DE1285310B - Bildempfangsmaterial fuer das Farbstoffentwickler-Diffusionsverfahren - Google Patents
Bildempfangsmaterial fuer das Farbstoffentwickler-DiffusionsverfahrenInfo
- Publication number
- DE1285310B DE1285310B DEJ24647A DEJ0024647A DE1285310B DE 1285310 B DE1285310 B DE 1285310B DE J24647 A DEJ24647 A DE J24647A DE J0024647 A DEJ0024647 A DE J0024647A DE 1285310 B DE1285310 B DE 1285310B
- Authority
- DE
- Germany
- Prior art keywords
- layer
- image
- image receiving
- alkali
- alcohol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000000463 material Substances 0.000 title claims description 30
- 238000009792 diffusion process Methods 0.000 title claims description 16
- 229920000642 polymer Polymers 0.000 claims description 31
- 239000003513 alkali Substances 0.000 claims description 20
- 229920002301 cellulose acetate Polymers 0.000 claims description 15
- 239000004372 Polyvinyl alcohol Substances 0.000 claims description 14
- 229920002451 polyvinyl alcohol Polymers 0.000 claims description 14
- 239000000203 mixture Substances 0.000 claims description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 10
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 claims description 9
- 229920002678 cellulose Polymers 0.000 claims description 8
- 239000001913 cellulose Substances 0.000 claims description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 7
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 6
- 230000002378 acidificating effect Effects 0.000 claims description 6
- GAMPNQJDUFQVQO-UHFFFAOYSA-N acetic acid;phthalic acid Chemical compound CC(O)=O.OC(=O)C1=CC=CC=C1C(O)=O GAMPNQJDUFQVQO-UHFFFAOYSA-N 0.000 claims description 5
- 229920002554 vinyl polymer Polymers 0.000 claims description 5
- 239000000020 Nitrocellulose Substances 0.000 claims description 4
- FJWGYAHXMCUOOM-QHOUIDNNSA-N [(2s,3r,4s,5r,6r)-2-[(2r,3r,4s,5r,6s)-4,5-dinitrooxy-2-(nitrooxymethyl)-6-[(2r,3r,4s,5r,6s)-4,5,6-trinitrooxy-2-(nitrooxymethyl)oxan-3-yl]oxyoxan-3-yl]oxy-3,5-dinitrooxy-6-(nitrooxymethyl)oxan-4-yl] nitrate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O)O[C@H]1[C@@H]([C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@@H](CO[N+]([O-])=O)O1)O[N+]([O-])=O)CO[N+](=O)[O-])[C@@H]1[C@@H](CO[N+]([O-])=O)O[C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O FJWGYAHXMCUOOM-QHOUIDNNSA-N 0.000 claims description 4
- 125000004185 ester group Chemical group 0.000 claims description 4
- 229920001220 nitrocellulos Polymers 0.000 claims description 4
- 230000008859 change Effects 0.000 claims description 3
- 239000003814 drug Substances 0.000 claims description 3
- 229940079593 drug Drugs 0.000 claims description 3
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 claims description 3
- 229920002689 polyvinyl acetate Polymers 0.000 claims description 3
- 239000011118 polyvinyl acetate Substances 0.000 claims description 3
- 229920002717 polyvinylpyridine Polymers 0.000 claims description 3
- KFDVPJUYSDEJTH-UHFFFAOYSA-N 4-ethenylpyridine Chemical compound C=CC1=CC=NC=C1 KFDVPJUYSDEJTH-UHFFFAOYSA-N 0.000 claims description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 claims description 2
- 238000009826 distribution Methods 0.000 claims description 2
- 238000000926 separation method Methods 0.000 claims description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 claims 2
- IYKJEILNJZQJPU-UHFFFAOYSA-N acetic acid;butanedioic acid Chemical compound CC(O)=O.OC(=O)CCC(O)=O IYKJEILNJZQJPU-UHFFFAOYSA-N 0.000 claims 1
