DE1241829B - Verfahren zur Herstellung von Estern des 3-Phenyl-3-hydroxypyrrolidins und ihren Salzen - Google Patents
Verfahren zur Herstellung von Estern des 3-Phenyl-3-hydroxypyrrolidins und ihren SalzenInfo
- Publication number
- DE1241829B DE1241829B DEP26856A DEP0026856A DE1241829B DE 1241829 B DE1241829 B DE 1241829B DE P26856 A DEP26856 A DE P26856A DE P0026856 A DEP0026856 A DE P0026856A DE 1241829 B DE1241829 B DE 1241829B
- Authority
- DE
- Germany
- Prior art keywords
- phenyl
- salts
- lower alkyl
- esters
- preparation
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000003839 salts Chemical class 0.000 title claims description 10
- 238000000034 method Methods 0.000 title claims description 8
- AFQYBBFSDHKQJV-UHFFFAOYSA-N 3-phenylpyrrolidin-3-ol Chemical compound C=1C=CC=CC=1C1(O)CCNC1 AFQYBBFSDHKQJV-UHFFFAOYSA-N 0.000 title claims description 5
- 150000002148 esters Chemical class 0.000 title claims description 5
- 238000002360 preparation method Methods 0.000 title claims description 5
- 239000002253 acid Substances 0.000 claims description 8
- 150000001875 compounds Chemical class 0.000 claims description 4
- 150000007513 acids Chemical class 0.000 claims description 3
- 125000003342 alkenyl group Chemical group 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 3
- 150000001298 alcohols Chemical class 0.000 claims description 2
- 150000007514 bases Chemical class 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 125000003884 phenylalkyl group Chemical group 0.000 claims description 2
- 229940079593 drug Drugs 0.000 claims 1
- 239000003814 drug Substances 0.000 claims 1
- -1 sulfuric acid ester Chemical class 0.000 claims 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- 241000700159 Rattus Species 0.000 description 6
- 239000012458 free base Substances 0.000 description 6
- 230000000202 analgesic effect Effects 0.000 description 5
- ZHEFOKKUFMPNTK-UHFFFAOYSA-N Cl.CC1NCCC1(OC(CC)=O)C1=CC=CC=C1 Chemical compound Cl.CC1NCCC1(OC(CC)=O)C1=CC=CC=C1 ZHEFOKKUFMPNTK-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 4
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- LUKSBMJXPCFBKO-UHFFFAOYSA-N prodilidine Chemical compound C=1C=CC=CC=1C1(OC(=O)CC)CCN(C)C1C LUKSBMJXPCFBKO-UHFFFAOYSA-N 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 231100000419 toxicity Toxicity 0.000 description 3
- 230000001988 toxicity Effects 0.000 description 3
- 241000700198 Cavia Species 0.000 description 2
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 239000012259 ether extract Substances 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 231100000636 lethal dose Toxicity 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- RJXLFZCMMQPELA-UHFFFAOYSA-N (1-benzyl-2-methyl-3-phenylpyrrolidin-3-yl) propanoate Chemical compound CC1C(OC(=O)CC)(C=2C=CC=CC=2)CCN1CC1=CC=CC=C1 RJXLFZCMMQPELA-UHFFFAOYSA-N 0.000 description 1
- BLRDJWDKGIIOSB-UHFFFAOYSA-N (2-methyl-3-phenylpyrrolidin-3-yl) propanoate Chemical compound C=1C=CC=CC=1C1(OC(=O)CC)CCNC1C BLRDJWDKGIIOSB-UHFFFAOYSA-N 0.000 description 1
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 description 1
- WMPPDTMATNBGJN-UHFFFAOYSA-N 2-phenylethylbromide Chemical compound BrCCC1=CC=CC=C1 WMPPDTMATNBGJN-UHFFFAOYSA-N 0.000 description 1
- MWTGBAURSCEGSL-UHFFFAOYSA-N 3-(benzylamino)propanenitrile Chemical compound N#CCCNCC1=CC=CC=C1 MWTGBAURSCEGSL-UHFFFAOYSA-N 0.000 description 1
- RUROFEVDCUGKHD-UHFFFAOYSA-N 3-bromoprop-1-enylbenzene Chemical compound BrCC=CC1=CC=CC=C1 RUROFEVDCUGKHD-UHFFFAOYSA-N 0.000 description 1
- XZBXAYCCBFTQHH-UHFFFAOYSA-N 3-chloropropylbenzene Chemical compound ClCCCC1=CC=CC=C1 XZBXAYCCBFTQHH-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- OSDWBNJEKMUWAV-UHFFFAOYSA-N Allyl chloride Chemical compound ClCC=C OSDWBNJEKMUWAV-UHFFFAOYSA-N 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 241001071864 Lethrinus laticaudis Species 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- AXWOILDRFGJMLL-UHFFFAOYSA-N [2-methyl-3-phenyl-1-(2-phenylethyl)pyrrolidin-3-yl] propanoate Chemical compound CC1C(OC(=O)CC)(C=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 AXWOILDRFGJMLL-UHFFFAOYSA-N 0.000 description 1
