DE1224500B - Verfahren zur Herstellung von Emulsionspolymerisaten - Google Patents
Verfahren zur Herstellung von EmulsionspolymerisatenInfo
- Publication number
- DE1224500B DE1224500B DED27727A DED0027727A DE1224500B DE 1224500 B DE1224500 B DE 1224500B DE D27727 A DED27727 A DE D27727A DE D0027727 A DED0027727 A DE D0027727A DE 1224500 B DE1224500 B DE 1224500B
- Authority
- DE
- Germany
- Prior art keywords
- acid
- acrylate
- sulfo
- hydroxy
- mixture
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 14
- 239000004908 Emulsion polymer Substances 0.000 title claims description 6
- 238000004519 manufacturing process Methods 0.000 title description 11
- -1 methylene carboxylic acid Chemical class 0.000 claims description 18
- 239000000839 emulsion Substances 0.000 claims description 12
- 150000003839 salts Chemical class 0.000 claims description 9
- 239000000178 monomer Substances 0.000 claims description 8
- 239000003054 catalyst Substances 0.000 claims description 3
- 230000000379 polymerizing effect Effects 0.000 claims description 2
- 239000002253 acid Substances 0.000 description 34
- 239000000203 mixture Substances 0.000 description 33
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 24
- 239000011734 sodium Substances 0.000 description 24
- 229910052708 sodium Inorganic materials 0.000 description 24
- 238000006116 polymerization reaction Methods 0.000 description 21
- 229920000642 polymer Polymers 0.000 description 20
- 229920000126 latex Polymers 0.000 description 19
- 239000004816 latex Substances 0.000 description 17
- 239000006185 dispersion Substances 0.000 description 16
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 15
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 13
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 12
- 150000001875 compounds Chemical class 0.000 description 12
- 239000000047 product Substances 0.000 description 12
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 10
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 10
- 238000003756 stirring Methods 0.000 description 10
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 8
- 238000001246 colloidal dispersion Methods 0.000 description 8
- VCJMYUPGQJHHFU-UHFFFAOYSA-N iron(3+);trinitrate Chemical compound [Fe+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O VCJMYUPGQJHHFU-UHFFFAOYSA-N 0.000 description 8
- 239000007787 solid Substances 0.000 description 8
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 7
- 150000007513 acids Chemical class 0.000 description 7
- 238000000576 coating method Methods 0.000 description 7
- 229910052757 nitrogen Inorganic materials 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- 239000002585 base Substances 0.000 description 6
- 229910052742 iron Inorganic materials 0.000 description 6
- SUMDYPCJJOFFON-UHFFFAOYSA-N isethionic acid Chemical compound OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 6
- 239000004094 surface-active agent Substances 0.000 description 6
- GQTFHSAAODFMHB-UHFFFAOYSA-N 2-prop-2-enoyloxyethanesulfonic acid Chemical compound OS(=O)(=O)CCOC(=O)C=C GQTFHSAAODFMHB-UHFFFAOYSA-N 0.000 description 5
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 description 5
- 239000011248 coating agent Substances 0.000 description 5
- 229920001577 copolymer Polymers 0.000 description 5
- 150000002148 esters Chemical class 0.000 description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 5
- 239000001257 hydrogen Substances 0.000 description 5
- 229910052739 hydrogen Inorganic materials 0.000 description 5
