DE1242579B - Verfahren zur Wiedergewinnung von Chlorwasserstoffsaeure aus einem durch katalytische Oxydation von Chlorwasserstoffgas mit einem sauerstoffhaltigen Gas erhaltenen Gasgemisch - Google Patents
Verfahren zur Wiedergewinnung von Chlorwasserstoffsaeure aus einem durch katalytische Oxydation von Chlorwasserstoffgas mit einem sauerstoffhaltigen Gas erhaltenen GasgemischInfo
- Publication number
- DE1242579B DE1242579B DES84734A DES0084734A DE1242579B DE 1242579 B DE1242579 B DE 1242579B DE S84734 A DES84734 A DE S84734A DE S0084734 A DES0084734 A DE S0084734A DE 1242579 B DE1242579 B DE 1242579B
- Authority
- DE
- Germany
- Prior art keywords
- gas
- hydrochloric acid
- gas mixture
- hydrogen chloride
- temperature
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 title claims description 129
- 239000007789 gas Substances 0.000 title claims description 104
- 239000000203 mixture Substances 0.000 title claims description 64
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 title claims description 38
- 229910000041 hydrogen chloride Inorganic materials 0.000 title claims description 38
- 238000000034 method Methods 0.000 title claims description 14
- 238000007254 oxidation reaction Methods 0.000 title claims description 13
- 230000003647 oxidation Effects 0.000 title claims description 11
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 title claims description 7
- 239000001301 oxygen Substances 0.000 title claims description 7
- 229910052760 oxygen Inorganic materials 0.000 title claims description 7
- 230000003197 catalytic effect Effects 0.000 title claims description 5
- 238000011084 recovery Methods 0.000 title claims description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 27
- 238000005406 washing Methods 0.000 claims description 24
- 238000010791 quenching Methods 0.000 claims description 20
- 230000000171 quenching effect Effects 0.000 claims description 18
- 229910001868 water Inorganic materials 0.000 claims description 17
- 239000003054 catalyst Substances 0.000 claims description 15
- 238000006243 chemical reaction Methods 0.000 description 28
- 239000007788 liquid Substances 0.000 description 20
- 239000000460 chlorine Substances 0.000 description 16
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 14
- 229910052801 chlorine Inorganic materials 0.000 description 14
- 238000002156 mixing Methods 0.000 description 9
- 239000002253 acid Substances 0.000 description 7
- 239000012535 impurity Substances 0.000 description 7
- 229910052751 metal Inorganic materials 0.000 description 7
- 239000002184 metal Substances 0.000 description 7
- 238000000926 separation method Methods 0.000 description 6
- 239000006227 byproduct Substances 0.000 description 5
- 239000002245 particle Substances 0.000 description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 238000005201 scrubbing Methods 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 150000002739 metals Chemical class 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- 238000010626 work up procedure Methods 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 238000005660 chlorination reaction Methods 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000002386 leaching Methods 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- OSDWBNJEKMUWAV-UHFFFAOYSA-N Allyl chloride Chemical compound ClCC=C OSDWBNJEKMUWAV-UHFFFAOYSA-N 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- PPNXXZIBFHTHDM-UHFFFAOYSA-N aluminium phosphide Chemical compound P#[Al] PPNXXZIBFHTHDM-UHFFFAOYSA-N 0.000 description 1
- 239000007809 chemical reaction catalyst Substances 0.000 description 1
- 150000001804 chlorine Chemical class 0.000 description 1