- 229940035676 analgesics Drugs 0.000 description 1
- 239000000730 antalgic agent Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 230000036461 convulsion Effects 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- PSLIMVZEAPALCD-UHFFFAOYSA-N ethanol;ethoxyethane Chemical compound CCO.CCOCC PSLIMVZEAPALCD-UHFFFAOYSA-N 0.000 description 1
- YKWNUSJLICDQEO-UHFFFAOYSA-N ethoxyethane;propan-2-ol Chemical compound CC(C)O.CCOCC YKWNUSJLICDQEO-UHFFFAOYSA-N 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 125000001183 hydrocarbyl group Chemical group 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 231100001231 less toxic Toxicity 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- NHKJPPKXDNZFBJ-UHFFFAOYSA-N phenyllithium Chemical compound [Li]C1=CC=CC=C1 NHKJPPKXDNZFBJ-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000010972 statistical evaluation Methods 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-M sulfamate Chemical compound NS([O-])(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-M 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/10—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/12—Oxygen or sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/24—Oxygen or sulfur atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyrrole Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Hydrogenated Pyridines (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB10617/58A GB862513A (en) | 1958-04-02 | 1958-04-02 | Pyrrolidine compounds and methods for producing the same |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1241829B true DE1241829B (de) | 1967-06-08 |
Family
ID=9971170
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEP26856A Pending DE1241829B (de) | 1958-04-02 | 1959-04-01 | Verfahren zur Herstellung von Estern des 3-Phenyl-3-hydroxypyrrolidins und ihren Salzen |
| DEP22513A Pending DE1176144B (de) | 1958-04-02 | 1959-04-01 | Verfahren zur Herstellung von Estern des 3-Phenyl-3-hydroxypyrrolidins und deren Salzen |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEP22513A Pending DE1176144B (de) | 1958-04-02 | 1959-04-01 | Verfahren zur Herstellung von Estern des 3-Phenyl-3-hydroxypyrrolidins und deren Salzen |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3256297A (cg-RX-API-DMAC10.html) |
| CH (1) | CH392508A (cg-RX-API-DMAC10.html) |
| DE (2) | DE1241829B (cg-RX-API-DMAC10.html) |
| ES (1) | ES247911A1 (cg-RX-API-DMAC10.html) |
| FR (2) | FR1374302A (cg-RX-API-DMAC10.html) |
| GB (1) | GB862513A (cg-RX-API-DMAC10.html) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3185702A (en) * | 1959-03-16 | 1965-05-25 | Lunsford Carl Dalton | Basic esters of 3-aryl-3-pyrrolidinols |
| US3462452A (en) * | 1966-05-17 | 1969-08-19 | Parke Davis & Co | 1-phenethyl or p-aminophenethyl-3-(m-hydroxy- or alkanoyloxy-phenyl)-3-propylpyrrolidines and salts thereof |
| US4774340A (en) * | 1984-04-06 | 1988-09-27 | Miles Inc. | Method for preparing 3-hydroxy pyrroles and esters thereof |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2878264A (en) * | 1959-03-17 | Substituted amino alcohols | ||
| US2880211A (en) * | 1959-03-31 | Chcoochj | ||
| US2850500A (en) * | 1958-09-02 | Chjchzcoochj | ||
| US2824875A (en) * | 1958-02-25 | Certificate of correction | ||
| GB483258A (en) * | 1936-06-08 | 1938-04-14 | Arthur George Bloxam | Manufacture of basic esters of polyarylacetic acids |
| GB629196A (en) * | 1946-07-08 | 1949-09-14 | Roche Products Ltd | Piperidine derivatives |
| NL94071C (cg-RX-API-DMAC10.html) * | 1954-04-20 | |||
| US2765314A (en) * | 1954-05-12 | 1956-10-02 | Rohm & Haas | Preparation of esters |
