DE1291622B - Lichtempfindliche Schicht - Google Patents
Lichtempfindliche SchichtInfo
- Publication number
- DE1291622B DE1291622B DEW38585A DEW0038585A DE1291622B DE 1291622 B DE1291622 B DE 1291622B DE W38585 A DEW38585 A DE W38585A DE W0038585 A DEW0038585 A DE W0038585A DE 1291622 B DE1291622 B DE 1291622B
- Authority
- DE
- Germany
- Prior art keywords
- color
- compound
- image
- furfurylidene
- weight
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000001875 compounds Chemical class 0.000 claims description 25
- 229940018564 m-phenylenediamine Drugs 0.000 claims description 18
- 239000003623 enhancer Substances 0.000 claims description 15
- 150000001412 amines Chemical class 0.000 claims description 13
- -1 amino, phenyl Chemical group 0.000 claims description 13
- 239000011230 binding agent Substances 0.000 claims description 12
- WZCQRUWWHSTZEM-UHFFFAOYSA-N 1,3-phenylenediamine Chemical compound NC1=CC=CC(N)=C1 WZCQRUWWHSTZEM-UHFFFAOYSA-N 0.000 claims description 11
- OKJPEAGHQZHRQV-UHFFFAOYSA-N iodoform Chemical compound IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 claims description 10
- 150000004982 aromatic amines Chemical class 0.000 claims description 9
- 125000002777 acetyl group Chemical class [H]C([H])([H])C(*)=O 0.000 claims description 6
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 claims description 5
- 125000003277 amino group Chemical group 0.000 claims description 4
- HFACYLZERDEVSX-UHFFFAOYSA-N benzidine Chemical compound C1=CC(N)=CC=C1C1=CC=C(N)C=C1 HFACYLZERDEVSX-UHFFFAOYSA-N 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 150000002366 halogen compounds Chemical class 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 4
- ZWUBBMDHSZDNTA-UHFFFAOYSA-N 4-Chloro-meta-phenylenediamine Chemical group NC1=CC=C(Cl)C(N)=C1 ZWUBBMDHSZDNTA-UHFFFAOYSA-N 0.000 claims description 3
- 238000004040 coloring Methods 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 125000001424 substituent group Chemical group 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 125000002529 biphenylenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3C12)* 0.000 claims description 2
- 125000004122 cyclic group Chemical group 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000001624 naphthyl group Chemical group 0.000 claims description 2
- 125000004957 naphthylene group Chemical group 0.000 claims description 2
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 10
- 229910052740 iodine Inorganic materials 0.000 description 10
- 239000011630 iodine Substances 0.000 description 10
- 239000000463 material Substances 0.000 description 10
- HYBBIBNJHNGZAN-UHFFFAOYSA-N furfural Chemical compound O=CC1=CC=CO1 HYBBIBNJHNGZAN-UHFFFAOYSA-N 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- VOZKAJLKRJDJLL-UHFFFAOYSA-N 2,4-diaminotoluene Chemical compound CC1=CC=C(N)C=C1N VOZKAJLKRJDJLL-UHFFFAOYSA-N 0.000 description 7
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 7
- 239000004793 Polystyrene Substances 0.000 description 7
- 229920002223 polystyrene Polymers 0.000 description 7
- 239000007787 solid Substances 0.000 description 7
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical group C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 5
- 239000011248 coating agent Substances 0.000 description 5
- 238000000576 coating method Methods 0.000 description 5
- 229920003229 poly(methyl methacrylate) Polymers 0.000 description 5
- 239000004926 polymethyl methacrylate Substances 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- 239000013078 crystal Substances 0.000 description 4
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 4
- 229910000043 hydrogen iodide Inorganic materials 0.000 description 4
