DE1044154B - Farbfernsehsystem - Google Patents
FarbfernsehsystemInfo
- Publication number
- DE1044154B DE1044154B DEF23078A DEF0023078A DE1044154B DE 1044154 B DE1044154 B DE 1044154B DE F23078 A DEF23078 A DE F23078A DE F0023078 A DEF0023078 A DE F0023078A DE 1044154 B DE1044154 B DE 1044154B
- Authority
- DE
- Germany
- Prior art keywords
- color
- signal
- television system
- signals
- frequency
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000003086 colorant Substances 0.000 claims description 2
- 230000005540 biological transmission Effects 0.000 description 18
- 238000000034 method Methods 0.000 description 8
- 238000001228 spectrum Methods 0.000 description 5
- 238000010586 diagram Methods 0.000 description 4
- 230000003111 delayed effect Effects 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- PCTMTFRHKVHKIS-BMFZQQSSSA-N (1s,3r,4e,6e,8e,10e,12e,14e,16e,18s,19r,20r,21s,25r,27r,30r,31r,33s,35r,37s,38r)-3-[(2r,3s,4s,5s,6r)-4-amino-3,5-dihydroxy-6-methyloxan-2-yl]oxy-19,25,27,30,31,33,35,37-octahydroxy-18,20,21-trimethyl-23-oxo-22,39-dioxabicyclo[33.3.1]nonatriaconta-4,6,8,10 Chemical compound C1C=C2C[C@@H](OS(O)(=O)=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2.O[C@H]1[C@@H](N)[C@H](O)[C@@H](C)O[C@H]1O[C@H]1/C=C/C=C/C=C/C=C/C=C/C=C/C=C/[C@H](C)[C@@H](O)[C@@H](C)[C@H](C)OC(=O)C[C@H](O)C[C@H](O)CC[C@@H](O)[C@H](O)C[C@H](O)C[C@](O)(C[C@H](O)[C@H]2C(O)=O)O[C@H]2C1 PCTMTFRHKVHKIS-BMFZQQSSSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 230000000295 complement effect Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 230000010363 phase shift Effects 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 230000002787 reinforcement Effects 0.000 description 1
- 238000005070 sampling Methods 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 230000005236 sound signal Effects 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H04—ELECTRIC COMMUNICATION TECHNIQUE
- H04N—PICTORIAL COMMUNICATION, e.g. TELEVISION
- H04N11/00—Colour television systems
- H04N11/06—Transmission systems characterised by the manner in which the individual colour picture signal components are combined
- H04N11/18—Transmission systems characterised by the manner in which the individual colour picture signal components are combined using simultaneous and sequential signals, e.g. SECAM-system
Landscapes
- Engineering & Computer Science (AREA)
- Multimedia (AREA)
- Signal Processing (AREA)
- Color Television Systems (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR1044154X | 1956-05-25 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1044154B true DE1044154B (de) | 1958-11-20 |
Family
ID=9590969
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEF23078A Pending DE1044154B (de) | 1956-05-25 | 1957-05-23 | Farbfernsehsystem |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US2993086A (enExample) |
| BE (1) | BE557654A (enExample) |
| CH (1) | CH350987A (enExample) |
| DE (1) | DE1044154B (enExample) |
| FR (1) | FR1150989A (enExample) |
| GB (1) | GB821246A (enExample) |
Cited By (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1145222B (de) * | 1961-10-17 | 1963-03-14 | Telefunken Patent | Farbfernsehempfaenger |
| DE1148256B (de) | 1961-12-22 | 1963-05-09 | Telefunken Patent | Farbfernsehsystem |
