DE1293155B - Verfahren zur Herstellung von 1, 3-Dicyan-3-buten durch Dimerisieren von Acrylsaeurenitril - Google Patents
Verfahren zur Herstellung von 1, 3-Dicyan-3-buten durch Dimerisieren von AcrylsaeurenitrilInfo
- Publication number
- DE1293155B DE1293155B DEB87125A DEB0087125A DE1293155B DE 1293155 B DE1293155 B DE 1293155B DE B87125 A DEB87125 A DE B87125A DE B0087125 A DEB0087125 A DE B0087125A DE 1293155 B DE1293155 B DE 1293155B
- Authority
- DE
- Germany
- Prior art keywords
- parts
- tri
- acrylonitrile
- butene
- layer
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 17
- 230000000447 dimerizing effect Effects 0.000 title claims description 3
- 238000002360 preparation method Methods 0.000 title claims 2
- -1 acrylic acid nitrile Chemical class 0.000 title description 18
- NGCJVMZXRCLPRQ-UHFFFAOYSA-N 2-methylidenepentanedinitrile Chemical compound N#CC(=C)CCC#N NGCJVMZXRCLPRQ-UHFFFAOYSA-N 0.000 title description 5
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 title description 4
- 238000006243 chemical reaction Methods 0.000 claims description 31
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 claims description 27
- 239000003054 catalyst Substances 0.000 claims description 20
- 239000002904 solvent Substances 0.000 claims description 12
- 150000001875 compounds Chemical class 0.000 claims description 10
- 229910052698 phosphorus Inorganic materials 0.000 claims description 10
- 229930195733 hydrocarbon Natural products 0.000 claims description 9
- 239000011574 phosphorus Substances 0.000 claims description 9
- 150000002430 hydrocarbons Chemical class 0.000 claims description 8
- 239000011541 reaction mixture Substances 0.000 claims description 7
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 6
- 238000009835 boiling Methods 0.000 claims description 6
- 238000010438 heat treatment Methods 0.000 claims description 6
- 125000001931 aliphatic group Chemical group 0.000 claims description 4
- 238000010626 work up procedure Methods 0.000 claims description 4
- 239000002841 Lewis acid Substances 0.000 claims description 3
- 150000007517 lewis acids Chemical class 0.000 claims description 3
- 238000000926 separation method Methods 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 239000000463 material Substances 0.000 claims description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 14
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 14
- 239000000203 mixture Substances 0.000 description 13
- UAEPNZWRGJTJPN-UHFFFAOYSA-N methylcyclohexane Chemical compound CC1CCCCC1 UAEPNZWRGJTJPN-UHFFFAOYSA-N 0.000 description 12
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 10
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 9
- 239000000243 solution Substances 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- GYNNXHKOJHMOHS-UHFFFAOYSA-N methyl-cycloheptane Natural products CC1CCCCCC1 GYNNXHKOJHMOHS-UHFFFAOYSA-N 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- 150000003003 phosphines Chemical class 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- IVIIAEVMQHEPAY-UHFFFAOYSA-N tridodecyl phosphite Chemical compound CCCCCCCCCCCCOP(OCCCCCCCCCCCC)OCCCCCCCCCCCC IVIIAEVMQHEPAY-UHFFFAOYSA-N 0.000 description 6
- 150000002825 nitriles Chemical class 0.000 description 5
- BDZBKCUKTQZUTL-UHFFFAOYSA-N triethyl phosphite Chemical compound CCOP(OCC)OCC BDZBKCUKTQZUTL-UHFFFAOYSA-N 0.000 description 5
- ZQOHAQBXINVHHC-UHFFFAOYSA-N hex-2-enedinitrile Chemical compound N#CCCC=CC#N ZQOHAQBXINVHHC-UHFFFAOYSA-N 0.000 description 4
- JKBPBRLDGFKIIA-UHFFFAOYSA-N 2-propylidenepropanedinitrile Chemical class CCC=C(C#N)C#N JKBPBRLDGFKIIA-UHFFFAOYSA-N 0.000 description 3