- 239000011248 coating agent Substances 0.000 claims 1
- 238000000576 coating method Methods 0.000 claims 1
- 239000011521 glass Substances 0.000 claims 1
- 239000007788 liquid Substances 0.000 claims 1
- 239000004408 titanium dioxide Substances 0.000 claims 1
- 239000010410 layer Substances 0.000 description 63
- 239000002253 acid Substances 0.000 description 21
- 239000000975 dye Substances 0.000 description 14
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 9
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 7
- 150000002500 ions Chemical class 0.000 description 7
- 239000000126 substance Substances 0.000 description 7
- 230000008961 swelling Effects 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- 150000002148 esters Chemical class 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 4
- YYXLGGIKSIZHSF-UHFFFAOYSA-N ethene;furan-2,5-dione Chemical compound C=C.O=C1OC(=O)C=C1 YYXLGGIKSIZHSF-UHFFFAOYSA-N 0.000 description 4
- 230000008569 process Effects 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- 229920001577 copolymer Polymers 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- 229920000159 gelatin Polymers 0.000 description 3
- 235000019322 gelatine Nutrition 0.000 description 3
- 230000003647 oxidation Effects 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- 230000009467 reduction Effects 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical group OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 2
- IMROMDMJAWUWLK-UHFFFAOYSA-N Ethenol Chemical compound OC=C IMROMDMJAWUWLK-UHFFFAOYSA-N 0.000 description 2
- 108010010803 Gelatin Proteins 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 150000001241 acetals Chemical class 0.000 description 2
- 229920000615 alginic acid Polymers 0.000 description 2
- 235000010443 alginic acid Nutrition 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical group 0.000 description 2
- 230000001627 detrimental effect Effects 0.000 description 2
- 239000008273 gelatin Substances 0.000 description 2
- 235000011852 gelatine desserts Nutrition 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- BJRNKVDFDLYUGJ-RMPHRYRLSA-N hydroquinone O-beta-D-glucopyranoside Chemical compound O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1OC1=CC=C(O)C=C1 BJRNKVDFDLYUGJ-RMPHRYRLSA-N 0.000 description 2
- 239000011229 interlayer Substances 0.000 description 2
- AJDUTMFFZHIJEM-UHFFFAOYSA-N n-(9,10-dioxoanthracen-1-yl)-4-[4-[[4-[4-[(9,10-dioxoanthracen-1-yl)carbamoyl]phenyl]phenyl]diazenyl]phenyl]benzamide Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2NC(=O)C(C=C1)=CC=C1C(C=C1)=CC=C1N=NC(C=C1)=CC=C1C(C=C1)=CC=C1C(=O)NC1=CC=CC2=C1C(=O)C1=CC=CC=C1C2=O AJDUTMFFZHIJEM-UHFFFAOYSA-N 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 2
- 229920002037 poly(vinyl butyral) polymer Polymers 0.000 description 2
- 238000009877 rendering Methods 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical compound CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 description 2
- 229910052709 silver Inorganic materials 0.000 description 2
- 239000004332 silver Substances 0.000 description 2
- -1 silver halide Chemical class 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 239000001043 yellow dye Substances 0.000 description 2
- MRAKLTZPBIBWFH-ARJAWSKDSA-N (z)-2-ethenylbut-2-enedioic acid Chemical compound OC(=O)\C=C(\C=C)C(O)=O MRAKLTZPBIBWFH-ARJAWSKDSA-N 0.000 description 1