| DE1161305B (de) * | 1960-12-10 | 1964-01-16 | Fernseh Gmbh | Farbfernseh-UEbertragungsverfahren |
| DE1164466B (de) * | 1962-09-29 | 1964-03-05 | Telefunken Patent | Farbfernsehuebertragungssystem |
| DE1173934B (de) * | 1962-03-02 | 1964-07-16 | Cft Comp Fse Television | Farbfernsehempfaenger |
| DE1230454B (de) * | 1963-01-31 | 1966-12-15 | Emi Ltd | Farbfernsehkamera |
| DE1537260A1 (de) * | 1966-07-19 | 1969-08-28 | Toshihiko Numakura | System zum Aufzeichnen von Farbfernsehsignalen |
| DE1412489B1 (de) * | 1960-03-07 | 1970-07-02 | Sony Corp | Magnetisches Aufzeichnungs- und Wiedergabesystem fuer Farbsignale |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE630668A (enExample) * | 1962-04-05 | |||
| US3294898A (en) * | 1963-08-21 | 1966-12-27 | Polaroid Corp | Compatible color television |
| GB1086352A (en) * | 1964-04-27 | 1967-10-11 | Communications Patents Ltd | Improved colour television systems and apparatus |
| US3492415A (en) * | 1965-07-02 | 1970-01-27 | Sony Corp | Line sequential color television synchronization system |
| GB1161021A (en) * | 1965-08-26 | 1969-08-13 | Gen Corp Formerly Yaou Electri | Colour Television Receiver |
| NZ146705A (enExample) * | 1965-10-20 | |||
| FR1474859A (fr) * | 1966-01-21 | 1967-03-31 | Cft Comp Fse Television | Perfectionnement aux circuits de démodulation d'une sous-porteuse de télévision en couleurs et aux émetteurs transmettant ladite sous-porteuse |
| NZ150889A (enExample) * | 1966-12-03 | |||
| US3617620A (en) * | 1967-05-08 | 1971-11-02 | Matsushita Electric Industrial Co Ltd | Method and apparatus for transmitting or recording and reproducing line-sequential color television signals |
| DE2113937A1 (de) * | 1971-03-23 | 1972-09-28 | Standard Elek K Lorenz Ag | SECAM-Dekoder |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR812987A (fr) * | 1936-01-30 | 1937-05-21 | Perfectionnements aux postes récepteurs de télévision | |
| US2657255A (en) * | 1950-05-20 | 1953-10-27 | Bell Telephone Labor Inc | Color television system |
| US2810779A (en) * | 1951-02-01 | 1957-10-22 | Rca Corp | Color television systems |
| BE509966A (enExample) * | 1951-03-17 | |||
| BE517543A (enExample) * | 1952-02-12 | |||
| US2729697A (en) * | 1952-02-28 | 1956-01-03 | Philco Corp | Color television system |
| US2811578A (en) * | 1954-04-05 | 1957-10-29 | Bell Telephone Labor Inc | Television band width reducing system |
-
0
- BE BE557654D patent/BE557654A/xx unknown
-
1956
- 1956-05-25 FR FR1150989D patent/FR1150989A/fr not_active Expired
-
1957
- 1957-05-20 CH CH350987D patent/CH350987A/fr unknown
- 1957-05-20 GB GB15976/57A patent/GB821246A/en not_active Expired
- 1957-05-22 US US660957A patent/US2993086A/en not_active Expired - Lifetime
- 1957-05-23 DE DEF23078A patent/DE1044154B/de active Pending
Non-Patent Citations (1)
| Title |
|---|
| None * |
Cited By (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1412489B1 (de) * | 1960-03-07 | 1970-07-02 | Sony Corp | Magnetisches Aufzeichnungs- und Wiedergabesystem fuer Farbsignale |
| DE1161305B (de) * | 1960-12-10 | 1964-01-16 | Fernseh Gmbh | Farbfernseh-UEbertragungsverfahren |
| DE1145222B (de) * | 1961-10-17 | 1963-03-14 | Telefunken Patent | Farbfernsehempfaenger |
