DE1272288B - Verfahren zur Herstellung von Cyclohexanonoxim - Google Patents
Verfahren zur Herstellung von CyclohexanonoximInfo
- Publication number
- DE1272288B DE1272288B DEP1272A DE1272288A DE1272288B DE 1272288 B DE1272288 B DE 1272288B DE P1272 A DEP1272 A DE P1272A DE 1272288 A DE1272288 A DE 1272288A DE 1272288 B DE1272288 B DE 1272288B
- Authority
- DE
- Germany
- Prior art keywords
- cyclohexanone
- kmol
- via line
- kmoles
- oxime
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- VEZUQRBDRNJBJY-UHFFFAOYSA-N cyclohexanone oxime Chemical compound ON=C1CCCCC1 VEZUQRBDRNJBJY-UHFFFAOYSA-N 0.000 title claims description 52
- 238000000034 method Methods 0.000 title claims description 12
- 230000008569 process Effects 0.000 title claims description 7
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 claims description 61
- 238000006243 chemical reaction Methods 0.000 claims description 35
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical class ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 claims description 23
- 239000002253 acid Substances 0.000 claims description 12
- 150000002923 oximes Chemical class 0.000 claims description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 11
- 239000007864 aqueous solution Substances 0.000 claims description 10
- 239000003960 organic solvent Substances 0.000 claims description 10
- 230000002378 acidificating effect Effects 0.000 claims description 6
- 238000000926 separation method Methods 0.000 claims 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 33
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 24
- 239000000243 solution Substances 0.000 description 13
- 239000010410 layer Substances 0.000 description 11
- 238000000605 extraction Methods 0.000 description 9
- 238000006146 oximation reaction Methods 0.000 description 9
- 239000000203 mixture Substances 0.000 description 8
- 239000002904 solvent Substances 0.000 description 7
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 6
- 239000012266 salt solution Substances 0.000 description 6
- 150000003839 salts Chemical class 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- 239000012429 reaction media Substances 0.000 description 4
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 3
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- MWUXSHHQAYIFBG-UHFFFAOYSA-N Nitric oxide Chemical compound O=[N] MWUXSHHQAYIFBG-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 150000003863 ammonium salts Chemical class 0.000 description 2
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 2
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 2
- 235000011130 ammonium sulphate Nutrition 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- -1 hydroxylammonium ion Chemical class 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- GDOPTJXRTPNYNR-UHFFFAOYSA-N methylcyclopentane Chemical compound CC1CCCC1 GDOPTJXRTPNYNR-UHFFFAOYSA-N 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 230000008707 rearrangement Effects 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- WHXCGIRATPOBAY-VOTSOKGWSA-N (ne)-n-hexan-2-ylidenehydroxylamine Chemical compound CCCC\C(C)=N\O WHXCGIRATPOBAY-VOTSOKGWSA-N 0.000 description 1
- QQZOPKMRPOGIEB-UHFFFAOYSA-N 2-Oxohexane Chemical compound CCCCC(C)=O QQZOPKMRPOGIEB-UHFFFAOYSA-N 0.000 description 1