- NCYNKWQXFADUOZ-UHFFFAOYSA-N 1,1-dioxo-2,1$l^{6}-benzoxathiol-3-one Chemical compound C1=CC=C2C(=O)OS(=O)(=O)C2=C1 NCYNKWQXFADUOZ-UHFFFAOYSA-N 0.000 description 1
- GGZHVNZHFYCSEV-UHFFFAOYSA-N 1-Phenyl-5-mercaptotetrazole Chemical compound SC1=NN=NN1C1=CC=CC=C1 GGZHVNZHFYCSEV-UHFFFAOYSA-N 0.000 description 1
- AGBXYHCHUYARJY-UHFFFAOYSA-N 2-phenylethenesulfonic acid Chemical compound OS(=O)(=O)C=CC1=CC=CC=C1 AGBXYHCHUYARJY-UHFFFAOYSA-N 0.000 description 1
- JNRLEMMIVRBKJE-UHFFFAOYSA-N 4,4'-Methylenebis(N,N-dimethylaniline) Chemical compound C1=CC(N(C)C)=CC=C1CC1=CC=C(N(C)C)C=C1 JNRLEMMIVRBKJE-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 239000001828 Gelatine Substances 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- UGZICOVULPINFH-UHFFFAOYSA-N acetic acid;butanoic acid Chemical compound CC(O)=O.CCCC(O)=O UGZICOVULPINFH-UHFFFAOYSA-N 0.000 description 1
- OONCXKMPLHTLBM-UHFFFAOYSA-N acetic acid;pentanedioic acid Chemical compound CC(O)=O.OC(=O)CCCC(O)=O OONCXKMPLHTLBM-UHFFFAOYSA-N 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 238000005054 agglomeration Methods 0.000 description 1
- 230000002776 aggregation Effects 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 229960000271 arbutin Drugs 0.000 description 1
- QVQLCTNNEUAWMS-UHFFFAOYSA-N barium oxide Chemical compound [Ba]=O QVQLCTNNEUAWMS-UHFFFAOYSA-N 0.000 description 1
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 1
- 229910001864 baryta Inorganic materials 0.000 description 1
- 229910052601 baryte Inorganic materials 0.000 description 1
- 239000010428 baryte Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 230000002542 deteriorative effect Effects 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- QELUYTUMUWHWMC-UHFFFAOYSA-N edaravone Chemical compound O=C1CC(C)=NN1C1=CC=CC=C1 QELUYTUMUWHWMC-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- UPBDXRPQPOWRKR-UHFFFAOYSA-N furan-2,5-dione;methoxyethene Chemical compound COC=C.O=C1OC(=O)C=C1 UPBDXRPQPOWRKR-UHFFFAOYSA-N 0.000 description 1
- 239000003292 glue Substances 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 150000002596 lactones Chemical class 0.000 description 1
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical group O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 230000005012 migration Effects 0.000 description 1
- 238000013508 migration Methods 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- BJRNKVDFDLYUGJ-UHFFFAOYSA-N p-hydroxyphenyl beta-D-alloside Natural products OC1C(O)C(O)C(CO)OC1OC1=CC=C(O)C=C1 BJRNKVDFDLYUGJ-UHFFFAOYSA-N 0.000 description 1
- 238000005192 partition Methods 0.000 description 1
- 239000012466 permeate Substances 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-M phthalate(1-) Chemical compound OC(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-M 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 229920002959 polymer blend Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 230000002028 premature Effects 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 239000001047 purple dye Substances 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- QEMXHQIAXOOASZ-UHFFFAOYSA-N tetramethylammonium Chemical compound C[N+](C)(C)C QEMXHQIAXOOASZ-UHFFFAOYSA-N 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C8/00—Diffusion transfer processes or agents therefor; Photosensitive materials for such processes
- G03C8/42—Structural details
- G03C8/52—Bases or auxiliary layers; Substances therefor
- G03C8/56—Mordant layers
