DE1123328B - Verfahren zur Herstellung basisch substituierter 2-Alkylmercapto-4-alkoxypyrimidinderivate. - Google Patents
Verfahren zur Herstellung basisch substituierter 2-Alkylmercapto-4-alkoxypyrimidinderivate.Info
- Publication number
- DE1123328B DE1123328B DE1958F0027395 DEF0027395A DE1123328B DE 1123328 B DE1123328 B DE 1123328B DE 1958F0027395 DE1958F0027395 DE 1958F0027395 DE F0027395 A DEF0027395 A DE F0027395A DE 1123328 B DE1123328 B DE 1123328B
- Authority
- DE
- Germany
- Prior art keywords
- general formula
- compounds
- alkyl radical
- derivatives
- alkylmercapto
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 6
- 238000002360 preparation method Methods 0.000 title claims description 3
- 150000001875 compounds Chemical class 0.000 claims description 17
- -1 aliphatic alcohols Chemical class 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 150000003242 quaternary ammonium salts Chemical class 0.000 claims description 4
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 2
- ZEMGGZBWXRYJHK-UHFFFAOYSA-N thiouracil Chemical class O=C1C=CNC(=S)N1 ZEMGGZBWXRYJHK-UHFFFAOYSA-N 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- 229910052799 carbon Inorganic materials 0.000 claims 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 18
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 8
- 241001465754 Metazoa Species 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 206010028980 Neoplasm Diseases 0.000 description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- ZLAQATDNGLKIEV-UHFFFAOYSA-N 5-methyl-2-sulfanylidene-1h-pyrimidin-4-one Chemical compound CC1=CNC(=S)NC1=O ZLAQATDNGLKIEV-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 230000001476 alcoholic effect Effects 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 230000001085 cytostatic effect Effects 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 2
- 229910052753 mercury Inorganic materials 0.000 description 2
- 229940072033 potash Drugs 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 235000015320 potassium carbonate Nutrition 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- 240000009226 Corylus americana Species 0.000 description 1
- 235000001543 Corylus americana Nutrition 0.000 description 1
- 235000007466 Corylus avellana Nutrition 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- WDJHALXBUFZDSR-UHFFFAOYSA-M acetoacetate Chemical compound CC(=O)CC([O-])=O WDJHALXBUFZDSR-UHFFFAOYSA-M 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- 125000005337 azoxy group Chemical group [N+]([O-])(=N*)* 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000000824 cytostatic agent Substances 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 150000003230 pyrimidines Chemical class 0.000 description 1
- 238000005956 quaternization reaction Methods 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- 125000005853 β-dimethylaminoethyl group Chemical group 0.000 description 1
Priority Applications (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE1958F0027395 DE1123328B (de) | 1958-12-31 | 1958-12-31 | Verfahren zur Herstellung basisch substituierter 2-Alkylmercapto-4-alkoxypyrimidinderivate. |
| FR837163A FR452M (en:Method) | 1958-12-31 | 1960-08-30 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE1958F0027395 DE1123328B (de) | 1958-12-31 | 1958-12-31 | Verfahren zur Herstellung basisch substituierter 2-Alkylmercapto-4-alkoxypyrimidinderivate. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1123328B true DE1123328B (de) | 1962-02-08 |
Family
ID=34398495
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1958F0027395 Pending DE1123328B (de) | 1958-12-31 | 1958-12-31 | Verfahren zur Herstellung basisch substituierter 2-Alkylmercapto-4-alkoxypyrimidinderivate. |
