DE1445674A1 - Verfahren zur Herstellung neuer substituierter Aminopyridine - Google Patents
Verfahren zur Herstellung neuer substituierter AminopyridineInfo
- Publication number
- DE1445674A1 DE1445674A1 DE19641445674 DE1445674A DE1445674A1 DE 1445674 A1 DE1445674 A1 DE 1445674A1 DE 19641445674 DE19641445674 DE 19641445674 DE 1445674 A DE1445674 A DE 1445674A DE 1445674 A1 DE1445674 A1 DE 1445674A1
- Authority
- DE
- Germany
- Prior art keywords
- general formula
- compound
- connection
- elevated temperature
- general
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 4
- 150000003927 aminopyridines Chemical class 0.000 title description 3
- 150000001875 compounds Chemical class 0.000 claims description 26
- 239000003054 catalyst Substances 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 239000012442 inert solvent Substances 0.000 claims description 5
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical class 0.000 claims description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 4
- 239000002904 solvent Substances 0.000 claims description 4
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 150000001340 alkali metals Chemical class 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 235000010233 benzoic acid Nutrition 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 238000009833 condensation Methods 0.000 claims description 3
- 230000005494 condensation Effects 0.000 claims description 3
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 3
- 239000005711 Benzoic acid Substances 0.000 claims description 2
- 241000251730 Chondrichthyes Species 0.000 claims description 2
- 125000004414 alkyl thio group Chemical group 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical compound [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims 2
- 101100371682 Caenorhabditis elegans cyk-3 gene Proteins 0.000 claims 1
- 239000003795 chemical substances by application Substances 0.000 claims 1
- 150000001991 dicarboxylic acids Chemical class 0.000 claims 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 1
- RLZZZVKAURTHCP-UHFFFAOYSA-N phenanthrene-3,4-diol Chemical compound C1=CC=C2C3=C(O)C(O)=CC=C3C=CC2=C1 RLZZZVKAURTHCP-UHFFFAOYSA-N 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 21
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 7
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 7
- -1 hydroxy- Chemical class 0.000 description 6
- 229910000027 potassium carbonate Inorganic materials 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- WYVAMUWZEOHJOQ-UHFFFAOYSA-N propionic anhydride Chemical compound CCC(=O)OC(=O)CC WYVAMUWZEOHJOQ-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- HHVIBTZHLRERCL-UHFFFAOYSA-N sulfonyldimethane Chemical compound CS(C)(=O)=O HHVIBTZHLRERCL-UHFFFAOYSA-N 0.000 description 2
- NJYFRQQXXXRJHK-UHFFFAOYSA-N (4-aminophenyl) thiocyanate Chemical compound NC1=CC=C(SC#N)C=C1 NJYFRQQXXXRJHK-UHFFFAOYSA-N 0.000 description 1
- CPEONABTMRSIKA-UHFFFAOYSA-N 1,4$l^{2}-oxazinane Chemical compound C1COCC[N]1 CPEONABTMRSIKA-UHFFFAOYSA-N 0.000 description 1
- MGYAGUUKOYNYAT-UHFFFAOYSA-N 2-(oxan-2-yl)oxane Chemical compound O1CCCCC1C1OCCCC1 MGYAGUUKOYNYAT-UHFFFAOYSA-N 0.000 description 1
- BAZVFQBTJPBRTJ-UHFFFAOYSA-N 2-chloro-5-nitropyridine Chemical compound [O-][N+](=O)C1=CC=C(Cl)N=C1 BAZVFQBTJPBRTJ-UHFFFAOYSA-N 0.000 description 1
- VIUDTWATMPPKEL-UHFFFAOYSA-N 3-(trifluoromethyl)aniline Chemical compound NC1=CC=CC(C(F)(F)F)=C1 VIUDTWATMPPKEL-UHFFFAOYSA-N 0.000 description 1
- KZNJHGNLFGRYNA-UHFFFAOYSA-N 3-chloro-n-phenylpyridin-2-amine Chemical compound ClC1=CC=CN=C1NC1=CC=CC=C1 KZNJHGNLFGRYNA-UHFFFAOYSA-N 0.000 description 1
- RKIDDEGICSMIJA-UHFFFAOYSA-N 4-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=C(Cl)C=C1 RKIDDEGICSMIJA-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- OZLBNRIWTFTOAD-UHFFFAOYSA-N C(CCCC)OC1=CC=C(C=C1)NC1=NC=C(C=C1)[N+](=O)[O-] Chemical compound C(CCCC)OC1=CC=C(C=C1)NC1=NC=C(C=C1)[N+](=O)[O-] OZLBNRIWTFTOAD-UHFFFAOYSA-N 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- NNQJVZHYUASQHU-UHFFFAOYSA-N N-(6-anilinopyridin-3-yl)propanamide Chemical compound C1(=CC=CC=C1)NC1=NC=C(C=C1)NC(CC)=O NNQJVZHYUASQHU-UHFFFAOYSA-N 0.000 description 1