- 150000003142 primary aromatic amines Chemical class 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 239000000758 substrate Substances 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- JRBJSXQPQWSCCF-UHFFFAOYSA-N 3,3'-Dimethoxybenzidine Chemical compound C1=C(N)C(OC)=CC(C=2C=C(OC)C(N)=CC=2)=C1 JRBJSXQPQWSCCF-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- 150000002466 imines Chemical class 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 3
- 230000000704 physical effect Effects 0.000 description 3
- 229920002037 poly(vinyl butyral) polymer Polymers 0.000 description 3
- UBOXGVDOUJQMTN-UHFFFAOYSA-N 1,1,2-trichloroethane Chemical compound ClCC(Cl)Cl UBOXGVDOUJQMTN-UHFFFAOYSA-N 0.000 description 2
- JBIJLHTVPXGSAM-UHFFFAOYSA-N 2-naphthylamine Chemical compound C1=CC=CC2=CC(N)=CC=C21 JBIJLHTVPXGSAM-UHFFFAOYSA-N 0.000 description 2
- MCSXGCZMEPXKIW-UHFFFAOYSA-N 3-hydroxy-4-[(4-methyl-2-nitrophenyl)diazenyl]-N-(3-nitrophenyl)naphthalene-2-carboxamide Chemical compound Cc1ccc(N=Nc2c(O)c(cc3ccccc23)C(=O)Nc2cccc(c2)[N+]([O-])=O)c(c1)[N+]([O-])=O MCSXGCZMEPXKIW-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- ZNZYKNKBJPZETN-WELNAUFTSA-N Dialdehyde 11678 Chemical compound N1C2=CC=CC=C2C2=C1[C@H](C[C@H](/C(=C/O)C(=O)OC)[C@@H](C=C)C=O)NCC2 ZNZYKNKBJPZETN-WELNAUFTSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 229920002125 Sokalan® Chemical class 0.000 description 2
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 2
- 150000001335 aliphatic alkanes Chemical class 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 229940125773 compound 10 Drugs 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- ZLVXBBHTMQJRSX-VMGNSXQWSA-N jdtic Chemical compound C1([C@]2(C)CCN(C[C@@H]2C)C[C@H](C(C)C)NC(=O)[C@@H]2NCC3=CC(O)=CC=C3C2)=CC=CC(O)=C1 ZLVXBBHTMQJRSX-VMGNSXQWSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 239000004584 polyacrylic acid Chemical class 0.000 description 2
- 229920000139 polyethylene terephthalate Polymers 0.000 description 2
- 239000005020 polyethylene terephthalate Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 2
- 229910052721 tungsten Inorganic materials 0.000 description 2
- 239000010937 tungsten Substances 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 description 1
- PCDRATAUXKUHBS-UHFFFAOYSA-N 1-(furan-2-yl)-n-phenylmethanimine Chemical compound C=1C=COC=1C=NC1=CC=CC=C1 PCDRATAUXKUHBS-UHFFFAOYSA-N 0.000 description 1
- XVXRQPHRNCORAZ-UHFFFAOYSA-N 1-chlorocyclohexa-3,5-diene-1,2-diamine Chemical compound NC1C=CC=CC1(N)Cl XVXRQPHRNCORAZ-UHFFFAOYSA-N 0.000 description 1
- VOSLIUIVGWBSOK-UHFFFAOYSA-N 1-n-phenylbenzene-1,2,4-triamine Chemical compound NC1=CC(N)=CC=C1NC1=CC=CC=C1 VOSLIUIVGWBSOK-UHFFFAOYSA-N 0.000 description 1
- BAHPQISAXRFLCL-UHFFFAOYSA-N 2,4-Diaminoanisole Chemical compound COC1=CC=C(N)C=C1N BAHPQISAXRFLCL-UHFFFAOYSA-N 0.000 description 1
- HQCHAOKWWKLXQH-UHFFFAOYSA-N 2,6-Dichloro-para-phenylenediamine Chemical compound NC1=CC(Cl)=C(N)C(Cl)=C1 HQCHAOKWWKLXQH-UHFFFAOYSA-N 0.000 description 1
- MGLZGLAFFOMWPB-UHFFFAOYSA-N 2-chloro-1,4-phenylenediamine Chemical compound NC1=CC=C(N)C(Cl)=C1 MGLZGLAFFOMWPB-UHFFFAOYSA-N 0.000 description 1
- YBRVSVVVWCFQMG-UHFFFAOYSA-N 4,4'-diaminodiphenylmethane Chemical compound C1=CC(N)=CC=C1CC1=CC=C(N)C=C1 YBRVSVVVWCFQMG-UHFFFAOYSA-N 0.000 description 1
- MTNLEKFLKGGTKS-UHFFFAOYSA-N 4-(2,4-diaminophenoxy)benzene-1,3-diamine Chemical compound NC1=CC(N)=CC=C1OC1=CC=C(N)C=C1N MTNLEKFLKGGTKS-UHFFFAOYSA-N 0.000 description 1
- XRWMYQLURQHNCL-UHFFFAOYSA-N 4-(4-amino-3-ethoxyphenyl)-2-ethoxyaniline Chemical compound C1=C(N)C(OCC)=CC(C=2C=C(OCC)C(N)=CC=2)=C1 XRWMYQLURQHNCL-UHFFFAOYSA-N 0.000 description 1
- HLBLWEWZXPIGSM-UHFFFAOYSA-N 4-Aminophenyl ether Chemical compound C1=CC(N)=CC=C1OC1=CC=C(N)C=C1 HLBLWEWZXPIGSM-UHFFFAOYSA-N 0.000 description 1
