DE1087107B - Dampfbuegeleisen mit Tropfverdampfer - Google Patents
Dampfbuegeleisen mit TropfverdampferInfo
- Publication number
- DE1087107B DE1087107B DEC15209A DEC0015209A DE1087107B DE 1087107 B DE1087107 B DE 1087107B DE C15209 A DEC15209 A DE C15209A DE C0015209 A DEC0015209 A DE C0015209A DE 1087107 B DE1087107 B DE 1087107B
- Authority
- DE
- Germany
- Prior art keywords
- evaporator
- steam
- soleplate
- shell
- disc
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 title claims description 61
- 229910052742 iron Inorganic materials 0.000 title claims description 29
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 16
- 239000000463 material Substances 0.000 claims description 6
- 241000538562 Banjos Species 0.000 claims description 2
- 238000001704 evaporation Methods 0.000 description 16
- 230000008020 evaporation Effects 0.000 description 16
- 238000010438 heat treatment Methods 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 3
- 238000004140 cleaning Methods 0.000 description 3
- 238000009826 distribution Methods 0.000 description 3
- 235000000396 iron Nutrition 0.000 description 3
- 229910000831 Steel Inorganic materials 0.000 description 2
- 238000005452 bending Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- 238000010409 ironing Methods 0.000 description 2
- 229910001234 light alloy Inorganic materials 0.000 description 2
- 238000013021 overheating Methods 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- 238000007789 sealing Methods 0.000 description 2
- 239000010959 steel Substances 0.000 description 2
- PMVSDNDAUGGCCE-TYYBGVCCSA-L Ferrous fumarate Chemical compound [Fe+2].[O-]C(=O)\C=C\C([O-])=O PMVSDNDAUGGCCE-TYYBGVCCSA-L 0.000 description 1
- 230000004888 barrier function Effects 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 230000003670 easy-to-clean Effects 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 230000012447 hatching Effects 0.000 description 1
- 238000009434 installation Methods 0.000 description 1
- 230000001788 irregular Effects 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229920002379 silicone rubber Polymers 0.000 description 1
- 239000004945 silicone rubber Substances 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000009827 uniform distribution Methods 0.000 description 1
- 238000009834 vaporization Methods 0.000 description 1
- 230000008016 vaporization Effects 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- D—TEXTILES; PAPER
- D06—TREATMENT OF TEXTILES OR THE LIKE; LAUNDERING; FLEXIBLE MATERIALS NOT OTHERWISE PROVIDED FOR
- D06F—LAUNDERING, DRYING, IRONING, PRESSING OR FOLDING TEXTILE ARTICLES
- D06F75/00—Hand irons
- D06F75/08—Hand irons internally heated by electricity
- D06F75/10—Hand irons internally heated by electricity with means for supplying steam to the article being ironed
- D06F75/14—Hand irons internally heated by electricity with means for supplying steam to the article being ironed the steam being produced from water in a reservoir carried by the iron
- D06F75/18—Hand irons internally heated by electricity with means for supplying steam to the article being ironed the steam being produced from water in a reservoir carried by the iron the water being fed slowly, e.g. drop by drop, from the reservoir to a steam generator
Landscapes
- Engineering & Computer Science (AREA)
- Textile Engineering (AREA)
- Irons (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR1087107X | 1956-07-25 | ||
| FR831574X | 1956-07-25 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1087107B true DE1087107B (de) | 1960-08-18 |
Family
ID=27614742
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEC15209A Pending DE1087107B (de) | 1956-07-25 | 1957-07-24 | Dampfbuegeleisen mit Tropfverdampfer |
Country Status (4)
| Country | Link |
|---|---|
| BE (1) | BE558745A (enExample) |
