DE1276628C2 - Verfahren zur herstellung von isophtalsaeure und/oder terephthalsaeure - Google Patents
Verfahren zur herstellung von isophtalsaeure und/oder terephthalsaeureInfo
- Publication number
- DE1276628C2 DE1276628C2 DE1964R0037891 DER0037891A DE1276628C2 DE 1276628 C2 DE1276628 C2 DE 1276628C2 DE 1964R0037891 DE1964R0037891 DE 1964R0037891 DE R0037891 A DER0037891 A DE R0037891A DE 1276628 C2 DE1276628 C2 DE 1276628C2
- Authority
- DE
- Germany
- Prior art keywords
- acid
- xylene
- acetaldehyde
- acetic acid
- solvent
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 21
- QQVIHTHCMHWDBS-UHFFFAOYSA-N perisophthalic acid Natural products OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 title claims description 15
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 title claims description 14
- 238000004519 manufacturing process Methods 0.000 title description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 42
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 claims description 28
- 239000002904 solvent Substances 0.000 claims description 17
- 239000008096 xylene Substances 0.000 claims description 15
- URLKBWYHVLBVBO-UHFFFAOYSA-N Para-Xylene Chemical group CC1=CC=C(C)C=C1 URLKBWYHVLBVBO-UHFFFAOYSA-N 0.000 claims description 14
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims description 13
- 239000003054 catalyst Substances 0.000 claims description 10
- 239000000203 mixture Substances 0.000 claims description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 9
- IVSZLXZYQVIEFR-UHFFFAOYSA-N m-xylene Chemical compound CC1=CC=CC(C)=C1 IVSZLXZYQVIEFR-UHFFFAOYSA-N 0.000 claims description 8
- 238000007254 oxidation reaction Methods 0.000 claims description 8
- 230000003647 oxidation Effects 0.000 claims description 7
- 239000012190 activator Substances 0.000 claims description 6
- 239000011541 reaction mixture Substances 0.000 claims description 6
- 229940011182 cobalt acetate Drugs 0.000 claims description 5
- QAHREYKOYSIQPH-UHFFFAOYSA-L cobalt(II) acetate Chemical compound [Co+2].CC([O-])=O.CC([O-])=O QAHREYKOYSIQPH-UHFFFAOYSA-L 0.000 claims description 5
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 2
- 229910001882 dioxygen Inorganic materials 0.000 claims description 2
- 238000000926 separation method Methods 0.000 claims description 2
- 238000006243 chemical reaction Methods 0.000 description 6
- 239000002253 acid Substances 0.000 description 4
- 150000001868 cobalt Chemical class 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 3
- XNGIFLGASWRNHJ-UHFFFAOYSA-N o-dicarboxybenzene Natural products OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 3
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- IKHGUXGNUITLKF-XPULMUKRSA-N acetaldehyde Chemical compound [14CH]([14CH3])=O IKHGUXGNUITLKF-XPULMUKRSA-N 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- ZBYYWKJVSFHYJL-UHFFFAOYSA-L cobalt(2+);diacetate;tetrahydrate Chemical compound O.O.O.O.[Co+2].CC([O-])=O.CC([O-])=O ZBYYWKJVSFHYJL-UHFFFAOYSA-L 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 150000003738 xylenes Chemical class 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/16—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation
- C07C51/21—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation with molecular oxygen
- C07C51/255—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation with molecular oxygen of compounds containing six-membered aromatic rings without ring-splitting
- C07C51/265—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation with molecular oxygen of compounds containing six-membered aromatic rings without ring-splitting having alkyl side chains which are oxidised to carboxyl groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Quick-Acting Or Multi-Walled Pipe Joints (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US28181963A | 1963-05-20 | 1963-05-20 | |
