DE1568129A1 - Verfahren zur Herstellung von Dimeren von alpha-Olefinen,insbesondere geradkettigen Dimeren - Google Patents
Verfahren zur Herstellung von Dimeren von alpha-Olefinen,insbesondere geradkettigen DimerenInfo
- Publication number
- DE1568129A1 DE1568129A1 DE19661568129 DE1568129A DE1568129A1 DE 1568129 A1 DE1568129 A1 DE 1568129A1 DE 19661568129 DE19661568129 DE 19661568129 DE 1568129 A DE1568129 A DE 1568129A DE 1568129 A1 DE1568129 A1 DE 1568129A1
- Authority
- DE
- Germany
- Prior art keywords
- compound
- aluminum
- activating agent
- dimers
- alpha
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 30
- 239000004711 α-olefin Substances 0.000 title claims description 10
- 239000000539 dimer Substances 0.000 title description 7
- 229910052782 aluminium Inorganic materials 0.000 claims description 18
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 16
- 239000003054 catalyst Substances 0.000 claims description 16
- 239000003795 chemical substances by application Substances 0.000 claims description 16
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 15
- 230000003213 activating effect Effects 0.000 claims description 13
- 238000006471 dimerization reaction Methods 0.000 claims description 8
- 150000002894 organic compounds Chemical class 0.000 claims description 7
- 239000007788 liquid Substances 0.000 claims description 6
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 claims description 6
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 claims description 6
- 150000001875 compounds Chemical class 0.000 claims description 5
- 239000003085 diluting agent Substances 0.000 claims description 5
- UHOVQNZJYSORNB-UHFFFAOYSA-N monobenzene Natural products C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 5
- 229910052751 metal Inorganic materials 0.000 claims description 4
- 239000002184 metal Substances 0.000 claims description 4
- 150000001336 alkenes Chemical class 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- -1 aluminum compound Chemical class 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- MXTZJQLUHDEYMN-UHFFFAOYSA-N tris(3-methylpentan-3-yloxy)alumane Chemical group C(C)C([O-])(C)CC.[Al+3].C(C)C([O-])(C)CC.C(C)C([O-])(C)CC MXTZJQLUHDEYMN-UHFFFAOYSA-N 0.000 claims description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims description 2
- 239000003701 inert diluent Substances 0.000 claims description 2
- 239000000463 material Substances 0.000 claims description 2
- 230000000737 periodic effect Effects 0.000 claims description 2
- 239000008096 xylene Substances 0.000 claims description 2
- SHWZFQPXYGHRKT-FDGPNNRMSA-N (z)-4-hydroxypent-3-en-2-one;nickel Chemical compound [Ni].C\C(O)=C\C(C)=O.C\C(O)=C\C(C)=O SHWZFQPXYGHRKT-FDGPNNRMSA-N 0.000 claims 1
- 150000001491 aromatic compounds Chemical class 0.000 claims 1
- 229940125898 compound 5 Drugs 0.000 claims 1
- 230000036461 convulsion Effects 0.000 claims 1
- 150000002736 metal compounds Chemical class 0.000 claims 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 claims 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 1
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 8
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 7
- 239000005977 Ethylene Substances 0.000 description 7
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 6
- 238000006116 polymerization reaction Methods 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical compound CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 description 5
- WWUVJRULCWHUSA-UHFFFAOYSA-N 2-methyl-1-pentene Chemical compound CCCC(C)=C WWUVJRULCWHUSA-UHFFFAOYSA-N 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- LIKMAJRDDDTEIG-UHFFFAOYSA-N 1-hexene Chemical compound CCCCC=C LIKMAJRDDDTEIG-UHFFFAOYSA-N 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 150000004678 hydrides Chemical class 0.000 description 4