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C8/00—Diffusion transfer processes or agents therefor; Photosensitive materials for such processes
- G03C8/42—Structural details
- G03C8/52—Bases or auxiliary layers; Substances therefor
Landscapes
- Engineering & Computer Science (AREA)
- Architecture (AREA)
- Structural Engineering (AREA)
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Thermal Transfer Or Thermal Recording In General (AREA)
- Optical Filters (AREA)
- Ink Jet Recording Methods And Recording Media Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US234864A US3362819A (en) | 1962-11-01 | 1962-11-01 | Color diffusion transfer photographic products and processes utilizing an image receiving element containing a polymeric acid layer |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1285310B true DE1285310B (de) | 1968-12-12 |
Family
ID=22883137
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEJ24647A Pending DE1285310B (de) | 1962-11-01 | 1963-10-29 | Bildempfangsmaterial fuer das Farbstoffentwickler-Diffusionsverfahren |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3362819A (forum.php) |
| JP (2) | JPS4926896B1 (forum.php) |
| BE (1) | BE639452A (forum.php) |
| BR (1) | BR6354115D0 (forum.php) |
| CH (1) | CH433010A (forum.php) |
| DE (1) | DE1285310B (forum.php) |
| FR (1) | FR1380778A (forum.php) |
| GB (2) | GB1071088A (forum.php) |
| NL (1) | NL140993B (forum.php) |
| SE (1) | SE321854B (forum.php) |
Families Citing this family (49)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3485628A (en) * | 1965-07-13 | 1969-12-23 | Polaroid Corp | Multicolor diffusion transfer process employing a minimum amount of a processing composition |
| US3445228A (en) * | 1966-06-14 | 1969-05-20 | Eastman Kodak Co | Dye diffusion transfer process and element |
| US3433633A (en) * | 1967-03-15 | 1969-03-18 | Polaroid Corp | Photographic products and processes |
| US3498785A (en) * | 1967-07-24 | 1970-03-03 | Polaroid Corp | Novel photographic products and processes |
| US3443939A (en) * | 1967-07-24 | 1969-05-13 | Polaroid Corp | Differential mobility of color moiety in color transfer |
| US3455686A (en) * | 1967-08-30 | 1969-07-15 | Polaroid Corp | Diffusion transfer image receiving element whose alkali diffusion flow rate varies inversely with the temperature |
| GB1269805A (en) * | 1968-05-13 | 1972-04-06 | Polaroid Corp | Photographic silver halide products and diffusion transfer processes |
| BE743336A (forum.php) * | 1968-12-23 | 1970-06-18 | ||
| US3647437A (en) * | 1970-12-18 | 1972-03-07 | Polaroid Corp | Photographic products, processes and compositions |
| DE2123456C2 (de) * | 1971-05-12 | 1982-04-08 | Agfa-Gevaert Ag, 5090 Leverkusen | Lichtempfindliches, farbphotographisches Aufzeichnungsmaterial |
| BE788926A (fr) * | 1971-09-16 | 1973-03-15 | Eastman Kodak Co | Nouveau produit photographique stable en conservation |
| US3765885A (en) * | 1972-01-03 | 1973-10-16 | Polaroid Corp | Neutralizing layer for color diffusion transfer film |
| NL179317C (nl) * | 1972-06-13 | 1986-08-18 | Polaroid Corp | Fotografische filmeenheid voor het vormen van een kleurdiffusieoverdrachtsbeeld. |
| DE2601653A1 (de) * | 1976-01-17 | 1977-07-21 | Agfa Gevaert Ag | Bremsschicht zur verzoegerung der diffusion von hydroxylionen bei dem farbdiffusionsuebertragungsverfahren |
| US4028103A (en) * | 1976-04-12 | 1977-06-07 | Eastman Kodak Company | Processing compositions for color transfer processes comprising alkali metal fluorides and oxalates |