- BXIXXXYDDJVHDL-UHFFFAOYSA-N 4-Chloro-ortho-phenylenediamine Chemical compound NC1=CC=C(Cl)C=C1N BXIXXXYDDJVHDL-UHFFFAOYSA-N 0.000 description 1
- PLIKAWJENQZMHA-UHFFFAOYSA-N 4-aminophenol Chemical compound NC1=CC=C(O)C=C1 PLIKAWJENQZMHA-UHFFFAOYSA-N 0.000 description 1
- PTMVFRKAMOUORT-UHFFFAOYSA-N 4-ethylbenzene-1,3-diamine Chemical compound CCC1=CC=C(N)C=C1N PTMVFRKAMOUORT-UHFFFAOYSA-N 0.000 description 1
- QJBSFRUUSXSEOB-UHFFFAOYSA-N 4-naphthalen-2-yloxybenzene-1,3-diamine Chemical compound NC1=CC(N)=CC=C1OC1=CC=C(C=CC=C2)C2=C1 QJBSFRUUSXSEOB-UHFFFAOYSA-N 0.000 description 1
- KVJZXNIGNQSNKS-UHFFFAOYSA-N 4-phenylsulfanylbenzene-1,3-diamine Chemical compound NC1=CC(N)=CC=C1SC1=CC=CC=C1 KVJZXNIGNQSNKS-UHFFFAOYSA-N 0.000 description 1
- 240000007817 Olea europaea Species 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000003172 aldehyde group Chemical group 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 150000004705 aldimines Chemical class 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000012295 chemical reaction liquid Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 239000006103 coloring component Substances 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- ZZTCPWRAHWXWCH-UHFFFAOYSA-N diphenylmethanediamine Chemical compound C=1C=CC=CC=1C(N)(N)C1=CC=CC=C1 ZZTCPWRAHWXWCH-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000005562 fading Methods 0.000 description 1
- 210000003608 fece Anatomy 0.000 description 1
- XPFVYQJUAUNWIW-UHFFFAOYSA-N furfuryl alcohol Chemical class OCC1=CC=CO1 XPFVYQJUAUNWIW-UHFFFAOYSA-N 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- KQSABULTKYLFEV-UHFFFAOYSA-N naphthalene-1,5-diamine Chemical compound C1=CC=C2C(N)=CC=CC2=C1N KQSABULTKYLFEV-UHFFFAOYSA-N 0.000 description 1
- 150000002896 organic halogen compounds Chemical class 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- ATGUVEKSASEFFO-UHFFFAOYSA-N p-aminodiphenylamine Chemical compound C1=CC(N)=CC=C1NC1=CC=CC=C1 ATGUVEKSASEFFO-UHFFFAOYSA-N 0.000 description 1
- BHAAPTBBJKJZER-UHFFFAOYSA-N p-anisidine Chemical compound COC1=CC=C(N)C=C1 BHAAPTBBJKJZER-UHFFFAOYSA-N 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 150000003077 polyols Chemical class 0.000 description 1
- 150000003097 polyterpenes Chemical class 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 150000003336 secondary aromatic amines Chemical class 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000006104 solid solution Substances 0.000 description 1
- 238000007614 solvation Methods 0.000 description 1
- 238000000638 solvent extraction Methods 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 239000011269 tar Substances 0.000 description 1
- 150000003513 tertiary aromatic amines Chemical class 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/56—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/52—Radicals substituted by nitrogen atoms not forming part of a nitro radical
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C1/00—Photosensitive materials
- G03C1/675—Compositions containing polyhalogenated compounds as photosensitive substances
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Plural Heterocyclic Compounds (AREA)
- Heat Sensitive Colour Forming Recording (AREA)
- Color Printing (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Non-Silver Salt Photosensitive Materials And Non-Silver Salt Photography (AREA)
Applications Claiming Priority (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US35131664A | 1964-03-12 | 1964-03-12 | |
| US626881A US3413121A (en) | 1967-03-29 | 1967-03-29 | Heat development of photographic plate containing volatile photosensitizer |