- GENIWTPCINNSKK-UHFFFAOYSA-N chloroethene 1,1-dichloroethane Chemical compound ClC(C)Cl.C(=C)Cl GENIWTPCINNSKK-UHFFFAOYSA-N 0.000 description 1
- -1 compound salts Chemical class 0.000 description 1
- 239000012084 conversion product Substances 0.000 description 1
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 1
- 238000005336 cracking Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- PXJJSXABGXMUSU-UHFFFAOYSA-N disulfur dichloride Chemical compound ClSSCl PXJJSXABGXMUSU-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- WTQUHLHXFJEOTI-UHFFFAOYSA-H trichloroneodymium;trichloropraseodymium Chemical compound Cl[Pr](Cl)Cl.Cl[Nd](Cl)Cl WTQUHLHXFJEOTI-UHFFFAOYSA-H 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B7/00—Halogens; Halogen acids
- C01B7/01—Chlorine; Hydrogen chloride
- C01B7/07—Purification ; Separation
- C01B7/0706—Purification ; Separation of hydrogen chloride
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Processing Of Solid Wastes (AREA)
- Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL277454 | 1962-04-19 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1242579B true DE1242579B (de) | 1967-06-22 |
Family
ID=19753770
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DES84734A Pending DE1242579B (de) | 1962-04-19 | 1963-04-17 | Verfahren zur Wiedergewinnung von Chlorwasserstoffsaeure aus einem durch katalytische Oxydation von Chlorwasserstoffgas mit einem sauerstoffhaltigen Gas erhaltenen Gasgemisch |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3242647A (Direct) |
| BE (1) | BE631187A (Direct) |
| DE (1) | DE1242579B (Direct) |
| ES (1) | ES287122A1 (Direct) |
| GB (1) | GB991081A (Direct) |
| NL (1) | NL277454A (Direct) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2634959A1 (de) * | 1976-08-04 | 1978-02-09 | Hoechst Ag | Verfahren zur gewinnung von salzsaeure durch entfernung von chlorwasserstoff aus verbrennungsgasen |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3516790A (en) * | 1967-05-20 | 1970-06-23 | Chemech Eng Ltd | Process and apparatus for preparing chlorine dioxide |
| US3593494A (en) * | 1968-08-08 | 1971-07-20 | Geigy Chem Corp | Process for the separation of gaseous mixtures of cyanogen chloride and hydrogen chloride |
| US3537818A (en) * | 1968-10-22 | 1970-11-03 | Atlantic Richfield Co | Purification of hydrogen chloride produced by the chlorination of paraffin hydrocarbons |
| CN102351149B (zh) * | 2011-06-30 | 2013-06-05 | 仇晓丰 | 氯化氢中氯气的去除和回收系统 |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1327536A (en) * | 1918-02-20 | 1920-01-06 | L M Freeman | Process for chemical separation of ores |
| US2644846A (en) * | 1948-12-11 | 1953-07-07 | Shell Dev | Hydrogen chloride oxidation |
| US2730194A (en) * | 1952-04-04 | 1956-01-10 | Michigan Chem Corp | Hydrochloric acid from chloral vent gases |
| US2929682A (en) * | 1957-03-28 | 1960-03-22 | Phillips Petroleum Co | Process for the production of hydrogen halide from a friedel-crafts metal halide sludge |
| BE568078A (Direct) * | 1957-07-31 | |||
| US3049417A (en) * | 1958-04-01 | 1962-08-14 | Fisons Ltd | Process for the production of fertilizer materials |
| US3054831A (en) * | 1958-04-10 | 1962-09-18 | Union Carbide Corp | Halogenation of organic compounds over a narrow temperature range |
| US3113972A (en) * | 1959-02-04 | 1963-12-10 | Sumitomo Chemical Co | Process for producing a highly concentrated formaldehyde solution |
| NL253964A (Direct) * | 1959-07-20 | |||
| US3079231A (en) * | 1959-08-24 | 1963-02-26 | Diamond Alkali Co | Cooling process for hci-containing gas |
| US3073092A (en) * | 1959-12-28 | 1963-01-15 | British Titan Products | Cooling of vapour-phase oxidation products |
