DE1069592B - - Google Patents
Info
- Publication number
- DE1069592B DE1069592B DENDAT1069592D DE1069592DA DE1069592B DE 1069592 B DE1069592 B DE 1069592B DE NDAT1069592 D DENDAT1069592 D DE NDAT1069592D DE 1069592D A DE1069592D A DE 1069592DA DE 1069592 B DE1069592 B DE 1069592B
- Authority
- DE
- Germany
- Prior art keywords
- sulfur
- sulfuric acid
- oxygen
- water
- acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 40
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 24
- 229910052717 sulfur Inorganic materials 0.000 claims description 23
- 239000011593 sulfur Substances 0.000 claims description 23
- 238000000034 method Methods 0.000 claims description 19
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 18
- 229910001868 water Inorganic materials 0.000 claims description 17
- 229910052760 oxygen Inorganic materials 0.000 claims description 12
- 239000001301 oxygen Substances 0.000 claims description 12
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 11
- 239000007789 gas Substances 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 239000010802 sludge Substances 0.000 claims description 3
- 238000006243 chemical reaction Methods 0.000 description 13
- AKEJUJNQAAGONA-UHFFFAOYSA-N sulfur trioxide Chemical compound O=S(=O)=O AKEJUJNQAAGONA-UHFFFAOYSA-N 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- 239000003054 catalyst Substances 0.000 description 7
- MWUXSHHQAYIFBG-UHFFFAOYSA-N Nitric oxide Chemical compound O=[N] MWUXSHHQAYIFBG-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000002253 acid Substances 0.000 description 5
- 230000003647 oxidation Effects 0.000 description 5
- 238000007254 oxidation reaction Methods 0.000 description 5
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- 238000004821 distillation Methods 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- MGWGWNFMUOTEHG-UHFFFAOYSA-N 4-(3,5-dimethylphenyl)-1,3-thiazol-2-amine Chemical compound CC1=CC(C)=CC(C=2N=C(N)SC=2)=C1 MGWGWNFMUOTEHG-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 2
- AFCARXCZXQIEQB-UHFFFAOYSA-N N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(CCNC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 AFCARXCZXQIEQB-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 229910001882 dioxygen Inorganic materials 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- JCXJVPUVTGWSNB-UHFFFAOYSA-N nitrogen dioxide Inorganic materials O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 239000000375 suspending agent Substances 0.000 description 2
- WTGITIGUIKCSQS-UHFFFAOYSA-N S(O)(O)(=O)=O.[N+](=O)[O-] Chemical compound S(O)(O)(=O)=O.[N+](=O)[O-] WTGITIGUIKCSQS-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- 238000000889 atomisation Methods 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 238000003889 chemical engineering Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 150000002926 oxygen Chemical class 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 229910052715 tantalum Inorganic materials 0.000 description 1
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 description 1
- 150000003682 vanadium compounds Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B17/00—Sulfur; Compounds thereof
- C01B17/69—Sulfur trioxide; Sulfuric acid
- C01B17/74—Preparation
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Catalysts (AREA)
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1069592B true DE1069592B (cg-RX-API-DMAC7.html) | 1959-11-26 |
Family
ID=594676
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DENDAT1069592D Pending DE1069592B (cg-RX-API-DMAC7.html) |
Country Status (1)
| Country | Link |
|---|---|
| DE (1) | DE1069592B (cg-RX-API-DMAC7.html) |
-
0
- DE DENDAT1069592D patent/DE1069592B/de active Pending
Non-Patent Citations (1)
| Title |
|---|
| None * |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2855231C3 (de) | Kontinuierliches Verfahren zur Herstellung von Glykolen | |
| CH631956A5 (de) | Verfahren zur herstellung von 2,5-dichlorphenol. | |
| DE1069592B (cg-RX-API-DMAC7.html) | ||
| DE2724189C3 (de) | Verfahren zur Herstellung von Äthylenglykol | |
| DE2713345C2 (de) | Verfahren zur Herstellung von reinem Brom | |
| EP0001792A1 (de) | Verfahren zur Aufbereitung von Abwasser | |
| DE2035496C3 (de) | Verfahren zur kontinuierlichen Herstellung von Cumolhydroperoxid | |
| DE1065846B (de) | Verfahren zur Herstellung von Carbonsäuren durch Oxydation von Aldehyden mit molekularem Sauerstoff | |
| EP0084674A1 (de) | Verfahren zur Reinigung von Abfallschwefelsäure | |
| DE690894C (de) | Verfahren zur Herstellung von Wasserstoffperoxyd | |
| DE2005015A1 (de) | Verfahren zur Herstellung von Wasserstoff | |
| CH335642A (de) | Verfahren zur Herstellung von Schwefelsäure | |
| DE1261833B (de) | Verfahren zur Herstellung von Chlor und Alkalinitrat | |
| DE854507C (de) | Verfahren zur Herstellung von Alkyladipinsaeuren | |
| DE615637C (de) | Verfahren zur Herstellung von Diacetyl | |
| DE2117034A1 (de) | Verfahren zur Herstellung von 2,4,7 Tn mtrofluorenon | |
| DE1567815C (de) | Verfahren zur Wiedergewinnung von Selenverbindungen | |
| DE1940076A1 (de) | Verfahren zur Herstellung von Oxalsaeure | |
| DE1940076C (cg-RX-API-DMAC7.html) | ||
| DE2326804C3 (de) | Verfahren zur Herstellung von Wasserstoffperoxid | |
| AT155462B (de) | Verfahren zur Herstellung von Wasserstoffperoxyd. | |
| DE862747C (de) | Verfahren zur Herstellung von ª‡, ªÏ-Cyanfettsaeuren | |
| CH506464A (de) | Herstellung von a-Naphthochinonen | |
| DE1273500B (de) | Verfahren zur Herstellung von Alkali- oder Ammoniummonopersulfat | |
| DE1004160B (de) | Verfahren zur Herstellung von reiner Terephthalsaeure |