- 229930195733 hydrocarbon Natural products 0.000 description 4
- BMGNSKKZFQMGDH-FDGPNNRMSA-L nickel(2+);(z)-4-oxopent-2-en-2-olate Chemical compound [Ni+2].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O BMGNSKKZFQMGDH-FDGPNNRMSA-L 0.000 description 4
- 229920000642 polymer Polymers 0.000 description 4
- 241001481828 Glyptocephalus cynoglossus Species 0.000 description 3
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 3
- CUJRVFIICFDLGR-UHFFFAOYSA-N acetylacetonate Chemical compound CC(=O)[CH-]C(C)=O CUJRVFIICFDLGR-UHFFFAOYSA-N 0.000 description 3
- 239000012190 activator Substances 0.000 description 3
- 239000001569 carbon dioxide Substances 0.000 description 3
- 229910002092 carbon dioxide Inorganic materials 0.000 description 3
- 230000035484 reaction time Effects 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- GYHNNYVSQQEPJS-UHFFFAOYSA-N Gallium Chemical compound [Ga] GYHNNYVSQQEPJS-UHFFFAOYSA-N 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 229910052790 beryllium Inorganic materials 0.000 description 2
- ATBAMAFKBVZNFJ-UHFFFAOYSA-N beryllium atom Chemical compound [Be] ATBAMAFKBVZNFJ-UHFFFAOYSA-N 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 229910052733 gallium Inorganic materials 0.000 description 2
- 125000004836 hexamethylene group Chemical class [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 229910052738 indium Inorganic materials 0.000 description 2
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 description 2
- 150000005673 monoalkenes Chemical class 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 229910001220 stainless steel Inorganic materials 0.000 description 2
- 239000010935 stainless steel Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- POILWHVDKZOXJZ-ARJAWSKDSA-M (z)-4-oxopent-2-en-2-olate Chemical compound C\C([O-])=C\C(C)=O POILWHVDKZOXJZ-ARJAWSKDSA-M 0.000 description 1
- OWWIWYDDISJUMY-UHFFFAOYSA-N 2,3-dimethylbut-1-ene Chemical compound CC(C)C(C)=C OWWIWYDDISJUMY-UHFFFAOYSA-N 0.000 description 1
- WGLLSSPDPJPLOR-UHFFFAOYSA-N 2,3-dimethylbut-2-ene Chemical compound CC(C)=C(C)C WGLLSSPDPJPLOR-UHFFFAOYSA-N 0.000 description 1
- JMMZCWZIJXAGKW-UHFFFAOYSA-N 2-methylpent-2-ene Chemical compound CCC=C(C)C JMMZCWZIJXAGKW-UHFFFAOYSA-N 0.000 description 1
- 102100031102 C-C motif chemokine 4 Human genes 0.000 description 1
- 101100054773 Caenorhabditis elegans act-2 gene Proteins 0.000 description 1
- WFDIJRYMOXRFFG-UHFFFAOYSA-N acetic anhydride Substances CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- TVSPOLBJUVJVCV-UHFFFAOYSA-N benzene;heptane Chemical compound C1=CC=CC=C1.CCCCCCC TVSPOLBJUVJVCV-UHFFFAOYSA-N 0.000 description 1
- IAQRGUVFOMOMEM-UHFFFAOYSA-N butene Natural products CC=CC IAQRGUVFOMOMEM-UHFFFAOYSA-N 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 239000002815 homogeneous catalyst Substances 0.000 description 1
- 239000003446 ligand Substances 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 150000002816 nickel compounds Chemical class 0.000 description 1
- 150000002902 organometallic compounds Chemical class 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 150000003003 phosphines Chemical class 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 150000003464 sulfur compounds Chemical class 0.000 description 1
- 229910052723 transition metal Inorganic materials 0.000 description 1
- 150000003624 transition metals Chemical class 0.000 description 1
- VOITXYVAKOUIBA-UHFFFAOYSA-N triethylaluminium Chemical compound CC[Al](CC)CC VOITXYVAKOUIBA-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2/00—Preparation of hydrocarbons from hydrocarbons containing a smaller number of carbon atoms
- C07C2/02—Preparation of hydrocarbons from hydrocarbons containing a smaller number of carbon atoms by addition between unsaturated hydrocarbons
