of isocyanic acid having isocyanate groups bound to acyclic carbon atoms
- C07C265/04—Derivatives of isocyanic acid having isocyanate groups bound to acyclic carbon atoms of a saturated carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C227/00—Preparation of compounds containing amino and carboxyl groups bound to the same carbon skeleton
- C07C227/14—Preparation of compounds containing amino and carboxyl groups bound to the same carbon skeleton from compounds containing already amino and carboxyl groups or derivatives thereof
- C07C227/18—Preparation of compounds containing amino and carboxyl groups bound to the same carbon skeleton from compounds containing already amino and carboxyl groups or derivatives thereof by reactions involving amino or carboxyl groups, e.g. hydrolysis of esters or amides, by formation of halides, salts or esters
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C229/00—Compounds containing amino and carboxyl groups bound to the same carbon skeleton
- C07C229/02—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C229/04—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C229/06—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one amino and one carboxyl group bound to the carbon skeleton
- C07C229/08—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one amino and one carboxyl group bound to the carbon skeleton the nitrogen atom of the amino group being further bound to hydrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C229/00—Compounds containing amino and carboxyl groups bound to the same carbon skeleton
- C07C229/02—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C229/04—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C229/24—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having more than one carboxyl group bound to the carbon skeleton, e.g. aspartic acid
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C229/00—Compounds containing amino and carboxyl groups bound to the same carbon skeleton
- C07C229/52—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton
- C07C229/54—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton with amino and carboxyl groups bound to carbon atoms of the same non-condensed six-membered aromatic ring
- C07C229/60—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton with amino and carboxyl groups bound to carbon atoms of the same non-condensed six-membered aromatic ring with amino and carboxyl groups bound in meta- or para- positions
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C263/00—Preparation of derivatives of isocyanic acid
- C07C263/04—Preparation of derivatives of isocyanic acid from or via carbamates or carbamoyl halides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C265/00—Derivatives of isocyanic acid
- C07C265/12—Derivatives of isocyanic acid having isocyanate groups bound to carbon atoms of six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G18/00—Polymeric products of isocyanates or isothiocyanates
- C08G18/06—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen
- C08G18/70—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen characterised by the isocyanates or isothiocyanates used
- C08G18/72—Polyisocyanates or polyisothiocyanates
- C08G18/77—Polyisocyanates or polyisothiocyanates having heteroatoms in addition to the isocyanate or isothiocyanate nitrogen and oxygen or sulfur
- C08G18/771—Polyisocyanates or polyisothiocyanates having heteroatoms in addition to the isocyanate or isothiocyanate nitrogen and oxygen or sulfur oxygen
