DE1517474A1 - Verfahren zum Koagulieren von Trueben - Google Patents
Verfahren zum Koagulieren von TruebenInfo
- Publication number
- DE1517474A1 DE1517474A1 DE19651517474 DE1517474A DE1517474A1 DE 1517474 A1 DE1517474 A1 DE 1517474A1 DE 19651517474 DE19651517474 DE 19651517474 DE 1517474 A DE1517474 A DE 1517474A DE 1517474 A1 DE1517474 A1 DE 1517474A1
- Authority
- DE
- Germany
- Prior art keywords
- additive
- molecular weight
- cationic
- anionic
- copolymer
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 50
- 230000008569 process Effects 0.000 title claims description 22
- 230000001112 coagulating effect Effects 0.000 title claims description 6
- 239000000243 solution Substances 0.000 claims description 38
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 36
- 125000002091 cationic group Chemical group 0.000 claims description 31
- 229920001577 copolymer Polymers 0.000 claims description 31
- 229920000642 polymer Polymers 0.000 claims description 29
- 239000000126 substance Substances 0.000 claims description 28
- 239000000654 additive Substances 0.000 claims description 27
- 230000000996 additive effect Effects 0.000 claims description 23
- 125000000129 anionic group Chemical group 0.000 claims description 23
- 238000005345 coagulation Methods 0.000 claims description 21
- 230000015271 coagulation Effects 0.000 claims description 21
- 239000007787 solid Substances 0.000 claims description 21
- 229920000768 polyamine Polymers 0.000 claims description 16
- 238000009833 condensation Methods 0.000 claims description 10
- 230000005494 condensation Effects 0.000 claims description 10
- 239000007864 aqueous solution Substances 0.000 claims description 9
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 8
- 239000002351 wastewater Substances 0.000 claims description 7
- 229920001495 poly(sodium acrylate) polymer Polymers 0.000 claims description 6
- 229920002401 polyacrylamide Polymers 0.000 claims description 6
- NNMHYFLPFNGQFZ-UHFFFAOYSA-M sodium polyacrylate Chemical compound [Na+].[O-]C(=O)C=C NNMHYFLPFNGQFZ-UHFFFAOYSA-M 0.000 claims description 5
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 claims description 4
- 229910021529 ammonia Inorganic materials 0.000 claims description 4
- 239000004927 clay Substances 0.000 claims description 3
- 229910021578 Iron(III) chloride Inorganic materials 0.000 claims description 2
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 claims description 2
- 239000004793 Polystyrene Substances 0.000 claims 3
- 229920002223 polystyrene Polymers 0.000 claims 3
- LTNZEXKYNRNOGT-UHFFFAOYSA-N dequalinium chloride Chemical compound [Cl-].[Cl-].C1=CC=C2[N+](CCCCCCCCCC[N+]3=C4C=CC=CC4=C(N)C=C3C)=C(C)C=C(N)C2=C1 LTNZEXKYNRNOGT-UHFFFAOYSA-N 0.000 claims 2
- 210000000988 bone and bone Anatomy 0.000 claims 1
- 230000001256 tonic effect Effects 0.000 claims 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 27
- 238000006243 chemical reaction Methods 0.000 description 24
- 239000007788 liquid Substances 0.000 description 24
- 239000000178 monomer Substances 0.000 description 23
- 238000011282 treatment Methods 0.000 description 23
- 150000001875 compounds Chemical class 0.000 description 20
- 239000000701 coagulant Substances 0.000 description 18
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- 239000011734 sodium Substances 0.000 description 14
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 13
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 12
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 11
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 9
- -1 Polybutylene Polymers 0.000 description 8
- 239000002253 acid Substances 0.000 description 8
- 239000003795 chemical substances by application Substances 0.000 description 8
- 238000002474 experimental method Methods 0.000 description 7
- 239000000203 mixture Substances 0.000 description 7
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- 125000002947 alkylene group Chemical group 0.000 description 6
