DD223066A5 - Bauelement fuer baumodelle,insbesondere bauspielzeuge - Google Patents
Bauelement fuer baumodelle,insbesondere bauspielzeuge Download PDFInfo
- Publication number
- DD223066A5 DD223066A5 DD260010A DD26001084A DD223066A5 DD 223066 A5 DD223066 A5 DD 223066A5 DD 260010 A DD260010 A DD 260010A DD 26001084 A DD26001084 A DD 26001084A DD 223066 A5 DD223066 A5 DD 223066A5
- Authority
- DD
- German Democratic Republic
- Prior art keywords
- coupling
- contact
- component
- coupling pin
- item
- Prior art date
Links
- 238000010276 construction Methods 0.000 title claims abstract description 11
- 238000010168 coupling process Methods 0.000 claims abstract description 188
- 238000005859 coupling reaction Methods 0.000 claims abstract description 188
- 230000008878 coupling Effects 0.000 claims abstract description 170
- 240000005611 Agrostis gigantea Species 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 abstract description 6
- 230000013011 mating Effects 0.000 description 7
- 239000002184 metal Substances 0.000 description 6
- 229910052751 metal Inorganic materials 0.000 description 6
- 239000000463 material Substances 0.000 description 3
- 239000011810 insulating material Substances 0.000 description 2
- 238000004080 punching Methods 0.000 description 2
- 229910001369 Brass Inorganic materials 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- 238000005452 bending Methods 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000010951 brass Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000004870 electrical engineering Methods 0.000 description 1
- 239000012777 electrically insulating material Substances 0.000 description 1
- 230000006870 function Effects 0.000 description 1
- 230000008571 general function Effects 0.000 description 1
- 238000003780 insertion Methods 0.000 description 1
- 230000037431 insertion Effects 0.000 description 1
- MOFOBJHOKRNACT-UHFFFAOYSA-N nickel silver Chemical compound [Ni].[Ag] MOFOBJHOKRNACT-UHFFFAOYSA-N 0.000 description 1
- 239000010956 nickel silver Substances 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- WRUUGTRCQOWXEG-UHFFFAOYSA-N pamidronate Chemical compound NCCC(O)(P(O)(O)=O)P(O)(O)=O WRUUGTRCQOWXEG-UHFFFAOYSA-N 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A63—SPORTS; GAMES; AMUSEMENTS
- A63H—TOYS, e.g. TOPS, DOLLS, HOOPS OR BUILDING BLOCKS
- A63H33/00—Other toys
- A63H33/04—Building blocks, strips, or similar building parts
-
- A—HUMAN NECESSITIES
- A63—SPORTS; GAMES; AMUSEMENTS
- A63H—TOYS, e.g. TOPS, DOLLS, HOOPS OR BUILDING BLOCKS
- A63H33/00—Other toys
- A63H33/04—Building blocks, strips, or similar building parts
- A63H33/042—Mechanical, electrical, optical, pneumatic or hydraulic arrangements; Motors
Landscapes
- Toys (AREA)
- Coupling Device And Connection With Printed Circuit (AREA)
- Building Environments (AREA)
- Buildings Adapted To Withstand Abnormal External Influences (AREA)
- Finishing Walls (AREA)
- Crystals, And After-Treatments Of Crystals (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Connector Housings Or Holding Contact Members (AREA)
- Macromonomer-Based Addition Polymer (AREA)
- Road Signs Or Road Markings (AREA)
- Vehicle Step Arrangements And Article Storage (AREA)
- Coin-Freed Apparatuses For Hiring Articles (AREA)
- Sewage (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH81483 | 1983-02-14 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DD223066A5 true DD223066A5 (de) | 1985-06-05 |
Family
ID=4195812
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DD260010A DD223066A5 (de) | 1983-02-14 | 1984-02-10 | Bauelement fuer baumodelle,insbesondere bauspielzeuge |