- 239000004215 Carbon black (E152) Substances 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 125000000753 cycloalkyl group Chemical group 0.000 description 3
- 238000006471 dimerization reaction Methods 0.000 description 3
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- QQBLOZGVRHAYGT-UHFFFAOYSA-N tris-decyl phosphite Chemical compound CCCCCCCCCCOP(OCCCCCCCCCC)OCCCCCCCCCC QQBLOZGVRHAYGT-UHFFFAOYSA-N 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- YRKCREAYFQTBPV-UHFFFAOYSA-N acetylacetone Chemical compound CC(=O)CC(C)=O YRKCREAYFQTBPV-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 238000003860 storage Methods 0.000 description 2
- DHWBYAACHDUFAT-UHFFFAOYSA-N tricyclopentylphosphane Chemical compound C1CCCC1P(C1CCCC1)C1CCCC1 DHWBYAACHDUFAT-UHFFFAOYSA-N 0.000 description 2
- IGNTWNVBGLNYDV-UHFFFAOYSA-N triisopropylphosphine Chemical compound CC(C)P(C(C)C)C(C)C IGNTWNVBGLNYDV-UHFFFAOYSA-N 0.000 description 2
- CYTQBVOFDCPGCX-UHFFFAOYSA-N trimethyl phosphite Chemical compound COP(OC)OC CYTQBVOFDCPGCX-UHFFFAOYSA-N 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- BRTNWPWZQXHESZ-UHFFFAOYSA-N 1,1'-biphenyl;phosphorous acid Chemical compound OP(O)O.C1=CC=CC=C1C1=CC=CC=C1.C1=CC=CC=C1C1=CC=CC=C1.C1=CC=CC=C1C1=CC=CC=C1 BRTNWPWZQXHESZ-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- VANGMRDOFGYBAF-UHFFFAOYSA-N 2-ethoxyethyl(dimethyl)phosphane Chemical compound CCOCCP(C)C VANGMRDOFGYBAF-UHFFFAOYSA-N 0.000 description 1
- CWNNYYIZGGDCHS-UHFFFAOYSA-N 2-methylideneglutaric acid Chemical compound OC(=O)CCC(=C)C(O)=O CWNNYYIZGGDCHS-UHFFFAOYSA-N 0.000 description 1
- JIGUICYYOYEXFS-UHFFFAOYSA-N 3-tert-butylbenzene-1,2-diol Chemical compound CC(C)(C)C1=CC=CC(O)=C1O JIGUICYYOYEXFS-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- WWZKQHOCKIZLMA-UHFFFAOYSA-N Caprylic acid Natural products CCCCCCCC(O)=O WWZKQHOCKIZLMA-UHFFFAOYSA-N 0.000 description 1
- DSEKYWAQQVUQTP-UHFFFAOYSA-N Cerin Natural products CC12CCC3(C)C4CC(C)(C)CCC4(C)CCC3(C)C2CCC2(C)C1CC(O)C(=O)C2C DSEKYWAQQVUQTP-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 241000158147 Sator Species 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000012062 aqueous buffer Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- GONOPSZTUGRENK-UHFFFAOYSA-N benzyl(trichloro)silane Chemical compound Cl[Si](Cl)(Cl)CC1=CC=CC=C1 GONOPSZTUGRENK-UHFFFAOYSA-N 0.000 description 1
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- OKEPOLZARIXTLH-UHFFFAOYSA-N butyl(diethyl)phosphane Chemical compound CCCCP(CC)CC OKEPOLZARIXTLH-UHFFFAOYSA-N 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- XGRJZXREYAXTGV-UHFFFAOYSA-N chlorodiphenylphosphine Chemical compound C=1C=CC=CC=1P(Cl)C1=CC=CC=C1 XGRJZXREYAXTGV-UHFFFAOYSA-N 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- MYMLEKSXMQPDJR-UHFFFAOYSA-N cyclohexyl-ethyl-methylphosphane Chemical compound CCP(C)C1CCCCC1 MYMLEKSXMQPDJR-UHFFFAOYSA-N 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- LVTCZSBUROAWTE-UHFFFAOYSA-N diethyl(phenyl)phosphane Chemical compound CCP(CC)C1=CC=CC=C1 LVTCZSBUROAWTE-UHFFFAOYSA-N 0.000 description 1
- 239000000539 dimer Substances 0.000 description 1
- ORDPXYVBSFJMAW-UHFFFAOYSA-N diphenoxy(phenylsulfanyl)phosphane Chemical compound C=1C=CC=CC=1OP(SC=1C=CC=CC=1)OC1=CC=CC=C1 ORDPXYVBSFJMAW-UHFFFAOYSA-N 0.000 description 1
- LLBCLGFWIFQPFG-UHFFFAOYSA-N dodecyl-trihydroxy-(12-phenyldodecyl)-lambda5-phosphane Chemical compound CCCCCCCCCCCCP(O)(O)(O)CCCCCCCCCCCCC1=CC=CC=C1 LLBCLGFWIFQPFG-UHFFFAOYSA-N 0.000 description 1
