DE1220852B - Verfahren zur Herstellung von 1, 1, 2, 2-Tetrachloraethylsulfenylchlorid - Google Patents
Verfahren zur Herstellung von 1, 1, 2, 2-TetrachloraethylsulfenylchloridInfo
- Publication number
- DE1220852B DE1220852B DEH50600A DEH0050600A DE1220852B DE 1220852 B DE1220852 B DE 1220852B DE H50600 A DEH50600 A DE H50600A DE H0050600 A DEH0050600 A DE H0050600A DE 1220852 B DE1220852 B DE 1220852B
- Authority
- DE
- Germany
- Prior art keywords
- isomer
- chloride
- tetrachloroethylsulfenyl
- soil
- tetrachloroethyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 8
- LCVOCDOSGJHZFH-UHFFFAOYSA-N 1,1,2,2-tetrachloroethyl thiohypochlorite Chemical compound ClSC(Cl)(Cl)C(Cl)Cl LCVOCDOSGJHZFH-UHFFFAOYSA-N 0.000 title claims description 7
- 238000002360 preparation method Methods 0.000 title claims description 3
- 239000000460 chlorine Substances 0.000 claims description 16
- 150000001875 compounds Chemical class 0.000 claims description 5
- -1 (1,1, 2,2-Tetrachloroethyl-1 ', 2', 2 ', 2'-tetrachloroethyl) disulfide Chemical compound 0.000 claims description 3
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 230000001069 nematicidal effect Effects 0.000 claims description 3
- 229910052717 sulfur Inorganic materials 0.000 claims description 3
- 239000003054 catalyst Substances 0.000 claims description 2
- 239000000203 mixture Substances 0.000 claims description 2
- 239000011541 reaction mixture Substances 0.000 claims description 2
- 241000196324 Embryophyta Species 0.000 claims 4
- 239000002689 soil Substances 0.000 claims 4
- RUFAFKWLURMVKG-UHFFFAOYSA-N 1,2,2,2-tetrachloroethyl thiohypochlorite Chemical group ClSC(Cl)C(Cl)(Cl)Cl RUFAFKWLURMVKG-UHFFFAOYSA-N 0.000 claims 2
- 241000244206 Nematoda Species 0.000 claims 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims 2
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 claims 2
- 239000005645 nematicide Substances 0.000 claims 2
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 claims 2
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 claims 2
- 240000008067 Cucumis sativus Species 0.000 claims 1
- 235000010799 Cucumis sativus var sativus Nutrition 0.000 claims 1
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 claims 1
- 206010061217 Infestation Diseases 0.000 claims 1
- 229910021578 Iron(III) chloride Inorganic materials 0.000 claims 1
- 241000243786 Meloidogyne incognita Species 0.000 claims 1
- 238000005481 NMR spectroscopy Methods 0.000 claims 1
- 244000061176 Nicotiana tabacum Species 0.000 claims 1
- 235000002637 Nicotiana tabacum Nutrition 0.000 claims 1
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- 201000010099 disease Diseases 0.000 claims 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims 1
- 230000000694 effects Effects 0.000 claims 1
- 238000002474 experimental method Methods 0.000 claims 1
- 238000004817 gas chromatography Methods 0.000 claims 1
- 230000005484 gravity Effects 0.000 claims 1
- 239000004519 grease Substances 0.000 claims 1
- 239000007788 liquid Substances 0.000 claims 1
- 229920001296 polysiloxane Polymers 0.000 claims 1
- 238000007086 side reaction Methods 0.000 claims 1
- 239000000377 silicon dioxide Substances 0.000 claims 1
- 235000013311 vegetables Nutrition 0.000 claims 1
- 238000009423 ventilation Methods 0.000 claims 1
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- BVBSBPNAKSURIT-UHFFFAOYSA-N 2,2,2-trichloroethyl thiohypochlorite Chemical compound ClC(CSCl)(Cl)Cl BVBSBPNAKSURIT-UHFFFAOYSA-N 0.000 description 2