- 159000000000 sodium salts Chemical class 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- 239000003995 emulsifying agent Substances 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- 239000003381 stabilizer Substances 0.000 description 4
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical compound OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 description 4
- 239000000080 wetting agent Substances 0.000 description 4
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 description 3
- NYUTUWAFOUJLKI-UHFFFAOYSA-N 3-prop-2-enoyloxypropane-1-sulfonic acid Chemical compound OS(=O)(=O)CCCOC(=O)C=C NYUTUWAFOUJLKI-UHFFFAOYSA-N 0.000 description 3
- OPRCENGOKJIGQF-UHFFFAOYSA-N 4-prop-2-enoyloxybutane-1-sulfonic acid Chemical compound OS(=O)(=O)CCCCOC(=O)C=C OPRCENGOKJIGQF-UHFFFAOYSA-N 0.000 description 3
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 3
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 3
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 3
- HFBMWMNUJJDEQZ-UHFFFAOYSA-N acryloyl chloride Chemical compound ClC(=O)C=C HFBMWMNUJJDEQZ-UHFFFAOYSA-N 0.000 description 3
- 239000012736 aqueous medium Substances 0.000 description 3
- 238000007664 blowing Methods 0.000 description 3
- 150000001768 cations Chemical class 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 238000005345 coagulation Methods 0.000 description 3
- 230000015271 coagulation Effects 0.000 description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 3
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 3
- 150000002978 peroxides Chemical class 0.000 description 3
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 2
- OIRBCDHJODNJQO-UHFFFAOYSA-N 1-prop-2-enoyloxybutane-2-sulfonic acid Chemical compound CCC(S(O)(=O)=O)COC(=O)C=C OIRBCDHJODNJQO-UHFFFAOYSA-N 0.000 description 2
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 2
- PRAMZQXXPOLCIY-UHFFFAOYSA-N 2-(2-methylprop-2-enoyloxy)ethanesulfonic acid Chemical compound CC(=C)C(=O)OCCS(O)(=O)=O PRAMZQXXPOLCIY-UHFFFAOYSA-N 0.000 description 2
- OFIZHEVXDIWONW-UHFFFAOYSA-N 3-prop-2-enoyloxypropane-1-sulfonic acid;sodium Chemical compound [Na].OS(=O)(=O)CCCOC(=O)C=C OFIZHEVXDIWONW-UHFFFAOYSA-N 0.000 description 2
- PQPMUSXNFZRRFG-UHFFFAOYSA-N 4-prop-2-enoyloxybutane-1-sulfonic acid;sodium Chemical compound [Na].OS(=O)(=O)CCCCOC(=O)C=C PQPMUSXNFZRRFG-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 2
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 2
- 230000001464 adherent effect Effects 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- BRXCDHOLJPJLLT-UHFFFAOYSA-N butane-2-sulfonic acid Chemical compound CCC(C)S(O)(=O)=O BRXCDHOLJPJLLT-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 2
- 230000001112 coagulating effect Effects 0.000 description 2
- 230000008021 deposition Effects 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- FJKIXWOMBXYWOQ-UHFFFAOYSA-N ethenoxyethane Chemical compound CCOC=C FJKIXWOMBXYWOQ-UHFFFAOYSA-N 0.000 description 2
- 125000002573 ethenylidene group Chemical group [*]=C=C([H])[H] 0.000 description 2
- 239000012065 filter cake Substances 0.000 description 2
- 239000006260 foam Substances 0.000 description 2
- 229940045996 isethionic acid Drugs 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000002609 medium Substances 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 229920000058 polyacrylate Polymers 0.000 description 2
- 239000002685 polymerization catalyst Substances 0.000 description 2
- USHAGKDGDHPEEY-UHFFFAOYSA-L potassium persulfate Chemical compound [K+].[K+].[O-]S(=O)(=O)OOS([O-])(=O)=O USHAGKDGDHPEEY-UHFFFAOYSA-L 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000000344 soap Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 2
