DE1067305B - - Google Patents
Info
- Publication number
- DE1067305B DE1067305B DENDAT1067305D DE1067305DA DE1067305B DE 1067305 B DE1067305 B DE 1067305B DE NDAT1067305 D DENDAT1067305 D DE NDAT1067305D DE 1067305D A DE1067305D A DE 1067305DA DE 1067305 B DE1067305 B DE 1067305B
- Authority
- DE
- Germany
- Prior art keywords
- mixture
- magnetic
- trough
- insulating material
- developer powder
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000000843 powder Substances 0.000 claims description 56
- 239000000203 mixture Substances 0.000 claims description 46
- 239000011810 insulating material Substances 0.000 claims description 33
- 239000002245 particle Substances 0.000 claims description 27
- 238000000034 method Methods 0.000 claims description 14
- 239000006249 magnetic particle Substances 0.000 claims description 12
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 12
- 239000000463 material Substances 0.000 description 10
- 229920005989 resin Polymers 0.000 description 9
- 239000011347 resin Substances 0.000 description 9
- 229910052742 iron Inorganic materials 0.000 description 5
- 238000009825 accumulation Methods 0.000 description 4
- 230000002093 peripheral effect Effects 0.000 description 4
- 229910001369 Brass Inorganic materials 0.000 description 3
- CWYNVVGOOAEACU-UHFFFAOYSA-N Fe2+ Chemical compound [Fe+2] CWYNVVGOOAEACU-UHFFFAOYSA-N 0.000 description 3
- 229910052782 aluminium Inorganic materials 0.000 description 3
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 3
- 239000010951 brass Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 230000033001 locomotion Effects 0.000 description 3
- 239000000696 magnetic material Substances 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 230000033458 reproduction Effects 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- RSWGJHLUYNHPMX-UHFFFAOYSA-N Abietic-Saeure Natural products C12CCC(C(C)C)=CC2=CCC2C1(C)CCCC2(C)C(O)=O RSWGJHLUYNHPMX-UHFFFAOYSA-N 0.000 description 2
- KHPCPRHQVVSZAH-HUOMCSJISA-N Rosin Natural products O(C/C=C/c1ccccc1)[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H](CO)O1 KHPCPRHQVVSZAH-HUOMCSJISA-N 0.000 description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- KHPCPRHQVVSZAH-UHFFFAOYSA-N trans-cinnamyl beta-D-glucopyranoside Natural products OC1C(O)C(O)C(CO)OC1OCC=CC1=CC=CC=C1 KHPCPRHQVVSZAH-UHFFFAOYSA-N 0.000 description 2
- KPAPHODVWOVUJL-UHFFFAOYSA-N 1-benzofuran;1h-indene Chemical compound C1=CC=C2CC=CC2=C1.C1=CC=C2OC=CC2=C1 KPAPHODVWOVUJL-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 229920004934 Dacron® Polymers 0.000 description 1
- 240000007597 Hymenaea verrucosa Species 0.000 description 1
- 239000004677 Nylon Substances 0.000 description 1
- 235000008331 Pinus X rigitaeda Nutrition 0.000 description 1
- 235000011613 Pinus brutia Nutrition 0.000 description 1
- 241000018646 Pinus brutia Species 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 230000005686 electrostatic field Effects 0.000 description 1
- 239000011491 glass wool Substances 0.000 description 1
- 210000004209 hair Anatomy 0.000 description 1
- SZVJSHCCFOBDDC-UHFFFAOYSA-N iron(II,III) oxide Inorganic materials O=[Fe]O[Fe]O[Fe]=O SZVJSHCCFOBDDC-UHFFFAOYSA-N 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- 238000012856 packing Methods 0.000 description 1
- 239000005020 polyethylene terephthalate Substances 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 238000005096 rolling process Methods 0.000 description 1
- 229920006298 saran Polymers 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229920002050 silicone resin Polymers 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 210000002268 wool Anatomy 0.000 description 1
- 239000011787 zinc oxide Substances 0.000 description 1
