DE1282592B - Optische Aufhellungsmittel - Google Patents
Optische AufhellungsmittelInfo
- Publication number
- DE1282592B DE1282592B DEF42743A DEF0042743A DE1282592B DE 1282592 B DE1282592 B DE 1282592B DE F42743 A DEF42743 A DE F42743A DE F0042743 A DEF0042743 A DE F0042743A DE 1282592 B DE1282592 B DE 1282592B
- Authority
- DE
- Germany
- Prior art keywords
- parts
- weight
- amino
- volume
- compounds
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 230000003287 optical effect Effects 0.000 title claims description 5
- 239000003795 chemical substances by application Substances 0.000 claims description 9
- BCMCBBGGLRIHSE-UHFFFAOYSA-N 1,3-benzoxazole Chemical class C1=CC=C2OC=NC2=C1 BCMCBBGGLRIHSE-UHFFFAOYSA-N 0.000 claims description 6
- 238000005282 brightening Methods 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 150000001875 compounds Chemical class 0.000 description 12
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- PBKONEOXTCPAFI-UHFFFAOYSA-N 1,2,4-trichlorobenzene Chemical compound ClC1=CC=C(Cl)C(Cl)=C1 PBKONEOXTCPAFI-UHFFFAOYSA-N 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 238000002844 melting Methods 0.000 description 8
- 230000008018 melting Effects 0.000 description 8
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 7
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical class NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 description 6
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 6
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 239000004952 Polyamide Substances 0.000 description 4
- 239000002202 Polyethylene glycol Substances 0.000 description 4
- 229920002647 polyamide Polymers 0.000 description 4
- 229920001223 polyethylene glycol Polymers 0.000 description 4
- -1 polyhexamethylene Polymers 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 229920002994 synthetic fiber Polymers 0.000 description 4
- FKLJPTJMIBLJAV-UHFFFAOYSA-N Compound IV Chemical compound O1N=C(C)C=C1CCCCCCCOC1=CC=C(C=2OCCN=2)C=C1 FKLJPTJMIBLJAV-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 238000006116 polymerization reaction Methods 0.000 description 3
- 238000009987 spinning Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- KKEYFWRCBNTPAC-UHFFFAOYSA-L terephthalate(2-) Chemical compound [O-]C(=O)C1=CC=C(C([O-])=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-L 0.000 description 3
- 235000005074 zinc chloride Nutrition 0.000 description 3
- 239000011592 zinc chloride Substances 0.000 description 3
- RELMFMZEBKVZJC-UHFFFAOYSA-N 1,2,3-trichlorobenzene Chemical compound ClC1=CC=CC(Cl)=C1Cl RELMFMZEBKVZJC-UHFFFAOYSA-N 0.000 description 2
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 2
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 239000004743 Polypropylene Substances 0.000 description 2
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000007844 bleaching agent Substances 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 229920000728 polyester Polymers 0.000 description 2
- 229920000137 polyphosphoric acid Polymers 0.000 description 2
- 229920001155 polypropylene Polymers 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 238000006798 ring closing metathesis reaction Methods 0.000 description 2
- 238000001256 steam distillation Methods 0.000 description 2