- WHOZNOZYMBRCBL-OUKQBFOZSA-N (2E)-2-Tetradecenal Chemical compound CCCCCCCCCCC\C=C\C=O WHOZNOZYMBRCBL-OUKQBFOZSA-N 0.000 description 1
- YFVKHKCZBSGZPE-UHFFFAOYSA-N 1-(1,3-benzodioxol-5-yl)-2-(propylamino)propan-1-one Chemical compound CCCNC(C)C(=O)C1=CC=C2OCOC2=C1 YFVKHKCZBSGZPE-UHFFFAOYSA-N 0.000 description 1
- RTZNGLQAICCIFI-UHFFFAOYSA-N 1-(2-methylprop-2-enoyloxy)propane-2-sulfonic acid Chemical compound OS(=O)(=O)C(C)COC(=O)C(C)=C RTZNGLQAICCIFI-UHFFFAOYSA-N 0.000 description 1
- RDTDYDTWPYJQPD-UHFFFAOYSA-N 1-bromo-3-hydroxypropane-2-sulfonic acid Chemical compound OCC(CBr)S(O)(=O)=O RDTDYDTWPYJQPD-UHFFFAOYSA-N 0.000 description 1
- XXFPQMHZQNFWBT-UHFFFAOYSA-N 1-bromo-3-prop-2-enoyloxypropane-2-sulfonic acid Chemical compound OS(=O)(=O)C(CBr)COC(=O)C=C XXFPQMHZQNFWBT-UHFFFAOYSA-N 0.000 description 1
- GTRRQWUEUJWBNJ-UHFFFAOYSA-N 1-hydroxybutane-2-sulfonic acid Chemical compound CCC(CO)S(O)(=O)=O GTRRQWUEUJWBNJ-UHFFFAOYSA-N 0.000 description 1
- CLHYKAZPWIRRRD-UHFFFAOYSA-N 1-hydroxypropane-1-sulfonic acid Chemical compound CCC(O)S(O)(=O)=O CLHYKAZPWIRRRD-UHFFFAOYSA-N 0.000 description 1
- KDKIWFRRJZZYRP-UHFFFAOYSA-N 1-hydroxypropane-2-sulfonic acid Chemical compound OCC(C)S(O)(=O)=O KDKIWFRRJZZYRP-UHFFFAOYSA-N 0.000 description 1
- NKIIKKAXXDXYJS-UHFFFAOYSA-N 1-prop-2-enoyloxypropane-2-sulfonic acid Chemical compound OS(=O)(=O)C(C)COC(=O)C=C NKIIKKAXXDXYJS-UHFFFAOYSA-N 0.000 description 1
- SODQFLRLAOALCF-UHFFFAOYSA-N 1lambda3-bromacyclohexa-1,3,5-triene Chemical compound Br1=CC=CC=C1 SODQFLRLAOALCF-UHFFFAOYSA-N 0.000 description 1
- CISIJYCKDJSTMX-UHFFFAOYSA-N 2,2-dichloroethenylbenzene Chemical compound ClC(Cl)=CC1=CC=CC=C1 CISIJYCKDJSTMX-UHFFFAOYSA-N 0.000 description 1
- SXZSFWHOSHAKMN-UHFFFAOYSA-N 2,3,4,4',5-Pentachlorobiphenyl Chemical compound C1=CC(Cl)=CC=C1C1=CC(Cl)=C(Cl)C(Cl)=C1Cl SXZSFWHOSHAKMN-UHFFFAOYSA-N 0.000 description 1
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- SBYMUDUGTIKLCR-UHFFFAOYSA-N 2-chloroethenylbenzene Chemical compound ClC=CC1=CC=CC=C1 SBYMUDUGTIKLCR-UHFFFAOYSA-N 0.000 description 1
- GAWAYYRQGQZKCR-UHFFFAOYSA-N 2-chloropropionic acid Chemical compound CC(Cl)C(O)=O GAWAYYRQGQZKCR-UHFFFAOYSA-N 0.000 description 1
- FYGCFQANVJVFIT-UHFFFAOYSA-N 2-hydroxy-2-methylpropane-1-sulfonic acid Chemical compound CC(C)(O)CS(O)(=O)=O FYGCFQANVJVFIT-UHFFFAOYSA-N 0.000 description 1
- SMFVCSFXTHBQGP-UHFFFAOYSA-N 2-hydroxy-3-methoxypropane-1-sulfonic acid Chemical compound COCC(O)CS(O)(=O)=O SMFVCSFXTHBQGP-UHFFFAOYSA-N 0.000 description 1
- NSRGOAGKXKNHQX-UHFFFAOYSA-N 2-hydroxybutane-1-sulfonic acid Chemical compound CCC(O)CS(O)(=O)=O NSRGOAGKXKNHQX-UHFFFAOYSA-N 0.000 description 1
- QBRYGDSLFHXJOD-UHFFFAOYSA-N 2-hydroxycyclohexane-1-sulfonic acid Chemical compound OC1CCCCC1S(O)(=O)=O QBRYGDSLFHXJOD-UHFFFAOYSA-N 0.000 description 1
- HSXUNHYXJWDLDK-UHFFFAOYSA-N 2-hydroxypropane-1-sulfonic acid Chemical compound CC(O)CS(O)(=O)=O HSXUNHYXJWDLDK-UHFFFAOYSA-N 0.000 description 1
- CTHJQRHPNQEPAB-UHFFFAOYSA-N 2-methoxyethenylbenzene Chemical compound COC=CC1=CC=CC=C1 CTHJQRHPNQEPAB-UHFFFAOYSA-N 0.000 description 1
- ODFVMDJNKICTHK-UHFFFAOYSA-N 2-phenyl-2-prop-2-enoyloxyethanesulfonic acid Chemical compound C=CC(=O)OC(CS(=O)(=O)O)C1=CC=CC=C1 ODFVMDJNKICTHK-UHFFFAOYSA-N 0.000 description 1
- XLLXMBCBJGATSP-UHFFFAOYSA-N 2-phenylethenol Chemical compound OC=CC1=CC=CC=C1 XLLXMBCBJGATSP-UHFFFAOYSA-N 0.000 description 1
- ONPJWQSDZCGSQM-UHFFFAOYSA-N 2-phenylprop-2-enoic acid Chemical compound OC(=O)C(=C)C1=CC=CC=C1 ONPJWQSDZCGSQM-UHFFFAOYSA-N 0.000 description 1