| US624136A US3361803A (en) | 1963-05-20 | 1967-03-20 | Process for the production of isophthalic and terephthalic acids |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE1276628C2 true DE1276628C2 (de) | 1975-01-16 |
| DE1276628B DE1276628B (enExample) | 1975-01-16 |
Family
ID=26961094
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1964R0037891 Expired DE1276628C2 (de) | 1963-05-20 | 1964-05-13 | Verfahren zur herstellung von isophtalsaeure und/oder terephthalsaeure |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3361803A (enExample) |
| BE (1) | BE648155A (enExample) |
| CH (1) | CH440250A (enExample) |
| DE (1) | DE1276628C2 (enExample) |
| DK (1) | DK112727B (enExample) |
| GB (1) | GB1004895A (enExample) |
| NL (1) | NL6405607A (enExample) |
| NO (1) | NO117027B (enExample) |
| SE (1) | SE313554B (enExample) |
Families Citing this family (32)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3852342A (en) * | 1972-09-01 | 1974-12-03 | Labofina Sa | Process for the liquid phase oxidation of methylaromatic compounds into polycarboxylic acids |
| US4230882A (en) * | 1978-05-19 | 1980-10-28 | Asahi Kasei Kogyo Kabushiki Kaisha | Process for the production of a high purity terephthalic acid |
| DE2822728C3 (de) * | 1978-05-24 | 1981-08-27 | Asahi Kasei Kogyo K.K., Osaka | Verfahren zur Herstellung von Terephthalsäure |
| WO2001038279A1 (en) * | 1999-11-26 | 2001-05-31 | Chemintel (India) Private Limited | Process for preparation of benzene dicarboxylic acids |
| US20060047153A1 (en) * | 2004-09-02 | 2006-03-02 | Wonders Alan G | Optimized liquid-phase oxidation |
| US7683210B2 (en) * | 2004-09-02 | 2010-03-23 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7692036B2 (en) * | 2004-11-29 | 2010-04-06 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7608733B2 (en) * | 2004-09-02 | 2009-10-27 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7910769B2 (en) * | 2004-09-02 | 2011-03-22 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7399882B2 (en) * | 2004-09-02 | 2008-07-15 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7563926B2 (en) * | 2004-09-02 | 2009-07-21 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7608732B2 (en) * | 2005-03-08 | 2009-10-27 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7361784B2 (en) * | 2004-09-02 | 2008-04-22 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7507857B2 (en) * | 2004-09-02 | 2009-03-24 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7741515B2 (en) * | 2004-09-02 | 2010-06-22 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7371894B2 (en) * | 2004-09-02 | 2008-05-13 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7568361B2 (en) * | 2004-09-02 | 2009-08-04 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7495125B2 (en) * | 2004-09-02 | 2009-02-24 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7482482B2 (en) * | 2004-09-02 | 2009-01-27 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7582793B2 (en) | 2004-09-02 | 2009-09-01 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7692037B2 (en) | 2004-09-02 | 2010-04-06 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7504535B2 (en) | 2004-09-02 | 2009-03-17 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7572932B2 (en) | 2004-09-02 | 2009-08-11 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7381836B2 (en) * | 2004-09-02 | 2008-06-03 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7390921B2 (en) * | 2004-09-02 | 2008-06-24 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7572936B2 (en) | 2004-09-02 | 2009-08-11 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7586000B2 (en) * | 2004-09-02 | 2009-09-08 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7589231B2 (en) * | 2004-09-02 | 2009-09-15 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US20060116531A1 (en) * | 2004-11-29 | 2006-06-01 | Wonders Alan G | Modeling of liquid-phase oxidation |
