DE1279872B - Leuchtstoff auf der Basis von Oxychalcogeniden des Lanthans und Lutetiums - Google Patents
Leuchtstoff auf der Basis von Oxychalcogeniden des Lanthans und LutetiumsInfo
- Publication number
- DE1279872B DE1279872B DE1966R0042881 DER0042881A DE1279872B DE 1279872 B DE1279872 B DE 1279872B DE 1966R0042881 DE1966R0042881 DE 1966R0042881 DE R0042881 A DER0042881 A DE R0042881A DE 1279872 B DE1279872 B DE 1279872B
- Authority
- DE
- Germany
- Prior art keywords
- lanthanum
- phosphors
- phosphor
- oxide
- lutetium
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 229910052746 lanthanum Inorganic materials 0.000 title claims description 8
- FZLIPJUXYLNCLC-UHFFFAOYSA-N lanthanum atom Chemical compound [La] FZLIPJUXYLNCLC-UHFFFAOYSA-N 0.000 title claims description 8
- OHSVLFRHMCKCQY-UHFFFAOYSA-N lutetium atom Chemical compound [Lu] OHSVLFRHMCKCQY-UHFFFAOYSA-N 0.000 title claims description 5
- 229910052765 Lutetium Inorganic materials 0.000 title claims description 4
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 title description 15
- 229910052772 Samarium Inorganic materials 0.000 claims description 6
- 229910052692 Dysprosium Inorganic materials 0.000 claims description 4
- 229910052693 Europium Inorganic materials 0.000 claims description 4
- 229910052691 Erbium Inorganic materials 0.000 claims description 3
- 229910052779 Neodymium Inorganic materials 0.000 claims description 3
- 229910052777 Praseodymium Inorganic materials 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 239000000126 substance Substances 0.000 claims description 3
- 229910052717 sulfur Inorganic materials 0.000 claims description 3
- 229910052689 Holmium Inorganic materials 0.000 claims description 2
- 229910052771 Terbium Inorganic materials 0.000 claims description 2
- 229910052775 Thulium Inorganic materials 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 229910052711 selenium Inorganic materials 0.000 claims description 2
- 229910052714 tellurium Inorganic materials 0.000 claims description 2
- 230000005855 radiation Effects 0.000 description 17
- 239000012190 activator Substances 0.000 description 11
- MRELNEQAGSRDBK-UHFFFAOYSA-N lanthanum(3+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[La+3].[La+3] MRELNEQAGSRDBK-UHFFFAOYSA-N 0.000 description 10
- 239000000203 mixture Substances 0.000 description 10
- 239000000047 product Substances 0.000 description 9
- 239000000843 powder Substances 0.000 description 7
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 6
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 6
- 239000000463 material Substances 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- 150000003891 oxalate salts Chemical class 0.000 description 4
- 230000003595 spectral effect Effects 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- KZUNJOHGWZRPMI-UHFFFAOYSA-N samarium atom Chemical compound [Sm] KZUNJOHGWZRPMI-UHFFFAOYSA-N 0.000 description 3
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 3
- 230000007704 transition Effects 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- 238000010894 electron beam technology Methods 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- PLDDOISOJJCEMH-UHFFFAOYSA-N neodymium(3+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Nd+3].[Nd+3] PLDDOISOJJCEMH-UHFFFAOYSA-N 0.000 description 2