- AFPMYNVTBFMKOI-UHFFFAOYSA-N ethene;pentanedioic acid Chemical compound C=C.OC(=O)CCCC(O)=O AFPMYNVTBFMKOI-UHFFFAOYSA-N 0.000 description 1
- XYIBRDXRRQCHLP-UHFFFAOYSA-N ethyl acetoacetate Chemical compound CCOC(=O)CC(C)=O XYIBRDXRRQCHLP-UHFFFAOYSA-N 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- BHEPBYXIRTUNPN-UHFFFAOYSA-N hydridophosphorus(.) (triplet) Chemical compound [PH] BHEPBYXIRTUNPN-UHFFFAOYSA-N 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000011031 large-scale manufacturing process Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- XVDBWWRIXBMVJV-UHFFFAOYSA-N n-[bis(dimethylamino)phosphanyl]-n-methylmethanamine Chemical compound CN(C)P(N(C)C)N(C)C XVDBWWRIXBMVJV-UHFFFAOYSA-N 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-N n-hexanoic acid Natural products CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- SXADIBFZNXBEGI-UHFFFAOYSA-N phosphoramidous acid Chemical class NP(O)O SXADIBFZNXBEGI-UHFFFAOYSA-N 0.000 description 1
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical class OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 1
- 125000004437 phosphorous atom Chemical group 0.000 description 1
- 150000003018 phosphorus compounds Chemical class 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- HHDLJTLPOGOXLR-UHFFFAOYSA-N propan-2-ylphosphane Chemical compound CC(C)P HHDLJTLPOGOXLR-UHFFFAOYSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000009877 rendering Methods 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 238000004513 sizing Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- ISIJQEHRDSCQIU-UHFFFAOYSA-N tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCCC11CNCC1 ISIJQEHRDSCQIU-UHFFFAOYSA-N 0.000 description 1
- 150000003509 tertiary alcohols Chemical class 0.000 description 1
- 150000003573 thiols Chemical class 0.000 description 1
- DZQQRNFLQBSVBN-UHFFFAOYSA-N tri(butan-2-yl)phosphane Chemical compound CCC(C)P(C(C)CC)C(C)CC DZQQRNFLQBSVBN-UHFFFAOYSA-N 0.000 description 1
- TUQOTMZNTHZOKS-UHFFFAOYSA-N tributylphosphine Chemical compound CCCCP(CCCC)CCCC TUQOTMZNTHZOKS-UHFFFAOYSA-N 0.000 description 1
- FICPQAZLPKLOLH-UHFFFAOYSA-N tricyclohexyl phosphite Chemical compound C1CCCCC1OP(OC1CCCCC1)OC1CCCCC1 FICPQAZLPKLOLH-UHFFFAOYSA-N 0.000 description 1
- WLPUWLXVBWGYMZ-UHFFFAOYSA-N tricyclohexylphosphine Chemical compound C1CCCCC1P(C1CCCCC1)C1CCCCC1 WLPUWLXVBWGYMZ-UHFFFAOYSA-N 0.000 description 1
- GRAKJTASWCEOQI-UHFFFAOYSA-N tridodecylphosphane Chemical compound CCCCCCCCCCCCP(CCCCCCCCCCCC)CCCCCCCCCCCC GRAKJTASWCEOQI-UHFFFAOYSA-N 0.000 description 1
- RXJKFRMDXUJTEX-UHFFFAOYSA-N triethylphosphine Chemical compound CCP(CC)CC RXJKFRMDXUJTEX-UHFFFAOYSA-N 0.000 description 1
- DMEUUKUNSVFYAA-UHFFFAOYSA-N trinaphthalen-1-ylphosphane Chemical compound C1=CC=C2C(P(C=3C4=CC=CC=C4C=CC=3)C=3C4=CC=CC=C4C=CC=3)=CC=CC2=C1 DMEUUKUNSVFYAA-UHFFFAOYSA-N 0.000 description 1
- RMZAYIKUYWXQPB-UHFFFAOYSA-N trioctylphosphane Chemical compound CCCCCCCCP(CCCCCCCC)CCCCCCCC RMZAYIKUYWXQPB-UHFFFAOYSA-N 0.000 description 1
- BKHZQJRTFNFCTG-UHFFFAOYSA-N tris(2-methylphenyl) phosphite Chemical compound CC1=CC=CC=C1OP(OC=1C(=CC=CC=1)C)OC1=CC=CC=C1C BKHZQJRTFNFCTG-UHFFFAOYSA-N 0.000 description 1
- COIOYMYWGDAQPM-UHFFFAOYSA-N tris(2-methylphenyl)phosphane Chemical compound CC1=CC=CC=C1P(C=1C(=CC=CC=1)C)C1=CC=CC=C1C COIOYMYWGDAQPM-UHFFFAOYSA-N 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEB87125A DE1293155B (de) | 1966-05-14 | 1966-05-14 | Verfahren zur Herstellung von 1, 3-Dicyan-3-buten durch Dimerisieren von Acrylsaeurenitril |
| LU53529D LU53529A1 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1966-05-14 | 1967-04-27 | |