- 229910052757 nitrogen Inorganic materials 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 5
- 239000004202 carbamide Substances 0.000 description 5
- 229920006317 cationic polymer Polymers 0.000 description 5
- 238000000926 separation method Methods 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- 230000007704 transition Effects 0.000 description 5
- 125000000217 alkyl group Chemical group 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- 239000011790 ferrous sulphate Substances 0.000 description 4
- 235000003891 ferrous sulphate Nutrition 0.000 description 4
- 238000005189 flocculation Methods 0.000 description 4
- 230000016615 flocculation Effects 0.000 description 4
- 150000003944 halohydrins Chemical class 0.000 description 4
- BAUYGSIQEAFULO-UHFFFAOYSA-L iron(2+) sulfate (anhydrous) Chemical compound [Fe+2].[O-]S([O-])(=O)=O BAUYGSIQEAFULO-UHFFFAOYSA-L 0.000 description 4
- 229910000359 iron(II) sulfate Inorganic materials 0.000 description 4
- 238000006116 polymerization reaction Methods 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 239000010865 sewage Substances 0.000 description 4
- 159000000000 sodium salts Chemical class 0.000 description 4
- 239000002699 waste material Substances 0.000 description 4
- ZORQXIQZAOLNGE-UHFFFAOYSA-N 1,1-difluorocyclohexane Chemical compound FC1(F)CCCCC1 ZORQXIQZAOLNGE-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- 241000283986 Lepus Species 0.000 description 3
- 229910004298 SiO 2 Inorganic materials 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 239000012736 aqueous medium Substances 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 230000003197 catalytic effect Effects 0.000 description 3
- 150000001767 cationic compounds Chemical class 0.000 description 3
- 150000001768 cations Chemical class 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 239000012530 fluid Substances 0.000 description 3
- 230000005484 gravity Effects 0.000 description 3
- 230000004807 localization Effects 0.000 description 3
- 239000002609 medium Substances 0.000 description 3
- FQPSGWSUVKBHSU-UHFFFAOYSA-N methacrylamide Chemical compound CC(=C)C(N)=O FQPSGWSUVKBHSU-UHFFFAOYSA-N 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 238000006386 neutralization reaction Methods 0.000 description 3
- 239000012875 nonionic emulsifier Substances 0.000 description 3
- USHAGKDGDHPEEY-UHFFFAOYSA-L potassium persulfate Chemical compound [K+].[K+].[O-]S(=O)(=O)OOS([O-])(=O)=O USHAGKDGDHPEEY-UHFFFAOYSA-L 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 239000000523 sample Substances 0.000 description 3
- 229910001388 sodium aluminate Inorganic materials 0.000 description 3
- 239000001593 sorbitan monooleate Substances 0.000 description 3
- 235000011069 sorbitan monooleate Nutrition 0.000 description 3
- 229940035049 sorbitan monooleate Drugs 0.000 description 3
- 241000894007 species Species 0.000 description 3
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 3
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 2
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- 230000001133 acceleration Effects 0.000 description 2
- 238000013019 agitation Methods 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 125000005907 alkyl ester group Chemical group 0.000 description 2
- XYLMUPLGERFSHI-UHFFFAOYSA-N alpha-Methylstyrene Chemical compound CC(=C)C1=CC=CC=C1 XYLMUPLGERFSHI-UHFFFAOYSA-N 0.000 description 2
- 229940037003 alum Drugs 0.000 description 2
- DIZPMCHEQGEION-UHFFFAOYSA-H aluminium sulfate (anhydrous) Chemical compound [Al+3].[Al+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O DIZPMCHEQGEION-UHFFFAOYSA-H 0.000 description 2
- ANBBXQWFNXMHLD-UHFFFAOYSA-N aluminum;sodium;oxygen(2-) Chemical compound [O-2].[O-2].[Na+].[Al+3] ANBBXQWFNXMHLD-UHFFFAOYSA-N 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- 238000010533 azeotropic distillation Methods 0.000 description 2
- 230000001588 bifunctional effect Effects 0.000 description 2