- 150000002823 nitrates Chemical class 0.000 description 2
- 235000006408 oxalic acid Nutrition 0.000 description 2
- -1 rare earth activated lanthanum oxide Chemical class 0.000 description 2
- ZIJTYIRGFVHPHZ-UHFFFAOYSA-N selenium oxide(seo) Chemical class [Se]=O ZIJTYIRGFVHPHZ-UHFFFAOYSA-N 0.000 description 2
- 230000000638 stimulation Effects 0.000 description 2
- XTQHKBHJIVJGKJ-UHFFFAOYSA-N sulfur monoxide Chemical class S=O XTQHKBHJIVJGKJ-UHFFFAOYSA-N 0.000 description 2
- 229910003451 terbium oxide Inorganic materials 0.000 description 2
- SCRZPWWVSXWCMC-UHFFFAOYSA-N terbium(iii) oxide Chemical compound [O-2].[O-2].[O-2].[Tb+3].[Tb+3] SCRZPWWVSXWCMC-UHFFFAOYSA-N 0.000 description 2
- 238000001429 visible spectrum Methods 0.000 description 2
- MCSXGCZMEPXKIW-UHFFFAOYSA-N 3-hydroxy-4-[(4-methyl-2-nitrophenyl)diazenyl]-N-(3-nitrophenyl)naphthalene-2-carboxamide Chemical compound Cc1ccc(N=Nc2c(O)c(cc3ccccc23)C(=O)Nc2cccc(c2)[N+]([O-])=O)c(c1)[N+]([O-])=O MCSXGCZMEPXKIW-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 229910052776 Thorium Inorganic materials 0.000 description 1
- 206010049155 Visual brightness Diseases 0.000 description 1
- JEROREPODAPBAY-UHFFFAOYSA-N [La].ClOCl Chemical compound [La].ClOCl JEROREPODAPBAY-UHFFFAOYSA-N 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- 229910052797 bismuth Inorganic materials 0.000 description 1
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- KBQHZAAAGSGFKK-UHFFFAOYSA-N dysprosium atom Chemical compound [Dy] KBQHZAAAGSGFKK-UHFFFAOYSA-N 0.000 description 1
- UYAHIZSMUZPPFV-UHFFFAOYSA-N erbium Chemical compound [Er] UYAHIZSMUZPPFV-UHFFFAOYSA-N 0.000 description 1
- OGPBJKLSAFTDLK-UHFFFAOYSA-N europium atom Chemical compound [Eu] OGPBJKLSAFTDLK-UHFFFAOYSA-N 0.000 description 1
- 229910001940 europium oxide Inorganic materials 0.000 description 1
- PVDYMOCCGHXJAK-UHFFFAOYSA-H europium(3+);oxalate Chemical class [Eu+3].[Eu+3].[O-]C(=O)C([O-])=O.[O-]C(=O)C([O-])=O.[O-]C(=O)C([O-])=O PVDYMOCCGHXJAK-UHFFFAOYSA-H 0.000 description 1
- AEBZCFFCDTZXHP-UHFFFAOYSA-N europium(3+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Eu+3].[Eu+3] AEBZCFFCDTZXHP-UHFFFAOYSA-N 0.000 description 1
- 230000005284 excitation Effects 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- VQEHIYWBGOJJDM-UHFFFAOYSA-H lanthanum(3+);trisulfate Chemical compound [La+3].[La+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O VQEHIYWBGOJJDM-UHFFFAOYSA-H 0.000 description 1
- UPIZSELIQBYSMU-UHFFFAOYSA-N lanthanum;sulfur monoxide Chemical compound [La].S=O UPIZSELIQBYSMU-UHFFFAOYSA-N 0.000 description 1
- 238000004020 luminiscence type Methods 0.000 description 1
- 229910003443 lutetium oxide Inorganic materials 0.000 description 1
- QEFYFXOXNSNQGX-UHFFFAOYSA-N neodymium atom Chemical compound [Nd] QEFYFXOXNSNQGX-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- MPARYNQUYZOBJM-UHFFFAOYSA-N oxo(oxolutetiooxy)lutetium Chemical compound O=[Lu]O[Lu]=O MPARYNQUYZOBJM-UHFFFAOYSA-N 0.000 description 1
- MMKQUGHLEMYQSG-UHFFFAOYSA-N oxygen(2-);praseodymium(3+) Chemical compound [O-2].[O-2].[O-2].[Pr+3].[Pr+3] MMKQUGHLEMYQSG-UHFFFAOYSA-N 0.000 description 1