| NL6706621A NL6706621A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1966-05-14 | 1967-05-11 | |
| BE698441D BE698441A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1966-05-14 | 1967-05-12 | |
| GB22122/67A GB1177182A (en) | 1966-05-14 | 1967-05-12 | Production of 1,3-Dicyano-3-Butene and Isomers thereof |
| FR106261A FR1522836A (fr) | 1966-05-14 | 1967-05-12 | Procédé perfectionné de préparation du 1, 3-dicyano-3-butène |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEB87125A DE1293155B (de) | 1966-05-14 | 1966-05-14 | Verfahren zur Herstellung von 1, 3-Dicyan-3-buten durch Dimerisieren von Acrylsaeurenitril |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1293155B true DE1293155B (de) | 1969-04-24 |
Family
ID=6983663
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEB87125A Pending DE1293155B (de) | 1966-05-14 | 1966-05-14 | Verfahren zur Herstellung von 1, 3-Dicyan-3-buten durch Dimerisieren von Acrylsaeurenitril |
Country Status (6)
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4102915A (en) | 1976-05-10 | 1978-07-25 | Imperial Chemical Industries Limited | Dimerization process |
| US4138428A (en) | 1976-10-21 | 1979-02-06 | Imperial Chemical Industries Limited | Dimerization process |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1514642A (en) * | 1976-05-24 | 1978-06-21 | Ici Ltd | Dimerisation of acrylonitrile |
| GB1547432A (en) * | 1976-11-24 | 1979-06-20 | Ici Ltd | Process for the dimerisation of acrylonitrile |
| US20230219884A1 (en) * | 2020-10-12 | 2023-07-13 | Lg Chem, Ltd. | Preparation method of acrylonitrile dimer |
Citations (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2232785A (en) * | 1938-12-20 | 1941-02-25 | Du Pont | Preparation of low molecular weight polymers of vinylidene compounds |
| US2566203A (en) * | 1950-04-26 | 1951-08-28 | Du Pont | Dimerization of methacrylonitrile to alpha-methylene-delta-methyladiponitrile |
| US2609385A (en) * | 1950-10-05 | 1952-09-02 | Du Pont | 3-methyleneglutaronitrile |
| FR1366081A (fr) * | 1963-05-24 | 1964-07-10 | Rhone Poulenc Sa | Dicyano-2, 4 butène-1 |
| BE644774A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1963-03-07 | 1964-09-07 | ||
| FR1385883A (fr) * | 1964-03-05 | 1965-01-15 | Basf Ag | Procédé pour la dimérisation d'acrylonitrile |
| FR1388444A (fr) * | 1963-04-08 | 1965-02-05 | Nat Distillers Chem Corp | Procédé de préparation de dimères des composés de l'acrylonitrile |
| FR1411003A (fr) * | 1963-02-18 | 1965-09-17 | Shell Int Research | Nouveau composé de 2-méthylèneglutaronitrile et procédé pour le préparer |
| FR1499708A (fr) * | 1966-02-01 | 1967-10-27 | Rohm & Haas | Procédé de fabrication de 2-méthylène-glutaronitrile |
-
1966
- 1966-05-14 DE DEB87125A patent/DE1293155B/de active Pending
-
1967
- 1967-04-27 LU LU53529D patent/LU53529A1/xx unknown
- 1967-05-11 NL NL6706621A patent/NL6706621A/xx unknown
- 1967-05-12 BE BE698441D patent/BE698441A/xx unknown
- 1967-05-12 FR FR106261A patent/FR1522836A/fr not_active Expired
- 1967-05-12 GB GB22122/67A patent/GB1177182A/en not_active Expired
Patent Citations (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2232785A (en) * | 1938-12-20 | 1941-02-25 | Du Pont | Preparation of low molecular weight polymers of vinylidene compounds |
| US2566203A (en) * | 1950-04-26 | 1951-08-28 | Du Pont | Dimerization of methacrylonitrile to alpha-methylene-delta-methyladiponitrile |
| US2609385A (en) * | 1950-10-05 | 1952-09-02 | Du Pont | 3-methyleneglutaronitrile |
| FR1411003A (fr) * | 1963-02-18 | 1965-09-17 | Shell Int Research | Nouveau composé de 2-méthylèneglutaronitrile et procédé pour le préparer |