- 229910000859 α-Fe Inorganic materials 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G15/00—Apparatus for electrographic processes using a charge pattern
- G03G15/06—Apparatus for electrographic processes using a charge pattern for developing
- G03G15/08—Apparatus for electrographic processes using a charge pattern for developing using a solid developer, e.g. powder developer
- G03G15/09—Apparatus for electrographic processes using a charge pattern for developing using a solid developer, e.g. powder developer using magnetic brush
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Dry Development In Electrophotography (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US634873A US3003462A (en) | 1957-01-18 | 1957-01-18 | Apparatus for applying developer powder to photo-conductive insulating sheets |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1067305B true DE1067305B (enExample) | 1959-10-15 |
Family
ID=24545506
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DENDAT1067305D Pending DE1067305B (enExample) | 1957-01-18 |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3003462A (enExample) |
| BE (1) | BE564031A (enExample) |
| CH (1) | CH342587A (enExample) |
| DE (1) | DE1067305B (enExample) |
| FR (1) | FR1197882A (enExample) |
| GB (1) | GB828188A (enExample) |
Cited By (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1186746B (de) * | 1958-03-13 | 1965-02-04 | Rank Xerox Ltd | Einrichtung zur Entwicklung eines elektrostatischen Bildes |
| DE1196962B (de) * | 1962-11-05 | 1965-07-15 | Ece Elektrostatik | Magnetwalze zur Entwicklung von elektrostatischen Abbildungen |
| DE1202138B (de) * | 1961-03-01 | 1965-09-30 | Gen Aniline & Film Corp | Vorrichtung zum Auftragen von ferromagnetischem, einen Farbtoner enthaltendem Entwicklungspulver auf einen Schichttraeger zum Entwickeln eines elektrostatischen Ladungsbildes |
| DE1219797B (de) * | 1961-12-16 | 1966-06-23 | Kalle Ag | Elektrophotographischer Pulverentwickler |
| DE1289429B (de) * | 1962-01-25 | 1969-02-13 | Imagie Process Ltd | Vorrichtung zum Entwickeln von Bildern aus Pulver festhaltenden und Pulver nicht festhaltenden Bildteilen |
| DE1297989B (de) * | 1961-03-17 | 1969-06-19 | Rank Xerox Ltd | Vorrichtung zum Nachschub von Tonerpulver in das Entwicklerpulver eines elektrofotografischen Kopiergeraetes |
| DE2420948A1 (de) * | 1973-05-01 | 1974-11-07 | Ricoh Kk | Entwicklungseinrichtung fuer ein mit trockenentwickler arbeitendes kopiergeraet |
| EP0007047A1 (de) * | 1978-07-19 | 1980-01-23 | Siemens Aktiengesellschaft | Vorratsbehälter für pulverförmiges Material, z.B. Toner |
Families Citing this family (30)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3098765A (en) * | 1959-03-16 | 1963-07-23 | Robertson Photo Mechanix Inc | Xerographic brush |
| US3088386A (en) * | 1959-11-16 | 1963-05-07 | American Photocopy Equip Co | Electrophotographic photocopy machine |
| US3144354A (en) * | 1960-03-10 | 1964-08-11 | Keuffel & Esser Co | Electrographic printer |
| US3152012A (en) * | 1960-12-19 | 1964-10-06 | Ibm | Apparatus for the development of electrostatic images |
| US3152924A (en) * | 1961-05-24 | 1964-10-13 | Robertson Photo Mechanix Inc | Xerographic brush |
| US3133834A (en) * | 1961-06-22 | 1964-05-19 | Rca Corp | Electrostatic developing apparatus |
| GB977356A (en) * | 1961-07-27 | 1964-12-09 | Werner Zindler | Improvements in or relating to magnetic developer powder applicators |
| NL286833A (nl) * | 1961-12-27 | 1965-02-25 | Kalle Ag | Inrichting voor het ontwikkelen van elektrostatische beelden |
| US3358637A (en) * | 1962-04-24 | 1967-12-19 | Plastic Coating Corp | Toner unit for photoelectrostatic reproduction equipment |
| US3145122A (en) * | 1962-08-13 | 1964-08-18 | Addressograph Multigraph | Apparatus for applying developer powder to photo-conductive insulating material |