- PUDIUYLPXJFUGB-UHFFFAOYSA-N praseodymium atom Chemical compound [Pr] PUDIUYLPXJFUGB-UHFFFAOYSA-N 0.000 description 1
- 229910003447 praseodymium oxide Inorganic materials 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 229910052761 rare earth metal Inorganic materials 0.000 description 1
- 229910001954 samarium oxide Inorganic materials 0.000 description 1
- 229940075630 samarium oxide Drugs 0.000 description 1
- FKTOIHSPIPYAPE-UHFFFAOYSA-N samarium(iii) oxide Chemical compound [O-2].[O-2].[O-2].[Sm+3].[Sm+3] FKTOIHSPIPYAPE-UHFFFAOYSA-N 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 150000004763 sulfides Chemical class 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 230000002123 temporal effect Effects 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09K—MATERIALS FOR MISCELLANEOUS APPLICATIONS, NOT PROVIDED FOR ELSEWHERE
- C09K11/00—Luminescent, e.g. electroluminescent, chemiluminescent materials
- C09K11/08—Luminescent, e.g. electroluminescent, chemiluminescent materials containing inorganic luminescent materials
- C09K11/77—Luminescent, e.g. electroluminescent, chemiluminescent materials containing inorganic luminescent materials containing rare earth metals
- C09K11/7766—Luminescent, e.g. electroluminescent, chemiluminescent materials containing inorganic luminescent materials containing rare earth metals containing two or more rare earth metals
- C09K11/7767—Chalcogenides
- C09K11/7769—Oxides
- C09K11/7771—Oxysulfides
Landscapes
- Chemical & Material Sciences (AREA)
- Inorganic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Organic Chemistry (AREA)
- Luminescent Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US44251865A | 1965-03-24 | 1965-03-24 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1279872B true DE1279872B (de) | 1968-10-10 |
Family
ID=23757107
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1966R0042881 Withdrawn DE1279872B (de) | 1965-03-24 | 1966-03-18 | Leuchtstoff auf der Basis von Oxychalcogeniden des Lanthans und Lutetiums |
Country Status (10)
| Country | Link |
|---|---|
| AT (1) | AT271661B (show.php) |
| BE (1) | BE678413A (show.php) |
| CA (1) | CA952706A (show.php) |
| DE (1) | DE1279872B (show.php) |
| DK (1) | DK117848B (show.php) |
| ES (1) | ES324472A1 (show.php) |
| FR (1) | FR1473532A (show.php) |
| GB (1) | GB1121055A (show.php) |
| NL (1) | NL6603804A (show.php) |
| SE (1) | SE301528B (show.php) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3502590A (en) * | 1967-03-01 | 1970-03-24 | Rca Corp | Process for preparing phosphor |
| DE3069191D1 (en) * | 1979-12-12 | 1984-10-18 | Hitachi Ltd | Phosphor and method of manufacturing the phosphor |
| US5166948A (en) * | 1991-06-19 | 1992-11-24 | Polaroid Corporation | Optically pumped up converting light source |
| EP1493798A1 (en) * | 2003-06-30 | 2005-01-05 | Agfa-Gevaert | Rare earth activated lutetium oxysulfide phosphor for direct x-ray detection. |
| DE602004030263D1 (de) * | 2003-09-24 | 2011-01-05 | Toshiba Kk | Szintillatorkeramik sowie strahlendetektor und radiographisches untersuchungsgerät, die diese enthalten |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1343851A (fr) * | 1962-11-05 | 1963-11-22 | Du Pont | Nouvelles compositions luminescentes |
-
1966
- 1966-03-04 CA CA953,907A patent/CA952706A/en not_active Expired