- CXIIVBDEBISQRW-UHFFFAOYSA-N 2-prop-2-enoyloxybutane-1-sulfonic acid Chemical compound OS(=O)(=O)CC(CC)OC(=O)C=C CXIIVBDEBISQRW-UHFFFAOYSA-N 0.000 description 1
- NUKQLDNZOSARNZ-UHFFFAOYSA-N 2-prop-2-enoyloxycyclohexane-1-sulfonic acid Chemical compound OS(=O)(=O)C1CCCCC1OC(=O)C=C NUKQLDNZOSARNZ-UHFFFAOYSA-N 0.000 description 1
- KPDIAZWNYLEPMX-UHFFFAOYSA-N 2-prop-2-enoyloxypropane-1-sulfonic acid Chemical compound OS(=O)(=O)CC(C)OC(=O)C=C KPDIAZWNYLEPMX-UHFFFAOYSA-N 0.000 description 1
- FRIBMENBGGCKPD-UHFFFAOYSA-N 3-(2,3-dimethoxyphenyl)prop-2-enal Chemical compound COC1=CC=CC(C=CC=O)=C1OC FRIBMENBGGCKPD-UHFFFAOYSA-N 0.000 description 1
- UYEDDHNXHRQYPD-UHFFFAOYSA-N 3-bromo-1-prop-2-enoyloxybutane-2-sulfonic acid Chemical compound CC(Br)C(S(O)(=O)=O)COC(=O)C=C UYEDDHNXHRQYPD-UHFFFAOYSA-N 0.000 description 1
- ZLCLZXDOPGXCOV-UHFFFAOYSA-N 3-chloro-1-prop-2-enoyloxybutane-2-sulfonic acid Chemical compound CC(Cl)C(S(O)(=O)=O)COC(=O)C=C ZLCLZXDOPGXCOV-UHFFFAOYSA-N 0.000 description 1
- ASGZHNLSTXEOKW-UHFFFAOYSA-N 3-chloro-2-methyl-2-prop-2-enoyloxypropane-1-sulfonic acid Chemical compound OS(=O)(=O)CC(CCl)(C)OC(=O)C=C ASGZHNLSTXEOKW-UHFFFAOYSA-N 0.000 description 1
- JHUFGBSGINLPOW-UHFFFAOYSA-N 3-chloro-4-(trifluoromethoxy)benzoyl cyanide Chemical compound FC(F)(F)OC1=CC=C(C(=O)C#N)C=C1Cl JHUFGBSGINLPOW-UHFFFAOYSA-N 0.000 description 1
- FOEVHHOHFUGYJL-UHFFFAOYSA-N 3-hydroxybutane-2-sulfonic acid Chemical compound CC(O)C(C)S(O)(=O)=O FOEVHHOHFUGYJL-UHFFFAOYSA-N 0.000 description 1
- XCSSRWZOTOEYQS-UHFFFAOYSA-N 3-prop-2-enoyloxybutane-1-sulfonic acid Chemical compound OS(=O)(=O)CCC(C)OC(=O)C=C XCSSRWZOTOEYQS-UHFFFAOYSA-N 0.000 description 1
- ZFLIODOVXOCSPQ-UHFFFAOYSA-N 3-prop-2-enoyloxybutane-2-sulfonic acid Chemical compound OS(=O)(=O)C(C)C(C)OC(=O)C=C ZFLIODOVXOCSPQ-UHFFFAOYSA-N 0.000 description 1
- WNPUYXXWEIHVBD-UHFFFAOYSA-N 4-prop-2-enoyloxybutane-2-sulfonic acid Chemical compound OS(=O)(=O)C(C)CCOC(=O)C=C WNPUYXXWEIHVBD-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- IEPRKVQEAMIZSS-UHFFFAOYSA-N Di-Et ester-Fumaric acid Natural products CCOC(=O)C=CC(=O)OCC IEPRKVQEAMIZSS-UHFFFAOYSA-N 0.000 description 1
- IEPRKVQEAMIZSS-WAYWQWQTSA-N Diethyl maleate Chemical compound CCOC(=O)\C=C/C(=O)OCC IEPRKVQEAMIZSS-WAYWQWQTSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 1
- GYCMBHHDWRMZGG-UHFFFAOYSA-N Methylacrylonitrile Chemical compound CC(=C)C#N GYCMBHHDWRMZGG-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 239000002174 Styrene-butadiene Substances 0.000 description 1
- ULUAUXLGCMPNKK-UHFFFAOYSA-N Sulfobutanedioic acid Chemical compound OC(=O)CC(C(O)=O)S(O)(=O)=O ULUAUXLGCMPNKK-UHFFFAOYSA-N 0.000 description 1
- ACIAHEMYLLBZOI-ZZXKWVIFSA-N Unsaturated alcohol Chemical compound CC\C(CO)=C/C ACIAHEMYLLBZOI-ZZXKWVIFSA-N 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000003931 anilides Chemical class 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- BWHOZHOGCMHOBV-UHFFFAOYSA-N benzylideneacetone Chemical compound CC(=O)C=CC1=CC=CC=C1 BWHOZHOGCMHOBV-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- INLLPKCGLOXCIV-UHFFFAOYSA-N bromoethene Chemical compound BrC=C INLLPKCGLOXCIV-UHFFFAOYSA-N 0.000 description 1
- MTAZNLWOLGHBHU-UHFFFAOYSA-N butadiene-styrene rubber Chemical compound C=CC=C.C=CC1=CC=CC=C1 MTAZNLWOLGHBHU-UHFFFAOYSA-N 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 238000005266 casting Methods 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 229920000547 conjugated polymer Polymers 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 230000001687 destabilization Effects 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 150000001993 dienes Chemical class 0.000 description 1
