DE1225388B - Verfahren zur Herstellung von hochpolymeren Poly-(alkylenglykolterephthalaten) - Google Patents
Verfahren zur Herstellung von hochpolymeren Poly-(alkylenglykolterephthalaten)Info
- Publication number
- DE1225388B DE1225388B DE1961N0019998 DEN0019998A DE1225388B DE 1225388 B DE1225388 B DE 1225388B DE 1961N0019998 DE1961N0019998 DE 1961N0019998 DE N0019998 A DEN0019998 A DE N0019998A DE 1225388 B DE1225388 B DE 1225388B
- Authority
- DE
- Germany
- Prior art keywords
- weight
- parts
- polyester
- poise
- viscosity
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- -1 poly (alkylene glycol terephthalates Chemical class 0.000 title claims description 23
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 title claims description 20
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 title claims description 11
- 238000000034 method Methods 0.000 title claims description 9
- 229920000642 polymer Polymers 0.000 title claims description 6
- 238000004519 manufacturing process Methods 0.000 title claims description 5
- 229920000728 polyester Polymers 0.000 claims description 18
- 229910052751 metal Inorganic materials 0.000 claims description 10
- 239000002184 metal Substances 0.000 claims description 10
- 238000006068 polycondensation reaction Methods 0.000 claims description 10
- 238000005809 transesterification reaction Methods 0.000 claims description 10
- 239000003054 catalyst Substances 0.000 claims description 9
- 229910019142 PO4 Inorganic materials 0.000 claims description 8
- 239000000155 melt Substances 0.000 claims description 8
- KKEYFWRCBNTPAC-UHFFFAOYSA-L terephthalate(2-) Chemical compound [O-]C(=O)C1=CC=C(C([O-])=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-L 0.000 claims description 7
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 6
- ADCOVFLJGNWWNZ-UHFFFAOYSA-N antimony trioxide Chemical compound O=[Sb]O[Sb]=O ADCOVFLJGNWWNZ-UHFFFAOYSA-N 0.000 claims description 6
- ZOIORXHNWRGPMV-UHFFFAOYSA-N acetic acid;zinc Chemical compound [Zn].CC(O)=O.CC(O)=O ZOIORXHNWRGPMV-UHFFFAOYSA-N 0.000 claims description 5
- 239000011574 phosphorus Substances 0.000 claims description 5
- 229910052698 phosphorus Inorganic materials 0.000 claims description 5
- 239000004246 zinc acetate Substances 0.000 claims description 5
- 239000010452 phosphate Substances 0.000 claims description 4
- 239000011734 sodium Substances 0.000 claims description 4
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 3
- 239000011777 magnesium Substances 0.000 claims description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 3
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 claims description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 2
- 229910052788 barium Inorganic materials 0.000 claims description 2
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 claims description 2
- 229910052791 calcium Inorganic materials 0.000 claims description 2
- 239000011575 calcium Substances 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 238000010438 heat treatment Methods 0.000 claims description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 2
- 229910052744 lithium Inorganic materials 0.000 claims description 2
- 229910052749 magnesium Inorganic materials 0.000 claims description 2
- 150000002739 metals Chemical class 0.000 claims description 2
- 239000011591 potassium Substances 0.000 claims description 2
- 229910052700 potassium Inorganic materials 0.000 claims description 2
- 229910052708 sodium Inorganic materials 0.000 claims description 2
- 229910052712 strontium Inorganic materials 0.000 claims description 2
