DE1272929B - - Google Patents
Info
- Publication number
- DE1272929B DE1272929B DE19651272929D DE1272929DA DE1272929B DE 1272929 B DE1272929 B DE 1272929B DE 19651272929 D DE19651272929 D DE 19651272929D DE 1272929D A DE1272929D A DE 1272929DA DE 1272929 B DE1272929 B DE 1272929B
- Authority
- DE
- Germany
- Prior art keywords
- chloro
- acid
- general formula
- furfural
- sulfamyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- HYBBIBNJHNGZAN-UHFFFAOYSA-N furfural Chemical compound O=CC1=CC=CO1 HYBBIBNJHNGZAN-UHFFFAOYSA-N 0.000 claims description 35
- 238000000034 method Methods 0.000 claims description 31
- 150000001875 compounds Chemical class 0.000 claims description 20
- 239000007868 Raney catalyst Substances 0.000 claims description 10
- 229910000564 Raney nickel Inorganic materials 0.000 claims description 10
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- UTQIGSMBKHNNRC-UHFFFAOYSA-N NS(C(C=CC=C1C(O)=O)=C1NCC1=CC=CO1)(=O)=O Chemical class NS(C(C=CC=C1C(O)=O)=C1NCC1=CC=CO1)(=O)=O UTQIGSMBKHNNRC-UHFFFAOYSA-N 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 239000003960 organic solvent Substances 0.000 claims description 4
- 241000251730 Chondrichthyes Species 0.000 claims description 3
- 229910052731 fluorine Inorganic materials 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 150000003335 secondary amines Chemical class 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 239000011737 fluorine Substances 0.000 claims description 2
- 125000001153 fluoro group Chemical group F* 0.000 claims description 2
- AAIRFJAUVBLEJY-UHFFFAOYSA-N furan-2-ylmethanimine Chemical compound N=CC1=CC=CO1 AAIRFJAUVBLEJY-UHFFFAOYSA-N 0.000 claims description 2
- 150000002240 furans Chemical class 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 claims 1
- 125000000440 benzylamino group Chemical group [H]N(*)C([H])([H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 25
- 238000000354 decomposition reaction Methods 0.000 description 19
- 238000006243 chemical reaction Methods 0.000 description 15
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 13
- -1 aromatic carboxylic acid radical Chemical class 0.000 description 13
- 239000000243 solution Substances 0.000 description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- DDRPCXLAQZKBJP-UHFFFAOYSA-N furfurylamine Chemical compound NCC1=CC=CO1 DDRPCXLAQZKBJP-UHFFFAOYSA-N 0.000 description 10
- 239000007858 starting material Substances 0.000 description 10
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 10
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 9
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 9
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- 239000002253 acid Substances 0.000 description 8
- 239000003054 catalyst Substances 0.000 description 8
- 238000005984 hydrogenation reaction Methods 0.000 description 8
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical compound NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 description 7
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 7
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 7
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- XPFVYQJUAUNWIW-UHFFFAOYSA-N furfuryl alcohol Chemical compound OCC1=CC=CO1 XPFVYQJUAUNWIW-UHFFFAOYSA-N 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 238000001953 recrystallisation Methods 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- NDDXOWNYPIJUDG-UHFFFAOYSA-N C(C)(=O)NS(=O)(=O)C=1C=C(C(=O)O)C(=CC=1Cl)N Chemical compound C(C)(=O)NS(=O)(=O)C=1C=C(C(=O)O)C(=CC=1Cl)N NDDXOWNYPIJUDG-UHFFFAOYSA-N 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- 125000003277 amino group Chemical group 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 238000003776 cleavage reaction Methods 0.000 description 4