- GMSCBRSQMRDRCD-UHFFFAOYSA-N dodecyl 2-methylprop-2-enoate Chemical compound CCCCCCCCCCCCOC(=O)C(C)=C GMSCBRSQMRDRCD-UHFFFAOYSA-N 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 238000004945 emulsification Methods 0.000 description 1
- 238000007720 emulsion polymerization reaction Methods 0.000 description 1
- CYKDLUMZOVATFT-UHFFFAOYSA-N ethenyl acetate;prop-2-enoic acid Chemical compound OC(=O)C=C.CC(=O)OC=C CYKDLUMZOVATFT-UHFFFAOYSA-N 0.000 description 1
- MEGHWIAOTJPCHQ-UHFFFAOYSA-N ethenyl butanoate Chemical compound CCCC(=O)OC=C MEGHWIAOTJPCHQ-UHFFFAOYSA-N 0.000 description 1
- UIWXSTHGICQLQT-UHFFFAOYSA-N ethenyl propanoate Chemical compound CCC(=O)OC=C UIWXSTHGICQLQT-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- SUPCQIBBMFXVTL-UHFFFAOYSA-N ethyl 2-methylprop-2-enoate Chemical compound CCOC(=O)C(C)=C SUPCQIBBMFXVTL-UHFFFAOYSA-N 0.000 description 1
- XHIOOWRNEXFQFM-UHFFFAOYSA-N ethyl prop-2-enoate;prop-2-enoic acid Chemical compound OC(=O)C=C.CCOC(=O)C=C XHIOOWRNEXFQFM-UHFFFAOYSA-N 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- PBZROIMXDZTJDF-UHFFFAOYSA-N hepta-1,6-dien-4-one Chemical compound C=CCC(=O)CC=C PBZROIMXDZTJDF-UHFFFAOYSA-N 0.000 description 1
- XQBYLOYJNLQCLU-UHFFFAOYSA-N hepta-2,5-dien-4-one Chemical compound CC=CC(=O)C=CC XQBYLOYJNLQCLU-UHFFFAOYSA-N 0.000 description 1
- LNMQRPPRQDGUDR-UHFFFAOYSA-N hexyl prop-2-enoate Chemical compound CCCCCCOC(=O)C=C LNMQRPPRQDGUDR-UHFFFAOYSA-N 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 229920001477 hydrophilic polymer Polymers 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- MVFCKEFYUDZOCX-UHFFFAOYSA-N iron(2+);dinitrate Chemical compound [Fe+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O MVFCKEFYUDZOCX-UHFFFAOYSA-N 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- VHRYZQNGTZXDNX-UHFFFAOYSA-N methacryloyl chloride Chemical compound CC(=C)C(Cl)=O VHRYZQNGTZXDNX-UHFFFAOYSA-N 0.000 description 1
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical group [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 description 1
- 235000020124 milk-based beverage Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- JESXATFQYMPTNL-UHFFFAOYSA-N mono-hydroxyphenyl-ethylene Natural products OC1=CC=CC=C1C=C JESXATFQYMPTNL-UHFFFAOYSA-N 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- QONHNMFEHWGACQ-UHFFFAOYSA-N pentan-3-yl prop-2-enoate Chemical compound CCC(CC)OC(=O)C=C QONHNMFEHWGACQ-UHFFFAOYSA-N 0.000 description 1
- 230000002688 persistence Effects 0.000 description 1
- 230000002085 persistent effect Effects 0.000 description 1
- 229940044654 phenolsulfonic acid Drugs 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229920002587 poly(1,3-butadiene) polymer Polymers 0.000 description 1
- KAQHZJVQFBJKCK-UHFFFAOYSA-L potassium pyrosulfate Chemical compound [K+].[K+].[O-]S(=O)(=O)OS([O-])(=O)=O KAQHZJVQFBJKCK-UHFFFAOYSA-L 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- KCXFHTAICRTXLI-UHFFFAOYSA-N propane-1-sulfonic acid Chemical compound CCCS(O)(=O)=O KCXFHTAICRTXLI-UHFFFAOYSA-N 0.000 description 1
- HNDXKIMMSFCCFW-UHFFFAOYSA-N propane-2-sulphonic acid Chemical compound CC(C)S(O)(=O)=O HNDXKIMMSFCCFW-UHFFFAOYSA-N 0.000 description 1
- PNXMTCDJUBJHQJ-UHFFFAOYSA-N propyl prop-2-enoate Chemical compound CCCOC(=O)C=C PNXMTCDJUBJHQJ-UHFFFAOYSA-N 0.000 description 1
- 238000010926 purge Methods 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- PFUVRDFDKPNGAV-UHFFFAOYSA-N sodium peroxide Chemical compound [Na+].[Na+].[O-][O-] PFUVRDFDKPNGAV-UHFFFAOYSA-N 0.000 description 1
