DD259190A5 - Verfahren zur herstellung von substituierten bruecken-diazabic ycloalkyl-chinolon-carbonsaeuren - Google Patents
Verfahren zur herstellung von substituierten bruecken-diazabic ycloalkyl-chinolon-carbonsaeuren Download PDFInfo
- Publication number
- DD259190A5 DD259190A5 DD86294486A DD29448686A DD259190A5 DD 259190 A5 DD259190 A5 DD 259190A5 DD 86294486 A DD86294486 A DD 86294486A DD 29448686 A DD29448686 A DD 29448686A DD 259190 A5 DD259190 A5 DD 259190A5
- Authority
- DD
- German Democratic Republic
- Prior art keywords
- diazabicyclo
- methyl
- oxo
- dihydro
- compound
- Prior art date
Links
- 229910052799 carbon Inorganic materials 0.000 title claims abstract description 24
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 title claims abstract description 19
- 238000000034 method Methods 0.000 title claims description 20
- 238000004519 manufacturing process Methods 0.000 title description 2
- 239000007991 ACES buffer Substances 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 135
- -1 methoxy, N-methylamino, p-fluorophenyl Chemical group 0.000 claims abstract description 76
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 37
- 239000001257 hydrogen Substances 0.000 claims abstract description 31
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims abstract description 26
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 16
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims abstract description 14
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims abstract description 11
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims abstract description 9
- 229920002554 vinyl polymer Chemical group 0.000 claims abstract description 9
- 150000001768 cations Chemical class 0.000 claims abstract description 7
- UKJLNMAFNRKWGR-UHFFFAOYSA-N cyclohexatrienamine Chemical group NC1=CC=C=C[CH]1 UKJLNMAFNRKWGR-UHFFFAOYSA-N 0.000 claims abstract description 7
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 6
- 125000001188 haloalkyl group Chemical group 0.000 claims abstract 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 22
- 239000002253 acid Substances 0.000 claims description 14
- 150000003839 salts Chemical class 0.000 claims description 11
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 6
- 239000001301 oxygen Substances 0.000 claims description 6
- 229910052760 oxygen Inorganic materials 0.000 claims description 6
- 125000001424 substituent group Chemical group 0.000 claims description 6
- 125000004454 (C1-C6) alkoxycarbonyl group Chemical group 0.000 claims description 3
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 3
- 241000251730 Chondrichthyes Species 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 claims 3
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims 1
- 125000005115 alkyl carbamoyl group Chemical group 0.000 claims 1
- 150000003254 radicals Chemical class 0.000 claims 1
- 230000000844 anti-bacterial effect Effects 0.000 abstract description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 60
- 238000006243 chemical reaction Methods 0.000 description 40
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 35
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 30
- 239000007787 solid Substances 0.000 description 22
- 239000000203 mixture Substances 0.000 description 21
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 20
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 18
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 15
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 14
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 13
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 13
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 12
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 239000010410 layer Substances 0.000 description 10
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 10
- XJKNACDCUAFDHD-UHFFFAOYSA-N 1,4-diazabicyclo[3.2.2]nonane Chemical compound C1CC2CCN1CCN2 XJKNACDCUAFDHD-UHFFFAOYSA-N 0.000 description 9
- GQHTUMJGOHRCHB-UHFFFAOYSA-N 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine Chemical compound C1CCCCN2CCCN=C21 GQHTUMJGOHRCHB-UHFFFAOYSA-N 0.000 description 9
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 8
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 8
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 8
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 8
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 8
- 238000007792 addition Methods 0.000 description 8
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 8
- 150000003951 lactams Chemical class 0.000 description 8
- 239000000725 suspension Substances 0.000 description 8
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 7
- 238000010992 reflux Methods 0.000 description 7
- 239000011734 sodium Substances 0.000 description 7
- 125000004777 2-fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 description 6
- XNZIHVKLRKGFBS-UHFFFAOYSA-N 8-methyl-3,8-diazabicyclo[3.2.1]octane;dihydrochloride Chemical compound Cl.Cl.C1NCC2CCC1N2C XNZIHVKLRKGFBS-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 6
- 239000007864 aqueous solution Substances 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- 229910052938 sodium sulfate Inorganic materials 0.000 description 6
- 235000011152 sodium sulphate Nutrition 0.000 description 6
- FTTATHOUSOIFOQ-UHFFFAOYSA-N 1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine Chemical compound C1NCCN2CCCC21 FTTATHOUSOIFOQ-UHFFFAOYSA-N 0.000 description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 5
- 229910010082 LiAlH Inorganic materials 0.000 description 5
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 5
- 239000002026 chloroform extract Substances 0.000 description 5
- 238000006264 debenzylation reaction Methods 0.000 description 5
- 239000012280 lithium aluminium hydride Substances 0.000 description 5
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 5
- 150000002923 oximes Chemical class 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 238000006722 reduction reaction Methods 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 4
- NRCDIJJTFDJACX-UHFFFAOYSA-N 9-methyl-4,9-diazabicyclo[4.2.1]nonane Chemical compound C1CNCC2CCC1N2C NRCDIJJTFDJACX-UHFFFAOYSA-N 0.000 description 4
- 241001465754 Metazoa Species 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 239000003085 diluting agent Substances 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 4