Country Status (32)
| Country | Link |
|---|---|
| US (1) | US4552541A (enExample) |
| EP (1) | EP0117846B1 (enExample) |
| JP (1) | JPS59156365A (enExample) |
| KR (1) | KR910003400B1 (enExample) |
| AT (1) | ATE23675T1 (enExample) |
| AU (1) | AU567318B2 (enExample) |
| BG (1) | BG44703A3 (enExample) |
| BR (1) | BR8400616A (enExample) |
| CA (1) | CA1225831A (enExample) |
| CS (1) | CS266323B2 (enExample) |
| DD (1) | DD223066A5 (enExample) |
| DE (1) | DE3461350D1 (enExample) |
| DK (1) | DK155205C (enExample) |
| EG (1) | EG16092A (enExample) |
| ES (3) | ES287795Y (enExample) |
| FI (1) | FI78398C (enExample) |
| GR (1) | GR81757B (enExample) |
| HK (1) | HK12088A (enExample) |
| HU (1) | HU187553B (enExample) |
| IE (1) | IE54895B1 (enExample) |
| IL (1) | IL70794A (enExample) |
| MA (1) | MA20029A1 (enExample) |
| MX (1) | MX156634A (enExample) |
| MY (1) | MY100348A (enExample) |
| NO (1) | NO158854C (enExample) |
| NZ (1) | NZ206971A (enExample) |
| PH (1) | PH21461A (enExample) |
| PL (1) | PL143935B1 (enExample) |
| PT (1) | PT78099B (enExample) |
| SG (1) | SG45087G (enExample) |
| SU (1) | SU1269733A3 (enExample) |
| ZA (1) | ZA84587B (enExample) |
Families Citing this family (73)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IL70827A (en) * | 1983-02-14 | 1986-10-31 | Interlego Ag | Building blocks for construction models |
| DK156244C (da) * | 1984-08-03 | 1989-12-04 | Lego As | Stroemfoerende byggeelement |
| DK156503C (da) * | 1984-08-03 | 1990-01-22 | Lego As | Stroemfoerende byggeelement |
| JPS6248397U (enExample) * | 1985-09-12 | 1987-03-25 | ||
| DK154964C (da) * | 1986-01-22 | 1989-05-29 | Lego As | Legetoejsbyggelement med elementer for tilvejebringelse af positionsinformation |
| IN168303B (enExample) * | 1986-02-05 | 1991-03-09 | Interlego Ag | |
| GB8608589D0 (en) * | 1986-04-09 | 1986-05-14 | Katable Co Ltd | Building block |
| DK436986A (da) * | 1986-09-12 | 1988-04-27 | Modulex As | Koblingsplade med et antal elektriske koblingspunkter, fremgangsmaadetil fremstilling af en saadan plade samt anvendelse af koblingspladen til en planlaegningstavle |
| DK437086A (da) * | 1986-09-12 | 1988-03-13 | Modulex As | Elektronisk identifikationskredsloeb samt integreret kredsloeb |
| JPS63197599U (enExample) * | 1987-06-12 | 1988-12-20 | ||
| USD317478S (en) | 1989-11-29 | 1991-06-11 | Interlego A.G. | Toy building element |
| USD325942S (en) | 1990-12-04 | 1992-05-05 | Interlego A.G. | Element for a toy building set |
| USD352973S (en) | 1992-08-18 | 1994-11-29 | Wonderwords, Inc. | Word brick structure |
| DE4313199C1 (de) * | 1993-04-22 | 1994-03-24 | Enno Messerschmitt | Spielschichtanordnung für ein elektrisches Spielelement |
| USD352750S (en) | 1993-09-22 | 1994-11-22 | Interlego A.G. | Building plate for a toy building set |
| USD354318S (en) | 1993-09-22 | 1995-01-10 | Interlego A.G. | Element for a toy building set |
| USD350784S (en) | 1993-09-22 | 1994-09-20 | Interlego, A.G. | Element for a toy building set |
| USD350787S (en) | 1993-09-22 | 1994-09-20 | Interlego, A.G. | Element for a toy building set |
| USD354526S (en) | 1993-09-22 | 1995-01-17 | Interlego A.G. | Element for a toy building set |
| USD350789S (en) | 1993-09-22 | 1994-09-20 | Interlego, A.G. | Element for a toy building set |
| USD350790S (en) | 1993-09-22 | 1994-09-20 | Interlego, A.G. | Element for a toy building set |
| USD350786S (en) | 1993-09-22 | 1994-09-20 | Interlego, A.G. | Element for a toy building set |
| USD354528S (en) | 1993-09-22 | 1995-01-17 | Interlego A.G. | Element for a toy building set |
| USD350791S (en) | 1993-09-22 | 1994-09-20 | Interlego A.G. | Element for a toy building set |