- 239000012496 blank sample Substances 0.000 description 2
- 150000001721 carbon Chemical group 0.000 description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 238000004140 cleaning Methods 0.000 description 2
- 238000006482 condensation reaction Methods 0.000 description 2
- 238000004132 cross linking Methods 0.000 description 2
- ZINJLDJMHCUBIP-UHFFFAOYSA-N ethametsulfuron-methyl Chemical compound CCOC1=NC(NC)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CC=2)C(=O)OC)=N1 ZINJLDJMHCUBIP-UHFFFAOYSA-N 0.000 description 2
- 125000005670 ethenylalkyl group Chemical group 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000013505 freshwater Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 229920001519 homopolymer Polymers 0.000 description 2
- 150000002430 hydrocarbons Chemical group 0.000 description 2
- 230000002209 hydrophobic effect Effects 0.000 description 2
- GKQPCPXONLDCMU-CCEZHUSRSA-N lacidipine Chemical compound CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC)C1C1=CC=CC=C1\C=C\C(=O)OC(C)(C)C GKQPCPXONLDCMU-CCEZHUSRSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 2
- 239000011976 maleic acid Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 150000002734 metacrylic acid derivatives Chemical class 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 230000036961 partial effect Effects 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- HJWLCRVIBGQPNF-UHFFFAOYSA-N prop-2-enylbenzene Chemical compound C=CCC1=CC=CC=C1 HJWLCRVIBGQPNF-UHFFFAOYSA-N 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 239000010802 sludge Substances 0.000 description 2
- HRZFUMHJMZEROT-UHFFFAOYSA-L sodium disulfite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])(=O)=O HRZFUMHJMZEROT-UHFFFAOYSA-L 0.000 description 2
- 229940001584 sodium metabisulfite Drugs 0.000 description 2
- 235000010262 sodium metabisulphite Nutrition 0.000 description 2
- 239000012265 solid product Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000003643 water by type Substances 0.000 description 2
- PAAZPARNPHGIKF-UHFFFAOYSA-N 1,2-dibromoethane Chemical compound BrCCBr PAAZPARNPHGIKF-UHFFFAOYSA-N 0.000 description 1
- PQUXFUBNSYCQAL-UHFFFAOYSA-N 1-(2,3-difluorophenyl)ethanone Chemical compound CC(=O)C1=CC=CC(F)=C1F PQUXFUBNSYCQAL-UHFFFAOYSA-N 0.000 description 1
- SBYMUDUGTIKLCR-UHFFFAOYSA-N 2-chloroethenylbenzene Chemical compound ClC=CC1=CC=CC=C1 SBYMUDUGTIKLCR-UHFFFAOYSA-N 0.000 description 1
- YPEMKASELPCGPB-UHFFFAOYSA-N 2-methylprop-2-enoic acid;prop-2-enamide Chemical compound NC(=O)C=C.CC(=C)C(O)=O YPEMKASELPCGPB-UHFFFAOYSA-N 0.000 description 1
- GQTFHSAAODFMHB-UHFFFAOYSA-N 2-prop-2-enoyloxyethanesulfonic acid Chemical compound OS(=O)(=O)CCOC(=O)C=C GQTFHSAAODFMHB-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- CYUZOYPRAQASLN-UHFFFAOYSA-N 3-prop-2-enoyloxypropanoic acid Chemical compound OC(=O)CCOC(=O)C=C CYUZOYPRAQASLN-UHFFFAOYSA-N 0.000 description 1
- 241000252073 Anguilliformes Species 0.000 description 1
- 241000132028 Bellis Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- RPNUMPOLZDHAAY-UHFFFAOYSA-N Diethylenetriamine Chemical compound NCCNCCN RPNUMPOLZDHAAY-UHFFFAOYSA-N 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 229920000877 Melamine resin Polymers 0.000 description 1
- GYCMBHHDWRMZGG-UHFFFAOYSA-N Methylacrylonitrile Chemical compound CC(=C)C#N GYCMBHHDWRMZGG-UHFFFAOYSA-N 0.000 description 1
- 229920002873 Polyethylenimine Polymers 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- 206010065954 Stubbornness Diseases 0.000 description 1
- 235000011941 Tilia x europaea Nutrition 0.000 description 1
- 229910052770 Uranium Inorganic materials 0.000 description 1
- 241000219873 Vicia Species 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- VJMAITQRABEEKP-UHFFFAOYSA-N [6-(phenylmethoxymethyl)-1,4-dioxan-2-yl]methyl acetate Chemical compound O1C(COC(=O)C)COCC1COCC1=CC=CC=C1 VJMAITQRABEEKP-UHFFFAOYSA-N 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 125000002015 acyclic group Chemical group 0.000 description 1