- 235000019341 magnesium sulphate Nutrition 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 description 4
- BKIMMITUMNQMOS-UHFFFAOYSA-N nonane Chemical compound CCCCCCCCC BKIMMITUMNQMOS-UHFFFAOYSA-N 0.000 description 4
- 239000008194 pharmaceutical composition Substances 0.000 description 4
- 230000002829 reductive effect Effects 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- QQXLDOJGLXJCSE-KNVOCYPGSA-N tropinone Chemical compound C1C(=O)C[C@H]2CC[C@@H]1N2C QQXLDOJGLXJCSE-KNVOCYPGSA-N 0.000 description 4
- HEYIOFYFCUOKDL-UHFFFAOYSA-N 1-ethenyl-6,7-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C(F)C=C2C(=O)C(C(=O)O)=CN(C=C)C2=C1 HEYIOFYFCUOKDL-UHFFFAOYSA-N 0.000 description 3
- 208000035143 Bacterial infection Diseases 0.000 description 3
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 3
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 150000001721 carbon Chemical group 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 125000002091 cationic group Chemical group 0.000 description 3
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 3
- 150000002576 ketones Chemical class 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 229910000104 sodium hydride Inorganic materials 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- PIDOCGDMKRSJMT-RSLHMRQOSA-N (1s,4s)-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride Chemical compound Cl.Cl.C1N[C@@H]2CN[C@H]1C2 PIDOCGDMKRSJMT-RSLHMRQOSA-N 0.000 description 2
- QFLWZFQWSBQYPS-AWRAUJHKSA-N (3S)-3-[[(2S)-2-[[(2S)-2-[5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-[1-bis(4-chlorophenoxy)phosphorylbutylamino]-4-oxobutanoic acid Chemical compound CCCC(NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](NC(=O)CCCCC1SC[C@@H]2NC(=O)N[C@H]12)C(C)C)P(=O)(Oc1ccc(Cl)cc1)Oc1ccc(Cl)cc1 QFLWZFQWSBQYPS-AWRAUJHKSA-N 0.000 description 2
- CHAMGYZQVLLZHI-UHFFFAOYSA-N 1-cyclopropyl-7-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-6-fluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C12=CC(N3C4CCN(CC4)CC3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 CHAMGYZQVLLZHI-UHFFFAOYSA-N 0.000 description 2
- MZXJFGRQQQDFKM-UHFFFAOYSA-N 1-ethenyl-6-fluoro-7-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)-4-oxoquinoline-3-carboxylic acid Chemical compound C=CN1C=C(C(O)=O)C(=O)C(C=C2F)=C1C=C2N(C1)CC2CCC1N2C MZXJFGRQQQDFKM-UHFFFAOYSA-N 0.000 description 2
- MHFJYVWFBPABTI-UHFFFAOYSA-N 1-ethyl-6,7-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C(F)C=C2N(CC)C=C(C(O)=O)C(=O)C2=C1 MHFJYVWFBPABTI-UHFFFAOYSA-N 0.000 description 2
- RTBFRGCFXZNCOE-UHFFFAOYSA-N 1-methylsulfonylpiperidin-4-one Chemical compound CS(=O)(=O)N1CCC(=O)CC1 RTBFRGCFXZNCOE-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- BSANRFVFCNMTII-UHFFFAOYSA-N 7-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-1-ethenyl-6-fluoro-4-oxoquinoline-3-carboxylic acid Chemical compound FC=1C=C2C(=O)C(C(=O)O)=CN(C=C)C2=CC=1N1CCN2CCC1CC2 BSANRFVFCNMTII-UHFFFAOYSA-N 0.000 description 2
- OXURVGFLFRPDCF-UHFFFAOYSA-N 7-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1N1CCN2CCC1CC2 OXURVGFLFRPDCF-UHFFFAOYSA-N 0.000 description 2
- PJYFVHIXGYHIGD-UHFFFAOYSA-N 7-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-6,8-difluoro-1-(2-fluoroethyl)-4-oxoquinoline-3-carboxylic acid Chemical compound FC=1C=C2C(=O)C(C(=O)O)=CN(CCF)C2=C(F)C=1N1CCN2CCC1CC2 PJYFVHIXGYHIGD-UHFFFAOYSA-N 0.000 description 2
- QPRZPTIWPFZPEH-UHFFFAOYSA-N 7-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-6-fluoro-1-(4-fluorophenyl)-4-oxoquinoline-3-carboxylic acid Chemical compound C12=CC(N3C4CCN(CC4)CC3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1=CC=C(F)C=C1 QPRZPTIWPFZPEH-UHFFFAOYSA-N 0.000 description 2
- FKTYNDUTDZWGMO-UHFFFAOYSA-N 7-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-6-fluoro-1-(methylamino)-4-oxoquinoline-3-carboxylic acid Chemical compound C1=C2N(NC)C=C(C(O)=O)C(=O)C2=CC(F)=C1N1CCN2CCC1CC2 FKTYNDUTDZWGMO-UHFFFAOYSA-N 0.000 description 2
- NVKWWNNJFKZNJO-UHFFFAOYSA-N 82419-35-0 Chemical compound O1CC(C)N2C=C(C(O)=O)C(=O)C3=C2C1=C(F)C(F)=C3 NVKWWNNJFKZNJO-UHFFFAOYSA-N 0.000 description 2
- WJNTXJZFBOWQPF-UHFFFAOYSA-N 9-benzyl-4,9-diazabicyclo[4.2.1]nonane Chemical compound C1NCCC2CCC1N2CC1=CC=CC=C1 WJNTXJZFBOWQPF-UHFFFAOYSA-N 0.000 description 2
- ZPLMTUXXQQUKDH-UHFFFAOYSA-N 9-methyl-4,9-diazabicyclo[4.2.1]nonan-3-one Chemical compound C1NC(=O)CC2CCC1N2C ZPLMTUXXQQUKDH-UHFFFAOYSA-N 0.000 description 2
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- QQXLDOJGLXJCSE-UHFFFAOYSA-N N-methylnortropinone Natural products C1C(=O)CC2CCC1N2C QQXLDOJGLXJCSE-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- JFCQEDHGNNZCLN-UHFFFAOYSA-N anhydrous glutaric acid Natural products OC(=O)CCCC(O)=O JFCQEDHGNNZCLN-UHFFFAOYSA-N 0.000 description 2
- 239000011260 aqueous acid Substances 0.000 description 2
- 230000001580 bacterial effect Effects 0.000 description 2
- 208000022362 bacterial infectious disease Diseases 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- MYSWGUAQZAJSOK-UHFFFAOYSA-N ciprofloxacin Chemical compound C12=CC(N3CCNCC3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 MYSWGUAQZAJSOK-UHFFFAOYSA-N 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 239000003937 drug carrier Substances 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 238000007918 intramuscular administration Methods 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- WLJVNTCWHIRURA-UHFFFAOYSA-N pimelic acid Chemical compound OC(=O)CCCCCC(O)=O WLJVNTCWHIRURA-UHFFFAOYSA-N 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 2
- 238000010791 quenching Methods 0.000 description 2
- 230000000171 quenching effect Effects 0.000 description 2
- LISFMEBWQUVKPJ-UHFFFAOYSA-N quinolin-2-ol Chemical group C1=CC=C2NC(=O)C=CC2=C1 LISFMEBWQUVKPJ-UHFFFAOYSA-N 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 238000006268 reductive amination reaction Methods 0.000 description 2
- 238000006798 ring closing metathesis reaction Methods 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 150000003335 secondary amines Chemical class 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000012279 sodium borohydride Substances 0.000 description 2
- 229910000033 sodium borohydride Inorganic materials 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 238000000967 suction filtration Methods 0.000 description 2