- 125000004432 carbon atom Chemical class C* 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- SAPVRZJHCTUGIW-UHFFFAOYSA-N 1,1,1,2-tetrachloro-2-(1,2,2,2-tetrachloroethyldisulfanyl)ethane Chemical compound ClC(Cl)(Cl)C(Cl)SSC(Cl)C(Cl)(Cl)Cl SAPVRZJHCTUGIW-UHFFFAOYSA-N 0.000 description 1
- SMZHKGXSEAGRTI-UHFFFAOYSA-N 1,1,1-trichloropropan-2-one Chemical compound CC(=O)C(Cl)(Cl)Cl SMZHKGXSEAGRTI-UHFFFAOYSA-N 0.000 description 1
- GCGSLMNJWBLLAH-UHFFFAOYSA-N 2-chloroethyl thiohypochlorite Chemical compound ClCCSCl GCGSLMNJWBLLAH-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- JLQNHALFVCURHW-UHFFFAOYSA-N cyclooctasulfur Chemical group S1SSSSSSS1 JLQNHALFVCURHW-UHFFFAOYSA-N 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 150000002019 disulfides Chemical class 0.000 description 1
- PXJJSXABGXMUSU-UHFFFAOYSA-N disulfur dichloride Chemical compound ClSSCl PXJJSXABGXMUSU-UHFFFAOYSA-N 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- SNICXCGAKADSCV-UHFFFAOYSA-N nicotine Chemical compound CN1CCCC1C1=CC=CN=C1 SNICXCGAKADSCV-UHFFFAOYSA-N 0.000 description 1
- 230000000361 pesticidal effect Effects 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- FWMUJAIKEJWSSY-UHFFFAOYSA-N sulfur dichloride Chemical class ClSCl FWMUJAIKEJWSSY-UHFFFAOYSA-N 0.000 description 1
- 125000004953 trihalomethyl group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C313/00—Sulfinic acids; Sulfenic acids; Halides, esters or anhydrides thereof; Amides of sulfinic or sulfenic acids, i.e. compounds having singly-bound oxygen atoms of sulfinic or sulfenic groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C313/08—Sulfenic acids; Derivatives thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Indole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US233874A US3200146A (en) | 1962-10-29 | 1962-10-29 | Tetrahaloethylsulfenyl halide |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1220852B true DE1220852B (de) | 1966-07-14 |
Family
ID=22879027
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEH50600A Pending DE1220852B (de) | 1962-10-29 | 1963-10-21 | Verfahren zur Herstellung von 1, 1, 2, 2-Tetrachloraethylsulfenylchlorid |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3200146A (cg-RX-API-DMAC7.html) |
| BE (1) | BE669489A (cg-RX-API-DMAC7.html) |
| DE (1) | DE1220852B (cg-RX-API-DMAC7.html) |
| GB (1) | GB1072737A (cg-RX-API-DMAC7.html) |
| NL (1) | NL299822A (cg-RX-API-DMAC7.html) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0485856A1 (de) * | 1990-11-16 | 1992-05-20 | Bayer Ag | Verfahren zur Herstellung von 1,1-Difluoralkansulfenylchloriden |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1204664B (de) * | 1964-02-19 | 1965-11-11 | Bayer Ag | Verfahren zur Herstellung von Thioaethergruppen enthaltenden Isocyanaten |
| US3463803A (en) * | 1966-10-28 | 1969-08-26 | Chemagro Corp | Polyhaloethyl and polyhalovinyl sulfinate and thiosulfinate esters |
| US3489766A (en) * | 1968-01-29 | 1970-01-13 | Hooker Chemical Corp | N-trihalovinylmercaptotetrahydrophthalimides |
| BE755701A (fr) * | 1969-09-03 | 1971-03-03 | Bayer Ag | Procede de preparation de n-(4-chloro-phenylthiomethyl)- phtalimide |
| US3764698A (en) * | 1970-05-21 | 1973-10-09 | Monsanto Co | Insecticides compositions and methods employing 3,4, substituted phenylmethylsulfinates |
| GB9100655D0 (en) * | 1991-01-11 | 1991-02-27 | Ici Plc | Preparation of sulphonyl halides |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1125915B (de) * | 1959-03-23 | 1962-03-22 | Hooker Chemical Corp | Verfahren zur Herstellung von 1, 2, 2, 2-Tetrahalogenaethylsulfenylhalogeniden |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2853516A (en) * | 1955-04-18 | 1958-09-23 | Phillips Petroleum Co | Method of reacting a halogen with an alkyl mercaptan and a dialkyl disulfide |