| BE644774A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1963-03-07 | 1964-09-07 | ||
| FR1388444A (fr) * | 1963-04-08 | 1965-02-05 | Nat Distillers Chem Corp | Procédé de préparation de dimères des composés de l'acrylonitrile |
| FR1366081A (fr) * | 1963-05-24 | 1964-07-10 | Rhone Poulenc Sa | Dicyano-2, 4 butène-1 |
| FR1385883A (fr) * | 1964-03-05 | 1965-01-15 | Basf Ag | Procédé pour la dimérisation d'acrylonitrile |
| FR1499708A (fr) * | 1966-02-01 | 1967-10-27 | Rohm & Haas | Procédé de fabrication de 2-méthylène-glutaronitrile |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4102915A (en) | 1976-05-10 | 1978-07-25 | Imperial Chemical Industries Limited | Dimerization process |
| US4138428A (en) | 1976-10-21 | 1979-02-06 | Imperial Chemical Industries Limited | Dimerization process |
Also Published As
| Publication number | Publication date |
|---|---|
| LU53529A1 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1967-06-27 |
| NL6706621A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1967-11-15 |
| GB1177182A (en) | 1970-01-07 |
| BE698441A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1967-11-13 |
| FR1522836A (fr) | 1968-04-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1667286B2 (de) | Verfahren zur herstellung von loesungen von kobalt und phosphor enthaltenden komplexkatalysatoren | |
| DE2533320C2 (de) | Verfahren zur Herstellung von Aldehyden | |
| EP0138141B1 (de) | Verfahren zur selektiven Hydrierung von C-C-Doppelbindungen in Gegenwart von reduzierbaren, stickstoffhaltigen Gruppen | |
| DE1144268B (de) | Verfahren zur Herstellung von Cyclooctadien-(1, 5) aus Butadien | |
| DE1518755B2 (de) | Verfahren zur herstellung von linearen alkylaromatischen verbindungen | |
| DE1293155B (de) | Verfahren zur Herstellung von 1, 3-Dicyan-3-buten durch Dimerisieren von Acrylsaeurenitril | |
| DE69608442T2 (de) | Verfahren zur herstellung von 5-formylvelerionsäure | |
| EP0007609A1 (de) | Verfahren zur Herstellung von Aldehyden | |
| DE2445119A1 (de) | Verfahren zur herstellung von butyraldehyden | |
| DE1239304B (de) | Verfahren zur Herstellung der Dimeren des Bicyclo-[2, 2, 1]-heptadiens-2, 5 und seiner unterhalb 140 siedenden Alkylderivate | |
| DE1468987A1 (de) | Verfahren zur Addierung von Kohlenmonoxid an ungesaettigte organische Verbindungen | |
| DE2248525A1 (de) | Verfahren zur decarboxylierung von ortho- oder para-hydroxyarylcarbonsaeuren | |
| DE2256039C3 (de) | Herstellung von 1,4-Dicyanbutenen | |
| DE2548625A1 (de) | Verfahren zur addition von mindestens drei chloratome enthaltendem methan an einen aethylenisch-ungesaettigten kohlenwasserstoff | |
| DE2451473C2 (de) | Verfahren zur Herstellung von Formylpropylacetaten | |
| DE2501859A1 (de) | Verfahren zur herstellung von cyclopentandionen | |
| DE1468614C3 (de) | Verfahren zur Herstellung von Aldehyden und/oder Alkoholen durch die Oxosynthese | |
| DE1693175C3 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
| DE1268614B (de) | Verfahren zur Herstellung von 1, 3-Dicyan-3-buten und dessen Isomeren aus Acrylsaeurenitril | |
| DE2337158A1 (de) | Verfahren zur herstellung von alkanoder aralkansaeuren | |
| DE1933744C (de) | Verfahren zur Herstellung von Aldehyden | |
| DE1275050B (de) | Verfahren zur Herstellung von olefinisch ungesaettigten Aldehyden und Ketonen | |
| DE2456739C3 (de) | Verfahren zur Herstellung von Aldehyden | |
| DE272572C (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
| DE1281429B (de) | Verfahren zur Herstellung von 1, 1, 4, 4-Tetraalkyl-1, 3-butadienen |