- 239000002195 soluble material Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000011115 styrene butadiene Substances 0.000 description 1
- 229920003048 styrene butadiene rubber Polymers 0.000 description 1
- 150000003440 styrenes Chemical class 0.000 description 1
- 150000008054 sulfonate salts Chemical class 0.000 description 1
- 150000003459 sulfonic acid esters Chemical group 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- KOZCZZVUFDCZGG-UHFFFAOYSA-N vinyl benzoate Chemical compound C=COC(=O)C1=CC=CC=C1 KOZCZZVUFDCZGG-UHFFFAOYSA-N 0.000 description 1
- FUSUHKVFWTUUBE-UHFFFAOYSA-N vinyl methyl ketone Natural products CC(=O)C=C FUSUHKVFWTUUBE-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F28/00—Homopolymers and copolymers of compounds having one or more unsaturated aliphatic radicals, each having only one carbon-to-carbon double bond, and at least one being terminated by a bond to sulfur or by a heterocyclic ring containing sulfur
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F236/00—Copolymers of compounds having one or more unsaturated aliphatic radicals, at least one having two or more carbon-to-carbon double bonds
- C08F236/02—Copolymers of compounds having one or more unsaturated aliphatic radicals, at least one having two or more carbon-to-carbon double bonds the radical having only two carbon-to-carbon double bonds
- C08F236/04—Copolymers of compounds having one or more unsaturated aliphatic radicals, at least one having two or more carbon-to-carbon double bonds the radical having only two carbon-to-carbon double bonds conjugated
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F36/00—Homopolymers and copolymers of compounds having one or more unsaturated aliphatic radicals, at least one having two or more carbon-to-carbon double bonds
- C08F36/02—Homopolymers and copolymers of compounds having one or more unsaturated aliphatic radicals, at least one having two or more carbon-to-carbon double bonds the radical having only two carbon-to-carbon double bonds
- C08F36/04—Homopolymers and copolymers of compounds having one or more unsaturated aliphatic radicals, at least one having two or more carbon-to-carbon double bonds the radical having only two carbon-to-carbon double bonds conjugated
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Polymerisation Methods In General (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US647975A US2914499A (en) | 1957-03-25 | 1957-03-25 | Emulsion polymerization with acrylictype acid esters of hydroxysulfonic acids and composition therefrom |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1224500B true DE1224500B (de) | 1966-09-08 |
Family
ID=24598960
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DED27727A Pending DE1224500B (de) | 1957-03-25 | 1958-03-24 | Verfahren zur Herstellung von Emulsionspolymerisaten |
Country Status (3)
| Country | Link |
|---|---|
| US (1) | US2914499A (OSRAM) |
| DE (1) | DE1224500B (OSRAM) |
| NL (2) | NL103875C (OSRAM) |
Families Citing this family (30)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3048561A (en) * | 1958-01-29 | 1962-08-07 | Dow Chemical Co | Compositions consisting essentially of graft copolymers of vinyl pyridine monomers on acrylonitrile polymers and method of preparing same |
| NL250052A (OSRAM) * | 1959-04-01 | |||
| US3306871A (en) * | 1959-09-23 | 1967-02-28 | Dow Chemical Co | Synthetic latexes comprising ar-monovinyl aromatic sulfonic acid saltstyrene-butadiene terpolymers |
| GB913145A (OSRAM) * | 1960-01-02 | 1900-01-01 | ||
| US3072589A (en) * | 1960-02-04 | 1963-01-08 | Dow Chemical Co | Aqueous polymerization of fluorinated monomer in the presence of halogenated aromaticcompounds |