| US3167455A (en) * | 1963-01-31 | 1965-01-26 | Dick Co Ab | Developer for facsimile printing machine |
| US3246629A (en) * | 1963-06-18 | 1966-04-19 | Addressograph Multigraph | Apparatus for developing electrostatic images |
| US3369917A (en) * | 1963-09-10 | 1968-02-20 | Daniel B. Granzow | Magnetic brush development of electrostatic images utilizing a high voltage corona |
| US3639051A (en) * | 1964-06-30 | 1972-02-01 | Savin Business Machines Corp | Electrostatic copier |
| US3358594A (en) * | 1966-01-17 | 1967-12-19 | American Can Co | Electrostatic printing with a magnetic brush feed |
| US3557751A (en) * | 1967-05-20 | 1971-01-26 | Minolta Camera Kk | Device for dry development in electrophotography |
| US3399652A (en) * | 1967-06-14 | 1968-09-03 | Addressograph Multigraph | Automatic toner concentrate detector |
| US3566076A (en) * | 1969-07-03 | 1971-02-23 | Xerox Corp | Toner fixing apparatus |
| US3687106A (en) * | 1969-07-11 | 1972-08-29 | Xerox Corp | Donor apparatus and method |
| US3647499A (en) * | 1969-08-19 | 1972-03-07 | Eastman Kodak Co | Process for transferring dry developed electrographic images |
| US3633545A (en) * | 1969-11-03 | 1972-01-11 | Bell & Howell Co | Magnetic printout equipment |
| US3866575A (en) * | 1971-09-06 | 1975-02-18 | Canon Kk | Magnet roll developing device |
| US3700142A (en) * | 1971-09-20 | 1972-10-24 | Singer Co | Powder dispensing unit |
| US3949704A (en) * | 1972-05-22 | 1976-04-13 | Xerox Corporation | Magnetic brush developing apparatus |
| US3877417A (en) * | 1973-10-15 | 1975-04-15 | Xerox Corp | Transfer corona generating device with support brushes |
| GB1485148A (en) * | 1973-12-17 | 1977-09-08 | Oce Van Der Grinten Nv | Apparatus for the development of an electrostatic charge image on a support |
| GB2006054B (en) * | 1977-09-10 | 1982-12-08 | Canon Kk | Developing apparatus for electrostatic image |
| US4310611A (en) * | 1979-06-29 | 1982-01-12 | Eastman Kodak Company | Electrographic magnetic carrier particles |
| JPS59119371A (ja) * | 1982-12-27 | 1984-07-10 | Ricoh Co Ltd | 現像装置 |
| JP2531133B2 (ja) * | 1985-10-07 | 1996-09-04 | ミノルタ株式会社 | 現像装置 |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US668941A (en) * | 1900-04-21 | 1901-02-26 | Guy H Waring | Method of magnetically separating ores. |
| US1114071A (en) * | 1913-07-03 | 1914-10-20 | Krupp Ag Grusonwerk | Magnetic separator. |
| US2376922A (en) * | 1941-06-04 | 1945-05-29 | Behr Manning Corp | Method of and apparatus for making pile fabrics |
| US2625905A (en) * | 1950-04-13 | 1953-01-20 | Rosson Richards Proc Co Inc | Apparatus for applying coating material to pipe |
| US2686733A (en) * | 1951-07-17 | 1954-08-17 | Dunlop Tire & Rubber Corp | Production of pile fabrics |
| US2811465A (en) * | 1952-04-30 | 1957-10-29 | Rca Corp | Electrostatic printing |
| NL174651B (nl) * | 1952-07-26 | Rhone Poulenc Textile | Werkwijze voor het bereiden van antistatische samenstellingen op basis van polyesters. | |
| US2786440A (en) * | 1953-06-30 | 1957-03-26 | Rca Corp | Electrophotographic developing apparatus |
| US2854947A (en) * | 1953-07-01 | 1958-10-07 | Rca Corp | Electrostatic printing |
| US2786441A (en) * | 1953-07-20 | 1957-03-26 | Rca Corp | Apparatus for applying electrostatic developer powder by means of a magnetic brush |
| US2763204A (en) * | 1955-05-11 | 1956-09-18 | Sperry Rand Corp | Magnetic printer |
| US2791949A (en) * | 1956-02-01 | 1957-05-14 | Haloid Co | Xerographic copying device |
| US2822779A (en) * | 1956-09-24 | 1958-02-11 | Century Geophysical Corp | Developer for electrostatic photography |
-
0
- DE DENDAT1067305D patent/DE1067305B/de active Pending
- BE BE564031D patent/BE564031A/xx unknown
-
1957
- 1957-01-18 US US634873A patent/US3003462A/en not_active Expired - Lifetime