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Health & Medical Sciences (AREA)
- Emergency Medicine (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US51897766A | 1966-01-06 | 1966-01-06 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1593963A1 true DE1593963A1 (de) | 1970-08-20 |
Family
ID=24066274
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19671618798 Pending DE1618798A1 (de) | 1966-01-06 | 1967-01-04 | Neue aliphatische,acylgruppenhaltige Isocyanate und Verfahren zu deren Herstellung |
| DE19671593963 Pending DE1593963A1 (de) | 1966-01-06 | 1967-01-04 | Verfahren zur Herstellung von aliphatischen acylierten Amin-Hydrochloriden und deren entsprechenden Isocyanaten |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19671618798 Pending DE1618798A1 (de) | 1966-01-06 | 1967-01-04 | Neue aliphatische,acylgruppenhaltige Isocyanate und Verfahren zu deren Herstellung |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3567763A (enExample) |
| JP (1) | JPS507584B1 (enExample) |
| BE (1) | BE691995A (enExample) |
| DE (2) | DE1618798A1 (enExample) |
| FR (1) | FR1507036A (enExample) |
| GB (2) | GB1176328A (enExample) |
| NL (1) | NL6700146A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0044363A1 (en) * | 1980-07-22 | 1982-01-27 | Toray Industries, Inc. | Method for preparing aminoalkyl esters of aminoacids |
Families Citing this family (70)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4395569A (en) | 1968-06-27 | 1983-07-26 | Rohm And Haas Company | Method of preparing sulfonic acid salts of acyloxyalkylamines and polymers and compounds therefrom |
| US4201847A (en) * | 1973-02-16 | 1980-05-06 | Bayer Aktiengesellschaft | Process of preparing foams with internal mold-release agents |
| DE2307589C3 (de) * | 1973-02-16 | 1984-11-15 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von Schaumstoffen mit vorzüglichen Entformungseigenschaften |
| US4247675A (en) * | 1979-08-14 | 1981-01-27 | Toray Industries, Inc. | Polyurethane resins and polyurethane resin coating compositions |
| JPS5864902U (ja) * | 1981-10-23 | 1983-05-02 | 株式会社日立ホームテック | 石油スト−ブ |
| JPS59166850U (ja) * | 1983-04-20 | 1984-11-08 | ブラザー工業株式会社 | 電気集塵機 |
| US4816529A (en) * | 1985-11-18 | 1989-03-28 | The Dow Chemical Company | Novel ester-modified poly(alkylene carbonate) polyahls and polyurethanes therefrom |
| US4795810A (en) * | 1985-11-18 | 1989-01-03 | The Dow Chemical Company | Modified poly(alkylene carbonate) polyahls |
| US5084528A (en) * | 1985-12-16 | 1992-01-28 | The Dow Chemical Company | Novel ester-modified poly(alkylene carbonate) polyahls |
| US4948862A (en) * | 1985-12-16 | 1990-08-14 | The Dow Chemical Company | Modified poly(alkylene carbonate) polyahls |
| US4689353A (en) * | 1986-02-21 | 1987-08-25 | The Dow Chemical Company | Hydroxy and amino-functional polyahls containing carbonate, urethane and/or urea moieties |
| US4861909A (en) * | 1986-04-11 | 1989-08-29 | The Dow Chemical Company | Isocyanate-modified poly(alkylene carbonate) polyahls |
| DE3633712A1 (de) * | 1986-10-03 | 1988-04-14 | Bayer Ag | Diisocyanat, ein verfahren zu seiner herstellung und seine verwendung |
| US4959499A (en) * | 1986-11-04 | 1990-09-25 | The Dow Chemical Company | Liquid polymers containing urethane and urea moieties and hydroxyl and/or amino end groups and a process for the preparation thereof |
| DE4417186A1 (de) * | 1994-05-17 | 1995-11-23 | Bayer Ag | Neue Diisocyanate, ein Verfahren zu ihrer Herstellung und ihre Verwendung |