- C07C2/04—Preparation of hydrocarbons from hydrocarbons containing a smaller number of carbon atoms by addition between unsaturated hydrocarbons by oligomerisation of well-defined unsaturated hydrocarbons without ring formation
- C07C2/06—Preparation of hydrocarbons from hydrocarbons containing a smaller number of carbon atoms by addition between unsaturated hydrocarbons by oligomerisation of well-defined unsaturated hydrocarbons without ring formation of alkenes, i.e. acyclic hydrocarbons having only one carbon-to-carbon double bond
- C07C2/08—Catalytic processes
- C07C2/26—Catalytic processes with hydrides or organic compounds
- C07C2/32—Catalytic processes with hydrides or organic compounds as complexes, e.g. acetyl-acetonates
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2531/00—Catalysts comprising hydrides, coordination complexes or organic compounds
- C07C2531/02—Catalysts comprising hydrides, coordination complexes or organic compounds containing organic compounds or metal hydrides
- C07C2531/12—Catalysts comprising hydrides, coordination complexes or organic compounds containing organic compounds or metal hydrides containing organo-metallic compounds or metal hydrides
- C07C2531/14—Catalysts comprising hydrides, coordination complexes or organic compounds containing organic compounds or metal hydrides containing organo-metallic compounds or metal hydrides of aluminium or boron
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2531/00—Catalysts comprising hydrides, coordination complexes or organic compounds
- C07C2531/16—Catalysts comprising hydrides, coordination complexes or organic compounds containing coordination complexes
- C07C2531/22—Organic complexes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB26100/65A GB1101498A (en) | 1965-06-21 | 1965-06-21 | Dimerisation process |
| GB1790266 | 1966-04-25 | ||
| GB1790466 | 1966-04-25 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1568129A1 true DE1568129A1 (de) | 1970-02-05 |
Family
ID=27257554
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19661568129 Pending DE1568129A1 (de) | 1965-06-21 | 1966-06-21 | Verfahren zur Herstellung von Dimeren von alpha-Olefinen,insbesondere geradkettigen Dimeren |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3483268A (OSRAM) |
| BE (1) | BE682856A (OSRAM) |
| DE (1) | DE1568129A1 (OSRAM) |
| GB (1) | GB1101498A (OSRAM) |
| NL (1) | NL148030B (OSRAM) |
| NO (1) | NO117693B (OSRAM) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3622648A (en) * | 1967-05-27 | 1971-11-23 | Basf Ag | Dimerization of olefins |
| US3542899A (en) * | 1969-08-22 | 1970-11-24 | Sun Oil Co | Process for dimerizing ethylene |
| JPS55136236A (en) * | 1979-04-11 | 1980-10-23 | Nissan Chem Ind Ltd | (co)dimerization of lower monoolefin |
| US4740652A (en) * | 1985-05-23 | 1988-04-26 | Uop Inc. | Process for the oligomerization of olefins |
| US4795851A (en) * | 1987-03-12 | 1989-01-03 | Uop Inc. | Process for the oligomerization of olefins and a catalyst thereof |
| US4795852A (en) * | 1987-03-13 | 1989-01-03 | Uop Inc. | Process for the oligomerization of olefins and a catalyst thereof |
| US4835331A (en) * | 1988-05-23 | 1989-05-30 | Uop | Process for the oligomerization of olefinic hydrocarbons |
| US5037788A (en) * | 1988-12-12 | 1991-08-06 | Uop | Process for the oligomerization of olefins and a catalyst thereof |
| US4935575A (en) * | 1988-12-12 | 1990-06-19 | Uop | Process for the oligomerization of olefins and a catalyst thereof |
| EP2446865A1 (en) | 2010-10-28 | 2012-05-02 | Louise Mohn | Thermostimulation apparatus |
| US9416071B2 (en) | 2014-05-06 | 2016-08-16 | Uop Llc | Hydrocarbon conversion processes using lactamium-based ionic liquids |
| WO2017011222A1 (en) | 2015-07-10 | 2017-01-19 | Uop Llc | Hydrocarbon conversion processes using non-cyclic amide and thioamide based ionic liquids |