- 239000006228 supernatant Substances 0.000 description 2
- JABYJIQOLGWMQW-UHFFFAOYSA-N undec-4-ene Chemical compound CCCCCCC=CCCC JABYJIQOLGWMQW-UHFFFAOYSA-N 0.000 description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 1
- 125000004916 (C1-C6) alkylcarbonyl group Chemical group 0.000 description 1
- CNBHGTBRNNCVMY-UHFFFAOYSA-N 1,2-diazabicyclo[3.2.2]nonane Chemical compound C1CC2CCN1NCC2 CNBHGTBRNNCVMY-UHFFFAOYSA-N 0.000 description 1
- WIRZUAGNPHTFBA-UHFFFAOYSA-N 1,3-diazabicyclo[2.1.1]hexane Chemical compound C1N2CC1NC2 WIRZUAGNPHTFBA-UHFFFAOYSA-N 0.000 description 1
- KQDQZEZWWRPNQH-UHFFFAOYSA-N 1,3-diazabicyclo[2.2.2]octane Chemical compound C1CC2CCN1CN2 KQDQZEZWWRPNQH-UHFFFAOYSA-N 0.000 description 1
- DWGZFVFPZSVCJJ-UHFFFAOYSA-N 1,3-diazabicyclo[3.2.1]octane Chemical compound C1C2CCN1CNC2 DWGZFVFPZSVCJJ-UHFFFAOYSA-N 0.000 description 1
- MDXBRYNJEKPLOC-UHFFFAOYSA-N 1,3-dibenzylpyrrolidin-3-amine Chemical compound C1CN(CC=2C=CC=CC=2)CC1(N)CC1=CC=CC=C1 MDXBRYNJEKPLOC-UHFFFAOYSA-N 0.000 description 1
- KYCAEEFYFFBAAP-UHFFFAOYSA-N 1,4-diazabicyclo[3.2.1]octane Chemical compound C1C2CCN1CCN2 KYCAEEFYFFBAAP-UHFFFAOYSA-N 0.000 description 1
- NYPUYWSDUIENGC-UHFFFAOYSA-N 1,4-diazabicyclo[3.3.1]nonane Chemical compound C1N2CCCC1NCC2 NYPUYWSDUIENGC-UHFFFAOYSA-N 0.000 description 1
- DTYLXDLAOLOTKT-UHFFFAOYSA-N 1,4-dihydroquinoline-3-carboxylic acid Chemical compound C1=CC=C2CC(C(=O)O)=CNC2=C1 DTYLXDLAOLOTKT-UHFFFAOYSA-N 0.000 description 1
- BGROAZHAWDEUDB-UHFFFAOYSA-N 1,5-diazabicyclo[4.2.2]decane Chemical compound C1CC2CCN1CCCN2 BGROAZHAWDEUDB-UHFFFAOYSA-N 0.000 description 1
- ONBQEOIKXPHGMB-VBSBHUPXSA-N 1-[2-[(2s,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-4,6-dihydroxyphenyl]-3-(4-hydroxyphenyl)propan-1-one Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1OC1=CC(O)=CC(O)=C1C(=O)CCC1=CC=C(O)C=C1 ONBQEOIKXPHGMB-VBSBHUPXSA-N 0.000 description 1
- MLEGMEBCXGDFQT-UHFFFAOYSA-N 1-benzylpiperidin-2-one Chemical compound O=C1CCCCN1CC1=CC=CC=C1 MLEGMEBCXGDFQT-UHFFFAOYSA-N 0.000 description 1
- YUBDLZGUSSWQSS-UHFFFAOYSA-N 1-benzylpiperidin-4-amine Chemical compound C1CC(N)CCN1CC1=CC=CC=C1 YUBDLZGUSSWQSS-UHFFFAOYSA-N 0.000 description 1
- LVUQCTGSDJLWCE-UHFFFAOYSA-N 1-benzylpyrrolidin-2-one Chemical compound O=C1CCCN1CC1=CC=CC=C1 LVUQCTGSDJLWCE-UHFFFAOYSA-N 0.000 description 1
- WBAZKXNBWFVTFI-UHFFFAOYSA-N 1-cyclopropyl-6-fluoro-7-(5-methyl-2-aza-5-azoniabicyclo[2.2.2]octan-2-yl)-4-oxoquinoline-3-carboxylate Chemical compound CN1CC2CCC1CN2C(C(=CC=1C(=O)C(C(O)=O)=C2)F)=CC=1N2C1CC1 WBAZKXNBWFVTFI-UHFFFAOYSA-N 0.000 description 1
- ALRZZABRVIYCNY-BETUJISGSA-N 1-cyclopropyl-6-fluoro-7-[(1s,5r)-8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl]-4-oxoquinoline-3-carboxylic acid Chemical compound C([C@H]1CC[C@@H](C2)N1C)N2C(C(=CC=1C(=O)C(C(O)=O)=C2)F)=CC=1N2C1CC1 ALRZZABRVIYCNY-BETUJISGSA-N 0.000 description 1
- VEPKTCTVHRIOEI-UHFFFAOYSA-N 1-cyclopropyl-7-(3,8-diazabicyclo[3.2.1]octan-3-yl)-6-fluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C12=CC(N3CC4CCC(N4)C3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 VEPKTCTVHRIOEI-UHFFFAOYSA-N 0.000 description 1
- GUFZCQOYIKWMOS-UHFFFAOYSA-N 1-ethenyl-6-fluoro-7-(9-methyl-4,9-diazabicyclo[4.2.1]nonan-4-yl)-4-oxoquinoline-3-carboxylic acid Chemical compound C1CC(C2)N(C)C1CCN2C(C(=C1)F)=CC2=C1C(=O)C(C(O)=O)=CN2C=C GUFZCQOYIKWMOS-UHFFFAOYSA-N 0.000 description 1
- FKKUVCHFRDLBHN-UHFFFAOYSA-N 1-ethyl-6,7,8-trifluoro-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C(F)C(F)=C2N(CC)C=C(C(O)=O)C(=O)C2=C1 FKKUVCHFRDLBHN-UHFFFAOYSA-N 0.000 description 1
- PZLPUVYSLZYCNH-UHFFFAOYSA-N 1-ethyl-6,8-difluoro-7-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)-4-oxoquinoline-3-carboxylic acid Chemical compound C1C(N2C)CCC2CN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(CC)C2=C1F PZLPUVYSLZYCNH-UHFFFAOYSA-N 0.000 description 1
- ZKCIAQPGRBXAHO-UHFFFAOYSA-N 1-ethyl-6-fluoro-7-(4-methyl-4,9-diazabicyclo[4.2.1]nonan-9-yl)-4-oxoquinoline-3-carboxylic acid Chemical compound C1CN(C)CC2CCC1N2C1=C(F)C=C2C(=O)C(C(O)=O)=CN(CC)C2=C1 ZKCIAQPGRBXAHO-UHFFFAOYSA-N 0.000 description 1
- FJXONQMAEPFNDI-UHFFFAOYSA-N 1-ethyl-6-fluoro-7-(5-methyl-2,5-diazabicyclo[2.2.2]octan-2-yl)-4-oxoquinoline-3-carboxylic acid Chemical compound C1C(N(C2)C)CCC2N1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(CC)C2=C1 FJXONQMAEPFNDI-UHFFFAOYSA-N 0.000 description 1
- VCOUHOQKYYYKQQ-UHFFFAOYSA-N 1-ethyl-6-fluoro-7-(9-methyl-3,9-diazabicyclo[3.3.1]nonan-3-yl)-4-oxoquinoline-3-carboxylic acid Chemical compound C1C(N2C)CCCC2CN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(CC)C2=C1 VCOUHOQKYYYKQQ-UHFFFAOYSA-N 0.000 description 1
- HQUQHIFQRKPXQT-UHFFFAOYSA-N 1-ethyl-6-fluoro-7-(9-methyl-4,9-diazabicyclo[4.2.1]nonan-4-yl)-4-oxoquinoline-3-carboxylic acid Chemical compound C1CC(N2C)CCC2CN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(CC)C2=C1 HQUQHIFQRKPXQT-UHFFFAOYSA-N 0.000 description 1
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- DJWDAKFSDBOQJK-UHFFFAOYSA-N 2,5-diazabicyclo[2.2.2]octane Chemical compound C1NC2CCC1NC2 DJWDAKFSDBOQJK-UHFFFAOYSA-N 0.000 description 1
- YSUIQYOGTINQIN-UZFYAQMZSA-N 2-amino-9-[(1S,6R,8R,9S,10R,15R,17R,18R)-8-(6-aminopurin-9-yl)-9,18-difluoro-3,12-dihydroxy-3,12-bis(sulfanylidene)-2,4,7,11,13,16-hexaoxa-3lambda5,12lambda5-diphosphatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one Chemical compound NC1=NC2=C(N=CN2[C@@H]2O[C@@H]3COP(S)(=O)O[C@@H]4[C@@H](COP(S)(=O)O[C@@H]2[C@@H]3F)O[C@H]([C@H]4F)N2C=NC3=C2N=CN=C3N)C(=O)N1 YSUIQYOGTINQIN-UZFYAQMZSA-N 0.000 description 1
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 1
- ZMDQWHCTODNNLT-UHFFFAOYSA-N 2h-1,2-benzoxazine-3-carboxylic acid Chemical class C1=CC=C2ONC(C(=O)O)=CC2=C1 ZMDQWHCTODNNLT-UHFFFAOYSA-N 0.000 description 1
- QBWKPGNFQQJGFY-QLFBSQMISA-N 3-[(1r)-1-[(2r,6s)-2,6-dimethylmorpholin-4-yl]ethyl]-n-[6-methyl-3-(1h-pyrazol-4-yl)imidazo[1,2-a]pyrazin-8-yl]-1,2-thiazol-5-amine Chemical compound N1([C@H](C)C2=NSC(NC=3C4=NC=C(N4C=C(C)N=3)C3=CNN=C3)=C2)C[C@H](C)O[C@H](C)C1 QBWKPGNFQQJGFY-QLFBSQMISA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- WGKZCFPJVPNRAV-UHFFFAOYSA-N 3-bromopropanal Chemical compound BrCCC=O WGKZCFPJVPNRAV-UHFFFAOYSA-N 0.000 description 1
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 1
- ZZHWFUDVZGOQSF-UHFFFAOYSA-N 4,9-diazabicyclo[4.2.1]nonane Chemical compound C1NCCC2CCC1N2 ZZHWFUDVZGOQSF-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- QDPQNPPBPWQCNR-UHFFFAOYSA-N 4-methyl-4,7-diazabicyclo[4.1.1]octane Chemical compound C1N(C)CCC2NC1C2 QDPQNPPBPWQCNR-UHFFFAOYSA-N 0.000 description 1