| US5965256A (en) * | 1997-10-14 | 1999-10-12 | Minnesota Mining And Manufacturing Company | Protective films and coatings |
| US6001936A (en) * | 1997-10-24 | 1999-12-14 | 3M Innovative Properties Company | Dye enhanced durability through controlled dye environment |
| US20080108719A1 (en) * | 1999-10-25 | 2008-05-08 | Geiger Eric J | Phthalic Anhydride Based Polyester-Ether Polyols and Double Metal Cyanide Catalyst System for Preparing Same |
| US20050085658A1 (en) * | 1999-10-25 | 2005-04-21 | Geiger Eric J. | Phthalic anhydride based polyester-ether polyols and double metal cyanide catalyst system for preparing same |
| US20080125247A1 (en) * | 2004-06-02 | 2008-05-29 | Murali Rajagopalan | Compositions for Golf Equipment |
| US7105628B2 (en) * | 2002-08-27 | 2006-09-12 | Acushnet Company | Compositions for golf equipment |
| SE0101523L (sv) * | 2000-12-29 | 2002-06-30 | Artimplant Ab | Linjär polymer |
| US7098274B2 (en) * | 2002-08-27 | 2006-08-29 | Acushnet Company | Compositions for golf equipment |
| US6582771B1 (en) | 2002-05-03 | 2003-06-24 | Bayer Corporation | Method for producing a polyurethane/geofabric composite |
| US7138477B2 (en) * | 2002-08-27 | 2006-11-21 | Acushnet Company | Compositions for golf equipment |
| US7101951B2 (en) * | 2002-08-27 | 2006-09-05 | Acushnet Company | Compositions for golf equipment |
| US7115703B2 (en) * | 2002-08-27 | 2006-10-03 | Acushnet Company | Compositions for golf equipment |
| US7157545B2 (en) * | 2002-08-27 | 2007-01-02 | Acushnet Company | Compositions for golf equipment |
| US7138476B2 (en) * | 2002-08-27 | 2006-11-21 | Acushnet Company | Compositions for golf equipment |
| US7105623B2 (en) * | 2002-08-27 | 2006-09-12 | Acushnet Company | Compositions for golf equipment |
| US7378483B2 (en) * | 2002-08-27 | 2008-05-27 | Acushnet Company | Compositions for golf equipment |
| US7138475B2 (en) * | 2002-08-27 | 2006-11-21 | Acushnet Company | Compositions for golf equipment |
| WO2004083274A1 (en) * | 2003-03-13 | 2004-09-30 | Stepan Company | Polyester polyols for polyurethane adhesives |
| US20110136587A1 (en) * | 2003-05-09 | 2011-06-09 | Shawn Ricci | Golf balls comprising thermoplastic or thermoset composition having controlled gel time |
| US20060035994A1 (en) * | 2004-05-17 | 2006-02-16 | Kaplan Warren A | Method for preparing phthalate polyester polyol-based dimensionally stable spray polyurethane foam |
| US7253245B2 (en) * | 2004-06-02 | 2007-08-07 | Acushnet Company | Compositions for golf equipment |
| US7253242B2 (en) * | 2004-06-02 | 2007-08-07 | Acushnet Company | Compositions for golf equipment |
| US7256249B2 (en) * | 2004-06-02 | 2007-08-14 | Acushnet Company | Compositions for golf equipment |
| US7276570B2 (en) * | 2004-06-02 | 2007-10-02 | Acushnet Company | Compositions for golf equipment |
| US7265195B2 (en) * | 2004-06-02 | 2007-09-04 | Acushnet Company | Compositions for golf equipment |
| US20080103265A1 (en) * | 2004-11-05 | 2008-05-01 | Basf Aktiengesellschaft | Microcapsule Dispersions |
| EP1666927A1 (de) * | 2004-12-03 | 2006-06-07 | Nanogate Advanced Materials GmbH | Sonnenschutzfolie |
| KR101572276B1 (ko) | 2007-07-23 | 2015-11-26 | 다우 글로벌 테크놀로지스 엘엘씨 | 사용 온도 범위에 걸쳐 실질적으로 일정한 g-계수를 갖는 2 부분 폴리우레탄 경화성 조성물 |
| DE102007046187A1 (de) | 2007-09-26 | 2009-04-09 | Bayer Materialscience Ag | Dachmodul |
| WO2009142899A1 (en) | 2008-05-22 | 2009-11-26 | Dow Global Technologies Inc. | Thermoset polyurethanes comprising cis, trans-1, 3- and 1, 4-cyclohexanedimethylether groups |
| DE102008051882A1 (de) | 2008-10-16 | 2010-04-29 | Bayer Materialscience Ag | Verfahren zur Herstellung von Polyetheresterpolyolen |
