DE1446655C3 - - Google Patents
Info
- Publication number
- DE1446655C3 DE1446655C3 DE1446655*CA DE1446655A DE1446655C3 DE 1446655 C3 DE1446655 C3 DE 1446655C3 DE 1446655 A DE1446655 A DE 1446655A DE 1446655 C3 DE1446655 C3 DE 1446655C3
- Authority
- DE
- Germany
- Prior art keywords
- paper
- recording
- layer
- electrosensitive
- sheet
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000002736 metal compounds Chemical class 0.000 claims description 26
- 239000011230 binding agent Substances 0.000 claims description 25
- 229910052751 metal Inorganic materials 0.000 claims description 19
- 239000002184 metal Substances 0.000 claims description 19
- 239000000126 substance Substances 0.000 claims description 14
- 239000011248 coating agent Substances 0.000 claims description 9
- 238000000576 coating method Methods 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 9
- 239000002245 particle Substances 0.000 claims description 7
- 239000000203 mixture Substances 0.000 claims description 5
- 239000000049 pigment Substances 0.000 claims description 5
- 230000015572 biosynthetic process Effects 0.000 claims description 3
- 238000011065 in-situ storage Methods 0.000 claims description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 2
- 229910000004 White lead Inorganic materials 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- 239000004020 conductor Substances 0.000 claims description 2
- RYZCLUQMCYZBJQ-UHFFFAOYSA-H lead(2+);dicarbonate;dihydroxide Chemical compound [OH-].[OH-].[Pb+2].[Pb+2].[Pb+2].[O-]C([O-])=O.[O-]C([O-])=O RYZCLUQMCYZBJQ-UHFFFAOYSA-H 0.000 claims description 2
- 238000005259 measurement Methods 0.000 claims description 2
- 239000003792 electrolyte Substances 0.000 claims 2
- KEQXNNJHMWSZHK-UHFFFAOYSA-L 1,3,2,4$l^{2}-dioxathiaplumbetane 2,2-dioxide Chemical compound [Pb+2].[O-]S([O-])(=O)=O KEQXNNJHMWSZHK-UHFFFAOYSA-L 0.000 claims 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims 1
- 239000000853 adhesive Substances 0.000 claims 1
- 230000001070 adhesive effect Effects 0.000 claims 1
- 238000009792 diffusion process Methods 0.000 claims 1
- 239000000428 dust Substances 0.000 claims 1
- 238000010891 electric arc Methods 0.000 claims 1
- 230000005611 electricity Effects 0.000 claims 1
- AWTSMFNITNKUQL-UHFFFAOYSA-N lead;sulfuric acid;hydrate Chemical compound O.[Pb].OS(O)(=O)=O AWTSMFNITNKUQL-UHFFFAOYSA-N 0.000 claims 1
- 230000000873 masking effect Effects 0.000 claims 1
- 239000003973 paint Substances 0.000 claims 1
- 229920002037 poly(vinyl butyral) polymer Polymers 0.000 claims 1
- 239000000779 smoke Substances 0.000 claims 1
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 94
- 239000011787 zinc oxide Substances 0.000 description 39
- 229910015902 Bi 2 O 3 Inorganic materials 0.000 description 6
- 229910052782 aluminium Inorganic materials 0.000 description 6
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 6
- HTUMBQDCCIXGCV-UHFFFAOYSA-N lead oxide Chemical compound [O-2].[Pb+2] HTUMBQDCCIXGCV-UHFFFAOYSA-N 0.000 description 5
- 229910010413 TiO 2 Inorganic materials 0.000 description 4
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 4
- 239000000945 filler Substances 0.000 description 4
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- CXKCTMHTOKXKQT-UHFFFAOYSA-N cadmium oxide Inorganic materials [Cd]=O CXKCTMHTOKXKQT-UHFFFAOYSA-N 0.000 description 3
- 239000011888 foil Substances 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- 239000000395 magnesium oxide Substances 0.000 description 3
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 3