| US3436363A (en) * | 1960-07-25 | 1969-04-01 | Gulf Oil Corp | Polymerization of ethylene in aqueous system |
| US3177172A (en) * | 1960-10-06 | 1965-04-06 | Dow Chemical Co | Method for the preparation of latexes of synthetic resins and for the control of theviscosity of such latexes |
| US3284541A (en) * | 1962-06-22 | 1966-11-08 | Dow Chemical Co | Compositions comprising graft copolymers on polyolefin substrates of one or more monomers of the group of sulfonated acrylates and methacrylates |
| US3159529A (en) * | 1962-07-06 | 1964-12-01 | Union Carbide Corp | Paper products containing a sulfonated 2-phenoxyethyl acrylate polymer |
| US3250736A (en) * | 1963-03-22 | 1966-05-10 | Dow Chemical Co | Latex modified cement mortar compositions |
| US3411911A (en) * | 1965-05-10 | 1968-11-19 | Eastman Kodak Co | Novel photographic materials containing water insoluble interpolymers |
| US3850726A (en) * | 1969-04-28 | 1974-11-26 | Staley Mfg Co A E | Vinylidene chloride copolymer |
| US4075134A (en) * | 1970-06-08 | 1978-02-21 | The Dow Chemical Company | Emulsion polymerization method for preparing microspheres having liquid center and seamless rigid walls |
| US3711449A (en) * | 1970-09-18 | 1973-01-16 | Rohm & Haas | Interpolymers of sulfoalkylene acrylates |
| JPS5130906B2 (OSRAM) * | 1972-11-21 | 1976-09-03 | ||
| US3917574A (en) * | 1973-04-16 | 1975-11-04 | Dow Chemical Co | Process for preparing substantially linear water-soluble or water-dispersible interpolymeric interfacially spreading polyelectrolytes |
| US3965032A (en) * | 1973-04-16 | 1976-06-22 | The Dow Chemical Company | Colloidally stable dispersions |
| DE2540468C3 (de) * | 1975-09-11 | 1988-11-10 | Basf Ag, 6700 Ludwigshafen | Verfahren zur Herstellung von wäßrigen Polymerisat-Dispersionen und deren Verwendung |
| JPS52107045A (en) * | 1976-03-05 | 1977-09-08 | Japan Exlan Co Ltd | Stable aqueous emulsions of acrylonitrile polymers, their preparation, and dyeability improvers therefrom |
| DE2830455A1 (de) * | 1978-07-11 | 1980-01-24 | Bayer Ag | Verfahren zur herstellung emulgatorfreier, selbstvernetzender kautschuklatices |
| DE2830470A1 (de) * | 1978-07-11 | 1980-01-31 | Bayer Ag | Verfahren zur herstellung von emulgatorfreien kautschuklatices |
| IT1179519B (it) | 1984-12-17 | 1987-09-16 | Minnesota Mining & Mfg | Materiale fotosensibile agli alogenuri d'argento per l'ottenimento di immagini in bianco e nero a mezza tinta e metodo per la riproduzione a mezza tinta ad alto contrasto |
| US4891401A (en) * | 1986-09-30 | 1990-01-02 | E. I. Du Pont De Nemours And Company | Pigment dispersant resin with P-containing acid |
| WO1988002381A1 (en) * | 1986-09-30 | 1988-04-07 | E.I. Du Pont De Nemours And Company | Pigment dispersant resin with s-containing acid |
| US4985591A (en) * | 1988-08-15 | 1991-01-15 | E. I. Du Pont De Nemours And Company | Acid catalysts for low temperature cure of coating compositions |
| US5274027A (en) * | 1989-04-04 | 1993-12-28 | The Dow Chemical Company | Monovinylidene aromatic and conjugated diene copolymer coating compositions comprising sulfoalkyl monomeric emulsifier |
| GB8907534D0 (en) * | 1989-04-04 | 1989-05-17 | Dow Europ Sa | Monovinylidene aromatic and conjugated diene copolymer coating compositions comprising sulfoalkyl monomeric emulsifier |
| NL9000194A (nl) * | 1990-01-26 | 1991-08-16 | Stamicarbon | Toepassing van een kunststofdispersie als omhulling voor anorganische en organische deeltjes. |
| US6084044A (en) * | 1994-12-14 | 2000-07-04 | The Dow Chemical Company | Catalyzed process for producing high molecular weight monovinylidene aromatic polymers |