| US2784192A (en) * | 1954-06-24 | 1957-03-05 | Rohm & Haas | Preparation of 4-hydroxypiperidines |
| US2846437A (en) * | 1955-09-12 | 1958-08-05 | Sterling Drug Inc | Lower alkyl 4-phenyl-1-(substituted-alkyl) piperidine-4-carboxylates and preparationthereof |
-
1958
- 1958-04-02 GB GB10617/58A patent/GB862513A/en not_active Expired
-
1959
- 1959-03-14 ES ES0247911A patent/ES247911A1/es not_active Expired
- 1959-03-20 US US800643A patent/US3256297A/en not_active Expired - Lifetime
- 1959-03-31 CH CH7139059A patent/CH392508A/fr unknown
- 1959-03-31 FR FR790838A patent/FR1374302A/fr not_active Expired
- 1959-04-01 DE DEP26856A patent/DE1241829B/de active Pending
- 1959-04-01 DE DEP22513A patent/DE1176144B/de active Pending
-
1960
- 1960-08-31 FR FR837391A patent/FR594M/fr active Active
Non-Patent Citations (1)
| Title |
|---|
| None * |
Also Published As
| Publication number | Publication date |
|---|---|
| FR1374302A (fr) | 1964-10-09 |
| DE1176144B (de) | 1964-08-20 |
| CH392508A (fr) | 1965-05-31 |
| US3256297A (en) | 1966-06-14 |
| ES247911A1 (es) | 1959-08-16 |
| FR594M (cg-RX-API-DMAC10.html) | 1961-06-12 |
| GB862513A (en) | 1961-03-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69513140T2 (de) | Neue phenylalkylaminoalkohol-carbamate und ein verfahren zu ihrer herstellung | |
| DE1643296C3 (de) | l-Aryl-2-alkylaminoäthanole und deren physiologisch verträgliche Säureadditionssalze, Verfahren zu deren Herstellung und sie enthaltende Arzneimittel | |
| EP0026848A1 (de) | Tetralinderivate, ihre Herstellung und Heilmittel, welche diese Verbindungen enthalten | |
| DE1112514B (de) | Verfahren zur Herstellung von analgetisch wirksamen basischen Carbonsaeureamiden | |
| DE1241829B (de) | Verfahren zur Herstellung von Estern des 3-Phenyl-3-hydroxypyrrolidins und ihren Salzen | |
| DE1670622A1 (de) | Verfahren zur Herstellung von Aminoalkyl-pyrrol-2-yl-ketonen | |
| DE684432C (de) | Verfahren zur Darstellung quaternaerer Anlagerungsverbindungen der Pyridin-, Chinolin- und Isochinolinreihe | |
| DE2318575A1 (de) | Neue oxazolidinone | |
| DE2543821A1 (de) | Cyclische aminosaeuren | |
| DE1966215A1 (de) | Verfahren zur Herstellung von heterocyclischen Benzamiden | |
| DE2709109A1 (de) | Verfahren zur herstellung von 1-tert.butylamino-3-(2,5-dichlorphenoxy)-2-propanol einschliesslich seiner enantiomere sowie von saeureadditionssalzen desselben | |
| DE1257152B (de) | Verfahren zur Herstellung substituierter Malonsaeurehydrazide | |
| AT213884B (de) | Verfahren zur Herstellung von neuen 3-Phenyl-3-pyrrolidinol-Verbindungen | |
| DE1235310B (de) | Verfahren zur Herstellung von Nopinsaeurederivaten | |
| DE1227462B (de) | Verfahren zur Herstellung von Chinolinderivaten | |
| AT220150B (de) | Verfahren zur Herstellung von neuen, substituierten Piperidinen | |
| DE1445469C (de) | 1 - Amino^-hydroxy^-phenyl-piperidinderivate, ihre Säureadditionssalze und Verfahren zu ihrer Herstellung | |
| DE1670258A1 (de) | Verfahren zur Entalkylierung cyclischer N-Alkyl-aminoverbindungen | |
| DE1518207C (de) | Verfahren zur Herstellung von neuen Phenylcyclopropandenvaten bzw deren Salzen und quaternaren Ammomumverbin düngen | |
| AT289777B (de) | Verfahren zur Herstellung von neuen heterocyklischen Benzamidderivaten und ihren Salzen | |
| DE2822473A1 (de) | Alkanolaminderivate, verfahren zu ihrer herstellung und sie enthaltende pharmazeutische zusammensetzungen | |
| AT226732B (de) | Verfahren zur Herstellung von neuen Guanidinverbindungen | |
| DE2165400A1 (de) | erythro-Phenylaminopropanolderivate und ihre Salze, Verfahren zu ihrer stereospezifischen Herstellung und diese Verbindungen enthaltende Arzneipräparate | |
| DE2229359A1 (de) | Neue 1-benzoyloxy-2-niedere-alkylaminobenzocycloalkanderivate | |
| DE1518310B1 (de) | Substituierte N-(tert.-Aminoalkyl)-benzamide sowie ihre Additionssalze und quartaeren Ammoniumderivate |