-
1958
- 1958-01-07 GB GB662/58A patent/GB828188A/en not_active Expired
- 1958-01-14 FR FR1197882D patent/FR1197882A/fr not_active Expired
- 1958-01-16 CH CH342587D patent/CH342587A/fr unknown
Cited By (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1186746B (de) * | 1958-03-13 | 1965-02-04 | Rank Xerox Ltd | Einrichtung zur Entwicklung eines elektrostatischen Bildes |
| DE1202138B (de) * | 1961-03-01 | 1965-09-30 | Gen Aniline & Film Corp | Vorrichtung zum Auftragen von ferromagnetischem, einen Farbtoner enthaltendem Entwicklungspulver auf einen Schichttraeger zum Entwickeln eines elektrostatischen Ladungsbildes |
| DE1297989B (de) * | 1961-03-17 | 1969-06-19 | Rank Xerox Ltd | Vorrichtung zum Nachschub von Tonerpulver in das Entwicklerpulver eines elektrofotografischen Kopiergeraetes |
| DE1219797B (de) * | 1961-12-16 | 1966-06-23 | Kalle Ag | Elektrophotographischer Pulverentwickler |
| DE1289429B (de) * | 1962-01-25 | 1969-02-13 | Imagie Process Ltd | Vorrichtung zum Entwickeln von Bildern aus Pulver festhaltenden und Pulver nicht festhaltenden Bildteilen |
| DE1196962B (de) * | 1962-11-05 | 1965-07-15 | Ece Elektrostatik | Magnetwalze zur Entwicklung von elektrostatischen Abbildungen |
| DE2420948A1 (de) * | 1973-05-01 | 1974-11-07 | Ricoh Kk | Entwicklungseinrichtung fuer ein mit trockenentwickler arbeitendes kopiergeraet |
| EP0007047A1 (de) * | 1978-07-19 | 1980-01-23 | Siemens Aktiengesellschaft | Vorratsbehälter für pulverförmiges Material, z.B. Toner |
Also Published As
| Publication number | Publication date |
|---|---|
| FR1197882A (fr) | 1959-12-03 |
| US3003462A (en) | 1961-10-10 |
| GB828188A (en) | 1960-02-17 |
| BE564031A (enExample) | |
| CH342587A (fr) | 1959-11-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1067305B (enExample) | ||
| DE2642681C2 (de) | Vorrichtung zur Entwicklermischung und Entwicklerzuführung an eine Magnetbürste eines elektrophotographischen Gerätes | |
| DE2161852C3 (de) | Vorrichtung zur Magnetbürstenentwicklung elektrostatischer latenter Bilder | |
| DE3305470C2 (de) | Entwicklungseinrichtung zum Entwickeln eines elektrostatischen latenten Bildes | |
| DE3413061C2 (enExample) | ||
| DE3612663C2 (enExample) | ||
| DE2839178A1 (de) | Entwicklungseinrichtung fuer ladungsbilder | |
| DE2257030A1 (de) | Magnetbuersten-entwicklungsstation | |
| DE3018906A1 (de) | Entwicklungsvorrichtung | |
| DE1202138B (de) | Vorrichtung zum Auftragen von ferromagnetischem, einen Farbtoner enthaltendem Entwicklungspulver auf einen Schichttraeger zum Entwickeln eines elektrostatischen Ladungsbildes | |
| DE3713256C2 (enExample) | ||
| DE1497076A1 (de) | Xerographische Entwicklungsvorrichtung | |
| DE2345827C2 (de) | Vorrichtung zur Entwicklung einer latenten elektrostatischen Abbildung mittels eines Entwicklerpulvers | |
| DE3415592C2 (enExample) | ||
| DE3210093A1 (de) | Entwicklungseinrichtung | |
| DE2803200C2 (de) | Vorrichtung zur Entwicklung eines elektrostatischen Ladungsbildes | |
| DE2043814A1 (enExample) | ||
| DE2633983A1 (de) | Magnetwalze | |
| DE2522052A1 (de) | Vorrichtung zum aufbringen von entwicklungsmaterial | |
| DE3330273C2 (de) | Elektrophotographische Entwicklungseinrichtung für Zweifarbenbilder | |
| DE2425060C3 (de) | Vorrichtung zur Steuerung der Tonerkonzentration eines pulverförmigen Entwicklers bei der elektrophotographischen Entwicklung | |
| DE2400926A1 (de) | Verfahren und vorrichtung zum entwickeln eines latenten elektrostatischen bildes mit hilfe eines magnetischen buerstensystems | |
| DE1900803A1 (de) | Verfahren und Vorrichtung zur Entwicklung eines latenten elektrostatischen Bildes | |
| DE2105760A1 (de) | Entwicklungsvorrichtung für elektro statische latente Bilder | |
| DE3208932C2 (de) | Entwicklungsvorrichtung |