| WO1996018663A1 (en) * | 1994-12-14 | 1996-06-20 | The Dow Chemical Company | High molecular weight polystyrene production by vinylacid catalyzed free radical polymerization |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2601256A (en) * | 1950-10-27 | 1952-06-24 | Ind Rayon Corp | Acrylonitrile polymers |
| GB744487A (en) * | 1953-03-11 | 1956-02-08 | Courtaulds Ltd | Improvements in and relating to copolymeric products |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1881172A (en) * | 1932-10-04 | The-main |
-
0
- NL NL226190D patent/NL226190A/xx unknown
- NL NL103875D patent/NL103875C/xx active
-
1957
- 1957-03-25 US US647975A patent/US2914499A/en not_active Expired - Lifetime
-
1958
- 1958-03-24 DE DED27727A patent/DE1224500B/de active Pending
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2601256A (en) * | 1950-10-27 | 1952-06-24 | Ind Rayon Corp | Acrylonitrile polymers |
| GB744487A (en) * | 1953-03-11 | 1956-02-08 | Courtaulds Ltd | Improvements in and relating to copolymeric products |
Also Published As
| Publication number | Publication date |
|---|---|
| NL103875C (OSRAM) | |
| NL226190A (OSRAM) | |
| US2914499A (en) | 1959-11-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1224500B (de) | Verfahren zur Herstellung von Emulsionspolymerisaten | |
| DE2331141C2 (de) | Verfahren zur Herstellung von Lactices durch Emulsionspolymerisation | |
| DE60033436T2 (de) | Verfahren zur herstellung von vergrössertem latex | |
| CH660597A5 (de) | Latex und verfahren zu dessen herstellung. | |
| DE1545104A1 (de) | Verfahren zur Herstellung von Emulsionspolymerisaten | |
| DE1595846B2 (de) | Verfahren zur herstellung von vinylchloridpolymerisaten | |
| DE2150090B2 (de) | Verfahren zum Koagulieren eines Dienkautschuklatex | |
| DE2222867A1 (de) | Schlagzaehes Vinylchloridharz und Verfahren zu seiner Herstellung | |
| DE2222879A1 (de) | Verfahren zum Dispergieren eines zaehen,kautschukartigen,gelierten Alkylacrylatpolymerisats in einem harten Vinylchloridharz | |
| DE2432342A1 (de) | Verfahren zur vergroesserung der partikel eines synthetischen gummi-latex | |
| DE1122259B (de) | Verfahren zur Herstellung stabiler Latices | |
| DE2259997A1 (de) | Verfahren zur homo- oder copolymerisation von vinylchlorid | |
| DE1720897C3 (de) | Verfahren zum Polymerisieren von äthylenisch ungesättigten Monomeren in wäßriger Emulsion | |
| DE1055241B (de) | Verfahren zur Herstellung von bestaendigen emulgiermittelfreien Latices | |
| DE2021398A1 (de) | Verfahren zur Koagulation von Pfropfpolymer-Latices | |
| DE1495871B1 (de) | Verfahren zur Herstellung von Vinylchloridpolymerisaten | |
| DE2165410A1 (de) | Verfahren zum Herstellen von synthetischem Kautschuk | |
| DE2165669A1 (de) | Verfahren zur Herstellung von thermoplastischen Polymeren mit hoher Schlagzähigkeit | |
| DE2437927A1 (de) | Anionisch-stabilisierte latex-zusammensetzung | |
| DE2915178A1 (de) | Verfahren zur herstellung von pfropfmischpolymerisaten und ihre verwendung | |
| DE962834C (de) | Verfahren zur Herstellung von Polyvinylchlorid | |
| DE69001706T2 (de) | Verfahren zur Herstellung von Vinylchloridpolymeren, modifiziert mit Lactonpolymeren und mit Lactonpolymeren modifizierte Vinylchloridpolymere. | |
| DE1033417B (de) | Verfahren zum Herstellen von Suspensions-Mischpolymerisaten aus einem Monomerengemisch, das eine groessere Menge einer alkenyl-aromatischen Verbindung und eine kleinere Menge eines Polyolefins enthaelt | |
| DE1495804A1 (de) | Verfahren zur Herstellung von Polyaethylen-Selbstglanzdispersionen | |
| DE68914189T2 (de) | Alkalin-Polymerisation von karboxylierten Polymeren. |