DE1543399C - - Google Patents
Info
- Publication number
- DE1543399C DE1543399C DE1543399C DE 1543399 C DE1543399 C DE 1543399C DE 1543399 C DE1543399 C DE 1543399C
- Authority
- DE
- Germany
- Prior art keywords
- weight
- group
- parts
- diethylstilbestrol
- general formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- MBMQEIFVQACCCH-UHFFFAOYSA-N trans-Zearalenon Natural products O=C1OC(C)CCCC(=O)CCCC=CC2=CC(O)=CC(O)=C21 MBMQEIFVQACCCH-UHFFFAOYSA-N 0.000 claims description 5
- MBMQEIFVQACCCH-QBODLPLBSA-N zearalenone Chemical compound O=C1O[C@@H](C)CCCC(=O)CCC\C=C\C2=CC(O)=CC(O)=C21 MBMQEIFVQACCCH-QBODLPLBSA-N 0.000 claims description 5
- 238000000034 method Methods 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 10
- 241001465754 Metazoa Species 0.000 description 8
- RGLYKWWBQGJZGM-ISLYRVAYSA-N diethylstilbestrol Chemical compound C=1C=C(O)C=CC=1C(/CC)=C(\CC)C1=CC=C(O)C=C1 RGLYKWWBQGJZGM-ISLYRVAYSA-N 0.000 description 7
- 229960000452 diethylstilbestrol Drugs 0.000 description 7
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- 229910021529 ammonia Inorganic materials 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 235000013372 meat Nutrition 0.000 description 5
- 230000001076 estrogenic effect Effects 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 241000283903 Ovis aries Species 0.000 description 3
- 239000007868 Raney catalyst Substances 0.000 description 3
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 3
- 229910000564 Raney nickel Inorganic materials 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- 230000004584 weight gain Effects 0.000 description 3
- 235000019786 weight gain Nutrition 0.000 description 3
- 240000008042 Zea mays Species 0.000 description 2
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 2
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 235000005822 corn Nutrition 0.000 description 2
- 125000004185 ester group Chemical group 0.000 description 2
- 229940011871 estrogen Drugs 0.000 description 2
- 239000000262 estrogen Substances 0.000 description 2
- 235000013312 flour Nutrition 0.000 description 2
- 230000003054 hormonal effect Effects 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 235000019739 Dicalciumphosphate Nutrition 0.000 description 1
- 241000223195 Fusarium graminearum Species 0.000 description 1
- 244000068988 Glycine max Species 0.000 description 1
- 235000010469 Glycine max Nutrition 0.000 description 1
- 240000004658 Medicago sativa Species 0.000 description 1
- 235000017587 Medicago sativa ssp. sativa Nutrition 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 1
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 description 1
- 229940038472 dicalcium phosphate Drugs 0.000 description 1
- 229910000390 dicalcium phosphate Inorganic materials 0.000 description 1
- -1 dimethyl compound Chemical class 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 150000002596 lactones Chemical class 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 235000013379 molasses Nutrition 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 230000000384 rearing effect Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 235000013619 trace mineral Nutrition 0.000 description 1
- 239000011573 trace mineral Substances 0.000 description 1
- 210000004291 uterus Anatomy 0.000 description 1
- 235000013343 vitamin Nutrition 0.000 description 1
- 239000011782 vitamin Substances 0.000 description 1
- 229940088594 vitamin Drugs 0.000 description 1
- 229930003231 vitamin Natural products 0.000 description 1
- 150000003722 vitamin derivatives Chemical class 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1543395B1 (de) | Zearalanole und Verfahren zu deren Herstellung | |
| DE1543398B1 (de) | Zearalane und Verfahren zu deren Herstellung | |
| DE2238540C3 (de) | N-(D-6-Methyl-8-isoergoün-I-yl)-N', N'-diäthylharnstoff, dessen Salze, deren Herstellung sowie Arzneimittel | |
| DE1543399B1 (de) | Verfahren zur Herstellung von basisch substituierten Zearalanen | |
| DE1543399C (cg-RX-API-DMAC7.html) | ||
| DE1543396B1 (de) | Zearalanone und Verfahren zu deren Herstellung | |
| DE2035334C3 (de) | Cholagoges Mittel | |
| DE2164169A1 (de) | Verfahren zur Herstellung von Bis(aminomethyl)-cyclohexan | |
| DE1543474B1 (de) | Zearalenol und Verfahren zu dessen Herstellung | |
| DE1543476C (de) | Verfahren zur Herstellung von Lactonen | |
| DE1272922B (de) | Verfahren zur Herstellung von 2-Alkylcyclopentan-1, 3-dionen | |
| DE1543398C (de) | Zearalane und Verfahren zu deren Herstellung | |
| DE3020470A1 (de) | Allyl- und propylderivate von recorcinylsaeurelakton-verbindungen und verfahren zu ihrer herstellung | |
| DE1543473C (de) | Zearalanonhydroxylamin und Verfahren zu dessen Herstellung | |
| DE716668C (de) | Verfahren zur Herstellung von Derivaten substituierter Aminobenzoesaeuren | |
| DE1543478C (de) | Diacetylzearalenon und Verfahren zu dessen Herstellung | |
| DE1543396C (de) | Zearalenone und Verfahren zu deren Herstellung | |
| DE1543395C (de) | Zearalanole und Verfahren zu deren Herstellung | |
| DE1543475C (de) | Verfahren zur Herstellung von cyclischen Zearalenon oder Zearalanonacetalen | |
| CH659244A5 (de) | Carbazinsaeurederivate, verfahren zur herstellung derselben und diese verbindungen enthaltende beifuttermittel. | |
| DE1543477C (de) | Zearalenonderivate und Verfahren zu deren Herstellung | |
| DE1543476B1 (de) | Verfahren zur Herstellung von Lactonen | |
| DE2052096A1 (de) | Lactone, Verfahren zu deren Her stellung und deren Verwendung | |
| DE1543400C (de) | Zearalenon 2,4 dinitrophenylhydrazon und Verfahren zu dessen Herstellung | |
| DE1543474C (de) | Zearalenol und Verfahren zu dessen Herstellung |