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- 239000004793 Polystyrene Substances 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 230000000875 corresponding effect Effects 0.000 description 2
- GNTDGMZSJNCJKK-UHFFFAOYSA-N divanadium pentaoxide Chemical compound O=[V](=O)O[V](=O)=O GNTDGMZSJNCJKK-UHFFFAOYSA-N 0.000 description 2
- 229920001971 elastomer Polymers 0.000 description 2
- 229910000464 lead oxide Inorganic materials 0.000 description 2
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000011159 matrix material Substances 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 229920002223 polystyrene Polymers 0.000 description 2
- 229920002689 polyvinyl acetate Polymers 0.000 description 2
- 239000011118 polyvinyl acetate Substances 0.000 description 2
- 239000004800 polyvinyl chloride Substances 0.000 description 2
- 229920000915 polyvinyl chloride Polymers 0.000 description 2
- 230000001105 regulatory effect Effects 0.000 description 2
- 239000005060 rubber Substances 0.000 description 2
- NDVLTYZPCACLMA-UHFFFAOYSA-N silver oxide Chemical compound [O-2].[Ag+].[Ag+] NDVLTYZPCACLMA-UHFFFAOYSA-N 0.000 description 2
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 2
- XOLBLPGZBRYERU-UHFFFAOYSA-N tin dioxide Chemical compound O=[Sn]=O XOLBLPGZBRYERU-UHFFFAOYSA-N 0.000 description 2
- 239000004408 titanium dioxide Substances 0.000 description 2
- WUPHOULIZUERAE-UHFFFAOYSA-N 3-(oxolan-2-yl)propanoic acid Chemical compound OC(=O)CCC1CCCO1 WUPHOULIZUERAE-UHFFFAOYSA-N 0.000 description 1
- 208000034656 Contusions Diseases 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 1
- 229910021586 Nickel(II) chloride Inorganic materials 0.000 description 1
- 239000000020 Nitrocellulose Substances 0.000 description 1
- 101000579646 Penaeus vannamei Penaeidin-1 Proteins 0.000 description 1
- 229920002367 Polyisobutene Polymers 0.000 description 1
- 229910006404 SnO 2 Inorganic materials 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- FJWGYAHXMCUOOM-QHOUIDNNSA-N [(2s,3r,4s,5r,6r)-2-[(2r,3r,4s,5r,6s)-4,5-dinitrooxy-2-(nitrooxymethyl)-6-[(2r,3r,4s,5r,6s)-4,5,6-trinitrooxy-2-(nitrooxymethyl)oxan-3-yl]oxyoxan-3-yl]oxy-3,5-dinitrooxy-6-(nitrooxymethyl)oxan-4-yl] nitrate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O)O[C@H]1[C@@H]([C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@@H](CO[N+]([O-])=O)O1)O[N+]([O-])=O)CO[N+](=O)[O-])[C@@H]1[C@@H](CO[N+]([O-])=O)O[C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O FJWGYAHXMCUOOM-QHOUIDNNSA-N 0.000 description 1
- PPKVREKQVQREQD-UHFFFAOYSA-N antimony pentasulfide Chemical compound S=[Sb](=S)S[Sb](=S)=S PPKVREKQVQREQD-UHFFFAOYSA-N 0.000 description 1
- 229960001283 antimony pentasulfide Drugs 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 229910052980 cadmium sulfide Inorganic materials 0.000 description 1
- CFEAAQFZALKQPA-UHFFFAOYSA-N cadmium(2+);oxygen(2-) Chemical compound [O-2].[Cd+2] CFEAAQFZALKQPA-UHFFFAOYSA-N 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 229910000420 cerium oxide Inorganic materials 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 230000004907 flux Effects 0.000 description 1
- 230000002452 interceptive effect Effects 0.000 description 1
- 238000009533 lab test Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000003801 milling Methods 0.000 description 1
- PXHVJJICTQNCMI-UHFFFAOYSA-N nickel Substances [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 1
- QMMRZOWCJAIUJA-UHFFFAOYSA-L nickel dichloride Chemical compound Cl[Ni]Cl QMMRZOWCJAIUJA-UHFFFAOYSA-L 0.000 description 1
- 229920001220 nitrocellulos Polymers 0.000 description 1