- 238000005273 aeration Methods 0.000 description 1
- 230000004520 agglutination Effects 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000005250 alkyl acrylate group Chemical group 0.000 description 1
- 150000005215 alkyl ethers Chemical class 0.000 description 1
- 125000005263 alkylenediamine group Chemical group 0.000 description 1
- 150000004645 aluminates Chemical class 0.000 description 1
- ZEMWIYASLJTEHQ-UHFFFAOYSA-J aluminum;sodium;disulfate;dodecahydrate Chemical compound O.O.O.O.O.O.O.O.O.O.O.O.[Na+].[Al+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O ZEMWIYASLJTEHQ-UHFFFAOYSA-J 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000002431 aminoalkoxy group Chemical group 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 150000001449 anionic compounds Chemical class 0.000 description 1
- 229920006318 anionic polymer Polymers 0.000 description 1
- 150000004836 anionic polysaccharides Chemical class 0.000 description 1
- 230000003466 anti-cipated effect Effects 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- YIRLUIDCBMHRSU-UHFFFAOYSA-N azane;1,2-dichloroethane Chemical compound N.ClCCCl YIRLUIDCBMHRSU-UHFFFAOYSA-N 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- ULEAQRIQMIQDPJ-UHFFFAOYSA-N butane-1,2-diamine Chemical compound CCC(N)CN ULEAQRIQMIQDPJ-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 1
- 125000000271 carboxylic acid salt group Chemical group 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- HNEGQIOMVPPMNR-IHWYPQMZSA-N citraconic acid Chemical compound OC(=O)C(/C)=C\C(O)=O HNEGQIOMVPPMNR-IHWYPQMZSA-N 0.000 description 1
- 229940018557 citraconic acid Drugs 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 235000009508 confectionery Nutrition 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000007334 copolymerization reaction Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 230000007547 defect Effects 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 239000003651 drinking water Substances 0.000 description 1
- 235000020188 drinking water Nutrition 0.000 description 1
- 230000009977 dual effect Effects 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 238000005265 energy consumption Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- GFJVXXWOPWLRNU-UHFFFAOYSA-N ethenyl formate Chemical compound C=COC=O GFJVXXWOPWLRNU-UHFFFAOYSA-N 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- 230000029142 excretion Effects 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 210000003608 fece Anatomy 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 239000008233 hard water Substances 0.000 description 1
- KWLMIXQRALPRBC-UHFFFAOYSA-L hectorite Chemical compound [Li+].[OH-].[OH-].[Na+].[Mg+2].O1[Si]2([O-])O[Si]1([O-])O[Si]([O-])(O1)O[Si]1([O-])O2 KWLMIXQRALPRBC-UHFFFAOYSA-L 0.000 description 1
- 229910000271 hectorite Inorganic materials 0.000 description 1
- 229920006158 high molecular weight polymer Polymers 0.000 description 1
- BHEPBYXIRTUNPN-UHFFFAOYSA-N hydridophosphorus(.) (triplet) Chemical compound [PH] BHEPBYXIRTUNPN-UHFFFAOYSA-N 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 125000001841 imino group Chemical group [H]N=* 0.000 description 1
- 239000002440 industrial waste Substances 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000004571 lime Substances 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 1
- JDSHMPZPIAZGSV-UHFFFAOYSA-N melamine Chemical compound NC1=NC(N)=NC(N)=N1 JDSHMPZPIAZGSV-UHFFFAOYSA-N 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- 239000008239 natural water Substances 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 150000004010 onium ions Chemical group 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 239000003415 peat Substances 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 229920000333 poly(propyleneimine) Polymers 0.000 description 1
- 229920001467 poly(styrenesulfonates) Polymers 0.000 description 1