- 1966-03-18 DK DK144366A patent/DK117848B/da unknown
- 1966-03-18 DE DE1966R0042881 patent/DE1279872B/de not_active Withdrawn
- 1966-03-22 ES ES0324472A patent/ES324472A1/es not_active Expired
- 1966-03-23 GB GB1278666A patent/GB1121055A/en not_active Expired
- 1966-03-23 NL NL6603804A patent/NL6603804A/xx unknown
- 1966-03-23 SE SE384266A patent/SE301528B/xx unknown
- 1966-03-24 AT AT283266A patent/AT271661B/de active
- 1966-03-24 BE BE678413D patent/BE678413A/xx unknown
- 1966-03-24 FR FR54792A patent/FR1473532A/fr not_active Expired
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1343851A (fr) * | 1962-11-05 | 1963-11-22 | Du Pont | Nouvelles compositions luminescentes |
Also Published As
| Publication number | Publication date |
|---|---|
| ES324472A1 (es) | 1967-03-16 |
| DK117848B (da) | 1970-06-08 |
| AT271661B (de) | 1969-06-10 |
| CA952706A (en) | 1974-08-13 |
| FR1473532A (fr) | 1967-03-17 |
| GB1121055A (en) | 1968-07-24 |
| BE678413A (show.php) | 1966-09-01 |
| NL6603804A (show.php) | 1966-09-26 |
| SE301528B (show.php) | 1968-06-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1800671B2 (de) | Leuchtstoff auf der basis von oxychalcogeniden seltener erden | |
| EP1116418B1 (de) | Leuchstoff für lichtquellen und zugehörige lichtquelle | |
| DE1792502A1 (de) | Leuchtstoff auf Chalcogenidbasis mit einem Lanthanidenelement als Aktivator | |
| DE1233077B (de) | Rot emittierende Leuchtstoffe und Verfahren zu ihrer Herstellung | |
| EP0966504A1 (de) | Nicht-grüner anti-stokes-leuchtstoff | |
| DE2410134C3 (de) | Borat-Leuchtstoff | |
| DE1804546A1 (de) | Mit Selten-Erdmetallen aktivierter Leuchtstoff sowie Verfahren zur Herstellung eines solchen Leuchtstoffes | |
| DE2739437A1 (de) | Leuchtstoff und verfahren zu seiner herstellung | |
| EP3017017B1 (de) | Verbesserter granatleuchtstoff und verfahren zu dessen herstellung sowie lichtquelle | |
| DE1915289A1 (de) | Infrarot erregbare Leuchtstoffe | |
| DE1279872B (de) | Leuchtstoff auf der Basis von Oxychalcogeniden des Lanthans und Lutetiums | |
| DE1300996B (de) | Verfahren zur Herstellung eines mit Europium aktivierten Gadolinium- und/oder Yttriumoxidleuchtstoffes | |
| DE2629413C3 (de) | Fluoreszenzmasse und ihre Verwendung | |
| DE1282819B (de) | Leuchtstoffe auf der Basis von Oxychalcogeniden seltener Erden | |
| DE1800671C (de) | Leuchtstoff auf der Basis von Oxychalcogeniden seltener Erden | |
| DE2620821A1 (de) | Lumineszierende masse | |
| DE1467485A1 (de) | Lumineszenzmaterial und Verfahren zu seiner Herstellung | |
| DE2031325C3 (de) | Mit Europium aktivierter Yttrium-Gadolinium-Oxy-sulfid-Leuchtstoff | |
| DE19827252A1 (de) | Seltenerdborat-Leuchtstoff | |
| DE1467484A1 (de) | Leuchtstoff und Verfahren zu seiner Herstellung | |
| DE1817790C3 (de) | Yttriumoxysulfid-Leuchtstoff | |
| DE3530180A1 (de) | Leuchtstoff und verfahren zu seiner herstellung | |
| DE1762982C3 (de) | Leuchtschirm für eine Kathodenstrahl-Farbbildwiedergaberöhre | |
| AT303912B (de) | Verfahren zur Herstellung von Leuchtmassen | |
| DE2739436A1 (de) | Leuchtstoff und verfahren zu seiner herstellung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| E77 | Valid patent as to the heymanns-index 1977 | ||
| EHJ | Ceased/non-payment of the annual fee |