- 239000004753 textile Substances 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 150000000183 1,3-benzoxazoles Chemical class 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- JEASLLCHQHBBGM-UHFFFAOYSA-N 2-amino-4,5-dimethylphenol Chemical compound CC1=CC(N)=C(O)C=C1C JEASLLCHQHBBGM-UHFFFAOYSA-N 0.000 description 1
- RPJUVNYXHUCRMG-UHFFFAOYSA-N 2-amino-4-tert-butylphenol Chemical compound CC(C)(C)C1=CC=C(O)C(N)=C1 RPJUVNYXHUCRMG-UHFFFAOYSA-N 0.000 description 1
- ALQKEYVDQYGZDN-UHFFFAOYSA-N 2-amino-6-methylphenol Chemical compound CC1=CC=CC(N)=C1O ALQKEYVDQYGZDN-UHFFFAOYSA-N 0.000 description 1
- QHPQWRBYOIRBIT-UHFFFAOYSA-N 4-tert-butylphenol Chemical compound CC(C)(C)C1=CC=C(O)C=C1 QHPQWRBYOIRBIT-UHFFFAOYSA-N 0.000 description 1
- 101100515517 Arabidopsis thaliana XI-I gene Proteins 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 1
- 229920002292 Nylon 6 Polymers 0.000 description 1
- 241000092161 Pithys Species 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- ZRSKSQHEOZFGLJ-UHFFFAOYSA-N ammonium adipate Chemical compound [NH4+].[NH4+].[O-]C(=O)CCCCC([O-])=O ZRSKSQHEOZFGLJ-UHFFFAOYSA-N 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 125000003943 azolyl group Chemical group 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 239000012496 blank sample Substances 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000002657 fibrous material Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N hydrochloric acid Substances Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- VIUHYPPHBQZSPF-UHFFFAOYSA-N naphthalene-1,4-dicarbonyl chloride Chemical compound C1=CC=C2C(C(=O)Cl)=CC=C(C(Cl)=O)C2=C1 VIUHYPPHBQZSPF-UHFFFAOYSA-N 0.000 description 1
- BJVRGBKOBQZKBD-UHFFFAOYSA-N naphthalene-1,4-dicarboxamide Chemical class C1=CC=C2C(C(=O)N)=CC=C(C(N)=O)C2=C1 BJVRGBKOBQZKBD-UHFFFAOYSA-N 0.000 description 1
- ABMFBCRYHDZLRD-UHFFFAOYSA-N naphthalene-1,4-dicarboxylic acid Chemical compound C1=CC=C2C(C(=O)O)=CC=C(C(O)=O)C2=C1 ABMFBCRYHDZLRD-UHFFFAOYSA-N 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 description 1
- 229920002239 polyacrylonitrile Polymers 0.000 description 1
- 238000006068 polycondensation reaction Methods 0.000 description 1
- 229920006149 polyester-amide block copolymer Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 230000002829 reductive effect Effects 0.000 description 1
- 238000007493 shaping process Methods 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 239000012209 synthetic fiber Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 230000002087 whitening effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/52—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings condensed with carbocyclic rings or ring systems
- C07D263/62—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings condensed with carbocyclic rings or ring systems having two or more ring systems containing condensed 1,3-oxazole rings
- C07D263/64—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings condensed with carbocyclic rings or ring systems having two or more ring systems containing condensed 1,3-oxazole rings linked in positions 2 and 2' by chains containing six-membered aromatic rings or ring systems containing such rings
-
- D—TEXTILES; PAPER
- D06—TREATMENT OF TEXTILES OR THE LIKE; LAUNDERING; FLEXIBLE MATERIALS NOT OTHERWISE PROVIDED FOR
- D06L—DRY-CLEANING, WASHING OR BLEACHING FIBRES, FILAMENTS, THREADS, YARNS, FABRICS, FEATHERS OR MADE-UP FIBROUS GOODS; BLEACHING LEATHER OR FURS
- D06L4/00—Bleaching fibres, filaments, threads, yarns, fabrics, feathers or made-up fibrous goods; Bleaching leather or furs