- 229920002432 poly(vinyl methyl ether) polymer Polymers 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 229920002239 polyacrylonitrile Polymers 0.000 description 1
- 229920001281 polyalkylene Polymers 0.000 description 1
- 229920001748 polybutylene Polymers 0.000 description 1
- 238000012643 polycondensation polymerization Methods 0.000 description 1
- 229920002717 polyvinylpyridine Polymers 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 230000002028 premature Effects 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 230000003449 preventive effect Effects 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- AOHJOMMDDJHIJH-UHFFFAOYSA-N propylenediamine Chemical compound CC(N)CN AOHJOMMDDJHIJH-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 238000004062 sedimentation Methods 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 229940047670 sodium acrylate Drugs 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 239000008234 soft water Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 230000003068 static effect Effects 0.000 description 1
- 229910052712 strontium Inorganic materials 0.000 description 1
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 229920005613 synthetic organic polymer Polymers 0.000 description 1
- 229920001059 synthetic polymer Polymers 0.000 description 1
- FAGUFWYHJQFNRV-UHFFFAOYSA-N tetraethylenepentamine Chemical compound NCCNCCNCCNCCN FAGUFWYHJQFNRV-UHFFFAOYSA-N 0.000 description 1
- JFALSRSLKYAFGM-UHFFFAOYSA-N uranium(0) Chemical compound [U] JFALSRSLKYAFGM-UHFFFAOYSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 235000015041 whisky Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C02—TREATMENT OF WATER, WASTE WATER, SEWAGE, OR SLUDGE
- C02F—TREATMENT OF WATER, WASTE WATER, SEWAGE, OR SLUDGE
- C02F1/00—Treatment of water, waste water, or sewage
- C02F1/52—Treatment of water, waste water, or sewage by flocculation or precipitation of suspended impurities
- C02F1/54—Treatment of water, waste water, or sewage by flocculation or precipitation of suspended impurities using organic material
-
- C—CHEMISTRY; METALLURGY
- C02—TREATMENT OF WATER, WASTE WATER, SEWAGE, OR SLUDGE
- C02F—TREATMENT OF WATER, WASTE WATER, SEWAGE, OR SLUDGE
- C02F11/00—Treatment of sludge; Devices therefor
- C02F11/12—Treatment of sludge; Devices therefor by de-watering, drying or thickening
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Hydrology & Water Resources (AREA)
- Engineering & Computer Science (AREA)
- Environmental & Geological Engineering (AREA)
- Water Supply & Treatment (AREA)
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Separation Of Suspended Particles By Flocculating Agents (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US423540A US3377274A (en) | 1965-01-05 | 1965-01-05 | Method of coagulation of low turbidity water |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1517474A1 true DE1517474A1 (de) | 1969-12-18 |
Family
ID=23679255
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19651517474 Pending DE1517474A1 (de) | 1965-01-05 | 1965-12-10 | Verfahren zum Koagulieren von Trueben |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3377274A (enExample) |
| DE (1) | DE1517474A1 (enExample) |
| ES (1) | ES317494A1 (enExample) |
| FR (1) | FR1574656A (enExample) |
| GB (1) | GB1108493A (enExample) |
Families Citing this family (76)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3479283A (en) * | 1966-11-15 | 1969-11-18 | Hercules Inc | Sewage treatment |
| US3479284A (en) * | 1967-03-30 | 1969-11-18 | Hercules Inc | Separation of finely divided solids from liquid suspensions thereof |
| US3506570A (en) * | 1968-05-08 | 1970-04-14 | Dow Chemical Co | Clarification of and phosphate removal from sewage |
| US3493499A (en) * | 1968-05-16 | 1970-02-03 | Dow Chemical Co | Flocculation of saline solid suspensions |
| US3617568A (en) * | 1970-01-02 | 1971-11-02 | Standard Oil Co | Process for flocculating colloidal particles by the sequential addition of polymers |