- WWILHZQYNPQALT-UHFFFAOYSA-N 2-methyl-2-morpholin-4-ylpropanal Chemical compound O=CC(C)(C)N1CCOCC1 WWILHZQYNPQALT-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- VEFXTGTZJOWDOF-UHFFFAOYSA-N benzene;hydrate Chemical compound O.C1=CC=CC=C1 VEFXTGTZJOWDOF-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 150000003997 cyclic ketones Chemical class 0.000 description 1
- CSKROPPOPPCYRH-UHFFFAOYSA-N cyclohexanone;hydrate Chemical compound O.O=C1CCCCC1 CSKROPPOPPCYRH-UHFFFAOYSA-N 0.000 description 1
- HYBIIGFUKKOJJM-UHFFFAOYSA-N cyclohexanone;hydroxylamine Chemical compound ON.O=C1CCCCC1 HYBIIGFUKKOJJM-UHFFFAOYSA-N 0.000 description 1
- 238000010494 dissociation reaction Methods 0.000 description 1
- 230000005593 dissociations Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 210000003608 fece Anatomy 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- RBLWMQWAHONKNC-UHFFFAOYSA-N hydroxyazanium Chemical class O[NH3+] RBLWMQWAHONKNC-UHFFFAOYSA-N 0.000 description 1
- VGYYSIDKAKXZEE-UHFFFAOYSA-L hydroxylammonium sulfate Chemical compound O[NH3+].O[NH3+].[O-]S([O-])(=O)=O VGYYSIDKAKXZEE-UHFFFAOYSA-L 0.000 description 1
- 229910000378 hydroxylammonium sulfate Inorganic materials 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 229910001867 inorganic solvent Inorganic materials 0.000 description 1
- 239000003049 inorganic solvent Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 229910000510 noble metal Inorganic materials 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 238000012856 packing Methods 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003613 toluenes Chemical class 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C251/00—Compounds containing nitrogen atoms doubly-bound to a carbon skeleton
- C07C251/32—Oximes
- C07C251/34—Oximes with oxygen atoms of oxyimino groups bound to hydrogen atoms or to carbon atoms of unsubstituted hydrocarbon radicals
- C07C251/44—Oximes with oxygen atoms of oxyimino groups bound to hydrogen atoms or to carbon atoms of unsubstituted hydrocarbon radicals with the carbon atom of at least one of the oxyimino groups being part of a ring other than a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C249/00—Preparation of compounds containing nitrogen atoms doubly-bound to a carbon skeleton
- C07C249/04—Preparation of compounds containing nitrogen atoms doubly-bound to a carbon skeleton of oximes
- C07C249/08—Preparation of compounds containing nitrogen atoms doubly-bound to a carbon skeleton of oximes by reaction of hydroxylamines with carbonyl compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL6513426A NL6513426A (enExample) | 1965-10-16 | 1965-10-16 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1272288B true DE1272288B (de) | 1968-07-11 |
Family
ID=19794388
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEP1272A Pending DE1272288B (de) | 1965-10-16 | 1966-10-07 | Verfahren zur Herstellung von Cyclohexanonoxim |
Country Status (12)
| Country | Link |
|---|---|
| AT (1) | AT265240B (enExample) |
| BE (1) | BE688260A (enExample) |
| CH (1) | CH481888A (enExample) |
| DE (1) | DE1272288B (enExample) |
| DK (1) | DK117701B (enExample) |
| ES (1) | ES332252A1 (enExample) |
| FR (1) | FR1496435A (enExample) |
| GB (1) | GB1138750A (enExample) |
| IL (1) | IL26663A (enExample) |
| NL (1) | NL6513426A (enExample) |
| NO (1) | NO125629B (enExample) |