| US10239985B2 (en) | 2008-12-23 | 2019-03-26 | Covestro Llc | Polymer polyols comprising a natural oil base polyol, polyurethane foams comprising these polymer polyols and processes for their preparation |
| RU2578713C9 (ru) | 2010-12-15 | 2016-11-20 | Байер Интеллектуэль Проперти Гмбх | Устойчивые к высоким температурам пеноматериалы |
| WO2012150201A2 (de) | 2011-05-02 | 2012-11-08 | Bayer Intellectual Property Gmbh | Hochtemperaturbeständige schaumstoffe mit geringer wärmeleitfähigkeit |
| WO2013127850A1 (en) | 2012-02-29 | 2013-09-06 | Bayer Intellectual Property Gmbh | 2-k pultrusion formulation and process |
| DE102012209598A1 (de) | 2012-06-06 | 2013-12-12 | Cht R. Beitlich Gmbh | Textilhilfsmittel und damit veredeltes Textilprodukt |
| DE102012222045A1 (de) | 2012-12-03 | 2014-06-05 | Cht R. Beitlich Gmbh | Beschichtung von Luminophoren |
| WO2015100128A1 (en) | 2013-12-23 | 2015-07-02 | Dow Global Technologies Llc | Adhesive containing high solid copolymer polyol polyurethane prepolymer |
| EP2894180A1 (en) | 2014-01-08 | 2015-07-15 | Bayer MaterialScience AG | Polymer Polyols comprising a Polyether Carbonate Polyol as the Base Polyol |
| CN107250230A (zh) | 2015-02-20 | 2017-10-13 | 科思创德国股份有限公司 | 耐高温的泡沫材料 |
| CN108290368A (zh) | 2015-09-17 | 2018-07-17 | 罗伯特·维洛兹·赫雷斯 | 承载复合面板、材料、产品及其制造和使用方法 |
| WO2018226380A1 (en) * | 2017-06-07 | 2018-12-13 | Us Synthetic Corporation | Bearing assemblies, related bearing apparatuses, and related methods |
| EP3746289B1 (en) | 2018-02-02 | 2021-12-29 | Basf Se | Simultaneous optimization of fiber sizing in-line with the pultrusion process |
| ES2928825T3 (es) * | 2018-07-03 | 2022-11-22 | Nouryon Chemicals Int Bv | Esteres de ácidos amino carboxílicos y un proceso para prepararlos |
| EP3741788A1 (de) | 2019-05-24 | 2020-11-25 | Covestro Deutschland AG | Verfahren zur herstellung von polyoxyalkylenpolyol-mischungen |
| EP3838963A1 (de) | 2019-12-17 | 2021-06-23 | Covestro Deutschland AG | Verfahren zur herstellung von polyoxyalkylenpolyesterpolyolen |
| EP3845304A1 (en) * | 2019-12-30 | 2021-07-07 | Bayer AG | Capsule suspension concentrates based on polyisocyanates and biodegradable amine based cross-linker |
| WO2022060685A1 (en) | 2020-09-15 | 2022-03-24 | Dow Global Technologies Llc | Low odor polyurethane adhesives |
| WO2022096390A1 (de) | 2020-11-06 | 2022-05-12 | Covestro Deutschland Ag | Verfahren zur herstellung eines polyol-gemisches |
| EP4413056B1 (de) | 2021-10-07 | 2025-07-23 | Covestro Deutschland AG | Verfahren zur herstellung von polyoxyalkylenpolyesterpolyolen |
| EP4480993A1 (de) | 2023-06-23 | 2024-12-25 | Covestro Deutschland AG | Verfahren zur herstellung eines polyoxyalkylenpolyols |
| WO2024260924A1 (de) | 2023-06-23 | 2024-12-26 | Covestro Deutschland Ag | Verfahren zur herstellung eines polyoxyalkylenpolyols |
| WO2025131996A1 (de) | 2023-12-21 | 2025-06-26 | Covestro Deutschland Ag | Verbindung enthaltend oximische hydroxylgruppen und deren herstellungsverfahren |
| EP4574869A1 (de) | 2023-12-21 | 2025-06-25 | Covestro Deutschland AG | Verbindung enthaltend oximische hydroxylgruppen und deren herstellungsverfahren |
| EP4644451A1 (de) | 2024-04-29 | 2025-11-05 | Covestro Deutschland AG | Verbindung enthaltend aromatische hydroxylgruppen und deren herstellungsverfahren |
-
1966
- 1966-01-06 US US518977A patent/US3567763A/en not_active Expired - Lifetime
- 1966-12-30 BE BE691995D patent/BE691995A/xx unknown
- 1966-12-30 FR FR89562A patent/FR1507036A/fr not_active Expired