| DE (1) | DE1087107B (enExample) |
| FR (4) | FR1129185A (enExample) |
| GB (1) | GB831574A (enExample) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1206844B (de) * | 1963-02-15 | 1965-12-16 | Licentia Gmbh | Dampfbuegeleisen |
| DE1206843B (de) * | 1961-03-27 | 1965-12-16 | Licentia Gmbh | Dampfbuegeleisen |
| DE1206845B (de) * | 1964-02-28 | 1965-12-16 | Licentia Gmbh | Dampfbuegeleisen |
| US4089128A (en) * | 1976-04-13 | 1978-05-16 | Baumgartner Erich R | Smoothing or pressing iron having a sole body consisting at least partially of a glass material |
| DE19735214A1 (de) * | 1996-08-24 | 1998-02-26 | Rowenta Werke Gmbh | Elektrisches Bügeleisen mit einer Bügelsohle |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3238649A (en) * | 1964-09-17 | 1966-03-08 | Gen Electric | Steam iron boiler cleaning |
| IT1134878B (it) * | 1980-12-23 | 1986-08-20 | Bettini Antonio Di Santo Betti | Vaporizzatore rapido amovible per ferri da stiro a vapore a caduta di goccia |
| US8776409B2 (en) | 2011-04-20 | 2014-07-15 | Notable Creations, Inc. | Apparatus for removing wrinkles from fabric |
Citations (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH145129A (fr) * | 1928-11-23 | 1931-02-15 | Henri Hirigoyen Eugene | Fer à repasser. |
| US2026422A (en) * | 1933-10-03 | 1935-12-31 | George T Fielding | Dampening and steaming assembly for pressing irons |
| US2329807A (en) * | 1940-11-05 | 1943-09-21 | Silex Co | Combination steaming and pressing iron |
| US2353426A (en) * | 1941-08-05 | 1944-07-11 | Westinghouse Electric & Mfg Co | Steam iron |
| US2387281A (en) * | 1942-07-29 | 1945-10-23 | Westinghouse Electric Corp | Steam iron |
| US2393425A (en) * | 1943-12-23 | 1946-01-22 | Westinghouse Air Brake Co | Reservoir arrangement |
| US2434097A (en) * | 1943-11-25 | 1948-01-06 | Silex Co | Combination steaming and pressing iron |
| US2506941A (en) * | 1949-07-07 | 1950-05-09 | John C Hockery | Steam iron |
| US2615265A (en) * | 1947-11-14 | 1952-10-28 | Nat Pressure Cooker Co | Steaming and pressing iron |
| US2617212A (en) * | 1946-05-31 | 1952-11-11 | Wilfred E Ellinwood | Eduction tube for steam iron tanks |
| US2625756A (en) * | 1947-06-06 | 1953-01-20 | Proctor Electric Co | Feed water system for steam irons |
| FR1083660A (fr) * | 1952-07-02 | 1955-01-11 | Fer à repasser électrique, à dégagement de vapeur d'eau | |
| FR1090438A (fr) * | 1953-03-30 | 1955-03-30 | Rech S Et D Expl De Procedes E | Fer à repasser électrique à vapeur |
| US2777224A (en) * | 1954-09-23 | 1957-01-15 | Casco Products Corp | Steam pressing iron |
| US2792652A (en) * | 1955-11-09 | 1957-05-21 | John P Thornton | Steam iron |
| US2797507A (en) * | 1954-08-06 | 1957-07-02 | Maykemper Henry | Hand pressing steam iron |
-
0
- BE BE558745D patent/BE558745A/xx unknown
-
1955
- 1955-07-21 FR FR1129185D patent/FR1129185A/fr not_active Expired
-
1956
- 1956-07-25 FR FR69638D patent/FR69638E/fr not_active Expired
- 1956-12-12 FR FR70130D patent/FR70130E/fr not_active Expired
-
1957
- 1957-04-24 FR FR71286D patent/FR71286E/fr not_active Expired
- 1957-07-24 DE DEC15209A patent/DE1087107B/de active Pending
- 1957-07-25 GB GB23593/57A patent/GB831574A/en not_active Expired
Patent Citations (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH145129A (fr) * | 1928-11-23 | 1931-02-15 | Henri Hirigoyen Eugene | Fer à repasser. |
| US2026422A (en) * | 1933-10-03 | 1935-12-31 | George T Fielding | Dampening and steaming assembly for pressing irons |
| US2329807A (en) * | 1940-11-05 | 1943-09-21 | Silex Co | Combination steaming and pressing iron |
| US2353426A (en) * | 1941-08-05 | 1944-07-11 | Westinghouse Electric & Mfg Co | Steam iron |
| US2387281A (en) * | 1942-07-29 | 1945-10-23 | Westinghouse Electric Corp | Steam iron |
| US2434097A (en) * | 1943-11-25 | 1948-01-06 | Silex Co | Combination steaming and pressing iron |