- NLRPLOMLCUJBET-UHFFFAOYSA-N 4-methyl-4,9-diazabicyclo[4.2.1]nonane Chemical compound C1N(C)CCC2CCC1N2 NLRPLOMLCUJBET-UHFFFAOYSA-N 0.000 description 1
- DUGFZRFLUQJFOO-UHFFFAOYSA-N 4-oxa-1-azatricyclo[7.3.1.05,13]trideca-2,5,7,9(13),11-pentaene-11-carboxylic acid Chemical compound C1=COC2=CC=CC3=C2N1C=C(C(=O)O)C3 DUGFZRFLUQJFOO-UHFFFAOYSA-N 0.000 description 1
- ZBGVFPLTIBCTRU-UHFFFAOYSA-N 6,7-difluoro-1-(2-fluoroethyl)-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C(F)C=C2C(=O)C(C(=O)O)=CN(CCF)C2=C1 ZBGVFPLTIBCTRU-UHFFFAOYSA-N 0.000 description 1
- UZNHZZMWSTZJCW-UHFFFAOYSA-N 6,7-difluoro-1-(methylamino)-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C(F)C=C2N(NC)C=C(C(O)=O)C(=O)C2=C1 UZNHZZMWSTZJCW-UHFFFAOYSA-N 0.000 description 1
- DHJRWNMTTJCQGO-UHFFFAOYSA-N 6,7-difluoro-1-methyl-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C(F)C=C2N(C)C=C(C(O)=O)C(=O)C2=C1 DHJRWNMTTJCQGO-UHFFFAOYSA-N 0.000 description 1
- BYPCCKPNSAXAPB-UHFFFAOYSA-N 6,8-difluoro-1-(1-fluoroethyl)-7-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)-4-oxoquinoline-3-carboxylic acid Chemical compound C1C(N2C)CCC2CN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(C(F)C)C2=C1F BYPCCKPNSAXAPB-UHFFFAOYSA-N 0.000 description 1
- QAYQPOYGMDLNJS-UHFFFAOYSA-N 6-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-7-fluoro-2-methyl-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid Chemical compound FC1=CC(C(C(C(O)=O)=C2)=O)=C3N2C(C)COC3=C1N1CCN2CCC1CC2 QAYQPOYGMDLNJS-UHFFFAOYSA-N 0.000 description 1
- IVSHGBHPPSHNCA-UHFFFAOYSA-N 6-fluoro-1-(2-fluoroethyl)-7-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)-4-oxoquinoline-3-carboxylic acid Chemical compound FCCN1C=C(C(O)=O)C(=O)C(C=C2F)=C1C=C2N(C1)CC2CCC1N2C IVSHGBHPPSHNCA-UHFFFAOYSA-N 0.000 description 1
- OJLOSIZWHIEZGO-UHFFFAOYSA-N 6-fluoro-1-(4-fluorophenyl)-7-(5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)-4-oxoquinoline-3-carboxylic acid Chemical compound CN1CC2CC1CN2C(C(=CC=1C(=O)C(C(O)=O)=C2)F)=CC=1N2C1=CC=C(F)C=C1 OJLOSIZWHIEZGO-UHFFFAOYSA-N 0.000 description 1
- PZVYAIIEIVMFHO-UHFFFAOYSA-N 6-fluoro-1-(4-fluorophenyl)-7-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)-4-oxoquinoline-3-carboxylic acid Chemical compound CN1C(C2)CCC1CN2C(C(=CC=1C(=O)C(C(O)=O)=C2)F)=CC=1N2C1=CC=C(F)C=C1 PZVYAIIEIVMFHO-UHFFFAOYSA-N 0.000 description 1
- KYINIAPWICLVSY-UHFFFAOYSA-N 6-fluoro-1-(methylamino)-7-(5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)-4-oxoquinoline-3-carboxylic acid Chemical compound C1=C2N(NC)C=C(C(O)=O)C(=O)C2=CC(F)=C1N1C(CN2C)CC2C1 KYINIAPWICLVSY-UHFFFAOYSA-N 0.000 description 1
- WSHKLWVLZGIWEM-UHFFFAOYSA-N 6-fluoro-1-methoxy-7-(5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)-4-oxoquinoline-3-carboxylic acid Chemical compound C1=C2N(OC)C=C(C(O)=O)C(=O)C2=CC(F)=C1N1C(CN2C)CC2C1 WSHKLWVLZGIWEM-UHFFFAOYSA-N 0.000 description 1
- LGUDEHVYHOCGLA-UHFFFAOYSA-N 6-fluoro-1-methoxy-7-(5-methyl-2,5-diazabicyclo[2.2.2]octan-2-yl)-4-oxoquinoline-3-carboxylic acid Chemical compound C1C(N(C2)C)CCC2N1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(OC)C2=C1 LGUDEHVYHOCGLA-UHFFFAOYSA-N 0.000 description 1
- PHCFKTNGQRYTEE-UHFFFAOYSA-N 6-methyl-4,9-diazabicyclo[4.2.1]nonane Chemical compound C1NCCC2CCC1(C)N2 PHCFKTNGQRYTEE-UHFFFAOYSA-N 0.000 description 1
- UBGCCYGMLOBJOJ-UHFFFAOYSA-N 7-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1N1CCN2CCC1CC2 UBGCCYGMLOBJOJ-UHFFFAOYSA-N 0.000 description 1
- MTUOLPZBNHSKRD-UHFFFAOYSA-N 7-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-6-fluoro-1-(2-fluoroethyl)-4-oxoquinoline-3-carboxylic acid Chemical compound FC=1C=C2C(=O)C(C(=O)O)=CN(CCF)C2=CC=1N1CCN2CCC1CC2 MTUOLPZBNHSKRD-UHFFFAOYSA-N 0.000 description 1
- AAWPEBWRUYSNEA-UHFFFAOYSA-N 7-(1,4-diazabicyclo[3.3.1]nonan-4-yl)-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C1CN(C2)CCCC2N1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(CC)C2=C1 AAWPEBWRUYSNEA-UHFFFAOYSA-N 0.000 description 1
- BVMNCVGZGHZACI-UHFFFAOYSA-N 7-(2,5-diazabicyclo[2.2.1]heptan-2-yl)-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1N1C(CN2)CC2C1 BVMNCVGZGHZACI-UHFFFAOYSA-N 0.000 description 1
- PJEAVPOUIOJDHO-UHFFFAOYSA-N 7-(2,5-diazabicyclo[2.2.2]octan-2-yl)-6-fluoro-1-(4-fluorophenyl)-4-oxoquinoline-3-carboxylic acid Chemical compound C12=CC(N3C4CCC(NC4)C3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1=CC=C(F)C=C1 PJEAVPOUIOJDHO-UHFFFAOYSA-N 0.000 description 1
- JFDXQLPTMBAMAJ-UHFFFAOYSA-N 7-(3,8-diazabicyclo[3.2.1]octan-3-yl)-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C1C(N2)CCC2CN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(CC)C2=C1 JFDXQLPTMBAMAJ-UHFFFAOYSA-N 0.000 description 1
- ALBSHLLFKPNOJO-UHFFFAOYSA-N 7-(9-benzyl-4,9-diazabicyclo[4.2.1]nonan-4-yl)-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1N(C1)CCC2CCC1N2CC1=CC=CC=C1 ALBSHLLFKPNOJO-UHFFFAOYSA-N 0.000 description 1
- LHZDPJRHQVYKPA-ONGXEEELSA-N 7-[(1s,4s)-2-aza-5-azoniabicyclo[2.2.1]heptan-2-yl]-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylate Chemical compound C([C@]1(NC[C@]2([H])C1)[H])N2C(C(=CC=1C(=O)C(C(O)=O)=C2)F)=CC=1N2C1CC1 LHZDPJRHQVYKPA-ONGXEEELSA-N 0.000 description 1
- YALBBOKCZCOQDK-UHFFFAOYSA-N 7-benzyl-4,7-diazabicyclo[4.1.1]octane Chemical compound C1NCCC2CC1N2CC1=CC=CC=C1 YALBBOKCZCOQDK-UHFFFAOYSA-N 0.000 description 1
- OFNWMZRPXFBZPX-UHFFFAOYSA-N 8-methyl-3,8-diazabicyclo[3.2.1]octane Chemical compound C1NCC2CCC1N2C OFNWMZRPXFBZPX-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 1
- 238000006237 Beckmann rearrangement reaction Methods 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- LZOCLCOYWGLZNE-UHFFFAOYSA-N C(C)OC(CC(CC(=O)OCC)(Br)Br)=O Chemical compound C(C)OC(CC(CC(=O)OCC)(Br)Br)=O LZOCLCOYWGLZNE-UHFFFAOYSA-N 0.000 description 1
- BQXUPNKLZNSUMC-YUQWMIPFSA-N CCN(CCCCCOCC(=O)N[C@H](C(=O)N1C[C@H](O)C[C@H]1C(=O)N[C@@H](C)c1ccc(cc1)-c1scnc1C)C(C)(C)C)CCOc1ccc(cc1)C(=O)c1c(sc2cc(O)ccc12)-c1ccc(O)cc1 Chemical compound CCN(CCCCCOCC(=O)N[C@H](C(=O)N1C[C@H](O)C[C@H]1C(=O)N[C@@H](C)c1ccc(cc1)-c1scnc1C)C(C)(C)C)CCOc1ccc(cc1)C(=O)c1c(sc2cc(O)ccc12)-c1ccc(O)cc1 BQXUPNKLZNSUMC-YUQWMIPFSA-N 0.000 description 1