| DE1148256B (de) | 1961-12-22 | 1963-05-09 | Telefunken Patent | Farbfernsehsystem |
| DE1173934B (de) * | 1962-03-02 | 1964-07-16 | Cft Comp Fse Television | Farbfernsehempfaenger |
| DE1164466B (de) * | 1962-09-29 | 1964-03-05 | Telefunken Patent | Farbfernsehuebertragungssystem |
| DE1230454B (de) * | 1963-01-31 | 1966-12-15 | Emi Ltd | Farbfernsehkamera |
| DE1537260A1 (de) * | 1966-07-19 | 1969-08-28 | Toshihiko Numakura | System zum Aufzeichnen von Farbfernsehsignalen |
Also Published As
| Publication number | Publication date |
|---|---|
| US2993086A (en) | 1961-07-18 |
| CH350987A (fr) | 1960-12-31 |
| BE557654A (enExample) | |
| GB821246A (en) | 1959-10-07 |
| FR1150989A (fr) | 1958-01-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69126139T2 (de) | System zur verminderung gegenseitiger interferenzen bei benutzung gleicher kanäle für einen digitalen hochauflösenden fernsehempfänger | |
| DE1044154B (de) | Farbfernsehsystem | |
| DE3590163C2 (enExample) | ||
| DE3888169T2 (de) | Datenübertragung in aktiver bildperiode. | |
| DE1808439A1 (de) | Einrichtung zum Aufzeichnen und Wiedergeben von Farbbildsignalen | |
| DE3341393A1 (de) | Verfahren zum uebertragen eines fernsehsignals hoeherer aufloesung | |
| DE2340907C3 (de) | Kompatibles stereoskopisches farbfernsehuebertragungssystem | |
| EP0246698B1 (de) | Schaltungsanordnung für einen Fernsehempfänger mit einem Videotextdekoder | |
| DE921950C (de) | Fernsehsystem zur Zerlegung, UEbertragung oder Wiedergabe farbiger Bilder | |
| DE2538545A1 (de) | Schaltungsanordnung zur automatischen regelung der bandbreite des leuchtdichtekanals in abhaengigkeit von der amplitude der farbbildinformation | |
| DE936340C (de) | Mehrfach-UEbertragungssystem zum UEbertragen von drei Signalen, die sich je auf ein Fernsehbild beziehen | |
| DE2446969B2 (de) | Aperturkorrekturschaltung fur Fernsehen | |
| DE2221888A1 (de) | Farbfernsehempfaenger fuer Pal- und Secam-Norm | |
| DE3919253C1 (en) | Transmitting compatible high definition colour TV images - subjecting colour composite video signal with high lying colour carrier to line alternation in two signal paths with delay | |
| DE1196696B (de) | Farbfernsehverfahren sowie Farbfernsehsender und Farbfernsehempfaenger zur Anwendungbei diesem Verfahren | |
| DE2812549C2 (de) | Fernsehempfänger mit einer Einrichtung zur gleichzeitigen Wiedergabe mehrerer Programme | |
| DE1299018B (de) | Land'sches Rot-Weiss-Farbfernsehsystem | |
| DE3941912C1 (en) | Transmission method for high definition TV images - mixing frequency components of video signal lying above limit frequency of station bandwidth to lower lying frequency | |
| DE4039514A1 (de) | Anordnungen zur codierung und decodierung zusaetzlicher information in einem fernsehsystem | |
| DE946998C (de) | Farbfernsehversorgungssystem und Empfaenger dafuer | |
| DE3331076C2 (de) | Tondemodulator für einen Fernsehempfänger | |
| DE1462484C3 (de) | Mit Speicherung arbeitendes sequentiellsimultanes Farbfernseh-Ubertragungssystem | |
| DE928475C (de) | Farbfernseh-UEberlagerungsempfaenger | |
| DE2202911C3 (de) | Steuerschaltung für einen PAL-Farbfernsehdecoder | |
| AT236472B (de) | Übertragungssystem für Farbfernsehen sowie Sender und Empfänger zur Verwendung bei diesem System |