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 claims description 2
- 229910052725 zinc Inorganic materials 0.000 claims description 2
- 239000011701 zinc Substances 0.000 claims description 2
- 239000001506 calcium phosphate Substances 0.000 claims 1
- 229910000389 calcium phosphate Inorganic materials 0.000 claims 1
- 210000003298 dental enamel Anatomy 0.000 claims 1
- UEGPKNKPLBYCNK-UHFFFAOYSA-L magnesium acetate Chemical compound [Mg+2].CC([O-])=O.CC([O-])=O UEGPKNKPLBYCNK-UHFFFAOYSA-L 0.000 claims 1
- 239000011654 magnesium acetate Substances 0.000 claims 1
- 229940069446 magnesium acetate Drugs 0.000 claims 1
- 235000011285 magnesium acetate Nutrition 0.000 claims 1
- 239000000047 product Substances 0.000 description 11
- FYIBGDKNYYMMAG-UHFFFAOYSA-N ethane-1,2-diol;terephthalic acid Chemical compound OCCO.OC(=O)C1=CC=C(C(O)=O)C=C1 FYIBGDKNYYMMAG-UHFFFAOYSA-N 0.000 description 10
- 229920001223 polyethylene glycol Polymers 0.000 description 9
- 239000000835 fiber Substances 0.000 description 6
- 235000021317 phosphate Nutrition 0.000 description 6
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- WOZVHXUHUFLZGK-UHFFFAOYSA-N dimethyl terephthalate Chemical compound COC(=O)C1=CC=C(C(=O)OC)C=C1 WOZVHXUHUFLZGK-UHFFFAOYSA-N 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 239000004753 textile Substances 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- RLSSMJSEOOYNOY-UHFFFAOYSA-N m-cresol Chemical compound CC1=CC=CC(O)=C1 RLSSMJSEOOYNOY-UHFFFAOYSA-N 0.000 description 2
- 238000002074 melt spinning Methods 0.000 description 2
- 229940100630 metacresol Drugs 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 150000003871 sulfonates Chemical class 0.000 description 2
- 101100453960 Drosophila melanogaster klar gene Proteins 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- VSGNNIFQASZAOI-UHFFFAOYSA-L calcium acetate Chemical compound [Ca+2].CC([O-])=O.CC([O-])=O VSGNNIFQASZAOI-UHFFFAOYSA-L 0.000 description 1
- 239000001639 calcium acetate Substances 0.000 description 1
- 229960005147 calcium acetate Drugs 0.000 description 1
- 235000011092 calcium acetate Nutrition 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 229910000464 lead oxide Inorganic materials 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- YEXPOXQUZXUXJW-UHFFFAOYSA-N oxolead Chemical compound [Pb]=O YEXPOXQUZXUXJW-UHFFFAOYSA-N 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000009987 spinning Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G63/00—Macromolecular compounds obtained by reactions forming a carboxylic ester link in the main chain of the macromolecule
- C08G63/68—Polyesters containing atoms other than carbon, hydrogen and oxygen
- C08G63/692—Polyesters containing atoms other than carbon, hydrogen and oxygen containing phosphorus
- C08G63/6924—Polyesters containing atoms other than carbon, hydrogen and oxygen containing phosphorus derived from polycarboxylic acids and polyhydroxy compounds
- C08G63/6926—Dicarboxylic acids and dihydroxy compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyesters Or Polycarbonates (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL251344 | 1960-05-07 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1225388B true DE1225388B (de) | 1966-09-22 |
Family
ID=34511307
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1961N0019998 Pending DE1225388B (de) | 1960-05-07 | 1961-05-04 | Verfahren zur Herstellung von hochpolymeren Poly-(alkylenglykolterephthalaten) |
Country Status (6)
| Country | Link |
|---|---|
| BE (1) | BE603443A (enExample) |
| DE (1) | DE1225388B (enExample) |