| US4025429A (en) * | 1972-06-23 | 1977-05-24 | Ciba-Geigy Corporation | Process for the purification of industrial effluent |
| US3915904A (en) * | 1972-08-25 | 1975-10-28 | Betz Laboratories | Water-soluble cationic polymeric materials and their use |
| JPS5543370B2 (enExample) * | 1973-07-23 | 1980-11-06 | ||
| NL178962C (nl) * | 1973-08-09 | 1986-06-16 | Montedison Spa | Werkwijze voor de verwijdering van kwik en kwikzouten uit een vloeibare afvalstroom. |
| US4173532A (en) * | 1974-03-07 | 1979-11-06 | Entenmann's, Inc. | Method for treating plant effluent |
| GB1478345A (en) * | 1974-04-10 | 1977-06-29 | Ebara Infilco | Process for purifying water containing suspended matter |
| US4046684A (en) * | 1974-06-21 | 1977-09-06 | Ebara Infilco Kabushiki Kaisha | Process for the treatment of a colloidal suspension |
| US4176058A (en) * | 1974-10-24 | 1979-11-27 | Grobler Jacobus J | Method means for de-silting water |
| US3977971A (en) * | 1974-12-03 | 1976-08-31 | Betz Laboratories, Inc. | Method of feeding polymers |
| DE2524172A1 (de) * | 1975-05-31 | 1976-12-16 | Giulini Gmbh Geb | Verbessertes verfahren zur wasser-, abwasser- und schlammbehandlung mit flockungsmitteln |
| US4217209A (en) * | 1975-08-20 | 1980-08-12 | Bayer Aktiengesellschaft | Process for removing heavy metal sulphides from aqueous systems |
| US4089780A (en) * | 1975-10-21 | 1978-05-16 | Nalco Chemical Company | Color removal process |
| US4374739A (en) * | 1976-08-13 | 1983-02-22 | Halliburton Company | Oil well treating method and composition |
| CA1103008A (en) * | 1976-08-13 | 1981-06-16 | Homer C. Mclaughlin | Treatment of clay formations with organic polycationic polymers |
| US4366074A (en) * | 1976-08-13 | 1982-12-28 | Halliburton Company | Oil well treating method and composition |
| GB1590345A (en) * | 1976-08-13 | 1981-06-03 | Halliburton Co | Stabilization of earth formations |
| US4366071A (en) * | 1976-08-13 | 1982-12-28 | Halliburton Company | Oil well treating method and composition |
| US4071450A (en) * | 1976-12-13 | 1978-01-31 | Chemed Corporation | Precipitation of iron related color bodies |
| US4147627A (en) * | 1977-02-07 | 1979-04-03 | American Cyanamid Company | Process for scale control using mixtures of polycationic and polyanionic polymers |
| US4354943A (en) * | 1977-03-28 | 1982-10-19 | Standard Oil Company (Indiana) | Clarification of ammonium polyphosphate solutions |
| US4437997A (en) | 1977-03-28 | 1984-03-20 | Standard Oil Company (Indiana) | Clarification of ammonium polyphosphate solutions |
| US4472284A (en) * | 1977-11-23 | 1984-09-18 | Drew Chemical | Treatment of water containing fats, oils and greases |
| US4354944A (en) * | 1978-10-13 | 1982-10-19 | Standard Oil Company (Indiana) | Clarification of ammonium polyphosphate solutions |
| CA1116324A (en) * | 1978-10-23 | 1982-01-12 | Grace Dearborn Inc. | Detoxification of cationic flocculants |
| US4201867A (en) * | 1978-11-16 | 1980-05-06 | Olin Corporation | Liquid polymer hydration |
| US4358382A (en) * | 1979-04-23 | 1982-11-09 | Petrolite Corporation | Use of quaternized derivatives of polymerized pyridines and quinolines as water clarifiers |
| US4308149A (en) * | 1980-07-14 | 1981-12-29 | Nalco Chemical Company | Branched/cross-linked cationic phenol-formaldehyde polymers useful in wastewater treatment |
| US4382864A (en) * | 1980-08-08 | 1983-05-10 | Kurita Water Industries Ltd. | Process for dewatering sludges |
| JPS6038200B2 (ja) * | 1982-04-22 | 1985-08-30 | 栗田工業株式会社 | 汚泥脱水法 |
| US4502959A (en) * | 1983-07-05 | 1985-03-05 | Atlantic Richfield Company | Purification of secondary recovery waterflood liquids |
| US4882069A (en) * | 1984-02-03 | 1989-11-21 | Continental Manufacturing & Sales Inc. | Method for the treatment of sewage and other impure water |
| US4784776A (en) * | 1984-05-14 | 1988-11-15 | Pony Industries, Inc. | Process for treating aqueous suspension |
| US4588508A (en) * | 1984-11-13 | 1986-05-13 | Nalco Cehmical Company | Bimodal cationics for water clarification |