| USD360911S (en) | 1994-04-01 | 1995-08-01 | Dezego Anita J | Word brick structures |
| USD362472S (en) | 1994-04-01 | 1995-09-19 | Wonderwords, Inc. | Word brick structure |
| DK112494A (da) * | 1994-09-29 | 1996-03-30 | Lego As | Konstruktionsbyggesæt med elektrisk leder |
| USD362875S (en) | 1994-09-29 | 1995-10-03 | Interlego Ag | Toy building element |
| USD365857S (en) | 1994-10-24 | 1996-01-02 | Dart Industries Inc. | Toy construction block |
| USD385926S (en) * | 1996-09-17 | 1997-11-04 | Interlego Ag | Toy building element |
| USD411261S (en) | 1998-04-16 | 1999-06-22 | Ara John Movsesian | Connector for a toy building block |
| USD445148S1 (en) | 1998-05-28 | 2001-07-17 | Mcintosh Eric G. | Toy construction block |
| US6443796B1 (en) * | 2000-06-19 | 2002-09-03 | Judith Ann Shackelford | Smart blocks |
| US6805605B2 (en) * | 2003-03-17 | 2004-10-19 | Lynn E. Reining | Electrically conductive block toy |
| US7846002B1 (en) | 2005-05-06 | 2010-12-07 | Mikesell Daniel G | Lighted toy construction blocks |
| USD545785S1 (en) * | 2005-07-11 | 2007-07-03 | Radica Games Ltd. | Multiply interconnectable environmentally interactive character simulation module |
| US7731558B2 (en) * | 2007-08-15 | 2010-06-08 | Jon Capriola | Illuminated toy building structures |
| US8864546B1 (en) * | 2007-08-15 | 2014-10-21 | Jon P. Capriola | Illuminated toy building system and methods |
| USD591957S1 (en) * | 2007-09-13 | 2009-05-12 | Artistic & Creative (H.K.) Limited | Photo holder |
| EP2340093B1 (en) * | 2008-07-25 | 2012-08-29 | Lego A/S | Electrically conducting building element |
| US8690631B2 (en) * | 2008-09-12 | 2014-04-08 | Texas Instruments Incorporated | Toy building block with embedded integrated circuit |
| EP2258457A1 (en) * | 2009-06-02 | 2010-12-08 | Mitsubishi Chemical Europe GmbH | Building element |
| US8742814B2 (en) | 2009-07-15 | 2014-06-03 | Yehuda Binder | Sequentially operated modules |
| US8602833B2 (en) | 2009-08-06 | 2013-12-10 | May Patents Ltd. | Puzzle with conductive path |
| USD621427S1 (en) * | 2009-12-18 | 2010-08-10 | 3M Innovative Properties Company | Adapter for a sanding tool |
| US20110263177A1 (en) * | 2010-04-26 | 2011-10-27 | Marc Lemchen | Apparatus and Method for Bonding Three Dimensional Construction Toys when Assembled |
| US11330714B2 (en) | 2011-08-26 | 2022-05-10 | Sphero, Inc. | Modular electronic building systems with magnetic interconnections and methods of using the same |
| US9019718B2 (en) | 2011-08-26 | 2015-04-28 | Littlebits Electronics Inc. | Modular electronic building systems with magnetic interconnections and methods of using the same |
| US9597607B2 (en) | 2011-08-26 | 2017-03-21 | Littlebits Electronics Inc. | Modular electronic building systems with magnetic interconnections and methods of using the same |
| US8371894B1 (en) | 2011-12-23 | 2013-02-12 | LaRose Industries, LLC | Illuminated toy construction kit |
| WO2013115930A1 (en) * | 2012-02-03 | 2013-08-08 | Scanzon Chris | Toy storage, vertical scaffold and interactive play stations |
| KR200477073Y1 (ko) * | 2013-03-07 | 2015-05-04 | 겟 모어 컴퍼니 리미티드 | 전기 접속 빌딩 블록의 접촉 유형 |
| US20140349544A1 (en) * | 2013-05-27 | 2014-11-27 | Ta-Yi Chien | Illuminable Building block |
| US8684750B1 (en) | 2013-07-29 | 2014-04-01 | Chia-Yen Lin | Contact type of electric connection building block and electric connection unit disposed therein |
| EP2832406B1 (en) * | 2013-07-29 | 2015-10-07 | Chia-Yen Lin | Contact type of electric connection building block and electric connection unit disposed therein |
