DE1445011A1 - Verfahren zur Herstellung von Bisazolverbindungen und Zwischenprodukt - Google Patents
Verfahren zur Herstellung von Bisazolverbindungen und ZwischenproduktInfo
- Publication number
- DE1445011A1 DE1445011A1 DE19611445011 DE1445011A DE1445011A1 DE 1445011 A1 DE1445011 A1 DE 1445011A1 DE 19611445011 DE19611445011 DE 19611445011 DE 1445011 A DE1445011 A DE 1445011A DE 1445011 A1 DE1445011 A1 DE 1445011A1
- Authority
- DE
- Germany
- Prior art keywords
- chlorine
- parts
- formula
- atom
- hydrogen atom
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000001875 compounds Chemical class 0.000 title claims description 6
- 238000000034 method Methods 0.000 title claims description 5
- 238000002360 preparation method Methods 0.000 title claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 20
- 239000000460 chlorine Substances 0.000 claims description 14
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 12
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 11
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 claims description 10
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 9
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 claims description 6
- 239000002253 acid Substances 0.000 claims description 6
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 claims description 6
- 125000001424 substituent group Chemical group 0.000 claims description 4
- VZKPHLAASBCFGX-UHFFFAOYSA-N thiolane-2,5-dicarboxylic acid Chemical compound OC(=O)C1CCC(C(O)=O)S1 VZKPHLAASBCFGX-UHFFFAOYSA-N 0.000 claims description 4
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 10
- HLRDGANDZDXNIM-UHFFFAOYSA-N ClC1(CCC(S1)(C(=O)Cl)Cl)C(=O)Cl Chemical compound ClC1(CCC(S1)(C(=O)Cl)Cl)C(=O)Cl HLRDGANDZDXNIM-UHFFFAOYSA-N 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- 238000009835 boiling Methods 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- -1 phenylene radical Chemical class 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- FZJKSRGBIVUYOF-UHFFFAOYSA-N O=C(C(CC1)SC1C(Cl)=O)Cl Chemical compound O=C(C(CC1)SC1C(Cl)=O)Cl FZJKSRGBIVUYOF-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 3
- 239000004327 boric acid Substances 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 229920000137 polyphosphoric acid Polymers 0.000 description 3
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 2
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical compound NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 description 2
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical compound NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 150000001448 anilines Chemical class 0.000 description 2
- 150000001555 benzenes Chemical class 0.000 description 2
- 238000005282 brightening Methods 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 125000002843 carboxylic acid group Chemical group 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Substances ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000002657 fibrous material Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 239000011368 organic material Substances 0.000 description 2
- HFPZCAJZSCWRBC-UHFFFAOYSA-N p-cymene Chemical compound CC(C)C1=CC=C(C)C=C1 HFPZCAJZSCWRBC-UHFFFAOYSA-N 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000000859 sublimation Methods 0.000 description 2
- 230000008022 sublimation Effects 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- VZKPHLAASBCFGX-QWWZWVQMSA-N (2r,5r)-thiolane-2,5-dicarboxylic acid Chemical compound OC(=O)[C@H]1CC[C@H](C(O)=O)S1 VZKPHLAASBCFGX-QWWZWVQMSA-N 0.000 description 1
- RELMFMZEBKVZJC-UHFFFAOYSA-N 1,2,3-trichlorobenzene Chemical compound ClC1=CC=CC(Cl)=C1Cl RELMFMZEBKVZJC-UHFFFAOYSA-N 0.000 description 1
- 125000000355 1,3-benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- RPKCLSMBVQLWIN-UHFFFAOYSA-N 2-n-methylbenzene-1,2-diamine Chemical compound CNC1=CC=CC=C1N RPKCLSMBVQLWIN-UHFFFAOYSA-N 0.000 description 1
- NUANSJJRMWHEHS-UHFFFAOYSA-N 2-n-propan-2-ylbenzene-1,2-diamine Chemical compound CC(C)NC1=CC=CC=C1N NUANSJJRMWHEHS-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- VGKZBAMIYUHSMU-UHFFFAOYSA-N 4-[[2-chloroethyl(nitroso)carbamoyl]amino]cyclohexane-1-carboxylic acid Chemical compound OC(=O)C1CCC(NC(=O)N(CCCl)N=O)CC1 VGKZBAMIYUHSMU-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000012320 chlorinating reagent Substances 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 238000004042 decolorization Methods 0.000 description 1
- 125000003963 dichloro group Chemical group Cl* 0.000 description 1
- XPPKVPWEQAFLFU-UHFFFAOYSA-N diphosphoric acid Chemical compound OP(O)(=O)OP(O)(O)=O XPPKVPWEQAFLFU-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 150000002460 imidazoles Chemical class 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 229940079865 intestinal antiinfectives imidazole derivative Drugs 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- 229940005657 pyrophosphoric acid Drugs 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 229910052979 sodium sulfide Inorganic materials 0.000 description 1