| US4631132A (en) * | 1985-07-19 | 1986-12-23 | National Starch And Chemical Corporation | Wastewater flocculating agent |
| US4999115A (en) * | 1985-08-19 | 1991-03-12 | Peterson Filters Corporation | Method and apparatus for use in separating solids from liquids |
| US4775468A (en) * | 1985-08-19 | 1988-10-04 | Peterson Filters Corporation | System for mineral slurry flocculation and vacuum filtration |
| US4761239A (en) * | 1986-04-10 | 1988-08-02 | Wardell Harry H | Waste water clarification |
| US4882070A (en) * | 1986-04-10 | 1989-11-21 | Dellchem, Inc. | Waste water clarification |
| US4842073A (en) * | 1988-03-14 | 1989-06-27 | Halliburton Services | Fluid additive and method for treatment of subterranean formations |
| US4906386A (en) * | 1988-11-03 | 1990-03-06 | Betz Laboraties, Inc. | Flocculation of coal fines with polyelectrolytes and electrolyte |
| JP2845495B2 (ja) * | 1989-07-03 | 1999-01-13 | 株式会社青木建設 | 低濃度濁水の処理工法 |
| US5089151A (en) * | 1990-10-29 | 1992-02-18 | The Western Company Of North America | Fluid additive and method for treatment of subterranean formations |
| IT1247453B (it) * | 1991-03-14 | 1994-12-17 | Leandro Taboga | Metodo per il trattamento dei liquami e rispettivo impianto |
| WO1992020627A1 (en) * | 1991-05-17 | 1992-11-26 | Hydro International Limited | Liquid treatment |
| AU617290B3 (en) * | 1991-05-27 | 1991-10-04 | Hoefer, Dawn Annette | Process for removing silica from aqueous liquors |
| US5330657A (en) * | 1992-04-27 | 1994-07-19 | Gas Research Institute | System and method for removing asbestos particles from a slurry |
| FR2693121B1 (fr) * | 1992-07-02 | 1994-09-09 | Atochem Elf Sa | Nouveau procédé de coagulation-floculation. |
| US5344572A (en) * | 1992-07-10 | 1994-09-06 | Wadhawan Satish C | Method for treating waste pickle liquor |
| US5286390A (en) * | 1992-09-30 | 1994-02-15 | Calgon Corporation | Method for treating deink wastes using melamine aldehyde-type polymers |
| US5374357A (en) * | 1993-03-19 | 1994-12-20 | D. W. Walker & Associates | Filter media treatment of a fluid flow to remove colloidal matter |
| US5368742A (en) * | 1993-06-01 | 1994-11-29 | B. G. Roberts Chemicals Inc. | Method of removing toxic resin acids and fatty acids from pulp and paper effluent and other streams |
| US5433865A (en) * | 1994-03-31 | 1995-07-18 | Laurent; Edward L. | Method for treating process waste streams by use of natural flocculants |
| US5779910A (en) * | 1996-04-08 | 1998-07-14 | Cytec Technology Corp. | Enhanced flocculation of mineral slurry with polymer blends |
| DE69725895D1 (de) * | 1996-07-08 | 2003-12-04 | Sony Corp | Verfahren zur Reinigung von Abwässern |
| DE69802781T2 (de) * | 1997-01-27 | 2002-05-23 | Degremont, Rueil-Malmaison | Verfahren zur physikalish-chemischen behandlung von wasser, insbesondere von für den verbrauch bestimmtem oberflächenwasser |
| JP2000084567A (ja) * | 1998-09-11 | 2000-03-28 | Fuji Heavy Ind Ltd | 切削油含有廃水の処理方法 |
| JP3691768B2 (ja) * | 2001-02-08 | 2005-09-07 | 株式会社埼玉種畜牧場 | 汚泥処理方法 |
| GB0405504D0 (en) * | 2004-03-12 | 2004-04-21 | Ciba Spec Chem Water Treat Ltd | Dewatering process |
| US7790042B2 (en) * | 2005-02-15 | 2010-09-07 | Halosource, Inc. | Method for the removal of submicron particulates from chlorinated water by sequentially adding a cationic polymer followed by adding an anionic polymer |
| US20110006013A1 (en) * | 2005-02-15 | 2011-01-13 | Halosource, Inc. | Method for the removal of submicron particulates from chlorinated water by sequentially adding a cationic polymer followed by adding an anionic polymer |
| US20090107925A1 (en) * | 2007-10-31 | 2009-04-30 | Chevron U.S.A. Inc. | Apparatus and process for treating an aqueous solution containing biological contaminants |
| CA2634672C (en) * | 2008-06-09 | 2013-03-12 | Jerry Hanna | Water reaction tank |
| US20100155330A1 (en) * | 2008-11-11 | 2010-06-24 | Molycorp Minerals, Llc | Target material removal using rare earth metals |