| US2393425A (en) * | 1943-12-23 | 1946-01-22 | Westinghouse Air Brake Co | Reservoir arrangement |
| US2617212A (en) * | 1946-05-31 | 1952-11-11 | Wilfred E Ellinwood | Eduction tube for steam iron tanks |
| US2625756A (en) * | 1947-06-06 | 1953-01-20 | Proctor Electric Co | Feed water system for steam irons |
| US2615265A (en) * | 1947-11-14 | 1952-10-28 | Nat Pressure Cooker Co | Steaming and pressing iron |
| US2506941A (en) * | 1949-07-07 | 1950-05-09 | John C Hockery | Steam iron |
| FR1083660A (fr) * | 1952-07-02 | 1955-01-11 | Fer à repasser électrique, à dégagement de vapeur d'eau | |
| FR1090438A (fr) * | 1953-03-30 | 1955-03-30 | Rech S Et D Expl De Procedes E | Fer à repasser électrique à vapeur |
| US2797507A (en) * | 1954-08-06 | 1957-07-02 | Maykemper Henry | Hand pressing steam iron |
| US2777224A (en) * | 1954-09-23 | 1957-01-15 | Casco Products Corp | Steam pressing iron |
| US2792652A (en) * | 1955-11-09 | 1957-05-21 | John P Thornton | Steam iron |
Cited By (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1206843B (de) * | 1961-03-27 | 1965-12-16 | Licentia Gmbh | Dampfbuegeleisen |
| DE1206844B (de) * | 1963-02-15 | 1965-12-16 | Licentia Gmbh | Dampfbuegeleisen |
| DE1206845B (de) * | 1964-02-28 | 1965-12-16 | Licentia Gmbh | Dampfbuegeleisen |
| US4089128A (en) * | 1976-04-13 | 1978-05-16 | Baumgartner Erich R | Smoothing or pressing iron having a sole body consisting at least partially of a glass material |
| DE19735214A1 (de) * | 1996-08-24 | 1998-02-26 | Rowenta Werke Gmbh | Elektrisches Bügeleisen mit einer Bügelsohle |
| DE19735214C2 (de) * | 1996-08-24 | 1998-07-09 | Rowenta Werke Gmbh | Elektrisches Bügeleisen mit einer Bügelsohle |
| US6035563A (en) * | 1996-08-24 | 2000-03-14 | Rowenta-Werke Gmbh | Electric iron with a soleplate and piezoelectric sprayer |
Also Published As
| Publication number | Publication date |
|---|---|
| GB831574A (en) | 1960-03-30 |
| BE558745A (enExample) | |
| FR1129185A (fr) | 1957-01-16 |
| FR69638E (fr) | 1958-11-10 |
| FR71286E (fr) | 1959-11-02 |
| FR70130E (fr) | 1959-02-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2605816B2 (de) | Gerät zur Erwärmung von Speisen u.a | |
| DE1087107B (de) | Dampfbuegeleisen mit Tropfverdampfer | |
| DE2701047C3 (de) | Elektro-Dampfbügeleisen | |
| DE2356062C3 (de) | Elektrisches Dampfbügeleisen | |
| DE1931848A1 (de) | Dampfbuegeleisen | |
| DE739862C (de) | Berieselungsverdampfer | |
| DE2403525C3 (de) | Dampfsterilisator | |
| DE3006783A1 (de) | Buegeleisensohle fuer ein dampf-buegeleisen | |
| CH379541A (de) | Flüssigkeitsverteileinrichtung für Rieselapparate | |
| DE654152C (de) | OEldampfbrenner fuer Kocher und Herde | |
| DE3901024C2 (enExample) | ||
| DE1219901B (de) | Dampfbuegeleisen | |
| DE689446C (enExample) | ||
| DE661504C (de) | Vorrichtung zur Verhinderung des Beschaedigens erhitzter Kochkessel beim Einlassen von kaltem Wasser | |
| DE2248639C3 (de) | Selbstreinigendes Dampfbügeleisen | |
| AT127783B (de) | Verfahren zum Destillieren oder Spalten von Kohlenwasserstoffen in einem Metallbade. | |
| DE596455C (de) | Duese zum Einfuehren von Fluessigkeiten und Gasen in Reaktionsraeume | |
| DE1421674C (de) | Vorrichtung zur Herstellung von fei nen Fasern aus mineralischen oder organi sehen Stoffen in viskosem Zustand, insbe sondere von Glasfasern | |
| DE597211C (de) | Inhalationsgeraet | |
| DE455694C (de) | Brennerkopf fuer Loetlampen und Loetkolben | |
| EP3420827B1 (de) | Kaminhaube für einen wasserpfeifenkopf | |
| DE970270C (de) | Vorrichtung zur Kondensation von Daempfen, Rauch und anderen Abgasen bei der Behandlung chemischer Produkte | |
| AT60772B (de) | Ofen zum Erhitzen der zum Ziehen von Glas benutzten Tiegel. | |
| DE3119370C1 (de) | Dampfbügeleisen | |
| DE727610C (de) | Vorrichtung zum zentralen Einfuehren des Spuelgases in einen ringschachtfoermigen Schwelofen |