- 238000009833 condensation Methods 0.000 description 4
- 230000005494 condensation Effects 0.000 description 4
- 239000007859 condensation product Substances 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 230000007017 scission Effects 0.000 description 4
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 239000002262 Schiff base Substances 0.000 description 3
- 150000004753 Schiff bases Chemical class 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- 238000007127 saponification reaction Methods 0.000 description 3
- NSTREUWFTAOOKS-UHFFFAOYSA-N 2-fluorobenzoic acid Chemical class OC(=O)C1=CC=CC=C1F NSTREUWFTAOOKS-UHFFFAOYSA-N 0.000 description 2
- WPTRLIUULSVGAC-UHFFFAOYSA-N 4-bromo-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoic acid Chemical compound S(N)(=O)(=O)C=1C=C(C(=O)O)C(=CC=1Br)NCC1=CC=CO1 WPTRLIUULSVGAC-UHFFFAOYSA-N 0.000 description 2
- ALZIDSSAOINORR-UHFFFAOYSA-N C(C)(=O)NS(=O)(=O)C1=C(C(C(=O)O)C(C=C1Cl)=CC1=CC=CO1)N Chemical compound C(C)(=O)NS(=O)(=O)C1=C(C(C(=O)O)C(C=C1Cl)=CC1=CC=CO1)N ALZIDSSAOINORR-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- IPEWNTLWCRYSRY-UHFFFAOYSA-N [CH2]C1=CC=CO1 Chemical compound [CH2]C1=CC=CO1 IPEWNTLWCRYSRY-UHFFFAOYSA-N 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 229960004050 aminobenzoic acid Drugs 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 125000004185 ester group Chemical group 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000007086 side reaction Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- QQLNFWFHBAFHPR-UHFFFAOYSA-N 2-(benzylamino)-4-chloro-5-sulfamoylbenzoic acid Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CC=C1 QQLNFWFHBAFHPR-UHFFFAOYSA-N 0.000 description 1
- QQLJBZFXGDHSRU-UHFFFAOYSA-N 2-amino-4-chloro-5-sulfamoylbenzoic acid Chemical compound NC1=CC(Cl)=C(S(N)(=O)=O)C=C1C(O)=O QQLJBZFXGDHSRU-UHFFFAOYSA-N 0.000 description 1
- IZWJJBADCHVZMW-UHFFFAOYSA-N 2-amino-6-benzyl-4-chloro-3-sulfamoylbenzoic acid Chemical compound S(N)(=O)(=O)C=1C(=C(C(=O)O)C(=CC1Cl)CC1=CC=CC=C1)N IZWJJBADCHVZMW-UHFFFAOYSA-N 0.000 description 1
- WDGCBNTXZHJTHJ-UHFFFAOYSA-N 2h-1,3-oxazol-2-id-4-one Chemical class O=C1CO[C-]=N1 WDGCBNTXZHJTHJ-UHFFFAOYSA-N 0.000 description 1
- LYBLYSRUMQHJTJ-UHFFFAOYSA-N 5-(benzoylsulfamoyl)-4-chloro-2-(furan-2-ylmethylamino)benzoic acid Chemical compound OC(=O)C1=CC(S(=O)(=O)NC(=O)C=2C=CC=CC=2)=C(Cl)C=C1NCC1=CC=CO1 LYBLYSRUMQHJTJ-UHFFFAOYSA-N 0.000 description 1
- 241000272525 Anas platyrhynchos Species 0.000 description 1
- KCMRBXWUMRZMFT-UHFFFAOYSA-N CC(NS(C(C=C(C(O)=O)C(N)=C1)=C1Br)(=O)=O)=O Chemical compound CC(NS(C(C=C(C(O)=O)C(N)=C1)=C1Br)(=O)=O)=O KCMRBXWUMRZMFT-UHFFFAOYSA-N 0.000 description 1
- ZMAAKXKSLSFOSU-UHFFFAOYSA-N CC(NS(C(C=C(C(O)=O)C(N=CC1=CC=CO1)=C1)=C1Cl)(=O)=O)=O Chemical compound CC(NS(C(C=C(C(O)=O)C(N=CC1=CC=CO1)=C1)=C1Cl)(=O)=O)=O ZMAAKXKSLSFOSU-UHFFFAOYSA-N 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical class CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 1
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical class CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 230000021736 acetylation Effects 0.000 description 1
- 238000006640 acetylation reaction Methods 0.000 description 1