| WO2017011232A1 (en) | 2015-07-10 | 2017-01-19 | Uop Llc | Synthesis of non-cyclic amide and thioamide based ionic liquids |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2781410A (en) * | 1953-04-04 | 1957-02-12 | Ziegler | Polymerization of ethylene in the presence of an aluminum trialkyl catalyst |
| DE1418672A1 (de) * | 1961-08-26 | 1969-06-19 | Basf Ag | Verfahren zur Herstellung von Oligomeren von 1,3-Dienen |
| NL286211A (OSRAM) * | 1962-11-30 | 1900-01-01 | ||
| US3364278A (en) * | 1964-12-17 | 1968-01-16 | Phillips Petroleum Co | Conversion of ethylene to butenes |
-
1965
- 1965-06-21 GB GB26100/65A patent/GB1101498A/en not_active Expired
-
1966
- 1966-06-15 NO NO163463A patent/NO117693B/no unknown
- 1966-06-20 US US558588A patent/US3483268A/en not_active Expired - Lifetime
- 1966-06-21 DE DE19661568129 patent/DE1568129A1/de active Pending
- 1966-06-21 NL NL666608574A patent/NL148030B/xx unknown
- 1966-06-21 BE BE682856D patent/BE682856A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NL148030B (nl) | 1975-12-15 |
| NL6608574A (OSRAM) | 1966-12-22 |
| NO117693B (OSRAM) | 1969-09-15 |
| BE682856A (OSRAM) | 1966-12-21 |
| GB1101498A (en) | 1968-01-31 |
| US3483268A (en) | 1969-12-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69212761T2 (de) | Ethylen Oligomerisierung | |
| DE69107197T2 (de) | Verfahren zum umsatz von ethylen in leichte alpha-olefine. | |
| DE69803333T2 (de) | Katalytische Zusammensetzung und Ethylenoligomerisierung, insbesondere in 1-buten und/oder 1-hexen | |
| DE1793487C3 (de) | Verfahren zum Oligomerisieren von Olefinen und Katalysator zur Durchführung dieses Verfahrens | |
| DE2930108C2 (de) | Verfahren zur Herstellung von weitgehend amorphen Buten-1 Propen-Ethen-Terpolymeren mit hohem Erweichungspunkt | |
| DE1568129A1 (de) | Verfahren zur Herstellung von Dimeren von alpha-Olefinen,insbesondere geradkettigen Dimeren | |
| DE69002468T2 (de) | Von Nickel katalysierte Verdrängungsreaktion. | |
| CH638770A5 (de) | Verfahren zum dimerisieren von niederen alpha-olefinen. | |
| DE1618135A1 (de) | Verfahren zur Herstellung von Dimeren von alpha-Olefinen | |
| DE1808833A1 (de) | Verfahren zur Herstellung von Additionsprodukten aus Olefinen | |
| DE69425496T2 (de) | Verfahren zur herstellung von 1,4-dienen | |
| DE1642947A1 (de) | Verfahren zur Herstellung von Dimeren von alpha-Olefinen,insbesondere von linearen Dimeren | |
| US3829520A (en) | Inhibition of olefin isomerization and reverse displacement in catalytic displacement reactions | |
| DE1643932A1 (de) | Verfahren zur Herstellung von Dimethylbutenen | |
| DE1520792A1 (de) | Verfahren zur Polymerisation von Olefinen | |
| DE2835365A1 (de) | Verfahren zum isomerisieren von alpha -olefindimerisaten | |
| DE1157225B (de) | Verfahren zur Herstellung von Aluminiumtrialkylen | |
| DE2021523C3 (de) | Verfahren zur Oligomerisierung oder Cooligomerisierung von Olefinen | |
| DE1568129C (de) | Verfahren zur Dimerisation eines alpha Olefins zur Herstellung eines aus vornehmlich geradkettigen Dimeren mit innerer Doppelbindung bestehenden Pro dukts | |
| DE1568130C (de) | Verfahren zur Dimerisation eines alpha-Olefins zur Herstellung eines vornehmlich aus verzweigtkettigen Dinieren mit innerer ungesättigter Gruppe und geradkettigen Dimeren bestehenden Produktes | |
| DE1568135A1 (de) | Verfahren zur Herstellung von Dimeren von alpha-Olefinen | |
| AT266061B (de) | Verfahren zur Dimerisierung von α-Olefinen | |
| DE1568135C (de) | Verfahren zur Herstellung von Dimeren von alpha-Olefinen | |
| DE964642C (de) | Verfahren zur katalytischen Polymerisation von AEthylen zu Buten, Hexen und bzw. oder hoeheren fluessigen oder festen paraffinaehnlichen Polymeren | |
| DE10238027A1 (de) | Kombiniertes Verfahren zur selektiven Herstellung von alpha-Olefinen |