| BRPI1015574A2 (pt) | 2009-07-06 | 2019-09-24 | Halosource Inc | sistema de duplo polímero para recuperação de águas e de separação de sólidos em suspensão em meios aquosos. |
| WO2011069223A1 (en) * | 2009-12-08 | 2011-06-16 | Jerry Hanna | Water reaction tank |
| US9233863B2 (en) | 2011-04-13 | 2016-01-12 | Molycorp Minerals, Llc | Rare earth removal of hydrated and hydroxyl species |
| KR101901627B1 (ko) | 2012-02-22 | 2018-09-27 | 더블유.알. 그레이스 앤드 캄파니-콘. | 점토 경감용 작용기가 부여된 폴리아민 |
| IN2014DN08736A (enExample) | 2012-05-04 | 2015-05-22 | Grace W R & Co | |
| CN106457073A (zh) | 2014-03-07 | 2017-02-22 | 安全自然资源有限公司 | 具有杰出的砷去除性质的氧化铈(iv) |
| WO2015142327A1 (en) * | 2014-03-19 | 2015-09-24 | Kanchi Krishna | System and method for recycling used oil |
| CN115092998B (zh) * | 2022-07-04 | 2024-10-29 | 庆阳新庄煤业有限公司新庄煤矿 | 一种用于回风大巷集水池的减盐减灰除煤尘絮凝剂 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA648242A (en) * | 1962-09-11 | G. Premo John | Coagulation of solids in liquid suspensions | |
| US3142638A (en) * | 1962-06-29 | 1964-07-28 | Blaisdell Donald Stapf | Process for separating solids from sewage |
| US3157594A (en) * | 1963-09-06 | 1964-11-17 | Pennsalt Chemicals Corp | Method of flocculation |
-
1965
- 1965-01-05 US US423540A patent/US3377274A/en not_active Expired - Lifetime
- 1965-09-15 ES ES0317494A patent/ES317494A1/es not_active Expired
- 1965-10-15 GB GB43756/65A patent/GB1108493A/en not_active Expired
- 1965-12-10 DE DE19651517474 patent/DE1517474A1/de active Pending
-
1966
- 1966-01-05 FR FR1574656D patent/FR1574656A/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| ES317494A1 (es) | 1966-04-01 |
| FR1574656A (enExample) | 1969-07-18 |
| GB1108493A (en) | 1968-04-03 |
| US3377274A (en) | 1968-04-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1517474A1 (de) | Verfahren zum Koagulieren von Trueben | |
| DE69618029T2 (de) | Wasserklärung mit Zugabe von kolloidalem Silika und nachfolgender Zugabe von Polyelektrolyte | |
| DE69026744T2 (de) | Amphoterer Elektrolyt, Verfahren zur Herstellung und Entwässerungsmittel für organische Schlämme | |
| DE2823640B2 (de) | Flüssige Polymerzusammensetzung | |
| DE68921053T2 (de) | Hochleistungs-Polymer-Flokkuliermittel. | |
| DE2205908C2 (de) | Verfahren zur Flockung von in wäßrigen Medien suspendierten Feststoffen | |
| DE60032891T2 (de) | Syntheseverfahren für flockungs- und koagulierungsmittel des polyvinylaminpulver typs | |
| DE69826239T2 (de) | Wässrige dispersion eines polymeren hocher spezifischer viskosität, ihre herstellung und verwendung | |
| DE2311222A1 (de) | Mittel und verfahren zum ausflocken von in wasser suspendierten feststoffen | |
| DE69935499T2 (de) | Verbesserte Polymergemische zur Entwässerung | |
| CH506312A (de) | Verfahren zum Ausflocken von in wässrigem Medium suspendierten Feststoffen | |
| DD202037A5 (de) | Verfahren zur herstellung wasserloeslicher copolymerisate | |
| DE2143355A1 (de) | Hochmolekulares Irenpfropfpolymer | |
| DE3318218A1 (de) | Verfahren zur herstellung von wasser-in-wasser-sekundaerdispersionen von wasserloeslichen polymerisaten und deren verwendung als flockungsmittel | |
| DE69415221T2 (de) | Zusammensetzung und Verfahren zur Wasserreinigung und Behandlung von Abwässern | |
| DE69323664T2 (de) | Metallabscheidungsmittel und Verfahren zu seiner Herstellung | |
| DE2557443C3 (de) | Verfahren zur Abtrennung von Polyvinylalkohol aus Lösungen | |
| DE1767749A1 (de) | Ausflockungsverfahren unter Verwendung modifizierter anionischer Polymerisate | |
| DE1442398A1 (de) | Ausflockungszusammensetzung und Verfahren zum Ausflocken | |
| DE2054523A1 (de) | Verfahren zur Klarung von Titan sulfatlosungen | |
| DE2538281B2 (de) | Retentions- und Flockungsmittel auf Basis von Polyacrylamiden | |
| DE2312450A1 (de) | Wasserloesliches polysaccharid | |
| DE2639085A1 (de) | Tensidfreies flockungsmittelkonzentrat | |
| DE69418393T2 (de) | Behandlungsverfahren für ölige Abwässer | |
| CN105944451A (zh) | 一种用于湿法磷酸精制絮凝硫酸钡的聚合剂及其絮凝方法 |