- D06L4/60—Optical bleaching or brightening
- D06L4/614—Optical bleaching or brightening in aqueous solvents
- D06L4/636—Optical bleaching or brightening in aqueous solvents with disperse brighteners
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Textile Engineering (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Priority Applications (14)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL131195D NL131195C (enExample) | 1964-04-29 | ||
| BE663227D BE663227A (enExample) | 1964-04-29 | ||
| DEF42743A DE1282592B (de) | 1964-04-29 | 1964-04-29 | Optische Aufhellungsmittel |
| DEF44817A DE1301791B (de) | 1964-04-29 | 1964-12-28 | Optische Aufhellungsmittel |
| US451040A US3336330A (en) | 1964-04-29 | 1965-04-26 | Certain dibenzoxazolylnaphthalene compounds |
| CH1780168A CH476796A (de) | 1964-04-29 | 1965-04-27 | Verfahren zum optischen Aufhellen von nichttextilen synthetischen Materialien |
| CH577465A CH476147A (de) | 1964-04-29 | 1965-04-27 | Verfahren zum optischen Aufhellen von synthetischen textilen Materialien und nach dem Verfahren optisch aufgehellte Materialien |
| AT386665A AT273032B (de) | 1964-04-29 | 1965-04-27 | Verfahren zum optischen Aufhellen von geformten Gebilden aus Kunststoffen |
| AT263768A AT273106B (de) | 1964-04-29 | 1965-04-27 | Verfahren zur Herstellung von neuen Benzoxazolverbindungen |
| DK215965AA DK114755B (da) | 1964-04-29 | 1965-04-28 | Fremgangsmåde til optisk klaring af syntetiske materialer samt optisk klaringsmiddel til anvendelse ved fremgangsmåden. |
| GB18089/65A GB1059687A (en) | 1964-04-29 | 1965-04-29 | Optical brighteners |
| NL6505474A NL6505474A (enExample) | 1964-04-29 | 1965-04-29 | |
| FR15090A FR1444004A (fr) | 1964-04-29 | 1965-04-29 | Nouveaux dérivés benzoxazoliques et leur utilisation comme azurants optiques |
| DK249969AA DK124548B (da) | 1964-04-29 | 1969-05-07 | Som optiske klaringsmidler virksomme benzoxazolforbindelser. |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF42743A DE1282592B (de) | 1964-04-29 | 1964-04-29 | Optische Aufhellungsmittel |
| DEF44817A DE1301791B (de) | 1964-04-29 | 1964-12-28 | Optische Aufhellungsmittel |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1282592B true DE1282592B (de) | 1968-11-14 |
Family
ID=25976244
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEF42743A Pending DE1282592B (de) | 1964-04-29 | 1964-04-29 | Optische Aufhellungsmittel |
| DEF44817A Pending DE1301791B (de) | 1964-04-29 | 1964-12-28 | Optische Aufhellungsmittel |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEF44817A Pending DE1301791B (de) | 1964-04-29 | 1964-12-28 | Optische Aufhellungsmittel |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3336330A (enExample) |
| AT (1) | AT273032B (enExample) |
| BE (1) | BE663227A (enExample) |
| CH (2) | CH476796A (enExample) |
| DE (2) | DE1282592B (enExample) |
| DK (2) | DK114755B (enExample) |
| GB (1) | GB1059687A (enExample) |
| NL (2) | NL6505474A (enExample) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0002030A1 (de) * | 1977-11-15 | 1979-05-30 | Hoechst Aktiengesellschaft | Neue fluorhaltige Benz-azol-Derivate, Verfahren zu ihrer Herstellung und ihre Verwendung als optische Aufheller |
| US5106989A (en) * | 1988-10-20 | 1992-04-21 | Mitsubishi Paper Mills Limited | Alkyl-substituted 2,2'-(1,4-naphthalenediyl)dibenzoxazole and photographic support comprising the same |