Country Status (2)
| Country | Link |
|---|---|
| DE (1) | DE1123328B (en:Method) |
| FR (1) | FR452M (en:Method) |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE9511A (de) | H. GLADE in Bremen | Maschine zum gleichzeitigen Schneiden und Hobeln dünner Breltchen | ||
| DE831698C (de) * | 1950-02-02 | 1952-02-18 | Aschaffenburger Zellstoffwerke | Verfahren zur Herstellung von 2-Thio-4-methyl-5-n-butyl-6-oxypyrimidin (4-Methyl-5-n-butyl-thiouracil) |
| DE936747C (de) * | 1952-06-27 | 1955-12-22 | Cilag Ag | Verfahren zur Herstellung von neuen Pyrimidinderivaten und deren Salzen |
-
1958
- 1958-12-31 DE DE1958F0027395 patent/DE1123328B/de active Pending
-
1960
- 1960-08-30 FR FR837163A patent/FR452M/fr active Active
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE9511A (de) | H. GLADE in Bremen | Maschine zum gleichzeitigen Schneiden und Hobeln dünner Breltchen | ||
| DE831698C (de) * | 1950-02-02 | 1952-02-18 | Aschaffenburger Zellstoffwerke | Verfahren zur Herstellung von 2-Thio-4-methyl-5-n-butyl-6-oxypyrimidin (4-Methyl-5-n-butyl-thiouracil) |
| DE936747C (de) * | 1952-06-27 | 1955-12-22 | Cilag Ag | Verfahren zur Herstellung von neuen Pyrimidinderivaten und deren Salzen |
Also Published As
| Publication number | Publication date |
|---|---|
| FR452M (en:Method) | 1961-04-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1593723A1 (de) | Verfahren zur Herstellung von Acetalen | |
| DD140041B1 (de) | Verfahren zur herstellung von langkettigen n-alkyldimethylmorpholinen | |
| EP0115325B1 (de) | Verfahren zur Herstellung von 2-substituierten 5-Nitroso-4,6-diamino-pyrimidinen | |
| DE880749C (de) | Verfahren zur Herstellung von tertiaeren Diaminen | |
| EP0003212B1 (de) | 2.4-Diamino-5-benzylpyrimidine und diese enthaltende pharmazeutische Präparate sowie deren Herstellung | |
| DE2065698C3 (de) | Verfahren zur Herstellung von 2-Isopropyl-6-methyl-4(3H)-pyrimidon | |
| DE1670168B2 (de) | 2-Benzolsulfonamido-4-methyl-5alkyl-pyrimidine und Verfahren zu ihrer Herstellung | |
| DE943706C (de) | Verfahren zur Herstellung von 2, 4-Diamino-5-benzylpyrimidinabkoemmlingen | |
| DE933754C (de) | Verfahren zur Herstellung von Derivaten des Tetrahydro-ª†-carbolins | |
| CH513158A (de) | Verfahren zur Herstellung von Pyrrolinverbindungen | |
| AT213896B (de) | Verfahren zur Herstellung von neuen, basisch substituierten Thioäthern von Pyrimidinen | |
| DE864555C (de) | Verfahren zur Herstellung von 2, 4-Diamino-5-aryloxypyrimidinen | |
| AT319960B (de) | Verfahren zur Herstellung von neuen Pyridazinverbindungen | |
| EP0065705B1 (de) | Verfahren zur Herstellung eines substituierten Pyrimidins | |
| DE1000387C2 (de) | Verfahren zur Herstellung von neuen, in 9-Stellung substituierten 1, 10-Diazaanthracenen | |
| DE1795842C2 (de) | Antidiabetisch wirksame Sulfonamide sowie Verfahren zu deren Herstellung | |
| DE889151C (de) | Verfahren zur Herstellung von 2, 4-Diamino-5-phenyl-pyrimidin-abkoemmlingen | |
| AT229870B (de) | Verfahren zur Herstellung von Sulfonamiden der Pyrimidinreihe | |
| AT338800B (de) | Verfahren zur herstellung von 2,4-diamino-5-(3',4',5'-trimethoxybenzyl)-6-chlorpyrimidin | |
| DE2333014A1 (de) | Neue immoniumsalze, verfahren zu ihrer herstellung und ihre anwendung bei der organischen synthese | |
| AT336020B (de) | Verfahren zur herstellung von 2,4-diamino-5-benzylpyrimidinen und ihren salzen | |
| DE1192647B (de) | Verfahren zur Herstellung von Thiol- bzw. Thionothiolphosphonsaeureestern | |
| DE2013557C (de) | Verfahren zur Herstellung von N (p Aminobenzolsulfonyl) methylcarbamat | |
| AT202147B (de) | Verfahren zur Herstellung von neuen Piperazinderivaten und von deren Salzen | |
| CH544107A (de) | Verfahren zur Herstellung von Pyrimidin-Derivaten |