| US7884232B2 (en) * | 2005-06-16 | 2011-02-08 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7358389B2 (en) * | 2006-01-04 | 2008-04-15 | Eastman Chemical Company | Oxidation system employing internal structure for enhanced hydrodynamics |
| US7355068B2 (en) | 2006-01-04 | 2008-04-08 | Eastman Chemical Company | Oxidation system with internal secondary reactor |
-
1964
- 1964-05-13 DE DE1964R0037891 patent/DE1276628C2/de not_active Expired
- 1964-05-14 DK DK242864AA patent/DK112727B/da unknown
- 1964-05-15 NO NO153276A patent/NO117027B/no unknown
- 1964-05-15 SE SE6008/64A patent/SE313554B/xx unknown
- 1964-05-15 GB GB20370/64A patent/GB1004895A/en not_active Expired
- 1964-05-19 CH CH647564A patent/CH440250A/fr unknown
- 1964-05-20 BE BE648155D patent/BE648155A/xx unknown
- 1964-05-20 NL NL6405607A patent/NL6405607A/xx unknown
-
1967
- 1967-03-20 US US624136A patent/US3361803A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| SE313554B (enExample) | 1969-08-18 |
| BE648155A (enExample) | 1964-11-20 |
| DK112727B (da) | 1969-01-13 |
| US3361803A (en) | 1968-01-02 |
| CH440250A (fr) | 1967-07-31 |
| DE1276628B (enExample) | 1975-01-16 |
| NO117027B (enExample) | 1969-06-23 |
| NL6405607A (enExample) | 1964-11-23 |
| GB1004895A (en) | 1965-09-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1276628C2 (de) | Verfahren zur herstellung von isophtalsaeure und/oder terephthalsaeure | |
| DE2416177C3 (de) | Verfahren zur Rückgewinnung des Schwermetall-Oxidationskatalysators aus einem Gemisch, das durch kontinuierliche Oxidation von p-Xylol erhalten worden ist | |
| DE2613871A1 (de) | Verbessertes verfahren zur kontinuierlichen herstellung hochreiner terephthalsaeure | |
| DE2627475C3 (de) | Verfahren zur Herstellung von Terephthalsäure | |
| DE1267677B (de) | Verfahren zur kontinuierlichen Herstellung von aromatischen Carbonsaeuren oder deren Anhydriden | |
| DE69301318T2 (de) | Oxydation von Isobutan zur Tertiär-Butyl-Hydroperoxid | |
| DE3030463A1 (de) | Verfahren zur herstellung von aromatischen polycarbonsaeuren | |
| CH374979A (de) | Verfahren zur Herstellung von aromatischen Carbonsäuren | |
| DE2814807C2 (enExample) | ||
| DE2257752A1 (de) | Verfahren zur herstellung von terephthalsaeure | |
| DE2939510C2 (de) | Verfahren zur Herstellung von Terephthalsäure | |
| DE1297590B (de) | Verfahren zur Herstellung von Dekandicarbonsaeure | |
| AT203708B (de) | Verfahren zur Polymerisation von Äthylen | |
| AT213876B (de) | Verfahren zur Herstellung der Iso- und/oder Terephthalsäurediester von Alkanolen mit 1 bis 4 C-Atomen | |
| DE2632898A1 (de) | Kobaltkatalysierte oxidation von gesaettigten, aliphatischen c tief 3 - c tief 7 -kohlenwasserstoffen zu essigsaeure | |
| DE1300924B (de) | Verfahren zur Herstellung von Benzolcarbonsaeuren | |
| AT352703B (de) | Verfahren zur herstellung von terephthalsaeure | |
| AT256079B (de) | Verfahren zur Herstellung von Terephthalsäure | |
| DE1668775C3 (de) | Verfahren zum Stabilisieren von epsilon-Caprolacton | |
| DE2846432C2 (enExample) | ||
| DE3545583A1 (de) | Verfahren zur herstellung organischer ester aus halogenkohlenstoffverbindungen | |
| DE1959621B2 (de) | Verfahren zur Gewinnung von Adipinsäure aus 6-Hydroperoxyhexansäure | |
| DE1041945B (de) | Verfahren zur Herstellung von Benzoldicarbonsaeureestern | |
| DE2355415A1 (de) | Verfahren zur herstellung von terephthalsaeure | |
| DE1277239B (de) | Verfahren zur Gewinnung von Adipinsaeure aus den sauren Waschwaessern der Cyclohexan-Luft-Oxydation |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C2 | Grant after previous publication (2nd publication) |