| ES (1) | ES267195A1 (enExample) |
| FR (1) | FR1296615A (enExample) |
| GB (1) | GB951213A (enExample) |
| NL (1) | NL251344A (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2412216B2 (de) | 1974-03-14 | 1979-12-13 | Davy International Ag, 6000 Frankfurt | Verfahren zur Herstellung von linearen Polyestern |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB769220A (en) * | 1953-09-30 | 1957-03-06 | Du Pont | Polyglycol terephthalates |
-
1960
- 1960-05-07 NL NL251344D patent/NL251344A/nl unknown
-
1961
- 1961-04-28 FR FR860222A patent/FR1296615A/fr not_active Expired
- 1961-05-04 DE DE1961N0019998 patent/DE1225388B/de active Pending
- 1961-05-05 BE BE603443A patent/BE603443A/nl unknown
- 1961-05-05 GB GB1646161A patent/GB951213A/en not_active Expired
- 1961-05-06 ES ES0267195A patent/ES267195A1/es not_active Expired
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB769220A (en) * | 1953-09-30 | 1957-03-06 | Du Pont | Polyglycol terephthalates |
Also Published As
| Publication number | Publication date |
|---|---|
| NL251344A (enExample) | 1964-02-25 |
| FR1296615A (fr) | 1962-06-22 |
| BE603443A (nl) | 1961-11-06 |
| ES267195A1 (es) | 1961-11-01 |
| GB951213A (en) | 1964-03-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2454189B2 (de) | Verfahren zur Herstellung von schwer entflammbaren linearen Polyestern | |
| DE1812997B2 (de) | Modifizierte Polyestermassen | |
| DE1108432B (de) | Verfahren zur Herstellung von Polyaethylenterephthalat | |
| DE1225388B (de) | Verfahren zur Herstellung von hochpolymeren Poly-(alkylenglykolterephthalaten) | |
| DE1595378C3 (de) | Verfahren zur Herstellung von modifizierten Polyestern | |
| DE1520079B2 (de) | Verfahren zur herstellung hochpolymerer polymethylenterephthalate | |
| CH495395A (de) | Verfahren zur Herstellung von synthetischen hochmolekularen Polyestern | |
| DE1420483B2 (de) | Verfahren zum herstellen mattierter linearer polyester hohen molekulargewichtes | |
| DE1595045A1 (de) | Verfahren zur Herstellung von Polyestern aus Terephthalsaeure und Glykolen | |
| DE1247542B (de) | Spinnmassen auf Grundlage von Gemischen, die lineare Polyester und Zusatzstoffe enthalten | |
| DE1495777B2 (de) | Verfahren zur herstellung von linearen hochmolekularen poly estern | |
| DE1273196B (de) | Verfahren zur Herstellung von Poly-(aethylenglykolterephthalat) | |
| CH410414A (de) | Verfahren zur Herstellung von Mischpolyestern aus Diglykolestern aromatischer Dicarbonsäuren und Phosphorsäure | |
| DE1950553A1 (de) | Verfahren zur Herstellung von Polyaethylenterephthalat | |
| DE2526749C2 (de) | Verfahren zur Herstellung von flammwidrigem Polybutylenterephthalat | |
| DE1301558B (de) | Verfahren zur Herstellung von Poly-(aethylenglykolterephthalat) | |
| DE1251951B (de) | Verfahren zur Herstellung linearer faserbildender Polyester | |
| DE2019429A1 (de) | Verfahren zur Herstellung von Terephthalsaeurepolyestern mit verbesserten Eigenschaften | |
| DE1271397B (de) | Verfahren zur Herstellung von spinnfaehigem Poly-(aethylenglykolterephthalat) | |
| DE2146055A1 (de) | Glasklare, lineare, thermoplastische copolyester und verfahren zu ihrer herstellung | |
| DE1645394A1 (de) | Verfahren zur Herstellung von Polyestern,insbesondere von linearen Polyaethylenterephthalaten | |
| AT257940B (de) | Verfahren zur Herstellung linearer Copolyester | |
| DE1520079C (de) | Verfahren zur Herstellung hochpolymerer Polymethylenterephthalate | |
| DE1618886C (de) | Verfahren zur Stabilisierung von alpha, alpha Dimethyl beta propiolacton | |
| DE2243425B2 (de) | Sulfonsaure Salze mit antistatischer Wirksamkeit |