| US5213888A (en) * | 1988-10-20 | 1993-05-25 | Mitsubishi Paper Mills Limited | Alkyl-substituted 2,2'-(1,4-naphthalenediyl)dibenzoxazole and photographic support comprising the same |
| US5785766A (en) * | 1996-03-01 | 1998-07-28 | Davis; Ronald O. | Process for the color recovery of vinyl plastics |
| US6121221A (en) * | 1999-07-26 | 2000-09-19 | Ronald O. Davis | Kit for cleaning vinyl plastics |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3499762A (en) * | 1966-11-03 | 1970-03-10 | Eastman Kodak Co | Photographic elements comprising novel u.v.-absorbing optical brightening agents |
| US3684764A (en) * | 1970-04-13 | 1972-08-15 | Bennett George Buell | Brightening polyvinyl chloride and polyolefin plastics with 2-naphthylnaphthoxazoles |
| US3660125A (en) * | 1970-04-13 | 1972-05-02 | American Cyanamid Co | Brightening plastics with 2-aryl-5-cyanonaphthoxazole brighteners |
| US4058408A (en) | 1971-08-10 | 1977-11-15 | Ciba-Geigy Corporation | Bis-benzoxazolyl-naphthalenes as optical brighteners |
| CH617809GA3 (enExample) * | 1975-10-10 | 1980-06-30 | ||
| US4110246A (en) * | 1976-05-13 | 1978-08-29 | Hoechst Aktiengesellschaft | Mixture of benzoxazole derivatives |
| DE3027479A1 (de) * | 1980-07-19 | 1982-03-04 | Hoechst Ag, 6000 Frankfurt | Mischungen von optischen aufhellern und deren verwendung |
| US5518656A (en) * | 1993-12-27 | 1996-05-21 | Nippon Chemical Works Co., Ltd. | Fluorescent detecting agents |
| US20080064621A1 (en) * | 2006-09-07 | 2008-03-13 | Daniel Alan Jervis | Optically brightened aqueous compositions |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB824659A (en) * | 1955-02-15 | 1959-12-02 | Ciba Ltd | Process for the optical brightening of fibres of polyacrylonitrile |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH333182A (de) * | 1955-02-15 | 1958-11-29 | Ciba Geigy | Verwendung von Di-imidazolen zum optischen Aufhellen von Materialien aus Acrylnitrilpolymerisaten |
| AT196343B (de) * | 1955-12-20 | 1958-03-10 | Ciba Geigy | Verfahren zum optischen Aufhellen von synthetischen Fasern |
| US2985661A (en) * | 1956-02-06 | 1961-05-23 | American Cyanamid Co | Preparation of 2(omicron-aminophenyl)-benzimidazole |
| NL277287A (enExample) * | 1958-09-02 | |||
| NL126593C (enExample) * | 1961-01-19 | |||
| US3137655A (en) * | 1961-03-21 | 1964-06-16 | Glanzstoff Ag | Optical brightening |
| US3250780A (en) * | 1962-05-21 | 1966-05-10 | Union Oil Co | Bis-benzoxazolythyl sulfide |
-
0
- NL NL131195D patent/NL131195C/xx active
- BE BE663227D patent/BE663227A/xx unknown
-
1964
- 1964-04-29 DE DEF42743A patent/DE1282592B/de active Pending
- 1964-12-28 DE DEF44817A patent/DE1301791B/de active Pending
-
1965
- 1965-04-26 US US451040A patent/US3336330A/en not_active Expired - Lifetime
- 1965-04-27 CH CH1780168A patent/CH476796A/de not_active IP Right Cessation
- 1965-04-27 AT AT386665A patent/AT273032B/de active
- 1965-04-27 CH CH577465A patent/CH476147A/de not_active IP Right Cessation
- 1965-04-28 DK DK215965AA patent/DK114755B/da unknown
- 1965-04-29 NL NL6505474A patent/NL6505474A/xx unknown
- 1965-04-29 GB GB18089/65A patent/GB1059687A/en not_active Expired
-
1969
- 1969-05-07 DK DK249969AA patent/DK124548B/da unknown
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB824659A (en) * | 1955-02-15 | 1959-12-02 | Ciba Ltd | Process for the optical brightening of fibres of polyacrylonitrile |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0002030A1 (de) * | 1977-11-15 | 1979-05-30 | Hoechst Aktiengesellschaft | Neue fluorhaltige Benz-azol-Derivate, Verfahren zu ihrer Herstellung und ihre Verwendung als optische Aufheller |