| DE1119832B (de) * | 1960-07-22 | 1961-12-21 | Knapsack Ag | Verfahren zur Herstellung von Chlorwasserstoff |
| NL272865A (Direct) * | 1960-12-22 | |||
| NL272867A (Direct) * | 1960-12-22 | |||
| US3131028A (en) * | 1962-05-07 | 1964-04-28 | Hercules Powder Co Ltd | Catalytic oxidation reaction of a hydrogen halide to produce the corresponding halogen in a single stage, homogeneous, vapor phase using no as a catalyst |
-
0
- NL NL277454D patent/NL277454A/xx unknown
- BE BE631187D patent/BE631187A/xx unknown
-
1963
- 1963-04-04 US US270662A patent/US3242647A/en not_active Expired - Lifetime
- 1963-04-17 GB GB15065/63A patent/GB991081A/en not_active Expired
- 1963-04-17 DE DES84734A patent/DE1242579B/de active Pending
- 1963-04-17 ES ES287122A patent/ES287122A1/es not_active Expired
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2634959A1 (de) * | 1976-08-04 | 1978-02-09 | Hoechst Ag | Verfahren zur gewinnung von salzsaeure durch entfernung von chlorwasserstoff aus verbrennungsgasen |
Also Published As
| Publication number | Publication date |
|---|---|
| BE631187A (Direct) | |
| GB991081A (en) | 1965-05-05 |
| US3242647A (en) | 1966-03-29 |
| NL277454A (Direct) | |
| ES287122A1 (es) | 1963-11-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2626133A1 (de) | Zyklisches verfahren zur herstellung von aethylendichlorid | |
| EP0411162B1 (de) | Verfahren zur Entfernung von Chlor aus Abgasen | |
| DE1190919B (de) | Verfahren zur Herstellung von Chlor und Stickstoffdioxyd | |
| DE1693042A1 (de) | Verfahren zur Herstellung von Vinylchlorid | |
| DE2636877A1 (de) | Verfahren zur herstellung von gereinigter terephthalsaeure | |
| DE910536C (de) | Verfahren zur Gewinnung von reinem Schwefeltrioxyd | |
| DE3201993A1 (de) | Isolierung des chlorgehalts bei einem integrierten prozess zur oxichlorierung und verbrennung von chlorierten kohlenwasserstoffen | |
| AT239809B (de) | Verfahren zur Wiedergewinnung von Chlorwasserstoffsäure aus einem durch katalytische Oxydation von Chlorwasserstoffgas mit einem sauerstoffhaltigen Gas erhaltenen Gasgemisch | |
| DE2136744C3 (de) | Verfahren zur Herstellung von Cyclohexylhydroperoxid enthaltenden Oxidationsprodukten | |
| DE2714027A1 (de) | Verfahren zur wiedergewinnung von chlorwasserstoff | |
| EP0212217B1 (de) | Verfahren zur Stabilisierung von sauren Waschwässern | |
| DE961708C (de) | Verfahren zur Gewinnung von Dihydroperoxyden aus den bei der Oxydation substituierter aromatischer Kohlenwasserstoffe erhaltenen Gemischen | |
| DE1815336A1 (de) | Verfahren zur Entfernung von in 1,2-Dichloraethan vorhandenem Trichloraethylen | |
| DE3000277A1 (de) | Verfahren zur herstellung von allylchlorid | |
| DE2530448A1 (de) | Verfahren zur reinigung von vinylidenchlorid | |
| DE2820394A1 (de) | Verfahren zur oxidation von p-methylbenzoesaeure | |
| DE2533508C3 (de) | Verfahren zur Herstellung von hochreinem Tetrachlorkohlenstoff | |
| DE1282634B (de) | Verfahren zur Wiedergewinnung von Kupfer und Vanadin aus den Mutterlaugen der Adipinsaeureherstellung | |
| DE937470C (de) | Verfahren zur Herstellung von Chlordioxyd | |
| DE1244765B (de) | Verfahren zur Herstellung eines Vinylesters | |
| DE1667396C3 (de) | Verfahren zur Abtrennung von Brom aus stickoxidhaltigen Gasgemischen | |
| DE1063158B (de) | Verfahren zur Herstellung von Dialkylsulfoxyden | |
| DE1468807C3 (de) | Verfahren zur kontinuierlichen Herstellung chlorierter Äthylenderivate | |
| DE1915194A1 (de) | Verfahren zur Verminderung des Chloridgehalts von Olefinderivaten,wie Vinylacetat | |
| DE1567996C (de) | Kontinuierliches Verfahren zur Herstellung von Kaliumnitrat |