DE1217365B - - Google Patents
Info
- Publication number
- DE1217365B DE1217365B DENDAT1217365D DE1217365DA DE1217365B DE 1217365 B DE1217365 B DE 1217365B DE NDAT1217365 D DENDAT1217365 D DE NDAT1217365D DE 1217365D A DE1217365D A DE 1217365DA DE 1217365 B DE1217365 B DE 1217365B
- Authority
- DE
- Germany
- Prior art keywords
- equivalent
- trichlorethylene
- hours
- sample
- methylpyrrole
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 claims description 19
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims description 18
- 239000003381 stabilizer Substances 0.000 claims description 17
- OXHNLMTVIGZXSG-UHFFFAOYSA-N 1-Methylpyrrole Chemical compound CN1C=CC=C1 OXHNLMTVIGZXSG-UHFFFAOYSA-N 0.000 claims description 16
- 238000000034 method Methods 0.000 claims description 15
- RBACIKXCRWGCBB-UHFFFAOYSA-N 1,2-Epoxybutane Chemical compound CCC1CO1 RBACIKXCRWGCBB-UHFFFAOYSA-N 0.000 claims description 13
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 claims description 13
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 12
- SQGYOTSLMSWVJD-UHFFFAOYSA-N silver(1+) nitrate Chemical compound [Ag+].[O-]N(=O)=O SQGYOTSLMSWVJD-UHFFFAOYSA-N 0.000 claims description 11
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 claims description 9
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 claims description 7
- FXNDIJDIPNCZQJ-UHFFFAOYSA-N 2,4,4-trimethylpent-1-ene Chemical group CC(=C)CC(C)(C)C FXNDIJDIPNCZQJ-UHFFFAOYSA-N 0.000 claims description 6
- 229910001961 silver nitrate Inorganic materials 0.000 claims description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical compound CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 claims description 2
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- IAQRGUVFOMOMEM-UHFFFAOYSA-N butene Natural products CC=CC IAQRGUVFOMOMEM-UHFFFAOYSA-N 0.000 claims description 2
- 150000002924 oxiranes Chemical class 0.000 claims description 2
- 230000006641 stabilisation Effects 0.000 claims description 2
- 238000011105 stabilization Methods 0.000 claims description 2
- NDVLTYZPCACLMA-UHFFFAOYSA-N silver oxide Chemical compound [O-2].[Ag+].[Ag+] NDVLTYZPCACLMA-UHFFFAOYSA-N 0.000 claims 2
- 229910002651 NO3 Inorganic materials 0.000 claims 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 claims 1
- CCBJETYDMFCKJZ-UHFFFAOYSA-L [OH-].[OH-].[Na+].[Cl+] Chemical compound [OH-].[OH-].[Na+].[Cl+] CCBJETYDMFCKJZ-UHFFFAOYSA-L 0.000 claims 1
- 150000002500 ions Chemical class 0.000 claims 1
- 229910001923 silver oxide Inorganic materials 0.000 claims 1
- 238000010992 reflux Methods 0.000 description 12
- 239000002244 precipitate Substances 0.000 description 11
- 239000000203 mixture Substances 0.000 description 9
- 238000010438 heat treatment Methods 0.000 description 6
- 239000002904 solvent Substances 0.000 description 5
- -1 trichlorethylene Chemical class 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 4
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 4
- 238000000354 decomposition reaction Methods 0.000 description 4
- 239000011521 glass Substances 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- 239000004593 Epoxy Substances 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 238000004448 titration Methods 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- FFRBMBIXVSCUFS-UHFFFAOYSA-N 2,4-dinitro-1-naphthol Chemical compound C1=CC=C2C(O)=C([N+]([O-])=O)C=C([N+]([O-])=O)C2=C1 FFRBMBIXVSCUFS-UHFFFAOYSA-N 0.000 description 1
- POAOYUHQDCAZBD-UHFFFAOYSA-N 2-butoxyethanol Chemical compound CCCCOCCO POAOYUHQDCAZBD-UHFFFAOYSA-N 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- 229940093475 2-ethoxyethanol Drugs 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- GVGLGOZIDCSQPN-PVHGPHFFSA-N Heroin Chemical compound O([C@H]1[C@H](C=C[C@H]23)OC(C)=O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4OC(C)=O GVGLGOZIDCSQPN-PVHGPHFFSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 235000008331 Pinus X rigitaeda Nutrition 0.000 description 1
- 235000011613 Pinus brutia Nutrition 0.000 description 1
- 241000018646 Pinus brutia Species 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 239000000956 alloy Substances 0.000 description 1
- 229910045601 alloy Inorganic materials 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005238 degreasing Methods 0.000 description 1
- RXKJFZQQPQGTFL-UHFFFAOYSA-N dihydroxyacetone Chemical compound OCC(=O)CO RXKJFZQQPQGTFL-UHFFFAOYSA-N 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- 125000003700 epoxy group Chemical group 0.000 description 1