| SE (1) | SE338985B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2029114A1 (en) * | 1970-06-12 | 1971-12-16 | Cyclohexanone oxime prepn and sepn by dist- - tillation |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL135679C (enExample) * | 1968-11-12 | 1900-01-01 | ||
| NL6914306A (enExample) * | 1969-09-20 | 1971-03-23 | ||
| US3862230A (en) * | 1969-09-20 | 1975-01-21 | Stamicarbon | Continuous preparation of cyclohexanone oxime |
| US3625835A (en) * | 1970-06-15 | 1971-12-07 | Stamicarbon | Process for the recovery of cyclohexanone oxime by plural stage, vacuum distillation per a |
| NL7008838A (enExample) * | 1970-06-17 | 1971-12-21 | ||
| DE2508247C3 (de) * | 1975-02-26 | 1981-03-12 | Basf Ag, 6700 Ludwigshafen | Verfahren zur Herstellung von Cyclohexanonoxim |
| US4104359A (en) * | 1977-02-28 | 1978-08-01 | Amax Inc. | Regeneration of organic extractants containing α-hydroxyoximes |
| DE3942334A1 (de) * | 1989-12-21 | 1991-06-27 | Basf Ag | Verfahren zur aufarbeitung von salzsaeure, schwefelsaeure und deren hydroxylammonium- und ammoniumsalze enthaltenden waessrigen mutterlaugen |
| US5254734A (en) * | 1991-02-13 | 1993-10-19 | Mitsubishi Kasei Corporation | Method for preparing an oxime |
| EP1299353B1 (en) | 2000-06-05 | 2006-04-12 | DSM IP Assets B.V. | Process for the preparation of cyclohexanone oxime |
| ATE425958T1 (de) * | 2000-06-05 | 2009-04-15 | Dsm Ip Assets Bv | Verfahren zur herstellung von cyclohexanonoxim |
| EP1318141A1 (en) | 2001-12-04 | 2003-06-11 | Dsm Nv | Process for treating an aqueous medium containing phosphate, cyclohexanone and cyclohexanone oxime |
| WO2003048037A1 (en) * | 2001-12-04 | 2003-06-12 | Dsm Ip Assets B.V. | Process for treating an aqueous medium containing phosphate salt and organic compounds |
| DE60126686T2 (de) | 2001-12-04 | 2007-10-31 | Dsm Ip Assets B.V. | Verfahren zur behandlung eines cyclohexanonoxim und cyclohexanon enthaltenden wässrigen mediums |
| US7423178B2 (en) | 2003-01-30 | 2008-09-09 | Dsm Ip Assets B.V. | Process for treating an organic solution comprising cyclohexanone oxime, cyclohexanone, and an organic solvent |
| TW200829544A (en) * | 2007-01-05 | 2008-07-16 | China Petrochemical Dev Corp | Method for preparing cyclohexanone oxime |
| CN103193672B (zh) * | 2013-03-11 | 2014-09-17 | 浙江圣安化工有限公司 | 一种肟的蒸馏方法 |
| CN105384656B (zh) * | 2015-10-23 | 2017-08-25 | 中石化南京工程有限公司 | 一种环己酮肟化的方法 |
| CN105348145B (zh) * | 2015-10-23 | 2018-02-06 | 中石化南京工程有限公司 | 氨法烟气脱硫副产环己酮肟的方法 |
Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2270204A (en) * | 1938-11-28 | 1942-01-13 | Du Pont | Process of producing oximes |
| DE1081884B (de) * | 1959-02-13 | 1960-05-19 | Basf Ag | Verfahren zur Herstellung von Cyclododecanonoxim |
| BE656387A (enExample) * | 1963-11-27 | 1965-05-28 | ||
| AT243243B (de) * | 1962-09-01 | 1965-10-25 | Basf Ag | Verfahren zur Herstellung von Oximen cycloaliphatischer Ketone mit mindestens 12 Kohlenstoffatomen |
-
1965
- 1965-10-16 NL NL6513426A patent/NL6513426A/xx unknown
-
1966
- 1966-10-06 GB GB44743/66A patent/GB1138750A/en not_active Expired
- 1966-10-07 DE DEP1272A patent/DE1272288B/de active Pending
- 1966-10-07 AT AT942866A patent/AT265240B/de active
- 1966-10-10 IL IL26663A patent/IL26663A/xx unknown
- 1966-10-10 CH CH1454566A patent/CH481888A/de not_active IP Right Cessation
- 1966-10-12 FR FR79609A patent/FR1496435A/fr not_active Expired
- 1966-10-14 ES ES0332252A patent/ES332252A1/es not_active Expired
- 1966-10-14 NO NO165161A patent/NO125629B/no unknown
- 1966-10-14 BE BE688260D patent/BE688260A/xx not_active IP Right Cessation