- 150000003855 acyl compounds Chemical class 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 1
- 229940051881 anilide analgesics and antipyretics Drugs 0.000 description 1
- 150000003931 anilides Chemical class 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical class NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000005521 carbonamide group Chemical group 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000002934 diuretic Substances 0.000 description 1
- 229940030606 diuretics Drugs 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 229910000510 noble metal Inorganic materials 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- KHUXNRRPPZOJPT-UHFFFAOYSA-N phenoxy radical Chemical group O=C1C=C[CH]C=C1 KHUXNRRPPZOJPT-UHFFFAOYSA-N 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- 239000010970 precious metal Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000000894 saliuretic effect Effects 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000000565 sulfonamide group Chemical group 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/52—Radicals substituted by nitrogen atoms not forming part of a nitro radical
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Furan Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF0046263 | 1965-06-05 | ||
| DEF0047271 | 1965-09-24 | ||
| DEF0047648 | 1965-11-11 | ||
| DEF0047647 | 1965-11-11 | ||
| DEF0049102 | 1966-05-04 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1272929B true DE1272929B (OSRAM) | 1968-07-18 |
Family
ID=27512067
Family Applications (5)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19651272929D Pending DE1272929B (OSRAM) | 1965-06-05 | 1965-06-05 | |
| DE19651281449D Pending DE1281449B (OSRAM) | 1965-06-05 | 1965-09-24 | |
| DE19651302132D Pending DE1302132B (OSRAM) | 1965-06-05 | 1965-11-11 | |
| DE19651300569D Pending DE1300569B (OSRAM) | 1965-06-05 | 1965-11-11 | |
| DE19661277860D Pending DE1277860B (de) | 1965-06-05 | 1966-05-04 | Verfahren zur Herstellung von SuIfamylanthranilsäuren |
Family Applications After (4)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19651281449D Pending DE1281449B (OSRAM) | 1965-06-05 | 1965-09-24 | |
| DE19651302132D Pending DE1302132B (OSRAM) | 1965-06-05 | 1965-11-11 | |
| DE19651300569D Pending DE1300569B (OSRAM) | 1965-06-05 | 1965-11-11 | |
| DE19661277860D Pending DE1277860B (de) | 1965-06-05 | 1966-05-04 | Verfahren zur Herstellung von SuIfamylanthranilsäuren |
Country Status (6)
| Country | Link |
|---|---|
| BE (1) | BE682141A (OSRAM) |
| CH (2) | CH459254A (OSRAM) |
| DE (5) | DE1272929B (OSRAM) |
| DK (1) | DK123406B (OSRAM) |
| FR (1) | FR1489135A (OSRAM) |
| SE (2) | SE332995B (OSRAM) |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2175585A (en) * | 1936-04-14 | 1939-10-10 | Adkins Homer | Preparation of furfurylamines |
| DE1174797B (de) * | 1962-10-16 | 1964-07-30 | Hoechst Ag | Verfahren zur Herstellung von Sulfamylanthranilsaeuren |
| FR1396621A (fr) * | 1963-04-13 | 1965-04-23 | Hoechst Ag | Procédé de préparation d'acides sulfamyl-anthraniliques |
-
1965
- 1965-06-05 DE DE19651272929D patent/DE1272929B/de active Pending
- 1965-09-24 DE DE19651281449D patent/DE1281449B/de active Pending
- 1965-11-11 DE DE19651302132D patent/DE1302132B/de active Pending
- 1965-11-11 DE DE19651300569D patent/DE1300569B/de active Pending
-
1966
- 1966-05-04 DE DE19661277860D patent/DE1277860B/de active Pending
- 1966-05-31 CH CH1360767A patent/CH459254A/de unknown
- 1966-05-31 CH CH783466A patent/CH444880A/de unknown
- 1966-06-02 SE SE1316368A patent/SE332995B/xx unknown