| EP3041592B1 (en) * | 2013-09-08 | 2019-04-10 | Brixo Smart Toys Ltd. | Selectively conductive toy building elements |
| CN203710704U (zh) * | 2014-01-25 | 2014-07-16 | 杭州速泽电子科技有限公司 | 兼容型磁吸附式电子积木 |
| CH711480A1 (de) * | 2015-08-31 | 2017-03-15 | Müller Stephan | Kunststoff-Spielbaustein mit elektrischen Kontakten zur elektronischen Bestimmung seiner Lage im verbauten Zustand und Verfahren zu seiner Herstellung. |
| USD788232S1 (en) | 2016-03-30 | 2017-05-30 | Mark George Koeberl | Translucent pixel block |
| USD815216S1 (en) * | 2017-03-30 | 2018-04-10 | Chrome Cherry Design Studio (Pty) Ltd | Tape forming a toy building block base |
| USD813317S1 (en) | 2017-03-30 | 2018-03-20 | Chrome Cherry Design Studio (Pty) Ltd | Tape forming a toy building block base |
| USD813318S1 (en) | 2017-03-30 | 2018-03-20 | Chrome Cherry Design Studio (Pty) Ltd | Tape forming a toy building block base |
| USD897451S1 (en) | 2017-07-06 | 2020-09-29 | Chrome Cherry Design Studio (Pty) Ltd | Tape forming a toy building block base |
| NL2019232B1 (en) | 2017-07-11 | 2019-01-28 | Pixsweet B V | Confection package |
| US11331590B2 (en) | 2017-08-18 | 2022-05-17 | Evan B. Grove | Building block |
| CN109833629B (zh) * | 2017-11-29 | 2023-12-15 | 龙门县佳茂聚氨酯橡胶有限公司 | 可多边导电的导电积木 |
| USD890858S1 (en) * | 2018-12-10 | 2020-07-21 | Evan B. Grove | Building block |
| NL2022367B1 (en) | 2019-01-10 | 2020-08-13 | What The Future Venture Capital Wtfvc B V | Confection package |
| US11616844B2 (en) | 2019-03-14 | 2023-03-28 | Sphero, Inc. | Modular electronic and digital building systems and methods of using the same |
| JP7233824B1 (ja) * | 2022-02-25 | 2023-03-07 | 滉大 馬野 | 電子回路用ブロック及び電子回路用ブロック群 |
| JP2024101642A (ja) * | 2023-01-18 | 2024-07-30 | 直士 高木 | カメラモジュール用筐体 |
| USD1093504S1 (en) * | 2023-11-04 | 2025-09-16 | The Atom Brick Inc. | Toy construction block |
| US12465871B1 (en) | 2025-04-03 | 2025-11-11 | Mattel-Mega Holdings (Us), Llc | Construction set elements |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH362354A (de) * | 1958-01-28 | 1962-05-31 | Kirk Christiansen Godtfred | Bauelement für Bauspielzeuge |
| US3005282A (en) * | 1958-01-28 | 1961-10-24 | Interlego Ag | Toy building brick |
| US3095668A (en) * | 1959-02-10 | 1963-07-02 | Clarence T Dorsett | Magnetic blocks |
| US3237341A (en) * | 1962-12-19 | 1966-03-01 | Roger S Dybvig | Base and stackable elements having cooperating electrical contact means |
| GB965399A (en) * | 1963-07-18 | 1964-07-29 | Maurice Emanuel Wides | Constructional toys |
| NL136808C (enExample) * | 1965-05-07 | |||
| DE1478284A1 (de) * | 1965-06-19 | 1969-03-13 | Lego System As | Verfahren zur Herstellung von einen oder mehrere elektrische Stromkreise enthaltenden Vorrichtungen oder Baumodellen,sowie Bauelemente zur Durchfuehrung des Verfahrens |
| NL6615701A (enExample) * | 1966-01-11 | 1967-07-12 | ||
| US3696548A (en) * | 1971-01-18 | 1972-10-10 | Kinetic Technologies Inc | Educational building toy modules with interior lights and mechanical connections acting as circuit closers |
| DE2552587A1 (de) * | 1975-11-24 | 1977-05-26 | Jens Freese | Klemmbaustein mit elektrischer verbindungsmoeglichkeit |
| US4423465A (en) * | 1981-09-30 | 1983-12-27 | Teng Ching Weng | Combination electronic circuit element with multidirectionally adjustable joints |
-
1984
- 1984-01-25 ZA ZA84587A patent/ZA84587B/xx unknown
- 1984-01-26 AU AU23817/84A patent/AU567318B2/en not_active Ceased
- 1984-01-26 IL IL70794A patent/IL70794A/xx not_active IP Right Cessation
- 1984-01-27 NZ NZ206971A patent/NZ206971A/xx unknown
- 1984-02-02 AT AT84810061T patent/ATE23675T1/de active
- 1984-02-02 EP EP84810061A patent/EP0117846B1/de not_active Expired
