DE1119286B - Verfahren zur Herstellung blutdruckwirksamer tertiaerer Amine - Google Patents
Verfahren zur Herstellung blutdruckwirksamer tertiaerer AmineInfo
- Publication number
- DE1119286B DE1119286B DEF28065A DEF0028065A DE1119286B DE 1119286 B DE1119286 B DE 1119286B DE F28065 A DEF28065 A DE F28065A DE F0028065 A DEF0028065 A DE F0028065A DE 1119286 B DE1119286 B DE 1119286B
- Authority
- DE
- Germany
- Prior art keywords
- formula
- amines
- chs
- carbon atoms
- tert
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 6
- 150000003512 tertiary amines Chemical class 0.000 title claims description 5
- 230000036772 blood pressure Effects 0.000 title claims description 3
- 238000002360 preparation method Methods 0.000 title claims description 3
- 150000001412 amines Chemical class 0.000 claims description 11
- -1 aryl sulfonic acid esters Chemical class 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 239000002253 acid Substances 0.000 claims description 3
- 150000003839 salts Chemical class 0.000 claims description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical class OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 2
- 125000002252 acyl group Chemical group 0.000 claims description 2
- 150000001298 alcohols Chemical class 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 229920006395 saturated elastomer Polymers 0.000 claims description 2
- 125000003441 thioacyl group Chemical group 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 12
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 10
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 5
- 235000019253 formic acid Nutrition 0.000 description 5
- 238000001816 cooling Methods 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- YBRBMKDOPFTVDT-UHFFFAOYSA-N tert-butylamine Chemical compound CC(C)(C)N YBRBMKDOPFTVDT-UHFFFAOYSA-N 0.000 description 4
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- 239000008098 formaldehyde solution Substances 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- POANXYQWEMCVBJ-UHFFFAOYSA-N 2-(tert-butylamino)propan-1-ol Chemical compound OCC(C)NC(C)(C)C POANXYQWEMCVBJ-UHFFFAOYSA-N 0.000 description 2
- ZWXQPERWRDHCMZ-UHFFFAOYSA-N 2-methyl-n-propan-2-ylpropan-2-amine Chemical compound CC(C)NC(C)(C)C ZWXQPERWRDHCMZ-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- MJGFBOZCAJSGQW-UHFFFAOYSA-N mercury sodium Chemical compound [Na].[Hg] MJGFBOZCAJSGQW-UHFFFAOYSA-N 0.000 description 2
- XQOIBQBPAXOVGP-UHFFFAOYSA-N n-ethyl-2-methylpropan-2-amine Chemical compound CCNC(C)(C)C XQOIBQBPAXOVGP-UHFFFAOYSA-N 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 229910001023 sodium amalgam Inorganic materials 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- LGAJYTCRJPCZRJ-UHFFFAOYSA-N 2-bromopentane Chemical compound CCCC(C)Br LGAJYTCRJPCZRJ-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- MRKCQNRYHYBXFO-UHFFFAOYSA-N N-tert-butyl-N-methylpentan-2-amine Chemical compound CCCC(C)N(C)C(C)(C)C MRKCQNRYHYBXFO-UHFFFAOYSA-N 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- 230000003276 anti-hypertensive effect Effects 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- ARFLASKVLJTEJD-UHFFFAOYSA-N ethyl 2-bromopropanoate Chemical compound CCOC(=O)C(C)Br ARFLASKVLJTEJD-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- FMKOJHQHASLBPH-UHFFFAOYSA-N isopropyl iodide Chemical compound CC(C)I FMKOJHQHASLBPH-UHFFFAOYSA-N 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 150000004681 metal hydrides Chemical class 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- WYLLBTPEHIVUKV-UHFFFAOYSA-N n,2-dimethyl-n-propan-2-ylpropan-2-amine Chemical compound CC(C)N(C)C(C)(C)C WYLLBTPEHIVUKV-UHFFFAOYSA-N 0.000 description 1
- DLSOILHAKCBARI-UHFFFAOYSA-N n-benzyl-2-methylpropan-2-amine Chemical compound CC(C)(C)NCC1=CC=CC=C1 DLSOILHAKCBARI-UHFFFAOYSA-N 0.000 description 1
- UWWDOXOEHZHHRR-UHFFFAOYSA-N n-benzyl-n,2-dimethylpropan-2-amine Chemical compound CC(C)(C)N(C)CC1=CC=CC=C1 UWWDOXOEHZHHRR-UHFFFAOYSA-N 0.000 description 1
- BWWLCYLGZIWOHK-UHFFFAOYSA-N n-ethyl-n,2-dimethylpropan-2-amine Chemical compound CCN(C)C(C)(C)C BWWLCYLGZIWOHK-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- CQKAPARXKPTKBK-UHFFFAOYSA-N tert-butylazanium;bromide Chemical compound Br.CC(C)(C)N CQKAPARXKPTKBK-UHFFFAOYSA-N 0.000 description 1