- 210000003608 fece Anatomy 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 238000006864 oxidative decomposition reaction Methods 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C17/00—Preparation of halogenated hydrocarbons
- C07C17/38—Separation; Purification; Stabilisation; Use of additives
- C07C17/42—Use of additives, e.g. for stabilisation
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Epoxy Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB1788063A GB990499A (en) | 1963-05-06 | 1963-05-06 | Stabilised solvent |
| BE647518A BE647518A (OSRAM) | 1963-05-06 | 1964-05-05 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1217365B true DE1217365B (OSRAM) | 1966-05-26 |
Family
ID=25655883
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DENDAT1217365D Pending DE1217365B (OSRAM) | 1963-05-06 |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US3269953A (OSRAM) |
| BE (1) | BE647518A (OSRAM) |
| DE (1) | DE1217365B (OSRAM) |
| NL (1) | NL6405011A (OSRAM) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1567652A (en) * | 1976-12-24 | 1980-05-21 | Ici Ltd | Stabilised 1,1,1-trichloroethane |
| US4368338A (en) * | 1981-06-18 | 1983-01-11 | The Dow Chemical Company | Degreaser solvent stabilization |
| US4942267A (en) * | 1986-12-22 | 1990-07-17 | Occidential Chemical Corporation | Perchloroethylene stabilization |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB765522A (en) * | 1954-02-16 | 1957-01-09 | Diamond Alkali Co | Improvements in or relating to the stabilization of chlorohydrocarbons |
| US2797250A (en) * | 1954-05-13 | 1957-06-25 | Du Pont | Stabilization of chlorinated hydrocarbons |
| US2978518A (en) * | 1957-12-19 | 1961-04-04 | Solvay | Process for the stabilization of chlorinated hydrocarbons |
| US2973392A (en) * | 1958-08-15 | 1961-02-28 | Canadian Ind | Stabilization of halohydrocarbons |
-
0
- DE DENDAT1217365D patent/DE1217365B/de active Pending
-
1964
- 1964-04-23 US US362190A patent/US3269953A/en not_active Expired - Lifetime
- 1964-05-05 BE BE647518A patent/BE647518A/xx unknown
- 1964-05-06 NL NL6405011A patent/NL6405011A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NL6405011A (OSRAM) | 1964-11-09 |
| BE647518A (OSRAM) | 1964-11-05 |
| US3269953A (en) | 1966-08-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE562820C (de) | Verfahren zum Stabilisieren von niedrigmolekularen chlorierten Kohlenwasserstoffen | |
| DE1173306B (de) | Gegen Zersetzung bei Beruehrung mit Metallen stabilisiertes 1, 1, 1-Trichloraethan | |
| DE2722819A1 (de) | Korrosionsinhibierendes kuehl- und metallbearbeitungsmittel | |
| DE1546412A1 (de) | Papierbehandlungsloesungen | |
| DE1217365B (OSRAM) | ||
| DE1211892B (de) | Nichtwaessriges Phosphatierungsbad | |
| DE2164394B2 (de) | Stabilisierung von Trichlorethylen oder Tetrachlorethylen | |
| DE3733209A1 (de) | Stabilisierte organische chlorverbindungen und chlorsubstituierte verbindungen mit c(pfeil abwaerts)3(pfeil abwaerts) und c(pfeil abwaerts)4(pfeil abwaerts), deren gemische oder zubereitungen | |
| DE1964752A1 (de) | Stabilisierte Methylchloroform-Zubereitung | |
| EP0085949B1 (de) | Stabilisiertes Trichlorethen und Mittel zur Stabilisierung von Trichlorethen | |
| DE880141C (de) | Verfahren zum Stabilisieren von technischem Tetrachloräthylen | |
| EP0111894B1 (de) | Verfahren zum Stabilisieren von epoxidhaltigem Perchlorethylen | |
| EP0033782B1 (de) | Stabilisiertes Trichloräthylen | |
| DE2932227C3 (de) | Stabilisiertes Cyclohexenoxid und dessen Verwendung zum Stabilisieren von ungesättigten chlorierten Lösungsmitteln | |
| DE2716534A1 (de) | Verfahren zur stabilisierung von methylenchlorid | |
| DE2928640C3 (de) | Stabilisiertes Cyclohexenoxid und Verwendung desselben zur Stabilisierung von Perchloräthylen | |
| DE2656076C3 (de) | Verwendung eines Stahls zur Herstellung sole- oder seewasserkorrosionsbeständiger Teile | |
| DE2360969A1 (de) | Stabilisierung von methylchloroform | |
| DE931449C (de) | Verfahren zum elektrolytischen AEtzen von Tantal | |
| DE2102842A1 (de) | Stabilisiertes Methylchloroform | |
| DE2717322A1 (de) | Stabilisiertes von 1,1,1-trichloraethan | |
| DE1567519C (de) | Stabilisierung von Wasserstoffperoxyd | |
| DE1468786A1 (de) | Verfahren zur Stabilisierung von 1,1,1-Trichloraethan gegenueber Zersetzung | |
| DE2225513C3 (de) | Stabilisierte Methylenchlorid-Zusammensetzung | |
| DE2123416C3 (de) | Verwendung einer korrosionsbeständigen Zirkoniumlegierung |