- DMKYRNKIRRPVIO-UHFFFAOYSA-N CON1C=C(C(C2=CC(=C(C=C12)N1C2CNC(C1)C2)F)=O)C(=O)O Chemical compound CON1C=C(C(C2=CC(=C(C=C12)N1C2CNC(C1)C2)F)=O)C(=O)O DMKYRNKIRRPVIO-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- WBYWAXJHAXSJNI-SREVYHEPSA-N Cinnamic acid Chemical compound OC(=O)\C=C/C1=CC=CC=C1 WBYWAXJHAXSJNI-SREVYHEPSA-N 0.000 description 1
- 229940126062 Compound A Drugs 0.000 description 1
- QMLVECGLEOSESV-RYUDHWBXSA-N Danofloxacin Chemical compound C([C@@H]1C[C@H]2CN1C)N2C(C(=CC=1C(=O)C(C(O)=O)=C2)F)=CC=1N2C1CC1 QMLVECGLEOSESV-RYUDHWBXSA-N 0.000 description 1
- 238000007355 Double Michael addition reaction Methods 0.000 description 1
- RRSNDVCODIMOFX-MPKOGUQCSA-N Fc1c(Cl)cccc1[C@H]1[C@@H](NC2(CCCCC2)[C@@]11C(=O)Nc2cc(Cl)ccc12)C(=O)Nc1ccc(cc1)C(=O)NCCCCCc1cccc2C(=O)N(Cc12)C1CCC(=O)NC1=O Chemical compound Fc1c(Cl)cccc1[C@H]1[C@@H](NC2(CCCCC2)[C@@]11C(=O)Nc2cc(Cl)ccc12)C(=O)Nc1ccc(cc1)C(=O)NCCCCCc1cccc2C(=O)N(Cc12)C1CCC(=O)NC1=O RRSNDVCODIMOFX-MPKOGUQCSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- OPFJDXRVMFKJJO-ZHHKINOHSA-N N-{[3-(2-benzamido-4-methyl-1,3-thiazol-5-yl)-pyrazol-5-yl]carbonyl}-G-dR-G-dD-dD-dD-NH2 Chemical compound S1C(C=2NN=C(C=2)C(=O)NCC(=O)N[C@H](CCCN=C(N)N)C(=O)NCC(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC(O)=O)C(N)=O)=C(C)N=C1NC(=O)C1=CC=CC=C1 OPFJDXRVMFKJJO-ZHHKINOHSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 description 1
- 125000000066 S-methyl group Chemical group [H]C([H])([H])S* 0.000 description 1
- 229910004298 SiO 2 Inorganic materials 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- LJOOWESTVASNOG-UFJKPHDISA-N [(1s,3r,4ar,7s,8s,8as)-3-hydroxy-8-[2-[(4r)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,4,4a,7,8,8a-octahydronaphthalen-1-yl] (2s)-2-methylbutanoate Chemical compound C([C@H]1[C@@H](C)C=C[C@H]2C[C@@H](O)C[C@@H]([C@H]12)OC(=O)[C@@H](C)CC)CC1C[C@@H](O)CC(=O)O1 LJOOWESTVASNOG-UFJKPHDISA-N 0.000 description 1
- UULHBJANFRFIQP-UHFFFAOYSA-N [Cl-].C1(=CC=CC=C1)[SeH+]C1=CC=CC=C1 Chemical compound [Cl-].C1(=CC=CC=C1)[SeH+]C1=CC=CC=C1 UULHBJANFRFIQP-UHFFFAOYSA-N 0.000 description 1
- JEDZLBFUGJTJGQ-UHFFFAOYSA-N [Na].COCCO[AlH]OCCOC Chemical compound [Na].COCCO[AlH]OCCOC JEDZLBFUGJTJGQ-UHFFFAOYSA-N 0.000 description 1
- 125000002015 acyclic group Chemical group 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- HONIICLYMWZJFZ-UHFFFAOYSA-N azetidine Chemical compound C1CNC1 HONIICLYMWZJFZ-UHFFFAOYSA-N 0.000 description 1
- WXBLLCUINBKULX-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1.OC(=O)C1=CC=CC=C1 WXBLLCUINBKULX-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- FNXLCIKXHOPCKH-UHFFFAOYSA-N bromamine Chemical compound BrN FNXLCIKXHOPCKH-UHFFFAOYSA-N 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000002512 chemotherapy Methods 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 229960003405 ciprofloxacin Drugs 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 229940126142 compound 16 Drugs 0.000 description 1
- 229940126086 compound 21 Drugs 0.000 description 1
- 229940125846 compound 25 Drugs 0.000 description 1
- 229940127204 compound 29 Drugs 0.000 description 1
- 229940126540 compound 41 Drugs 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- WLNWKZXPHXIQKT-UHFFFAOYSA-N cyclohepta-2,6-dien-1-one Chemical compound O=C1C=CCCC=C1 WLNWKZXPHXIQKT-UHFFFAOYSA-N 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- DXLXLBWDINXHBH-UHFFFAOYSA-N diethyl 1-benzylazetidine-2,4-dicarboxylate Chemical compound CCOC(=O)C1CC(C(=O)OCC)N1CC1=CC=CC=C1 DXLXLBWDINXHBH-UHFFFAOYSA-N 0.000 description 1
- XIMIGUBYDJDCKI-UHFFFAOYSA-N diselenium Chemical compound [Se]=[Se] XIMIGUBYDJDCKI-UHFFFAOYSA-N 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 239000003651 drinking water Substances 0.000 description 1
- 235000020188 drinking water Nutrition 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 125000003784 fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 150000003949 imides Chemical class 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- OVEHNNQXLPJPPL-UHFFFAOYSA-N lithium;n-propan-2-ylpropan-2-amine Chemical compound [Li].CC(C)NC(C)C OVEHNNQXLPJPPL-UHFFFAOYSA-N 0.000 description 1
- RENRQMCACQEWFC-UGKGYDQZSA-N lnp023 Chemical compound C1([C@H]2N(CC=3C=4C=CNC=4C(C)=CC=3OC)CC[C@@H](C2)OCC)=CC=C(C(O)=O)C=C1 RENRQMCACQEWFC-UGKGYDQZSA-N 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
- 230000011987 methylation Effects 0.000 description 1
- 238000007069 methylation reaction Methods 0.000 description 1
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 1
- MHWLWQUZZRMNGJ-UHFFFAOYSA-N nalidixic acid Chemical compound C1=C(C)N=C2N(CC)C=C(C(O)=O)C(=O)C2=C1 MHWLWQUZZRMNGJ-UHFFFAOYSA-N 0.000 description 1
- 229960000210 nalidixic acid Drugs 0.000 description 1
- OGJPXUAPXNRGGI-UHFFFAOYSA-N norfloxacin Chemical compound C1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1N1CCNCC1 OGJPXUAPXNRGGI-UHFFFAOYSA-N 0.000 description 1
- 229960001180 norfloxacin Drugs 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- KIMVTSGNCBGHES-UHFFFAOYSA-N octane;dihydrochloride Chemical compound Cl.Cl.CCCCCCCC KIMVTSGNCBGHES-UHFFFAOYSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- XNQULTQRGBXLIA-UHFFFAOYSA-O phosphonic anhydride Chemical compound O[P+](O)=O XNQULTQRGBXLIA-UHFFFAOYSA-O 0.000 description 1
- BCIIMDOZSUCSEN-UHFFFAOYSA-N piperidin-4-amine Chemical compound NC1CCNCC1 BCIIMDOZSUCSEN-UHFFFAOYSA-N 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000000651 prodrug Substances 0.000 description 1
- 229940002612 prodrug Drugs 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- XRXDAJYKGWNHTQ-UHFFFAOYSA-N quipazine Chemical class C1CNCCN1C1=CC=C(C=CC=C2)C2=N1 XRXDAJYKGWNHTQ-UHFFFAOYSA-N 0.000 description 1
- 230000010076 replication Effects 0.000 description 1
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 description 1
- 239000012419 sodium bis(2-methoxyethoxy)aluminum hydride Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 125000003003 spiro group Chemical group 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/08—Bridged systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/08—Bridged systems
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/55—Design of synthesis routes, e.g. reducing the use of auxiliary or protecting groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Oncology (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Communicable Diseases (AREA)
- Public Health (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Plural Heterocyclic Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Materials For Photolithography (AREA)