- 241000159606 Netrium Species 0.000 description 1
- JGGQNNZJVBRCRP-UHFFFAOYSA-N OC(=O)O.[C] Chemical compound OC(=O)O.[C] JGGQNNZJVBRCRP-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 241000220010 Rhode Species 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- IUHFWCGCSVTMPG-UHFFFAOYSA-N [C].[C] Chemical group [C].[C] IUHFWCGCSVTMPG-UHFFFAOYSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- 150000001559 benzoic acids Chemical class 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000011435 rock Substances 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 125000001302 tertiary amino group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/74—Amino or imino radicals substituted by hydrocarbon or substituted hydrocarbon radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/75—Amino or imino radicals, acylated by carboxylic or carbonic acids, or by sulfur or nitrogen analogues thereof, e.g. carbamates
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DED0045302 | 1964-08-29 | ||
| DED0045303 | 1964-08-29 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1445674A1 true DE1445674A1 (de) | 1969-01-16 |
Family
ID=25971962
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19641445674 Pending DE1445674A1 (de) | 1964-08-29 | 1964-08-29 | Verfahren zur Herstellung neuer substituierter Aminopyridine |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3375257A (https=) |
| BE (1) | BE668738A (https=) |
| BR (1) | BR6572596D0 (https=) |
| CH (2) | CH484136A (https=) |
| DE (1) | DE1445674A1 (https=) |
| DK (1) | DK126592B (https=) |
| ES (1) | ES316911A1 (https=) |
| FI (1) | FI47188C (https=) |
| FR (1) | FR4598M (https=) |
| GB (1) | GB1111507A (https=) |
| NL (2) | NL6511104A (https=) |
| SE (2) | SE349802B (https=) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0011854A1 (en) * | 1978-11-27 | 1980-06-11 | Dainippon Pharmaceutical Co., Ltd. | 4-(2'-Pyridylamino)-phenylacetic acid derivatives, process for their preparation, pharmaceuticals containing these compounds and their use |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1670522C3 (de) * | 1966-05-12 | 1978-08-31 | Deutsche Gold- Und Silber-Scheideanstalt Vormals Roessler, 6000 Frankfurt | Neue Benzylaminopyridine |
| DE1568426A1 (de) * | 1966-11-16 | 1970-04-02 | Degussa | Verfahren zur Herstellung von neuen N-aromatisch substituierten Saeureamiden |
| US3930007A (en) * | 1970-08-04 | 1975-12-30 | Ici Ltd | Pesticidal bis-pyridyl amine derivatives |
| EP0000816A1 (en) * | 1977-08-06 | 1979-02-21 | Beecham Group Plc | Substituted amino-pyridine derivatives, processes for their preparation and pharmaceutical compositions containing them |
| ZA796645B (en) * | 1978-12-22 | 1980-12-31 | Ici Australia Ltd | Herbicidally active compounds and compositions |
| GB8311003D0 (en) * | 1983-04-22 | 1983-05-25 | Shell Int Research | Aniline compounds |
| US6022884A (en) | 1997-11-07 | 2000-02-08 | Amgen Inc. | Substituted pyridine compounds and methods of use |
| FR2926297B1 (fr) | 2008-01-10 | 2013-03-08 | Centre Nat Rech Scient | Molecules chimiques inhibitrices du mecanisme d'epissage pour traiter des maladies resultant d'anomalies d'epissage. |
| EP2440204B1 (en) | 2009-06-12 | 2013-12-18 | Bristol-Myers Squibb Company | Nicotinamide compounds useful as kinase modulators |
| EP2505198A1 (en) | 2011-04-01 | 2012-10-03 | Société Splicos | Compounds for use as therapeutic agents affecting p53 expression and/or activity |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3107263A (en) * | 1961-01-12 | 1963-10-15 | Parke Davis & Co | Anthranilic acids |
-
0
- NL NL132603D patent/NL132603C/xx active
-
1964
- 1964-08-29 DE DE19641445674 patent/DE1445674A1/de active Pending
-
1965
- 1965-08-02 CH CH1082865A patent/CH484136A/de not_active IP Right Cessation