| US4030920A (en) * | 1976-04-12 | 1977-06-21 | Eastman Kodak Company | Processing compositions containing glycols for color transfer processes comprising direct positive silver halide developement |
| US4179538A (en) * | 1976-09-10 | 1979-12-18 | Eastman Kodak Company | Process of eliminating cracking in the coating of TiO2 layers |
| US4297431A (en) * | 1978-09-15 | 1981-10-27 | Polaroid Corporation | Diffusion control layers in diffusion transfer photographic products |
| US4201587A (en) * | 1978-09-15 | 1980-05-06 | Polaroid Corporation | Graft copolymers as diffusion control layers in photographic diffusion transfer products |
| DE2910271A1 (de) * | 1979-03-15 | 1980-09-25 | Polaroid Corp | Pfropfpolymere als schichten zur steuerung der diffusion in photographischen produkten |
| DE2910270A1 (de) * | 1979-03-15 | 1980-09-25 | Polaroid Corp | Pfropfpolymere als schicht zur steuerung der diffusion in photographischen produkten |
| US4426481A (en) | 1980-03-14 | 1984-01-17 | Polaroid Corporation | Polymeric matrix containing β-eliminating polymer and process for preparing same |
| US4288523A (en) * | 1980-03-14 | 1981-09-08 | Polaroid Corporation | Diffusion control layers in diffusion transfer photographic products |
| US4546159A (en) * | 1980-03-14 | 1985-10-08 | Polaroid Corporation | Eliminating polymers useful in diffusion control layers |
| US4357392A (en) * | 1980-08-04 | 1982-11-02 | Eastman Kodak Company | Coversheet for color transfer assemblages |
| US4357409A (en) * | 1980-11-20 | 1982-11-02 | Eastman Kodak Company | Sulfo-containing adhesive compositions and self-processing photographic products containing same |
| US4357408A (en) * | 1980-11-20 | 1982-11-02 | Eastman Kodak Company | Acidic adhesive compositions and self-processing photographic products containing same |
| US4415648A (en) * | 1981-02-17 | 1983-11-15 | Polaroid Corporation | Variable density photographic transparencies |
| US4359517A (en) * | 1981-04-30 | 1982-11-16 | Polaroid Corporation | Diffusion transfer products with two timing layers for production of transparencies |
| US4395477A (en) * | 1982-01-21 | 1983-07-26 | Eastman Kodak Company | Neutralizing-timing layer for color transfer assemblages containing lactone polymer |
| US4423141A (en) * | 1982-01-21 | 1983-12-27 | Eastman Kodak Company | Carboxy-ester lactone polymer neutralizing-timing layer for color transfer assemblages |
| US4865946A (en) * | 1983-03-28 | 1989-09-12 | Eastman Kodak Company | Temporary barrier layer for photographic element |
| JPS59188644A (ja) * | 1983-04-09 | 1984-10-26 | Fuji Photo Film Co Ltd | 画像形成方法 |
| US4504569A (en) * | 1983-08-26 | 1985-03-12 | Eastman Kodak Company | Photographic material with a temporary barrier layer comprising a chill-gelable polymer |
| US4775613A (en) | 1985-03-30 | 1988-10-04 | Fuji Photo Film Co., Ltd. | Heat-developable light-sensitive material |
| JPS61250636A (ja) | 1985-04-30 | 1986-11-07 | Fuji Photo Film Co Ltd | 熱現像感光材料 |
| JPH083621B2 (ja) | 1985-07-31 | 1996-01-17 | 富士写真フイルム株式会社 | 画像形成方法 |
| US4653775A (en) * | 1985-10-21 | 1987-03-31 | Polaroid Corporation, Patent Dept. | Preprinted image-receiving elements for laminated documents |
| JPH0693110B2 (ja) * | 1986-12-29 | 1994-11-16 | 富士写真フイルム株式会社 | カラ−拡散転写法用写真要素 |
| JPH0693111B2 (ja) * | 1986-12-29 | 1994-11-16 | 富士写真フイルム株式会社 | カラ−拡散転写法用写真要素 |
| US4873171A (en) * | 1988-05-02 | 1989-10-10 | Polaroid Corporation | Image-receiving element for diffusion transfer photographic product |