-
1967
- 1967-01-04 DE DE19671618798 patent/DE1618798A1/de active Pending
- 1967-01-04 DE DE19671593963 patent/DE1593963A1/de active Pending
- 1967-01-05 GB GB54012/66A patent/GB1176328A/en not_active Expired
- 1967-01-05 NL NL6700146A patent/NL6700146A/xx unknown
- 1967-01-05 GB GB35352/69A patent/GB1176329A/en not_active Expired
- 1967-04-22 JP JP42025620A patent/JPS507584B1/ja active Pending
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0044363A1 (en) * | 1980-07-22 | 1982-01-27 | Toray Industries, Inc. | Method for preparing aminoalkyl esters of aminoacids |
Also Published As
| Publication number | Publication date |
|---|---|
| GB1176328A (en) | 1970-01-01 |
| US3567763A (en) | 1971-03-02 |
| GB1176329A (en) | 1970-01-01 |
| FR1507036A (fr) | 1967-12-22 |
| NL6700146A (enExample) | 1967-07-07 |
| BE691995A (enExample) | 1967-06-30 |
| JPS507584B1 (enExample) | 1975-03-27 |
| DE1618798A1 (de) | 1971-02-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1593963A1 (de) | Verfahren zur Herstellung von aliphatischen acylierten Amin-Hydrochloriden und deren entsprechenden Isocyanaten | |
| DE69222972T2 (de) | Herstellung von Urethan- und Carbonatprodukten | |
| DE1668805C3 (de) | Verfahren zur Herstellung von Hydroxyphenylharnstoffen | |
| DE3025999C2 (de) | Verfahren zur Herstellung von Polymethylen-polyphenyl-carbamaten | |
| DE1900514A1 (de) | Verfahren zur Herstellung von Diisocyanaten | |
| EP0432135A1 (de) | Zwischenprodukte für Benzoylphenylharnstoffe | |
| DE2903589A1 (de) | Verfahren zur razemisierung von optisch aktiven aminen | |
| DE941288C (de) | Verfahren zur Herstellung substituierter 2-Imino-4-thiazoline oder von Salzen derselben bzw. von substituierten 2-Aminothiazolen | |
| DE3781518T2 (de) | Verfahren zur herstellung von primaeren aralkylurethanen, harnstoffe und isocyanate, die von ihnen abgeleitet sind. | |
| DE19535506A1 (de) | Herstellung von Etherisocyanaten durch Gasphasenphosgenierung von Etheraminen | |
| EP0071839B1 (de) | Neue N,N-disubstituierte Sulfonamidgruppen aufweisende aromatische Diisocyanate, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Aufbaukomponente bei der Herstellung von Polyurethanen | |
| DE1123662B (de) | Verfahren zur Herstellung von Alkylbenzoldiisocyanaten | |
| DE1161905B (de) | Verfahren zur Herstellung von neuen Kondensationsprodukten tetramerer Halogencyane | |
| DE69610549T2 (de) | Neue carbamatverbindungen die eine thiocarbamoylgruppe enthalten und verfahren zu ihrer herstellung | |
| DE2521347B2 (de) | Hydroxylsubstituierte 2-Chlor- a -(tertbutylaminomethyD-benzylalkohole, Herstellungsverfahren und Arzneimittel | |
| DE1238455B (de) | Verfahren zur Herstellung von substituierten Phenyl-alkyl-harnstoffen | |
| DE3135489A1 (de) | 4-isocyanato-2,2,6,6-tetramethylpiperidin sowie seine herstellung | |
| DE2710504A1 (de) | Verfahren zur herstellung von optisch aktivem phenylglycin | |
| DE1620196A1 (de) | Verfahren zur Herstellung 3-substituierter 5-(2-Halogenaethyl)-2-oxazolidinone | |
| DE69614842T2 (de) | Neue carbamatverbindungen die eine n-substituierte thiocarbamoylgruppe haben und verfahren zu ihrer herstellung | |
| DE1568497C3 (enExample) | ||
| DE2555830A1 (de) | Verfahren zur herstellung von organischen isocyanaten | |
| DE1253262B (de) | Verfahren zur Herstellung von organischen Mono- oder Polyisocyanaten | |
| DE1145162B (de) | Verfahren zur Herstellung von Carbaminsaeureestern | |
| DE1445760C (de) | Substituierte 1 eckige Klammer auf Thiazolyl (2) eckige Klammer zu hexahydro s tnazin 2 one und thione |