- ZJVTYKZWDWVIFD-UHFFFAOYSA-N zinc;hydrochloride Chemical compound Cl.[Zn] ZJVTYKZWDWVIFD-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C231/00—Preparation of carboxylic acid amides
- C07C231/02—Preparation of carboxylic acid amides from carboxylic acids or from esters, anhydrides, or halides thereof by reaction with ammonia or amines
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF28065A DE1119286B (de) | 1959-03-28 | 1959-03-28 | Verfahren zur Herstellung blutdruckwirksamer tertiaerer Amine |
| BE589124A BE589124A (fr) | 1959-03-28 | 1960-03-28 | Fabrication d'amines tertiaires agissant sur la tension sanguine. |
| FR837166A FR455M (https=) | 1959-03-28 | 1960-08-30 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF28065A DE1119286B (de) | 1959-03-28 | 1959-03-28 | Verfahren zur Herstellung blutdruckwirksamer tertiaerer Amine |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1119286B true DE1119286B (de) | 1961-12-14 |
Family
ID=7092730
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEF28065A Pending DE1119286B (de) | 1959-03-28 | 1959-03-28 | Verfahren zur Herstellung blutdruckwirksamer tertiaerer Amine |
Country Status (3)
| Country | Link |
|---|---|
| BE (1) | BE589124A (https=) |
| DE (1) | DE1119286B (https=) |
| FR (1) | FR455M (https=) |
-
1959
- 1959-03-28 DE DEF28065A patent/DE1119286B/de active Pending
-
1960
- 1960-03-28 BE BE589124A patent/BE589124A/fr unknown
- 1960-08-30 FR FR837166A patent/FR455M/fr active Active
Non-Patent Citations (1)
| Title |
|---|
| None * |
Also Published As
| Publication number | Publication date |
|---|---|
| BE589124A (fr) | 1960-07-18 |
| FR455M (https=) | 1961-04-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1545575C2 (de) | N, N'-Bis- eckige Klammer auf 3"(3', 4', 5'-trimethoxybenzoyloxy)-propyl eckige Klammer zu -homopiperazin | |
| DE916168C (de) | Verfahren zur Herstellung von Pyrrolidinoalkylphenothiazinen | |
| DE934651C (de) | Verfahren zur Herstellung von tetrasubstituierten Diaminoalkanen | |
| DE1795344A1 (de) | 3-Amino-isothiazole | |
| DE1119286B (de) | Verfahren zur Herstellung blutdruckwirksamer tertiaerer Amine | |
| AT216485B (de) | Verfahren zur Herstellung neuer tertiärer Amine | |
| DE1138048B (de) | Verfahren zur Herstellung von (Thiono)Phosphon- bzw. (Thiono)Phosphinsaeureestern der ª- und ª-Naphthole | |
| DE1158083B (de) | Verfahren zur Herstellung basisch substituierter Phenylacetonitrile | |
| DE957842C (de) | Verfahren zur Herstellung von neuen Octahydropyridopyrimidinverbindungen | |
| DE930565C (de) | Verfahren zur Herstellung von 1-Phenyl-2-amino-1, 3-propandiolen oder von im Phenylrest substituierten 1-Phenyl-2-amino-1, 3-propandiolen | |
| AT243806B (de) | Verfahren zur Herstellung eines neuen Aziridinyl-Derivates | |
| AT225197B (de) | Verfahren zur Herstellung der neuen N-[p-3,3-disubstituierten-1-Azetidinyläthoxy)-benzyl]-3,4,5-trimethoxybenzamide | |
| AT205962B (de) | Verfahren zur Herstellung von neuen ungesättigten aliphatischen Amino-diolen | |
| DE1193499B (de) | Verfahren zur Herstellung neuer Sulfonamide | |
| DE1088484B (de) | Verfahren zur Herstellung blutdruckwirksamer bicyclisch substituierter Carbinamine bzw. deren nicht toxischen Salzen | |
| DE1033663B (de) | Verfahren zur Herstellung von N-Alkyl-piperidylmethyl-phenthiazinen | |
| DE1445648C (de) | Homopiperazindenvate | |
| DE2136325C3 (de) | 2-(Indanyl-4'-amino) Delta hoch 2imidazolin, seine physiologisch unbedenklichen Säureadditionssalze, Verfahren zu ihrer Herstellung sowie Arzneimittel | |
| DE959015C (de) | Verfahren zur Herstellung von neuen pharmakologisch wirksamen basischen Estern und ihren Salzen | |
| AT200135B (de) | Verfahren zur Herstellung von threo-ß-(p-Nitrophenyl)-serin | |
| AT288395B (de) | Verfahren zur Herstellung von neuen Zimtsäureamiden | |
| AT243268B (de) | Verfahren zur Herstellung von neuen Benzochinolizin-Derivaten | |
| DE1137439B (de) | Verfahren zur Herstellung von substituierten Morpholinen | |
| DE1092003B (de) | Stereospezifisches Verfahren zur Herstellung von 1,3-Dihydroxy-2-amino-alkenen-4 | |
| DE2321496A1 (de) | 2-aminomethyl-4,4-dialkyl-4h-1,3-benzoxazine, deren salze und verfahren zu ihrer herstellung |