| JP2597908B2 (ja) | 1989-04-25 | 1997-04-09 | 富士写真フイルム株式会社 | ハロゲン化銀カラー写真感光材料 |
| JP2643538B2 (ja) * | 1989-06-02 | 1997-08-20 | 富士写真フイルム株式会社 | 自己処理写真フイルムユニット |
| US5336761A (en) | 1991-03-05 | 1994-08-09 | Fuji Photo Film Co., Ltd. | Heat-developable diffusion transfer color photographic material |
| US5177262A (en) * | 1991-07-19 | 1993-01-05 | Polaroid Corporation | Process and composition for use in photographic materials containing hydroquinones |
| US5593810A (en) * | 1996-05-14 | 1997-01-14 | Polaroid Corporation | Diffusion transfer film unit |
| EP1299246A4 (en) | 2000-07-07 | 2004-05-26 | Polaroid Corp | SIMPLIFIED SELF-DEVELOPED FILM ASSEMBLIES AND METHODS OF MAKING |
| US6579656B2 (en) * | 2001-06-29 | 2003-06-17 | Polaroid Corporation | Half esters of isobutylene/maleic anhydride copolymer as attenuators of photographic film development |
| US6565271B1 (en) * | 2002-09-20 | 2003-05-20 | Polaroid Corporation | Self-developing film assemblages |
Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2567750A (en) * | 1945-10-25 | 1951-09-11 | Du Pont | Light sensitive elements for color photography |
| US2635048A (en) * | 1948-07-06 | 1953-04-14 | Polaroid Corp | Photographic transfer product and process |
| US2983606A (en) * | 1958-07-14 | 1961-05-09 | Polaroid Corp | Processes and products for forming photographic images in color |
| DE1155334B (de) * | 1960-10-20 | 1963-10-03 | Gevaert Photo Prod Nv | Silbersalzdiffusionsuebertragungsverfahren und Material hierfuer |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA576590A (en) * | 1959-05-26 | R. Blout Elkan | Processes for developing and forming photographic images | |
| BE607422A (forum.php) * | ||||
| CA620571A (en) * | 1961-05-23 | Polaroid Corporation | Process of forming photographic images in color | |
| US2607685A (en) * | 1946-10-03 | 1952-08-19 | Polaroid Corp | Photographic product comprising a plurality of rupturable containers, each carrying a liquid for processing said product |
| US2661293A (en) * | 1946-10-08 | 1953-12-01 | Polaroid Corp | Process of producing a colored photographic image by means of exhaustion of developer |
| US2584030A (en) * | 1947-02-07 | 1952-01-29 | Polaroid Corp | Light sensitive silver halide photographic product for image transfer and process utilizing the same |
| US2923623A (en) * | 1955-03-14 | 1960-02-02 | Polaroid Corp | Photographic process and product |
| BE578578A (forum.php) * | 1958-05-12 | |||
| NL122760C (forum.php) * | 1960-08-22 | |||
| JPS4926896A (forum.php) * | 1972-07-07 | 1974-03-09 |
-
1962
- 1962-11-01 US US234864A patent/US3362819A/en not_active Expired - Lifetime
-
1963
- 1963-10-18 GB GB1536/67A patent/GB1071088A/en not_active Expired
- 1963-10-18 GB GB41273/63A patent/GB1071086A/en not_active Expired
- 1963-10-23 NL NL63299627A patent/NL140993B/xx not_active IP Right Cessation
- 1963-10-29 BR BR154115/63A patent/BR6354115D0/pt unknown
- 1963-10-29 SE SE11880/63A patent/SE321854B/xx unknown
- 1963-10-29 DE DEJ24647A patent/DE1285310B/de active Pending
- 1963-10-30 FR FR952330D patent/FR1380778A/fr not_active Expired
- 1963-10-31 JP JP38058205A patent/JPS4926896B1/ja active Pending
- 1963-10-31 CH CH1340063A patent/CH433010A/de unknown
- 1963-10-31 BE BE639452A patent/BE639452A/xx unknown
-
1973
- 1973-08-23 JP JP9394973A patent/JPS5512585B1/ja active Pending
Patent Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2567750A (en) * | 1945-10-25 | 1951-09-11 | Du Pont | Light sensitive elements for color photography |