- Preparation Of Compounds By Using Micro-Organisms (AREA)
- Saccharide Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US77747185A | 1985-09-18 | 1985-09-18 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DD259190A5 true DD259190A5 (de) | 1988-08-17 |
Family
ID=25110350
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DD86294486A DD259190A5 (de) | 1985-09-18 | 1986-09-17 | Verfahren zur herstellung von substituierten bruecken-diazabic ycloalkyl-chinolon-carbonsaeuren |
Country Status (42)
Families Citing this family (61)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IN166416B (ja�@�@) * | 1985-09-18 | 1990-05-05 | Pfizer | |
| DE3601567A1 (de) * | 1986-01-21 | 1987-07-23 | Bayer Ag | 7-(azabicycloalkyl)-chinoloncarbonsaeure- und -naphthyridon-carbonsaeure-derivate |
| IL83049A (en) * | 1986-07-04 | 1991-12-12 | Chemie Linz Ag | 4-quinolinone-3-carboxylic acid derivatives,their manufacture and pharmaceutical compositions containing them |
| US4965273A (en) * | 1986-10-08 | 1990-10-23 | Bristol-Myers Company | Certain 1-tertiary-butyl-naphthyridone carboxylic acid derivatives anti-bacterial agents |
| WO1989000158A1 (en) * | 1987-07-02 | 1989-01-12 | Pfizer Inc. | Bridged-diazabicycloalkyl quinolone carboxylic acids and esters |
| US4923879A (en) * | 1987-07-31 | 1990-05-08 | Warner-Lambert Company | 1,8-Naphthyridines and their use as antibacterial agents |
| US4968799A (en) * | 1987-07-31 | 1990-11-06 | Warner-Lambert Company | Antibacterial agents |
| US4992546A (en) * | 1987-07-31 | 1991-02-12 | Warner-Lambert Company | Process for preparing 6,8-diazabicyclo[3.2.2]nonane derivatives |
| US4933335A (en) * | 1987-08-07 | 1990-06-12 | Warner-Lambert Company | Quinolones as antibacterial agents |
| WO1989005643A1 (en) * | 1987-12-18 | 1989-06-29 | Pfizer Inc. | Heterocyclic-substituted quinoline-carboxylic acids |
| DE3902079A1 (de) * | 1988-04-15 | 1989-10-26 | Bayer Ag | I.m. injektionsformen von gyrase-inhibitoren |
| US5147873A (en) * | 1988-08-23 | 1992-09-15 | Pfizer Inc. | Amino-substituted bridged azabicyclic quinolone carboxylic acids and esters |
| WO1990002123A1 (en) * | 1988-08-23 | 1990-03-08 | Pfizer Inc. | Amino-substituted bridged azabicyclic quinolone carboxylic acids and esters |
| US4895943A (en) * | 1988-10-25 | 1990-01-23 | Pfizer Inc. | Preparation of 1,4-diazabicyclo(3.2.2)nonane |
| US5036153A (en) * | 1989-05-11 | 1991-07-30 | Braish Tamim F | Preparation of 2,5-diazabicyclo[2.2.1]heptanes and intermediates |
| US5214051A (en) * | 1989-08-01 | 1993-05-25 | Pfizer Inc. | Thiazolyl and oxazolyl[5,4-c]piperidyl-substituted quinolone-carboxylic acid and related analogs thereof having antibacterial properties are disclosed |
| US5095121A (en) * | 1989-09-25 | 1992-03-10 | Pfizer Inc | Process for optically active 2-alkyl-2,5-diazabicyclo(2.2.1)heptanes |
| US5157125A (en) * | 1989-09-25 | 1992-10-20 | Pfizer Inc. | Optically active 2-alkyl-2,5-diazabicyclo[2.2.1]heptanes |
| US5013839A (en) * | 1989-09-25 | 1991-05-07 | Pfizer Inc. | Process for optically active 2-alkyl-2,5-diazabicyclo(2.2.1) heptanes |
| FI921475L (fi) * | 1989-10-06 | 1992-04-03 | Pfizer | 1,4-dihydro-4-oxo-3-kinolinderivat som selektivt toxiska antibakteriella aemenn hos daeggdjur. |
| US5385913A (en) * | 1989-10-06 | 1995-01-31 | Pfizer Inc. | 1,4-dihydro-4-oxo-3-quinoline derivatives as selectively toxic mammalian antibacterial agents |
| US4992449A (en) * | 1990-02-01 | 1991-02-12 | American Cyanamid Company | 7-(substituted)cycloalkylamino-1-(substituted)-6-fluoro-1,4-dihydro-4-oxo-3-quinolinecarboxylic acids |
| US5580872A (en) * | 1990-05-02 | 1996-12-03 | Abbott Laboratories | Quinolizinone type compounds |
| ES2065175T3 (es) * | 1991-03-01 | 1995-02-01 | Pfizer | Derivados de 1-azabiciclo(3.2.2)nonan-3-amina. |
| US5235054A (en) * | 1992-07-15 | 1993-08-10 | Pfizer Inc. | 3-carboxaldehyde substituted quinolines and naphthyridines |
| GB2291421A (en) * | 1994-07-16 | 1996-01-24 | Pfizer | A process for preparing a quinoline carboxylic acid |
| ES2092963B1 (es) * | 1995-04-12 | 1997-12-16 | Sint Quimica Sa | Procedimiento para la preparacion del acido 1-ciclopropil-6-fluoro-1, 4-dihidro-7-(1s,4s)-5-metil-2,5-diazabiciclo(2.2.1) hept-2-il)-4-oxo-3-quinolincarboxilico y sus sales. |
| US5929086A (en) | 1996-05-10 | 1999-07-27 | Pharmacia & Upjohn Company | Topical administration of antimicrobial agents for the treatment of systemic bacterial diseases |
| US6056436A (en) * | 1997-02-20 | 2000-05-02 | University Of Maryland | Simultaneous measurement of temperature and strain using optical sensors |
| US6114531A (en) * | 1998-07-28 | 2000-09-05 | Pfizer Inc. | Process for preparing quinolone and naphthyridone carboxylic acids |
| NZ513575A (en) | 1999-05-04 | 2003-07-25 | Neurosearch As | Heteroaryl diazabicycloalkanes useful for treating or preventing a disease or a disorder responsive to the activity of nAChR modulators |
| FR2809731B1 (fr) * | 2000-05-31 | 2002-07-19 | Sanofi Synthelabo | Derives de 1,4-diazabicyclo-[3.2.2] nonane-pheylisoxazole, leur preparation et leur application en therapeutique |
| FR2809732B1 (fr) * | 2000-05-31 | 2002-07-19 | Sanofi Synthelabo | DERIVES DE 4(-2-PHENYLTHIAZOL-5-yl)-1,4-DIAZABICYCLO-[3.2.2] NONANE, LEUR PREPARATION ET LEUR APPLICATION ENTHERAPEUTIQUE |
| FR2809730B1 (fr) * | 2000-05-31 | 2002-07-19 | Sanofi Synthelabo | Derives de 1,4-diazabicyclo[3.2.2] nonanebenzoxazole, -benzothiazole et -benzimidazole, leur preparation et leur application therapeutique |
| NZ527006A (en) * | 2001-03-02 | 2005-02-25 | Neurosearch As | Novel 2,5-diazabicyclo[2.2.1]heptane derivatives |
| CA2498291C (en) * | 2002-09-10 | 2009-04-07 | Pfizer Products Inc. | Diazabicyclic compounds useful in the treatment of cns and other disorders |
| MXPA05003317A (es) * | 2002-09-25 | 2005-07-05 | Memory Pharm Corp | Indazoles, benzotiazoles y benzoisotiazoles asi como preparacion y usos de los mismos. |
| DE10312346A1 (de) * | 2003-03-20 | 2004-09-30 | Bayer Healthcare Ag | Kontrolliertes Freisetzungssystem |
| DE10351448A1 (de) | 2003-11-04 | 2005-06-09 | Bayer Healthcare Ag | Geschmackstoffhaltige Arzneimittelformulierungen mit verbesserten pharmazeutischen Eigenschaften |
| RU2389729C2 (ru) * | 2003-12-22 | 2010-05-20 | Мемори Фармасьютиклз Корпорейшн | 1н-индазолы, 1, 2-бензизоксазолы и 1, 2-бензизотиазолы, их получение и применение |