| US626721A US3394394A (en) | 1964-03-12 | 1967-03-29 | Photographic medium based on 5-halofurfurylidenes |
| US641720A US3394395A (en) | 1964-03-12 | 1967-04-21 | Photosensitive medium comprising a furfurylidene, a primary aromatic amine and a lower haloalkane |
| US676637A US3410687A (en) | 1964-03-12 | 1967-10-19 | Photosensitive medium comprising an aromatic protected aldehyde, a primary aromatic amine and a lower haloalkane |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1291622B true DE1291622B (de) | 1969-03-27 |
Family
ID=27541230
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEW38585A Pending DE1291622B (de) | 1964-03-12 | 1965-02-19 | Lichtempfindliche Schicht |
| DEP1772091.1A Pending DE1294192B (de) | 1964-03-12 | 1968-03-28 | Lichtempfindliches Aufzeichnungsmaterial |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEP1772091.1A Pending DE1294192B (de) | 1964-03-12 | 1968-03-28 | Lichtempfindliches Aufzeichnungsmaterial |
Country Status (7)
| Country | Link |
|---|---|
| US (3) | US3394394A (https=) |
| BE (2) | BE660874A (https=) |
| CH (2) | CH450911A (https=) |
| DE (2) | DE1291622B (https=) |
| FR (2) | FR1432881A (https=) |
| GB (2) | GB1093724A (https=) |
| NL (2) | NL145365B (https=) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3637390A (en) * | 1969-12-19 | 1972-01-25 | Scott Paper Co | Photographic medium containing an aliphatic amine stabilizer |
| US3649284A (en) * | 1970-11-17 | 1972-03-14 | Scott Paper Co | Furfurvylidene-lower haloalkane photosensitive composition containing arylamino disulfide |
| JPS4923885B1 (https=) * | 1970-12-19 | 1974-06-19 | ||
| JPS4920979B1 (https=) * | 1970-12-29 | 1974-05-29 | ||
| JPS5121336B1 (https=) * | 1970-12-29 | 1976-07-01 | ||
| JPS511424B1 (https=) * | 1971-04-20 | 1976-01-17 | ||
| US3753718A (en) * | 1972-02-04 | 1973-08-21 | Scott Paper Co | Photosensitive medium comprising a cyclic acetal of furfural, a lower haloalkane, and silica |
| US3904419A (en) * | 1972-05-26 | 1975-09-09 | Fuji Photo Film Co Ltd | Non-silver salt photosensitive materials |
| FR2227270B1 (https=) | 1973-04-26 | 1977-11-04 | Rhone Poulenc Ind | |
| US3907570A (en) * | 1974-03-19 | 1975-09-23 | Scott Paper Co | Photosensitive material comprising a furfurylidene, a lower haloalkane and poly-n-vinyl carbazole |
| DE2433373A1 (de) * | 1974-07-11 | 1976-01-29 | Agfa Gevaert Ag | Lichtempfindliches material |
| US4066459A (en) * | 1976-01-26 | 1978-01-03 | Horizons Incorporated, A Division Of Horizons Research Incorporated | Free radical photosensitive compositions with improved sensitivity and shelf life stability |
| US10307256B2 (en) * | 2009-07-27 | 2019-06-04 | Biomet Manufacturing, Llc | Knee replacement system and method for enabling natural knee movement |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1134587B (de) * | 1959-01-16 | 1962-08-09 | Horizons Inc | Zur Herstellung von lichtempfindlichen Schichten geeignete Gemische |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2680731A (en) * | 1950-07-05 | 1954-06-08 | Du Pont | Acetals containing a cyanoacetyl group |
| US2680732A (en) * | 1950-10-31 | 1954-06-08 | Du Pont | Acetals containing a cyanoacetyl group |
| US3147117A (en) * | 1961-05-26 | 1964-09-01 | Horizons Inc | Process of forming print-out images from light sensitive organic amine compositions |
| US3202507A (en) * | 1961-11-22 | 1965-08-24 | Horizons Inc | Photographic method using a light sensitive visible image-bearing masking layer which includes an anti-halation layer |
-
1965
- 1965-02-16 GB GB6672/65A patent/GB1093724A/en not_active Expired
- 1965-02-19 DE DEW38585A patent/DE1291622B/de active Pending
- 1965-03-10 BE BE660874D patent/BE660874A/xx unknown
- 1965-03-11 NL NL656503105A patent/NL145365B/xx unknown