| US2635048A (en) * | 1948-07-06 | 1953-04-14 | Polaroid Corp | Photographic transfer product and process |
| US2983606A (en) * | 1958-07-14 | 1961-05-09 | Polaroid Corp | Processes and products for forming photographic images in color |
| DE1155334B (de) * | 1960-10-20 | 1963-10-03 | Gevaert Photo Prod Nv | Silbersalzdiffusionsuebertragungsverfahren und Material hierfuer |
Also Published As
| Publication number | Publication date |
|---|---|
| BE639452A (forum.php) | 1964-04-30 |
| JPS5512585B1 (forum.php) | 1980-04-02 |
| CH433010A (de) | 1967-03-31 |
| US3362819A (en) | 1968-01-09 |
| FR1380778A (fr) | 1964-12-04 |
| NL299627A (forum.php) | 1965-08-25 |
| GB1071086A (en) | 1967-06-07 |
| JPS4926896B1 (forum.php) | 1974-07-12 |
| GB1071088A (en) | 1967-06-07 |
| BR6354115D0 (pt) | 1973-07-17 |
| NL140993B (nl) | 1974-01-15 |
| SE321854B (forum.php) | 1970-03-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1285310B (de) | Bildempfangsmaterial fuer das Farbstoffentwickler-Diffusionsverfahren | |
| DE1191689B (de) | Lichtempfindliches photographisches Material fuer Diffusionsuebertragungsfarbverfahren | |
| CH616008A5 (forum.php) | ||
| DE2137559C2 (de) | Bildempfangsmaterial für photographische Farbdiffusionsübertragungsverfahren | |
| DE2049688A1 (de) | Fotografisches Farbstoffdiffusions-übertragungsverfahren | |
| DE1926549A1 (de) | Lichtempfindliches fotografisches Material | |
| DE1138630B (de) | Verfahren zur Herstellung von ein- oder mehrfarbigen UEbertragungsbildern mit Hilfe von Farbstoffentwicklersubstanzen | |
| DE1936708C3 (de) | Lichtempfindliches fotografisches Aufzeichnungsmaterial für Farbdiffusionsübertragungsverfahren | |
| DE2127144A1 (de) | Fotografisches Aufzeichnungsmaterial | |
| DE2364740A1 (de) | Lichtempfindliches fotografisches aufzeichnungsmaterial fuer das diffusionsuebertragungsverfahren | |
| DE2319489A1 (de) | Photographische entwicklungs- oder behandlungsmasse, insbesondere fuer das diffusionsuebertragungsverfahren | |
| DE1547806A1 (de) | Farbdiffusionsuebertragungsverfahren | |
| EP0017025B1 (de) | Fotografische Filmeinheit zur Herstellung farbiger Übertragsbilder | |
| DE2652464A1 (de) | Fotografische filmeinheit zur herstellung farbiger uebertragsbilder | |
| DE2263014C2 (de) | Farbphotographisches Diffusionsübertragungsverfahren und Entwicklerflüssigkeit | |
| DE2058545A1 (de) | Photographisches Aufzeichnungsmaterial fuer mehrfarbige Bilder | |
| DE2218181A1 (de) | Lichtempfindliches fotografisches Material | |
| DE1191688B (de) | Fuer Diffusionsuebertragungsfarbverfahren geeignetes photographisches Material | |
| EP0031957B1 (de) | Fotografisches Material mit einer aus organischer Lösung aufgetragenen temporären Sperrschicht | |
| DE1597537B1 (de) | Farbphotographisches Aufzeichnungsmaterial fuer das Diffusionsuebertragungsverfahren | |
| DE2364137C2 (de) | Photographisches Aufzeichnungsmaterial für das Farbdiffusionsübertragungsverfahren | |
| DE1964534A1 (de) | Photographisches Aufzeichnungsmaterial | |
| DE2729819B2 (de) | Photographisches Aufzeichnungsmaterial für das Diffusionsübertragungsverfahren | |
| DE2064884A1 (de) | Lichtempfindliches fotografisches Aufzeichnungsmaterial für Diffusions-übertragungsverfahren. Ausscheidung aus: 2038260 | |
| DE2037931C3 (de) | Lichtempfindliches fotografisches Aufzeichnungsmaterial fur Farbdiffusions übertragungsverfahren Jim Polaroid Corp , Cambridge, Mass (V St A) |