- BMMGVYCKOGBVEV-UHFFFAOYSA-N oxo(oxoceriooxy)cerium Chemical compound [Ce]=O.O=[Ce]=O BMMGVYCKOGBVEV-UHFFFAOYSA-N 0.000 description 1
- RVTZCBVAJQQJTK-UHFFFAOYSA-N oxygen(2-);zirconium(4+) Chemical compound [O-2].[O-2].[Zr+4] RVTZCBVAJQQJTK-UHFFFAOYSA-N 0.000 description 1
- 239000013618 particulate matter Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003229 poly(methyl methacrylate) Polymers 0.000 description 1
- -1 polyethylene methacrylate Polymers 0.000 description 1
- 229920000193 polymethacrylate Polymers 0.000 description 1
- 239000004926 polymethyl methacrylate Substances 0.000 description 1
- 229920005990 polystyrene resin Polymers 0.000 description 1
- 229910052573 porcelain Inorganic materials 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229910001923 silver oxide Inorganic materials 0.000 description 1
- GGCZERPQGJTIQP-UHFFFAOYSA-N sodium;9,10-dioxoanthracene-2-sulfonic acid Chemical compound [Na+].C1=CC=C2C(=O)C3=CC(S(=O)(=O)O)=CC=C3C(=O)C2=C1 GGCZERPQGJTIQP-UHFFFAOYSA-N 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910001928 zirconium oxide Inorganic materials 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B41—PRINTING; LINING MACHINES; TYPEWRITERS; STAMPS
- B41M—PRINTING, DUPLICATING, MARKING, OR COPYING PROCESSES; COLOUR PRINTING
- B41M5/00—Duplicating or marking methods; Sheet materials for use therein
- B41M5/20—Duplicating or marking methods; Sheet materials for use therein using electric current
Landscapes
- Heat Sensitive Colour Forming Recording (AREA)
- Cosmetics (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US848393A US3138547A (en) | 1959-10-23 | 1959-10-23 | Electrosensitive recording sheets |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1446655A1 DE1446655A1 (de) | 1969-03-20 |
| DE1446655B2 DE1446655B2 (de) | 1973-07-12 |
| DE1446655C3 true DE1446655C3 (enExample) | 1975-08-07 |
Family
ID=25303135
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19601446655 Granted DE1446655B2 (de) | 1959-10-23 | 1960-10-22 | Elektroempfindliches registrierblatt |
Country Status (3)
| Country | Link |
|---|---|
| US (1) | US3138547A (enExample) |
| DE (1) | DE1446655B2 (enExample) |
| GB (1) | GB892807A (enExample) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3256523A (en) * | 1963-10-23 | 1966-06-14 | Medical Electronics And Res Co | Recording instrument |
| US3335423A (en) * | 1965-03-24 | 1967-08-08 | Denki Onkyo Co Ltd | Medium for treating information |
| US3441940A (en) * | 1966-09-15 | 1969-04-29 | Phonocopy Inc | Process for electro-junction thermography |
| US3516911A (en) * | 1967-12-01 | 1970-06-23 | Nashua Corp | Electrosensitive recording material |
| GB1337427A (en) * | 1970-05-12 | 1973-11-14 | Kansai Paint Co Ltd | Compositions for electrosensitive recording material |
| US3713996A (en) * | 1971-01-06 | 1973-01-30 | Bausch & Lomb | Electrosensitive recording media |
| US3898672A (en) * | 1972-01-28 | 1975-08-05 | Ricoh Kk | Electrosensitive recording member |
| US3864684A (en) * | 1974-03-22 | 1975-02-04 | Mitsubishi Paper Mills Ltd | Multicolor electrothermic recording sheet |
| GB1511364A (en) * | 1974-07-27 | 1978-05-17 | Canon Kk | Image recording member |
| CA1037101A (en) * | 1974-07-29 | 1978-08-22 | Eastman Kodak Company | Electrographic recording process and apparatus |
| US4324622A (en) * | 1974-09-26 | 1982-04-13 | American Cyanamid Company | Multilayered electroplatographic element comprising ion conductive and electrochromic layers |
| JPS54106229A (en) * | 1978-02-08 | 1979-08-21 | Fuji Photo Film Co Ltd | Image forming material and image formation using the same |