- 1966-06-02 SE SE754066A patent/SE322787B/xx unknown
- 1966-06-03 DK DK288966A patent/DK123406B/da unknown
- 1966-06-06 FR FR1489135D patent/FR1489135A/fr not_active Expired
- 1966-06-06 BE BE682141D patent/BE682141A/xx unknown
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2175585A (en) * | 1936-04-14 | 1939-10-10 | Adkins Homer | Preparation of furfurylamines |
| DE1174797B (de) * | 1962-10-16 | 1964-07-30 | Hoechst Ag | Verfahren zur Herstellung von Sulfamylanthranilsaeuren |
| FR1396621A (fr) * | 1963-04-13 | 1965-04-23 | Hoechst Ag | Procédé de préparation d'acides sulfamyl-anthraniliques |
Also Published As
| Publication number | Publication date |
|---|---|
| DE1300569B (OSRAM) | 1969-08-07 |
| SE332995B (OSRAM) | 1971-03-01 |
| BE682141A (OSRAM) | 1966-12-06 |
| DE1281449B (OSRAM) | 1968-10-31 |
| CH444880A (de) | 1967-10-15 |
| DE1302132B (OSRAM) | 1970-01-22 |
| SE322787B (OSRAM) | 1970-04-20 |
| FR1489135A (OSRAM) | 1967-10-26 |
| DE1277860B (de) | 1968-09-19 |
| CH459254A (de) | 1968-07-15 |
| DK123406B (da) | 1972-06-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3212170C2 (OSRAM) | ||
| CH653996A5 (de) | Tryptaminderivate und verfahren zu deren herstellung. | |
| EP0084127B1 (de) | Verfahren zur Herstellung von Acemetacin | |
| DE1272929B (OSRAM) | ||
| DE1695136B2 (de) | Verfahren zur Herstellung von 3-Amino-5-methylisoxazol | |
| DE887816C (de) | Verfahren zur Herstellung von 1-Nitrophenyl-2-amino-propan-1, 3-diolderivaten | |
| DE1918253A1 (de) | Verbessertes Verfahren zur Herstellung von 3-Hydroxyisoxazolverbindungen | |
| DE1227893B (de) | Verfahren zur Herstellung von Glycyrrhetinsaeurederivaten | |
| DD273250A5 (de) | Verfahren zur herstellung von alpha-(1-methylethyl)-3,4-dimethoxybenzolacetonitril | |
| AT326638B (de) | Verfahren zur herstellung von n(beta-diäthylaminoäthyl) -4-amino-5-chlor-2-methoxybenzamid | |
| DE3408850C2 (OSRAM) | ||
| DE1174797B (de) | Verfahren zur Herstellung von Sulfamylanthranilsaeuren | |
| DE1240873B (de) | Verfahren zur Herstellung von 4-Halogen-5-sulfamylanthranilsaeure-hydroxamiden | |
| DE1900948C (de) | Cis- und trans-2-Methyl-5-(3, 4, S-trimethoxybenzamidoJ-decahydroisochinolin | |
| DE1493484C3 (de) | Verfahren zur Herstellung von L-(-)-aIpha-Methyl-beta-(3,4-dihydroxyphenyl)-alanin | |
| DE2628653C2 (de) | Verfahren zur Herstellung von Naphtholactam | |
| EP0175264B1 (de) | Verfahren zur Herstellung von 2-Amino-3-cyano-5-dialkoxymethyl-pyrazinen und Zwischenprodukte für dieses Verfahren | |
| AT215417B (de) | Verfahren zur Herstellung neuer N-Carbalkoxy- bzw. -aralkoxyalkyl-β-(3,4-dihydroxyphenyl)-β-hydroxyäthylamine und deren Salze | |
| DE1166782B (de) | Verfahren zur Herstellung von substituierten aromatischen Dicarbonsaeureimiden und deren Salzen | |
| DE878656C (de) | Verfahren zur Herstellung von Halogenacetamidodiolen | |
| DE2118365C3 (de) | m-Benzoylphenylessigsäureester, Verfahren zu ihrer Herstellung und pharmazeutische Zusammensetzungen | |
| DE3230333A1 (de) | Verfahren zur herstellung von threo-1-phenyl-2-amino-propanol-(1)-derivaten | |
| DE2166456C3 (de) | Verfahren zur Herstellung von N-Diäthylaminoäthyl-2-methoxy-4-amino-5-chlorbenzamid | |
| DE2206424A1 (de) | Verfahren zur Herstellung von N-substituierten Anthranilsäurederivaten | |
| DE3000209A1 (de) | N-(3-(1'-3''-oxapentamethylenamino-aethylindenamino)-2,4,6-trijodbenzoyl) - (beta) -amino-(alpha) -methylpropionitril, ein verfahren zu dessen herstellung und dessen verwendung als zwischenprodukt |