DE1222927B - Verfahren zur Herstellung von Cyanocarbonsaeureestern - Google Patents
Verfahren zur Herstellung von CyanocarbonsaeureesternInfo
- Publication number
- DE1222927B DE1222927B DET25628A DET0025628A DE1222927B DE 1222927 B DE1222927 B DE 1222927B DE T25628 A DET25628 A DE T25628A DE T0025628 A DET0025628 A DE T0025628A DE 1222927 B DE1222927 B DE 1222927B
- Authority
- DE
- Germany
- Prior art keywords
- acid esters
- quaternary ammonium
- general formula
- ammonium compound
- preparation
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 7
- HJMZMZRCABDKKV-UHFFFAOYSA-N carbonocyanidic acid Chemical class OC(=O)C#N HJMZMZRCABDKKV-UHFFFAOYSA-N 0.000 title claims description 5
- 238000002360 preparation method Methods 0.000 title claims description 4
- 150000002825 nitriles Chemical class 0.000 claims description 7
- 150000003856 quaternary ammonium compounds Chemical class 0.000 claims description 6
- 125000003118 aryl group Chemical group 0.000 claims description 5
- 238000009833 condensation Methods 0.000 claims description 5
- 230000005494 condensation Effects 0.000 claims description 5
- 239000000203 mixture Substances 0.000 claims description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 239000003054 catalyst Substances 0.000 claims description 4
- -1 halocarboxylic acid esters Chemical class 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 3
- 238000006243 chemical reaction Methods 0.000 claims description 3
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 3
- 125000001424 substituent group Chemical group 0.000 claims description 3
- 125000006615 aromatic heterocyclic group Chemical group 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 claims description 2
- 239000003960 organic solvent Substances 0.000 claims description 2
- 150000003512 tertiary amines Chemical class 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- NXSULZXMFZGORH-UHFFFAOYSA-N 4-cyano-4-phenylpentanoic acid Chemical compound OC(=O)CCC(C)(C#N)C1=CC=CC=C1 NXSULZXMFZGORH-UHFFFAOYSA-N 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 150000001916 cyano esters Chemical class 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- SUSQOBVLVYHIEX-UHFFFAOYSA-N phenylacetonitrile Chemical compound N#CCC1=CC=CC=C1 SUSQOBVLVYHIEX-UHFFFAOYSA-N 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- LVFFZQQWIZURIO-UHFFFAOYSA-N 2-phenylbutanedioic acid Chemical compound OC(=O)CC(C(O)=O)C1=CC=CC=C1 LVFFZQQWIZURIO-UHFFFAOYSA-N 0.000 description 1
- IZPUPXNVRNBDSW-UHFFFAOYSA-N 2-phenylbutanenitrile Chemical compound CCC(C#N)C1=CC=CC=C1 IZPUPXNVRNBDSW-UHFFFAOYSA-N 0.000 description 1
- NVAOLENBKNECGF-UHFFFAOYSA-N 2-phenylpropanenitrile Chemical compound N#CC(C)C1=CC=CC=C1 NVAOLENBKNECGF-UHFFFAOYSA-N 0.000 description 1
- GMPNSKPTQXVWAF-UHFFFAOYSA-N 3-cyano-3-phenylpropanoic acid Chemical compound OC(=O)CC(C#N)C1=CC=CC=C1 GMPNSKPTQXVWAF-UHFFFAOYSA-N 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000003868 ammonium compounds Chemical class 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000007809 chemical reaction catalyst Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- IBFHBLOKQVCABG-UHFFFAOYSA-N cyclohexyl 2-chloroacetate Chemical compound ClCC(=O)OC1CCCCC1 IBFHBLOKQVCABG-UHFFFAOYSA-N 0.000 description 1
- GCFAUZGWPDYAJN-UHFFFAOYSA-N cyclohexyl 3-phenylprop-2-enoate Chemical compound C=1C=CC=CC=1C=CC(=O)OC1CCCCC1 GCFAUZGWPDYAJN-UHFFFAOYSA-N 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000003949 imides Chemical class 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- KUTJRVYIMHTRNJ-UHFFFAOYSA-N n-benzyl-n-ethylethanamine;hydrobromide Chemical compound Br.CCN(CC)CC1=CC=CC=C1 KUTJRVYIMHTRNJ-UHFFFAOYSA-N 0.000 description 1
- 125000002560 nitrile group Chemical group 0.000 description 1
- 239000012454 non-polar solvent Substances 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- UQFSVBXCNGCBBW-UHFFFAOYSA-M tetraethylammonium iodide Chemical compound [I-].CC[N+](CC)(CC)CC UQFSVBXCNGCBBW-UHFFFAOYSA-M 0.000 description 1
- DUTXDHXKLWIQID-UHFFFAOYSA-M tribenzyl(3-methoxypropyl)azanium bromide Chemical compound [Br-].COCCC[N+](CC1=CC=CC=C1)(CC1=CC=CC=C1)CC1=CC=CC=C1 DUTXDHXKLWIQID-UHFFFAOYSA-M 0.000 description 1