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- WQYSXVGEZYESBR-UHFFFAOYSA-N thiophosphoryl chloride Chemical compound ClP(Cl)(Cl)=S WQYSXVGEZYESBR-UHFFFAOYSA-N 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/26—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D333/38—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing three or more hetero rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1085860A CH403777A (de) | 1960-09-26 | 1960-09-26 | Verfahren zur Herstellung von 2,5-substituierten Thiophenderivaten |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1445011A1 true DE1445011A1 (de) | 1968-10-24 |
Family
ID=4367561
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19611445011 Pending DE1445011A1 (de) | 1960-09-26 | 1961-09-25 | Verfahren zur Herstellung von Bisazolverbindungen und Zwischenprodukt |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3127416A (enExample) |
| CH (1) | CH403777A (enExample) |
| DE (1) | DE1445011A1 (enExample) |
| ES (1) | ES270730A1 (enExample) |
| GB (1) | GB923096A (enExample) |
| NL (1) | NL269564A (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH504471A (de) * | 1963-11-25 | 1971-03-15 | Ciba Geigy Ag | Neues Verfahren zur Herstellung von 7-Aminocephalosporanverbindungen |
| CH424701A (de) * | 1964-05-29 | 1966-08-15 | Geigy Ag J R | Verfahren zum optischen Aufhellen von polymere Ester der Terephthalsäure enthaltendem Fasermaterial |
| CA1084511A (en) * | 1976-07-05 | 1980-08-26 | Leonardo Guglielmetti | Process for the manufacture of 2,5-bis-(benzoxazolyl)- thiophene compounds |
| TW420674B (en) | 1994-08-25 | 2001-02-01 | Ciba Sc Holding Ag | Process for the preparation of thiophene-2,5-dicarboxylic acid and the dichloride thereof |
| US6924276B2 (en) | 2001-09-10 | 2005-08-02 | Warner-Lambert Company | Diacid-substituted heteroaryl derivatives as matrix metalloproteinase inhibitors |
| CN118754870B (zh) * | 2024-07-25 | 2025-05-09 | 江苏格罗瑞化学有限公司 | 一种荧光增白剂用ob酸的绿色高效制备工艺 |
-
0
- NL NL269564D patent/NL269564A/xx unknown
-
1960
- 1960-09-26 CH CH1085860A patent/CH403777A/de unknown
-
1961
- 1961-09-25 DE DE19611445011 patent/DE1445011A1/de active Pending
- 1961-09-25 GB GB34282/61A patent/GB923096A/en not_active Expired
- 1961-09-25 US US140235A patent/US3127416A/en not_active Expired - Lifetime
- 1961-09-25 ES ES0270730A patent/ES270730A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| NL269564A (enExample) | |
| CH403777A (de) | 1965-12-15 |
| GB923096A (en) | 1963-04-10 |
| ES270730A1 (es) | 1962-03-16 |
| US3127416A (en) | 1964-03-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2150787C3 (de) | Neue N,N*-Diaryloxamide, ihre Herstellung und Verwendung als Stabilisatoren für organische Materialien | |
| DE1445011A1 (de) | Verfahren zur Herstellung von Bisazolverbindungen und Zwischenprodukt | |
| DE2344889A1 (de) | Neue perfluoralkylverbindungen, verfahren zu deren herstellung und ihre verwendung | |
| DE2556760A1 (de) | Verfahren zur herstellung von carbodiimiden | |
| DE2501859A1 (de) | Verfahren zur herstellung von cyclopentandionen | |
| AT236935B (de) | Verfahren zur Herstellung von Bis-azolyl-thiophenverbindungen | |
| DE907414C (de) | Verfahren zur Herstellung von 2-(2-Methyl-5-halogen-phenyl-1-mercapto)-benzoesaeuren | |
| DE946986C (de) | Verfahren zur Herstellung von ª‡-Acetotetronsaeuren | |
| CH437347A (de) | Verfahren zur Herstellung eines Dichlor-tetrahydrothiophen-2,5-dicarbonsäuredichlorides | |
| LU82205A1 (de) | Verfahren zur herstellung eines carbazolderivates | |
| AT235855B (de) | Verfahren zur Herstellung von Organometallverbindungen | |
| CH242865A (de) | Abzugsvorrichtung von selbsttätigen Handfeuerwaffen. | |
| DE1300573B (de) | Verfahren zur Herstellung von 2-Chlor-5, 6-naphtho-1, 3, 2-dioxaphosphorin-4-onen | |
| AT228216B (de) | Verfahren zur Herstellung von neuen, carboxylhaltigen Amidinen | |
| DE1493826B1 (de) | Verfahren zur Herstellung von halogenierten 4,7-Endomethylen-4,7,8,9-tetrahydrophthalan-5-onen | |
| DE1545900C (de) | Verfahren zur Herstellung von 1-H-Benzo-2,3-thiazinon-4-dioxyden-(2,2) | |
| AT229305B (de) | Verfahren zur Herstellung von neuen Anthrachinonderivaten | |
| DE964861C (de) | Verfahren zur Herstellung von (Bz)-Oxy-chinolonen-(4) | |
| DE842066C (de) | Verfahren zur Herstellung von Phthaloyl-4-chlorchinazolinen | |
| AT222125B (de) | Verfahren zur Herstellung von neuen Triazinverbindungen | |
| EP0150441A1 (de) | 1,4-Bis-(styryl)-benzole und deren Verwendung als optische Aufheller | |
| DE1807735A1 (de) | Chinoxalin-di-N-oxid-lactone | |
| DE2147264A1 (de) | Verfahren zur herstellung ungesaettigter phosphorhaltiger carbonsaeurederivate | |
| DE1670975A1 (de) | 7-Indazolyl-3-phenyl-cumarine | |
| DE1268758B (de) | Verfahren zur Herstellung von Nitrofarbstoffen |