| EP1735306A2 (en) | 2004-03-25 | 2006-12-27 | Memory Pharmaceuticals Corporation | Indazoles, benzothiazoles, benzoisothiazoles, benzisoxazoles, and preparation and uses thereof |
| CA2567977A1 (en) * | 2004-04-22 | 2006-01-05 | Memory Pharmaceutical Corporation | Indoles, 1h-indazoles, 1,2-benzisoxazoles, 1,2-benzoisothiazoles, and preparation and uses thereof |
| NZ551712A (en) * | 2004-05-07 | 2010-07-30 | Memory Pharm Corp | 1H-indazoles, benzothiazoles, 1,2-benzoisoxazoles, 1,2-benzoisothiazoles, and chromones and preparations and uses thereof |
| DE102005055385A1 (de) * | 2004-12-09 | 2006-06-14 | Bayer Healthcare Ag | Arzneimittel zur hygienischen Applikation im Ohr |
| CA2591817A1 (en) | 2004-12-22 | 2006-06-29 | Memory Pharmaceuticals Corporation | Nicotinic alpha-7 receptor ligands and preparation and uses thereof |
| US8106066B2 (en) * | 2005-09-23 | 2012-01-31 | Memory Pharmaceuticals Corporation | Indazoles, benzothiazoles, benzoisothiazoles, benzisoxazoles, pyrazolopyridines, isothiazolopyridines, and preparation and uses thereof |
| CN101379063A (zh) | 2006-02-10 | 2009-03-04 | 神经研究公司 | 3,9-二氮杂双环[3.3.1]壬烷衍生物及其作为单胺神经递质再摄取抑制剂的用途 |
| AU2007213670A1 (en) | 2006-02-10 | 2007-08-16 | Neurosearch A/S | 3,9-diazabicyclo[3.3.1]nonane derivatives and their use as monoamine neurotransmitter re-uptake inhibitors |
| WO2007090888A1 (en) | 2006-02-10 | 2007-08-16 | Neurosearch A/S | 3-heteroaryl- 3,9-diazabicyclo[3.3.1]nonane derivatives as nicotinic acetylcholine receptor agonists |
| DE102006010642A1 (de) * | 2006-03-08 | 2007-09-27 | Bayer Healthcare Aktiengesellschaft | Arzneimittelformulierungen, enthaltend Fluorchinolone |
| DE102006010643A1 (de) | 2006-03-08 | 2007-09-13 | Bayer Healthcare Aktiengesellschaft | Arzneimittel enthaltend Fluorchinolone |
| DE102007026550A1 (de) | 2007-06-08 | 2008-12-11 | Bayer Healthcare Ag | Extrudate mit verbesserter Geschmacksmaskierung |
| DE102007055341A1 (de) | 2007-11-19 | 2009-05-20 | Bayer Animal Health Gmbh | Stabilisierung öliger Suspensionen enthaltend hydrophobe Kieselsäuren |
| WO2009111680A1 (en) * | 2008-03-07 | 2009-09-11 | Smithline Beecham Corporation | Trpv4 antagonists |
| MX2011009414A (es) * | 2009-03-11 | 2011-10-19 | Kyorin Seiyaku Kk | 7-cicloalquiloaminoquinolonas como inhibidores de gsk-3. |
| ES2806256T3 (es) | 2010-10-12 | 2021-02-17 | Bayer Ip Gmbh | Productos masticables blandos no basados en almidón |
| NZ708741A (en) | 2012-12-19 | 2019-11-29 | Bayer Animal Health Gmbh | Tablets with improved acceptance and good storage stability |
| MD4291C1 (ro) * | 2013-12-27 | 2015-02-28 | Государственный Медицинский И Фармацевтический Университет "Nicolae Testemitanu" Республики Молдова | Preparat medicamentos pentru tratamentul otitelor |
| US12350281B2 (en) | 2019-05-24 | 2025-07-08 | Dechra Veterinary Products, Llc | Long-acting injectable formulations and use thereof |
| CA3150301A1 (en) * | 2019-09-06 | 2021-03-11 | Stacy ROSS | GRANULAR VETERINARY COMPOSITIONS OF PLEASANT TASTE |
| CN115368369A (zh) * | 2022-08-16 | 2022-11-22 | 浙江国邦药业有限公司 | 一种甲磺酸达氟沙星脱甲基杂质的合成方法 |
Family Cites Families (30)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS53141286A (en) * | 1977-05-16 | 1978-12-08 | Kyorin Seiyaku Kk | Novel substituted quinolinecarboxylic acid |
| CA1175836A (en) * | 1977-09-20 | 1984-10-09 | Marcel Pesson | Production of 1,4-dihydroquinoline-3-carboxylic acid derivatives |
| JPS54112876A (en) * | 1978-02-20 | 1979-09-04 | Sumitomo Chem Co Ltd | Preparation of 1-substituted-1,4-dihydro-4-oxo-3-quinoline carboxylic acid derivatives |
| JPS5845426B2 (ja) * | 1978-09-29 | 1983-10-08 | 杏林製薬株式会社 | 置換キノリンカルボン酸誘導体 |
| JPS5746986A (en) * | 1980-09-02 | 1982-03-17 | Dai Ichi Seiyaku Co Ltd | Pyrido(1,2,3-de)(1,4)benzoxazine derivative |
| JPS5823382A (ja) * | 1981-08-05 | 1983-02-12 | Nec Corp | コンテイギユアス・デイスク・バブル検出・消去器 |
| JPS5823381A (ja) * | 1981-08-05 | 1983-02-12 | Nec Corp | 磁気バブル検出装置 |
| JPS58204193A (ja) * | 1982-01-14 | 1983-11-28 | Kobe Steel Ltd | 表面処理鋼板 |
| US4499091A (en) * | 1982-03-31 | 1985-02-12 | Sterling Drug Inc. | 1-Amino (or substituted amino)-1,4-dihydro-4-oxo-6-fluoro-7-heterylquinoline-3-carboxylic acids and their use as antibacterial agents |
| EP0090424B1 (en) * | 1982-03-31 | 1986-05-28 | Sterling Drug Inc. | New quinolone compounds and preparation thereof |
| JPS58204194A (ja) * | 1982-05-21 | 1983-11-28 | Hitachi Ltd | 電気ニツケルメツキ方法 |
| JPS58219293A (ja) * | 1982-06-15 | 1983-12-20 | Chiyoda Chem Eng & Constr Co Ltd | 重質油の水素化分解方法 |
| US4665079A (en) * | 1984-02-17 | 1987-05-12 | Warner-Lambert Company | Antibacterial agents |
| IE55898B1 (en) * | 1982-09-09 | 1991-02-14 | Warner Lambert Co | Antibacterial agents |
| JPS59137481A (ja) * | 1983-01-26 | 1984-08-07 | Hokuriku Seiyaku Co Ltd | 7−ジアザビシクロアルカン置換−4−オキソ−1,4−ジヒドロキノリン−3−カルボン酸誘導体 |
| NZ208470A (en) * | 1983-07-18 | 1988-06-30 | Abbott Lab | 6-fluoro-1,4-dihydro-4-oxo-quinoline-3-carboxylic acid derivatives and antibacterial compositions containing such |
| US4730000A (en) * | 1984-04-09 | 1988-03-08 | Abbott Laboratories | Quinoline antibacterial compounds |
| US4571396A (en) * | 1984-04-16 | 1986-02-18 | Warner-Lambert Company | Antibacterial agents |
| JPS6212760A (ja) * | 1984-12-14 | 1987-01-21 | Dai Ichi Seiyaku Co Ltd | 1−(2−ハロゲノシクロプロピル)キノリンカルボン酸誘導体 |
| IL77846A (en) * | 1985-03-25 | 1989-08-15 | Warner Lambert Co | Process for the preparation of 7-amino-quinolin-4-oxy-3-carboxylic acid derivatives |
| US4578473A (en) * | 1985-04-15 | 1986-03-25 | Warner-Lambert Company | Process for quinoline-3-carboxylic acid antibacterial agents |
| US4684648A (en) * | 1985-05-10 | 1987-08-04 | Otsuka Pharmaceutical Company Limited | Antimicrobial 1-substituted phenyl-4-oxoquinoline-3-carboxylic acid compounds and compositions thereof |
| IN166416B (ja�@�@) * | 1985-09-18 | 1990-05-05 | Pfizer | |
| US4772706A (en) * | 1986-01-13 | 1988-09-20 | Warner-Lambert Company | Process for quinoline-3-carboxylic acid antibacterial agents |
| US4840956A (en) * | 1986-02-18 | 1989-06-20 | Warner-Lambert Company | Novel disubstituted-7-pyrrolidinoquinoline antibacterial agents |
| IL83049A (en) * | 1986-07-04 | 1991-12-12 | Chemie Linz Ag | 4-quinolinone-3-carboxylic acid derivatives,their manufacture and pharmaceutical compositions containing them |
| DE3721745A1 (de) * | 1986-07-04 | 1988-01-14 | Lentia Gmbh | Bicyclisch substituierte chinoloncarbonsaeurederivate, verfahren zu ihrer herstellung und diese enthaltende pharmazeutische praeparate |