| US5106989A (en) * | 1988-10-20 | 1992-04-21 | Mitsubishi Paper Mills Limited | Alkyl-substituted 2,2'-(1,4-naphthalenediyl)dibenzoxazole and photographic support comprising the same |
| US5213888A (en) * | 1988-10-20 | 1993-05-25 | Mitsubishi Paper Mills Limited | Alkyl-substituted 2,2'-(1,4-naphthalenediyl)dibenzoxazole and photographic support comprising the same |
| US5785766A (en) * | 1996-03-01 | 1998-07-28 | Davis; Ronald O. | Process for the color recovery of vinyl plastics |
| US6121221A (en) * | 1999-07-26 | 2000-09-19 | Ronald O. Davis | Kit for cleaning vinyl plastics |
Also Published As
| Publication number | Publication date |
|---|---|
| GB1059687A (en) | 1967-02-22 |
| CH476796A (de) | 1969-08-15 |
| BE663227A (enExample) | |
| NL6505474A (enExample) | 1965-11-01 |
| DE1301791B (de) | 1969-08-28 |
| NL131195C (enExample) | |
| DK114755B (da) | 1969-08-04 |
| US3336330A (en) | 1967-08-15 |
| CH476147A (de) | 1969-09-15 |
| CH577465A4 (enExample) | 1969-04-15 |
| DK124548B (da) | 1972-10-30 |
| AT273032B (de) | 1969-07-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2262633B2 (de) | Sulfogruppen und v-Triazolylreste enthaltende 4,4'-Divinyldiphenyl-Verbindungen und deren Salze | |
| DE1469206A1 (de) | Neue Bis-Oxazole,Verfahren zu deren Herstellung und Verwendung | |
| DE1282592B (de) | Optische Aufhellungsmittel | |
| DE1294923B (de) | Optische Aufhellmittel | |
| DE2704825B2 (de) | Fluoreszenzfarbstoffe, Verfahren zu deren Herstellung und deren Verwendung zum Weißtönen organischer Materialien | |
| DE1594822B1 (de) | Optische Aufhellmittel | |
| DE1469207A1 (de) | Neue Bis-oxazolyl-stilbenverbindungen,Verfahren zu deren Herstellung und Verwendung | |
| EP0027897A1 (de) | Quaternierte, verbrückte Benzimidazolyl-benzimidazole, Verfahren zu deren Herstellung und deren Verwendung | |
| DE2645301A1 (de) | 1,4-bis- eckige klammer auf azolyl- (2') eckige klammer zu -naphthaline | |
| DE1294917B (de) | Optisches Aufhellmittel | |
| DE2247791C2 (de) | Alkylbenzoxazolylstilbenderivate | |
| DE1805371C3 (de) | Bis-v-triazol-sryrolderivate, Verfahren zu deren Herstellung sowie deren Anwendung als optische Aufheller | |
| DE1470242C3 (de) | 7-Arenotriazolyl-3-phenyl-cumarine, deren Herstellung und Verwendung | |
| CH477501A (de) | Verfahren zur Aufhellung von nichttextilem Polymermaterial mittels Dibenzazolylstilbenverbindungen | |
| DE2852531A1 (de) | Benzofuranyl-benzimidazole | |
| DE1695121A1 (de) | v-Triazolyl-cumarine | |
| DE1794386C3 (de) | Verwendung von Bis-stilben-Verbindungen als optische Aufhellmittel | |
| DE2332089C2 (de) | 2,7-Distyryl-dibenzofurane und deren Verwendung | |
| DE3617451A1 (de) | Sulfonat- oder sulfonamidgruppen-haltige bis-benzoxazolylnaphthaline, verfahren zu deren herstellung und deren verwendung | |
| EP0005465A1 (de) | Benzofuranyl-benzimidazole, Verfahren zu ihrer Herstellung sowie ihre Verwendung zum optischen Aufhellen von organischen Materialien | |
| DE1594822C (de) | Optische Aufhellmittel | |
| DE1238431B (de) | Optische Aufhellmittel | |
| DE2213839A1 (de) | 2-Stilbenyl-4-styryl-v-triazole, deren Verwendung zum optischen Aufhellen von organischen Materialien und Verfahren zu deren Herstellung | |
| DE1297066B (de) | Optisches Aufhellen | |
| DE1445694B2 (de) | 4,4'-bis-(benzoxazolyl-(2))-stilbenverbindungen und verfahren zu deren herstellung |