| FR2435100A1 (fr) * | 1978-08-29 | 1980-03-28 | Antzan Paul | Procede electroyltique d'inscription |
| US4263105A (en) * | 1979-08-21 | 1981-04-21 | Issec Sa | Electrosensitive recording material and process |
| US4550061A (en) * | 1984-04-13 | 1985-10-29 | International Business Machines Corporation | Electroerosion printing media using depolymerizable polymer coatings |
| US5109771A (en) * | 1988-08-19 | 1992-05-05 | Presstek, Inc. | Spark-discharge lithography plates containing image-support pigments |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH149268A (de) * | 1930-03-22 | 1931-08-31 | Bausch Viktor | Verfahren zur Herstellung von Jodid enthaltendem Empfangspapier für elektrische Aufzeichnungsgeräte. |
| BE411766A (enExample) * | 1934-10-13 | |||
| US2281013A (en) * | 1939-02-25 | 1942-04-28 | Radio Inventions Inc | Electrolytic recording paper |
| US2319765A (en) * | 1939-12-14 | 1943-05-18 | Radio Inventions Inc | Electrolytic recording |
| US2554017A (en) * | 1946-11-14 | 1951-05-22 | Timefax Corp | Electroresponsive recording blank |
| DE962661C (de) * | 1951-06-25 | 1957-04-25 | Int Standard Electric Corp | Verfahren zur Herstellung von Aufzeichnungspapier |
-
1959
- 1959-10-23 US US848393A patent/US3138547A/en not_active Expired - Lifetime
-
1960
- 1960-10-21 GB GB36228/60A patent/GB892807A/en not_active Expired
- 1960-10-22 DE DE19601446655 patent/DE1446655B2/de active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| DE1446655B2 (de) | 1973-07-12 |
| US3138547A (en) | 1964-06-23 |
| DE1446655A1 (de) | 1969-03-20 |
| GB892807A (en) | 1962-03-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1446655C3 (enExample) | ||
| DE2730758C3 (de) | Verfahren und Verbundmaterial zur Aufzeichnung mittels elektrischer Entladung | |
| DE2842772C2 (de) | Farbband zum anschlagfreien Drucken | |
| DE2928038A1 (de) | Aufzeichnungsmaterial fuer die elektrographie mit einer einen metalloxid- halbleiter enthaltenden leitfaehigen schicht | |
| DE2411219C2 (de) | Elektrostatisches Aufzeichnungsmaterial | |
| DE2740148C2 (enExample) | ||
| DE2618757C3 (de) | Elektrisch leitender Schichtträger | |
| DE2935140C2 (de) | Elektrostatisches Aufzeichnungsmaterial | |
| DE4118294A1 (de) | Leitendes substrat | |
| DE2727689C3 (de) | Elektro-wärmeempfindliches Aufzeichnungsmaterial | |
| DE1273325B (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE3023582A1 (de) | Elektrostatisches aufzeichnungsmaterial | |
| DE2255585C3 (de) | Elektrographisches Aufzeichnungsmaterial | |
| DE2434105A1 (de) | Elektrosensitiver aufzeichnungstraeger | |
| DE1011722B (de) | Elektroempfindlicher, vervielfaeltigungsfaehiger Aufzeichnungstraeger | |
| DE1303695B (de) | Elektrographisches aufzeichnungsmaterial | |
| DE2406189A1 (de) | Sperrelektrode zur verwendung bei einem photoelektrophoretischen abbildungssystem | |
| DE1671605A1 (de) | Druckempfindliches magnetisches Farbuebertragungsblatt oder -band vom Ausquetschtyp und Verfahren zu seiner Herstellung | |
| DE2723868C3 (de) | Elektrographisches Verfahren mit Aufzeichnungselektrode | |
| DE2148514C3 (de) | Elektrisch beschreibbare Flachdruckplatte | |
| DE2151690C3 (de) | Elektrophotographisches Aufzeichnungsmaterial mit einer photoleitfähigen Schicht | |
| DE1272124B (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE2512864C3 (de) | Elektrographisches Aufzeichnungsmaterial | |
| DE1167365B (de) | Elektrisch beschreibbare lithographische Flachdruckfolie | |
| DE2536303A1 (de) | Elektrostatisches aufzeichnungsmaterial |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| E77 | Valid patent as to the heymanns-index 1977 |