- 1966-10-14 SE SE14007/66A patent/SE338985B/xx unknown
- 1966-10-17 DK DK535566AA patent/DK117701B/da unknown
Patent Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2270204A (en) * | 1938-11-28 | 1942-01-13 | Du Pont | Process of producing oximes |
| DE1081884B (de) * | 1959-02-13 | 1960-05-19 | Basf Ag | Verfahren zur Herstellung von Cyclododecanonoxim |
| AT243243B (de) * | 1962-09-01 | 1965-10-25 | Basf Ag | Verfahren zur Herstellung von Oximen cycloaliphatischer Ketone mit mindestens 12 Kohlenstoffatomen |
| BE656387A (enExample) * | 1963-11-27 | 1965-05-28 |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2029114A1 (en) * | 1970-06-12 | 1971-12-16 | Cyclohexanone oxime prepn and sepn by dist- - tillation |
Also Published As
| Publication number | Publication date |
|---|---|
| AT265240B (de) | 1968-10-10 |
| DK117701B (da) | 1970-05-25 |
| SE338985B (enExample) | 1971-09-27 |
| FR1496435A (fr) | 1967-09-29 |
| ES332252A1 (es) | 1967-07-16 |
| BE688260A (enExample) | 1967-04-14 |
| IL26663A (en) | 1970-09-17 |
| NO125629B (enExample) | 1972-10-09 |
| NL6513426A (enExample) | 1967-04-17 |
| CH481888A (de) | 1969-11-30 |
| GB1138750A (en) | 1969-01-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2901733C2 (enExample) | ||
| DE69824283T2 (de) | Verfahren zur reinigung von caprolactam | |
| DE2332973A1 (de) | Verfahren zur gewinnung von lactamen aus sauren reaktionsgemischen | |
| DE69310007T2 (de) | Herstellung eines organischen Salzes des seltenen Erdmetalls | |
| DE1493198B2 (de) | Verfahren zur herstellung eines aliphatischen oder cycloaliphatischen ketoxims | |
| DE3545196A1 (de) | Verfahren zur aufarbeitung von abfallschwefelsaeure | |
| DE2508247C3 (de) | Verfahren zur Herstellung von Cyclohexanonoxim | |
| DE1567590C2 (de) | Verfahren zur Reinigung und Konzentrierung von Phosphorsäure | |
| DE1246694B (de) | Verfahren zur Gewinnung freier Schwefelsaeure aus Ammoniumbisulfat | |
| DE2338784A1 (de) | Verfahren zur abscheidung von lactamen | |
| DE2046256A1 (de) | Kontinuierliche Herstellung von Cyclohexanonoxim | |
| DE2111792C3 (de) | Verfahren zur Herstellung eines Cyclohexanonoxim/Cyclododecanonoxim-Gemisches | |
| DE954249C (de) | Verfahren zur Trennung von primaeren und tertiaeren Cymolhydroperoxyden | |
| DE1768535A1 (de) | Verfahren zur Trennung von Isomergemischen | |
| DE2646185A1 (de) | Verfahren zur gewinnung von nickel aus einer ammoniakalischen loesung | |
| DE69210245T2 (de) | N-Ethyl-Hydroxamsäure-Chelatbildner | |
| DE854359C (de) | Verfahren zur fortlaufenden Herstellung von Lactamen | |
| EP0019767B1 (de) | Verfahren zur Behandlung von Cyclohexanon und Cyclohexanonoxim enthaltenden Ammoniumhydrogensulfatlösungen | |
| DE34947C (de) | Verfahren zur Verwerthung der bei dem Reinigen der leichten Steinkohlentheeröle resultirenden Abfallsäure | |
| DE1031308B (de) | Verfahren zur Gewinnung von reinem Caprolactam aus dem neutralisierten Reaktionsgemisch der Beckmannschen Umlagerung von Cyclohexanonoxim | |
| DE2129657A1 (de) | Abscheidung von Lactamen aus einem,konzentrierte Schwefelsaeure bzw.Schwefeltrioxyd enthaltenden Medium | |
| DE1545703C3 (enExample) | ||
| DE1770745A1 (de) | Verfahren zur Herstellung von reinem Caprolactam | |
| DE2413448A1 (de) | Verfahren zum reinigen von dicarbonsaeuren | |
| CH417600A (de) | Verfahren zum Ausscheiden eines Lactams aus einem sauren Reaktionsgemisch |