| US2821554A (en) * | 1955-08-30 | 1958-01-28 | California Spray Chemical Corp | Methane sulfenyl bromides |
| US3019258A (en) * | 1958-12-30 | 1962-01-30 | Pennsalt Chemicals Corp | Organic fluorine compounds |
-
0
- NL NL299822D patent/NL299822A/xx unknown
-
1962
- 1962-10-29 US US233874A patent/US3200146A/en not_active Expired - Lifetime
-
1963
- 1963-10-18 GB GB41232/63A patent/GB1072737A/en not_active Expired
- 1963-10-21 DE DEH50600A patent/DE1220852B/de active Pending
-
1965
- 1965-09-10 BE BE669489A patent/BE669489A/xx unknown
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1125915B (de) * | 1959-03-23 | 1962-03-22 | Hooker Chemical Corp | Verfahren zur Herstellung von 1, 2, 2, 2-Tetrahalogenaethylsulfenylhalogeniden |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0485856A1 (de) * | 1990-11-16 | 1992-05-20 | Bayer Ag | Verfahren zur Herstellung von 1,1-Difluoralkansulfenylchloriden |
Also Published As
| Publication number | Publication date |
|---|---|
| GB1072737A (en) | 1967-06-21 |
| BE669489A (cg-RX-API-DMAC7.html) | 1965-12-31 |
| US3200146A (en) | 1965-08-10 |
| NL299822A (cg-RX-API-DMAC7.html) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1220852B (de) | Verfahren zur Herstellung von 1, 1, 2, 2-Tetrachloraethylsulfenylchlorid | |
| DE2614875C2 (de) | Verfahren zur Herstellung von Alkyl- bzw. Arylthiomethylphenolen | |
| DE955417C (de) | Verfahren zur Herstellung von quartaeren Ammoniumsalzen | |
| DE848811C (de) | Verfahren zur Herstellung organischer Chlorthiophosphorsaeureester | |
| DE1204665B (de) | Verfahren zur Herstellung von Trifluormethyl-phenylsulfonsaeure-trifluormethylphenylamiden | |
| DE2007864A1 (de) | Thiophosphorsäureester, Verfahren zu deren Herstellung sowie deren Verwendung | |
| DE1148540B (de) | Verfahren zur Herstellung von substituierten Benzylisothiocyanaten | |
| US3365361A (en) | Plant root-knot gall nematode control with 5-carbamoyloxyimino-1, 3-dithianes | |
| CH624668A5 (cg-RX-API-DMAC7.html) | ||
| DE965968C (de) | Verfahren zur Herstellung von Aminsulfenhalogeniden | |
| DE2240427C3 (de) | Cyclohexylthiophosphorsäureester, Verfahren zu Ihrer Herstellung und ihre Verwendung | |
| DE2808006A1 (de) | Verfahren zur herstellung von prostacyclin und seinen analogen | |
| DE1793773A1 (de) | Verfahren zur herstellung von alkylenepisulfiden mit 2 bis 3 kohlenstoffatomen | |
| DE1125915B (de) | Verfahren zur Herstellung von 1, 2, 2, 2-Tetrahalogenaethylsulfenylhalogeniden | |
| DE946710C (de) | Verfahren zur Herstellung von N-disubstituierten Sulfamidsaeurechloriden | |
| DE1226098B (de) | Verfahren zur Herstellung von Bis-(halogenalkyl)-disulfiden | |
| DE2937291C2 (de) | Verfahren zur Herstellung von 3-Methylthio-butanon(2) | |
| DE2548898A1 (de) | Benzothiazolderivate, verfahren zu ihrer herstellung und ihre verwendung als herbizide | |
| DE3018088A1 (de) | Verfahren zur herstellung von 2-chlorbenzothiazol | |
| DE1140583B (de) | Verfahren zur Herstellung von o-[Bis-(2-chloraethyl)-amino]-phenyl-alanin | |
| AT225707B (de) | Verfahren zur Herstellung von Arylimino-halogenkohlensäureestern | |
| DE2316733A1 (de) | Dithio- und trithiophosphonsaeureester, verfahren zu ihrer herstellung und ihre verwendung als insektizide, akarizide und nematozide | |
| DE2519085B2 (de) | Substituierte benzolmethanolverbindungen und diese enthaltende herbizide mittel | |
| DE1071701B (de) | Verfahren zur Herstellung von neuen Dithiophosphonsäureestiern | |
| DE1931054A1 (de) | Verfahren zur Herstellung von N-substituierten-N-Fluorcarbonyl-N-sulfenylhalogeniden |