| DE3641312A1 (de) * | 1986-12-03 | 1988-06-09 | Bayer Ag | Verfahren zur herstellung von chinolincarbonsaeuren |
| US4923879A (en) * | 1987-07-31 | 1990-05-08 | Warner-Lambert Company | 1,8-Naphthyridines and their use as antibacterial agents |
| US4851418A (en) * | 1987-08-21 | 1989-07-25 | Warner-Lambert Company | Naphthyridine antibacterial agents containing an α-amino acid in the side chain of the 7-substituent |
-
1986
- 1986-08-18 IN IN740/DEL/86A patent/IN166416B/en unknown
- 1986-08-19 US US06/898,473 patent/US4861779A/en not_active Expired - Lifetime
- 1986-08-19 US US06/898,458 patent/US4775668A/en not_active Expired - Lifetime
- 1986-08-28 MW MW58/86A patent/MW5886A1/xx unknown
- 1986-09-03 ZM ZM85/86A patent/ZM8586A1/xx unknown
- 1986-09-12 EP EP86307045A patent/EP0215650B1/en not_active Expired - Lifetime
- 1986-09-12 DE DE1996175019 patent/DE19675019I2/de active Active
- 1986-09-12 AT AT86307045T patent/ATE72245T1/de active
- 1986-09-12 DE DE8686307045T patent/DE3683711D1/de not_active Expired - Lifetime
- 1986-09-15 EG EG580/86A patent/EG18184A/xx active
- 1986-09-15 IL IL80033A patent/IL80033A/xx not_active IP Right Cessation
- 1986-09-16 CZ CS866678A patent/CZ277825B6/cs not_active IP Right Cessation
- 1986-09-16 GR GR862363A patent/GR862363B/el unknown
- 1986-09-16 ES ES8601935A patent/ES2001428A6/es not_active Expired
- 1986-09-16 CA CA000518238A patent/CA1340734C/en not_active Expired - Lifetime
- 1986-09-16 PT PT83388A patent/PT83388B/pt unknown
- 1986-09-16 PL PL1986261410A patent/PL149987B1/pl unknown
- 1986-09-16 SK SK6678-86A patent/SK278605B6/sk unknown
- 1986-09-17 UA UA4028142A patent/UA6340A1/uk unknown
- 1986-09-17 ZA ZA867063A patent/ZA867063B/xx unknown
- 1986-09-17 NO NO863718A patent/NO170335C/no not_active IP Right Cessation
- 1986-09-17 IE IE247986A patent/IE58966B1/en not_active IP Right Cessation
- 1986-09-17 SU SU864028142A patent/SU1482531A3/ru active
- 1986-09-17 AU AU62768/86A patent/AU576302B2/en not_active Expired
- 1986-09-17 CN CN86106385A patent/CN1014789B/zh not_active Expired
- 1986-09-17 MA MA20998A patent/MA20770A1/fr unknown
- 1986-09-17 HU HU863976A patent/HU200462B/hu unknown
- 1986-09-17 DK DK445886A patent/DK171276B1/da not_active IP Right Cessation
- 1986-09-17 KR KR1019860007855A patent/KR870000961B1/ko not_active Expired
- 1986-09-17 DD DD86294486A patent/DD259190A5/de unknown
- 1986-09-17 OA OA58953A patent/OA08410A/xx unknown
- 1986-09-17 MX MX003751A patent/MX173358B/es unknown
- 1986-09-17 YU YU1617/86A patent/YU45024B/xx unknown
- 1986-09-17 FI FI863756A patent/FI87565C/fi not_active IP Right Cessation
- 1986-09-17 ZW ZW193/86A patent/ZW19386A1/xx unknown
- 1986-09-17 NZ NZ217614A patent/NZ217614A/xx unknown
- 1986-09-18 PH PH34266A patent/PH24048A/en unknown
- 1986-09-18 BG BG076465A patent/BG49275A3/xx unknown
- 1986-09-18 JP JP61220819A patent/JPH0798819B2/ja not_active Expired - Lifetime
-
1987
- 1987-08-25 MY MYPI87001447A patent/MY102518A/en unknown
-
1988
- 1988-02-16 US US07/157,182 patent/US5091383A/en not_active Expired - Fee Related
-
1989
- 1989-07-11 PH PH38922A patent/PH25338A/en unknown
-
1992
- 1992-03-17 BG BG096080A patent/BG61091B2/bg unknown
-
1994
- 1994-02-22 SG SG28094A patent/SG28094G/en unknown
-
1995
- 1995-08-24 HK HK132795A patent/HK132795A/en not_active IP Right Cessation
- 1995-10-20 CY CY177495A patent/CY1774A/xx unknown
-
1999
- 1999-02-24 LU LU90356C patent/LU90356I2/xx unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DD259190A5 (de) | Verfahren zur herstellung von substituierten bruecken-diazabic ycloalkyl-chinolon-carbonsaeuren | |
| DE60124577T2 (de) | Aza- und polyaza-naphthalenylcarbonsäureamide als hiv-integrase-hemmer | |
| EP0757990B1 (de) | 7-(1-Pyrrolidinyl)-3-chinolon- und -naphthyridoncarbonsäure-Derivate, Verfahren zu ihrer Herstellung sowie substituierte mono- und bicyclische Pyrrolidinderivate als Zwischenprodukte zu ihrer Herstellung, und sie enthaltende antibakterielle Mittel und Futterzusatzstoffe | |
| DE68928447T2 (de) | Azaspiro(n,m)alkane und Diazaspiro(n,m)alkane | |
| DE69426422T2 (de) | Pyridazino-chinolin verbindungen | |
| DE69430950T2 (de) | Chinolonderivate und verfahren zu deren herstellung | |
| DE4120646A1 (de) | 7-isoindolinyl-chinolon- und naphthyridoncarbonsaeure-derivate | |
| DD238795A5 (de) | Verfahren zur herstellung eines 1,4-dihydro-4-oxonaphthyridin-derivate | |
| WO1994004533A1 (en) | Condensed indole derivatives as 5ht2c and 5ht2b antagonists | |
| DE69427517T2 (de) | Tetracyclische kondensierte heterocyclische Verbindungen zur Behandlung von seniler Demenz | |
| DE69013750T2 (de) | Antagonisten von excitatorischen Aminosäuren. | |
| DD235260A5 (de) | Verfahren zur herstellung neuer kondensierter diazepinone | |
| DE3525108A1 (de) | Antibakteriell wirksame chinoloncarbonsaeureester | |
| DE60213851T2 (de) | Ringannelierte pyrazolderivate | |
| DD265401A5 (de) | Verfahren zur herstellung von 7-(azabicycloakyl)-chinolencarbonsaeure- und -naphthydridencarbonsaeure-derivaten | |
| DD266354A5 (de) | Verfahren zur herstellung von 1-tertiaeren alkylsubstituierten naphthyridin- und chinolinkarbonsaeuren als antibakterielle mittel | |
| EP0251308B1 (de) | 4-Chinolon-3-carbonsäurederivate, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate | |
| US4778812A (en) | 2,3-dihydro-9-methyl-1H-pyrrolo[1,2-a]indol-1-amines and derivatives thereof | |
| DE3721745A1 (de) | Bicyclisch substituierte chinoloncarbonsaeurederivate, verfahren zu ihrer herstellung und diese enthaltende pharmazeutische praeparate | |
| DE69526106T2 (de) | Pyridazinochinolinverbindungen | |
| EP0704443B1 (de) | Chinolon- und Naphthyridoncarbonsäurederivate | |
| DE60117581T2 (de) | Verfahren zur produktion eines trizyklischen kondensierten heterozyklischen derivats | |
| DD285601A5 (de) | Verfahren zur herstellung von 7-(1-pyrrolidinyl)-3-chinolon- und naphthyridoncarbonsaeure-derivaten | |
| DE19506535A1 (de) | 1,6-Naphthyridoncarbonsäurederivate |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NPV | Change in the person, the name or the address of the representative (addendum to changes before extension act) | ||
| RPV | Change in the person, the name or the address of the representative (searches according to art. 11 and 12 extension act) |
Representative=s name: PATENTANWAELTE LEDERER, KELLER UND PARTNER, 80538 M |
|
| IF04 | In force in the year 2004 |
Expiry date: 20060918 |