- 1965-08-02 CH CH1082965A patent/CH475984A/de not_active IP Right Cessation
- 1965-08-23 US US481938A patent/US3375257A/en not_active Expired - Lifetime
- 1965-08-24 BE BE668738D patent/BE668738A/xx unknown
- 1965-08-24 GB GB36336/65A patent/GB1111507A/en not_active Expired
- 1965-08-25 NL NL6511104A patent/NL6511104A/xx unknown
- 1965-08-27 SE SE11197/65A patent/SE349802B/xx unknown
- 1965-08-27 SE SE11196/65A patent/SE330887B/xx unknown
- 1965-08-27 BR BR172596/65A patent/BR6572596D0/pt unknown
- 1965-08-27 DK DK439765AA patent/DK126592B/da unknown
- 1965-08-28 FI FI652066A patent/FI47188C/fi active
- 1965-08-28 ES ES0316911A patent/ES316911A1/es not_active Expired
- 1965-11-12 FR FR38147A patent/FR4598M/fr not_active Expired
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0011854A1 (en) * | 1978-11-27 | 1980-06-11 | Dainippon Pharmaceutical Co., Ltd. | 4-(2'-Pyridylamino)-phenylacetic acid derivatives, process for their preparation, pharmaceuticals containing these compounds and their use |
Also Published As
| Publication number | Publication date |
|---|---|
| FI47188B (https=) | 1973-07-02 |
| CH484136A (de) | 1970-01-15 |
| NL6511104A (https=) | 1966-03-01 |
| DK126592B (da) | 1973-07-30 |
| CH475984A (de) | 1969-07-31 |
| BR6572596D0 (pt) | 1973-08-07 |
| FI47188C (fi) | 1973-10-10 |
| SE349802B (https=) | 1972-10-09 |
| NL132603C (https=) | |
| GB1111507A (en) | 1968-05-01 |
| US3375257A (en) | 1968-03-26 |
| ES316911A1 (es) | 1966-01-01 |
| BE668738A (https=) | 1965-12-16 |
| FR4598M (https=) | 1966-11-14 |
| SE330887B (https=) | 1970-12-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE844741C (de) | Verfahren zur Herstellung von heterocyclischen Carbaminsaeureestern | |
| DE1445674A1 (de) | Verfahren zur Herstellung neuer substituierter Aminopyridine | |
| DE2455155A1 (de) | 5-chlor-2-(2'-hydroxy-5'-tert.octylphenyl)-benzotriazol, dieses enthaltende polypropylene und verfahren zur herstellung von hydroxyarylbenzotriazolen und ihren n-oxiden | |
| GB1590902A (en) | 1-phenyl-3-azabicyclo(3,1,0)hexan-2-ones | |
| CH513157A (de) | Verfahren zur Herstellung von Pyrrolinverbindungen | |
| DD280323A5 (de) | Herstellung von zwischenprodukten der oxophthalazinyl-essigsaeuren mit benzothiazol- oder anderen heterocyclischen seitenketten | |
| CH502339A (de) | Verfahren zur Herstellung neuer substituierter Aminopyridine | |
| CH501592A (de) | Verfahren zur Herstellung von 2-(substituierten-Benzyl)-cyanessigsäureestern | |
| CH619208A5 (https=) | ||
| CH445492A (de) | Verfahren zur Herstellung von in 1-Stellung acylierten a-(3-Indolyl)-niederaliphatischen-säuren | |
| DE1300117B (de) | 5-Sulfonyl-1, 2-dithiol-3-one | |
| AT395148B (de) | Verfahren zur herstellung von 1-(3-mercapto-(2s)methyl-1-oxo-propyl)-l-prolin | |
| DE2065367C2 (de) | Verfahren zur Herstellung von 2,4- Diamino-5-benzylpyrimidinen | |
| US4772730A (en) | Tetrafluoro-2,3-dihydrobenzofurans | |
| AT339294B (de) | Verfahren zur herstellung von 4-(5- oder 7-)-benzoylindolin-2-onen | |
| DE69411273T2 (de) | Verfahren zur herstellung von hydrochinon-und benzochinon-derivaten | |
| DE2628469B2 (de) | Verfahren zur Herstellung von γ -Aminoalkoholen | |
| DE2619165A1 (de) | Indazolderivate und verfahren zu ihrer herstellung | |
| DE1929237A1 (de) | Verfahren zur Herstellung von N-Acyl-3,4-epoxy-pyrrolidin-Derivaten | |
| AT258904B (de) | Verfahren zur Herstellung neuer substituierter Aminopyridine | |
| Kumar et al. | Synthesis of 3-Alkoxy-, 3-Aryloxy-and 3-Substituted Amino-2, 5-Diarylfurans by Reductive-Furanization of α, β-Unsaturated-1, 4-Diketones | |
| DE1770802A1 (de) | Indolyl-(3)-acetonitrile und Verfahren zu ihrer Herstellung | |
| DE947165C (de) | Verfahren zur Herstellung von in 3-Stellung substituierten 4-Oxycumarinen | |
| AT270647B (de) | Verfahren zur Herstellung neuer substituierter Aminopyridine, von deren Salzen und optisch aktiven Isomeren | |
| DE1445800C (de) | Verfahren zur Herstellung von Diben zoazepinen |