- 150000003627 tricarboxylic acid derivatives Chemical class 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| PL100790A PL48991B1 (https=) | 1963-02-18 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1222927B true DE1222927B (de) | 1966-08-18 |
Family
ID=19939102
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DET25628A Pending DE1222927B (de) | 1963-02-18 | 1964-02-18 | Verfahren zur Herstellung von Cyanocarbonsaeureestern |
Country Status (4)
| Country | Link |
|---|---|
| CH (1) | CH460737A (https=) |
| DE (1) | DE1222927B (https=) |
| FR (1) | FR1383366A (https=) |
| NL (1) | NL6401487A (https=) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4224052A (en) * | 1978-05-05 | 1980-09-23 | American Cyanamid Company | Polysubstituted butanoic acids, esters and derivatives thereof utilizing the same as herbicides |
| FR2471973A1 (fr) * | 1979-12-20 | 1981-06-26 | Rhone Poulenc Ind | Procede de preparation de cyanoacetates d'alkyle |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2537981A (en) * | 1949-10-28 | 1951-01-16 | American Cyanamid Co | Method of producing a glycidyl ester |
-
1964
- 1964-02-18 NL NL6401487A patent/NL6401487A/xx unknown
- 1964-02-18 DE DET25628A patent/DE1222927B/de active Pending
- 1964-02-18 FR FR964173A patent/FR1383366A/fr not_active Expired
- 1964-02-18 CH CH190164A patent/CH460737A/de unknown
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2537981A (en) * | 1949-10-28 | 1951-01-16 | American Cyanamid Co | Method of producing a glycidyl ester |
Also Published As
| Publication number | Publication date |
|---|---|
| CH460737A (de) | 1968-08-15 |
| NL6401487A (https=) | 1964-08-19 |
| FR1383366A (fr) | 1964-12-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2061838B2 (de) | 2-phosphono-butan-1,2-dicarbonsaeure-derivate, verfahren zu ihrer herstellung und diese verbindungen enthaltenden mittel | |
| DE1906401A1 (de) | Verfahren zur Herstellung von 4-Acyloxy-azetidin-2-onen | |
| DE1222927B (de) | Verfahren zur Herstellung von Cyanocarbonsaeureestern | |
| DE936395C (de) | Verfahren zur Herstellung von bisquaternaeren Ammoniumverbindungen | |
| EP0003105A1 (de) | Verfahren zur Anilidierung von Carbonsäureestern | |
| DE2348536C3 (de) | Verfahren zur Herstellung von 5-Oxocarbonsäuren | |
| DE1108213B (de) | Verfahren zur Herstellung von 2, 2-Dimethyl-3-phenylcyclopropan-carbonsaeuren | |
| DE1010065B (de) | Verfahren zur Herstellung von komplexbildenden 2-oxycyclohexylsubstituierten Aminoessigsaeuren, deren Salzen bzw. Metall-Komplexsalzen | |
| DE180202C (https=) | ||
| AT219579B (de) | Verfahren zur Herstellung von α-Cyclohexylbuttersäuredialkylaminoäthylestern und deren Salzen | |
| DE157840C (https=) | ||
| DE866647C (de) | Verfahren zur Herstellung von sekundaeren 1, 3-Alkendiaminen | |
| DE1151516B (de) | Verfahren zur Herstellung von ª†-Aminoalkoholen mit quartaerem ª‰-C-Atom | |
| EP0070424A1 (de) | Verfahren zur Herstellung von N,N'-disubstituierten 3-Aminopropanamiden | |
| DE1232956B (de) | Verfahren zur Herstellung von 5-(3-Hydroxypropyl)-dibenzo-[a, d]-cyclohepten | |
| CH437354A (de) | Verfahren zur Herstellung von 1-(Acylphenyl)-2-amino-1,3-propandiolen | |
| DE635494C (de) | Verfahren zur Herstellung von Salzen hochmolekularer Imidoaether, Imidothioaether und Amidine | |
| DE2217623C3 (de) | Verfahren zur Herstellung N-alkylsubstiiuierier Amiöe von alpha, betaungesättigten aliphatischen Carbonsäuren | |
| DE859892C (de) | Verfahren zur Herstellung von substituierten Piperidinoessigsaeureestern | |
| AT250334B (de) | Verfahren zur Herstellung von α-Carbalkoxy-β-arylamino-acrylsäureestern | |
| AT222660B (de) | Verfahren zur Herstellung von neuen Azepin-Derivaten | |
| DE624377C (de) | Verfahren zur Darstellung von Abkoemmlingen cyclischer ª‰-Ketocarbonsaeuren | |
| AT222104B (de) | Verfahren zur Herstellung von neuen Cyclobutanderivaten | |
| AT223189B (de) | Verfahren zur Herstellung von neuen Aryloxyessigsäureamiden | |
| DE1168918B (de) | Verfahren zur Herstellung von Acylanthranilsaeureaniliden |