- 1965-03-12 FR FR8944A patent/FR1432881A/fr not_active Expired
- 1965-03-12 CH CH344265A patent/CH450911A/fr unknown
-
1967
- 1967-03-29 US US626721A patent/US3394394A/en not_active Expired - Lifetime
- 1967-04-21 US US641720A patent/US3394395A/en not_active Expired - Lifetime
- 1967-10-19 US US676637A patent/US3410687A/en not_active Expired - Lifetime
-
1968
- 1968-03-27 GB GB04790/68A patent/GB1217900A/en not_active Expired
- 1968-03-28 FR FR1557507D patent/FR1557507A/fr not_active Expired
- 1968-03-28 DE DEP1772091.1A patent/DE1294192B/de active Pending
- 1968-03-28 BE BE712880D patent/BE712880A/xx unknown
- 1968-03-28 CH CH457968A patent/CH493006A/fr not_active IP Right Cessation
- 1968-03-29 NL NL6804436A patent/NL6804436A/xx unknown
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1134587B (de) * | 1959-01-16 | 1962-08-09 | Horizons Inc | Zur Herstellung von lichtempfindlichen Schichten geeignete Gemische |
Also Published As
| Publication number | Publication date |
|---|---|
| GB1217900A (en) | 1970-12-31 |
| CH493006A (fr) | 1970-06-30 |
| US3394394A (en) | 1968-07-23 |
| BE660874A (https=) | 1965-09-10 |
| CH450911A (fr) | 1968-05-15 |
| FR1432881A (fr) | 1966-03-25 |
| NL145365B (nl) | 1975-03-17 |
| US3410687A (en) | 1968-11-12 |
| NL6804436A (https=) | 1968-09-30 |
| FR1557507A (https=) | 1969-02-14 |
| GB1093724A (en) | 1967-12-06 |
| NL6503105A (https=) | 1965-09-13 |
| BE712880A (https=) | 1968-09-30 |
| DE1294192B (de) | 1969-04-30 |
| US3394395A (en) | 1968-07-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0521823B1 (de) | Phenylthiophenylketone | |
| DE1291622B (de) | Lichtempfindliche Schicht | |
| DE2811026A1 (de) | Photothermographisches aufzeichnungsmaterial | |
| DE1269479B (de) | Lichtempfindliche Schicht | |
| DE2321470C2 (de) | Wasserlösliche Oxonolfarbstoffe und Verfahren zu ihrer Herstellung | |
| DE2627828C2 (de) | Verfahren zur Herstellung eines elektrisch leitenden Bildes | |
| DE3119304A1 (de) | "akutanzfarbstoffe und diese enthaltende lichtempfindliche, thermisch entwickelbare zusammensetzungen und materialien" | |
| DE1228142B (de) | Lichtempfindliches photographisches Kopiermaterial | |
| DE1285882B (de) | Verfahren zum Schutze von photographischem Material vor der Einwirkung ultravioletter Strahlung | |
| DE1911999A1 (de) | Fotoaufzeichnungsverfahren und Fotoaufzeichnungsblatt | |
| DE2822495A1 (de) | Bildaufzeichnungsmaterial | |
| DE1282452B (de) | Verfahren zum Stabilisieren von Bildern in Schichten aus photochromen Stoffen | |
| DE2716136A1 (de) | Verfahren zur verarbeitung von silberfarbbleichmaterialien | |
| DE2241563A1 (de) | Verfahren zum sensibilisieren von auskopiermaterialien | |
| DE2364040A1 (de) | Photographisches silberhalogenidaufzeichnungsmaterial | |
| DE548323C (de) | Verfahren zum Stabilisieren einer Silberhalogenemulsion | |
| DE2939259A1 (de) | Verfahren zur herstellung farbphotographischer bilder nach dem silberfarbbleichverfahren | |
| DE2524823C2 (de) | Thermophotographisches Aufzeichnungsmaterial | |
| DE2524431A1 (de) | Verfahren zur herstellung eines positiven farbphotographischen bildes | |
| DE2525674A1 (de) | Verfahren zur herstellung von stabilen polymer-bildern durch photopolymerisation in einer matrix | |
| DE953132C (de) | Lichtempfindliches photographisches Material, insbesondere farbenphotographisches Mehrschichtenmaterial | |
| DE2345787C3 (de) | Auskopiermaterial mit einer lichtempfindlichen Schicht und Auskopierverfahren | |
| CH378283A (de) | Verfahren zur Herstellung von farbigen photographischen Bildern auf Textilmaterial | |
| DE1522404A1 (de) | Verbessertes durch Licht entwickelbares fotografisches Material und Aufzeichnungsverfahren | |
| DE3620161C2 (https=) |