- 1984-02-02 PH PH30195A patent/PH21461A/en unknown
- 1984-02-02 DE DE8484810061T patent/DE3461350D1/de not_active Expired
- 1984-02-06 CS CS84822A patent/CS266323B2/cs unknown
- 1984-02-06 GR GR73717A patent/GR81757B/el unknown
- 1984-02-08 EG EG95/84A patent/EG16092A/xx active
- 1984-02-09 US US06/578,415 patent/US4552541A/en not_active Expired - Lifetime
- 1984-02-10 SU SU843699950A patent/SU1269733A3/ru active
- 1984-02-10 DD DD260010A patent/DD223066A5/de not_active IP Right Cessation
- 1984-02-10 MA MA20251A patent/MA20029A1/fr unknown
- 1984-02-13 DK DK062584A patent/DK155205C/da not_active IP Right Cessation
- 1984-02-13 BR BR8400616A patent/BR8400616A/pt not_active IP Right Cessation
- 1984-02-13 CA CA000447265A patent/CA1225831A/en not_active Expired
- 1984-02-13 PL PL1984246200A patent/PL143935B1/pl unknown
- 1984-02-13 IE IE326/84A patent/IE54895B1/en not_active IP Right Cessation
- 1984-02-13 ES ES1984287795U patent/ES287795Y/es not_active Expired
- 1984-02-13 MX MX200302A patent/MX156634A/es unknown
- 1984-02-13 HU HU84560A patent/HU187553B/hu not_active IP Right Cessation
- 1984-02-13 NO NO840517A patent/NO158854C/no unknown
- 1984-02-14 KR KR1019840000694A patent/KR910003400B1/ko not_active Expired
- 1984-02-14 FI FI840594A patent/FI78398C/fi not_active IP Right Cessation
- 1984-02-14 BG BG064247A patent/BG44703A3/xx unknown
- 1984-02-14 JP JP59024542A patent/JPS59156365A/ja active Granted
- 1984-02-14 PT PT78099A patent/PT78099B/pt not_active IP Right Cessation
-
1985
- 1985-12-31 ES ES1985291859U patent/ES291859Y/es not_active Expired
- 1985-12-31 ES ES1985291858U patent/ES291858Y/es not_active Expired
-
1987
- 1987-03-03 MY MYPI87000218A patent/MY100348A/en unknown
- 1987-05-15 SG SG450/87A patent/SG45087G/en unknown
-
1988
- 1988-02-10 HK HK120/88A patent/HK12088A/xx not_active IP Right Cessation
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0117846B1 (de) | Bauelement für Baumodelle, insbesondere Bauspielzeuge | |
| EP0236260B1 (de) | Bauelement für Baumodelle, insbesondere Bauspielzeuge | |
| EP0116519B1 (de) | Bauelement für Baumodelle, insbesondere Bauspielzeuge | |
| DE2234960C3 (de) | Elektrischer Stecker | |
| DE2406125C3 (de) | Buchsenkontakt | |
| DE69330110T2 (de) | Elektrischer Verbinder mit verbesserten Kontaktrückhaltemitteln | |
| DE2700617C3 (de) | Verfahren zum Herstellen eines elektrischen Bauteils mit AnschluBfahnen und mit diesem Verfahren hergestellter Bauteil | |
| DE2245982B2 (de) | Elektrischer Verbinder zur Herstellung einer Andrückverbindung mit einem Flachleiter eines Flachleiterkabels | |
| DE1861066U (de) | Dreidimensional aufgebaute schaltungsanordnung mit blockfoermigen, in ein rahmengestell einschiebbaren schaltungsgruppen. | |
| DE3244247A1 (de) | Mehrfachsteckverbinderstueck | |
| DE2419735C3 (de) | Elektrischer Schaltungsträger | |
| DE60000853T2 (de) | Verbinder mit überbrückbaren und konfigurierbaren Kontakten | |
| DE4422876B4 (de) | Elektrischer oder elektronischer Anschlußkontakt für gedruckte Schaltungen, Verfahren zu dessen Herstellung und seiner Befestigung an der gedruckten Schaltung | |
| DE2708291C3 (de) | Elektrische Steckvorrichtung | |
| DE4407083C2 (de) | Steckverbindergehäuse und zugehöriger Steckverbinder | |
| DE2333273C2 (de) | Elektrischer Verbinder zum Anschluß von Schaltungen auf Karten | |
| DE2555138A1 (de) | Mehrpolige federleiste | |
| DE102005053565A1 (de) | Steckerstift mit Schneidklemme | |
| DE9215527U1 (de) | Verbindungsstück für Stromschienen | |
| EP3201994A1 (de) | Stiftleiste | |
| DE2336244B2 (de) | Anklemmbares Kontaktplättchen für flache elektrische Schaltkreise | |
| DE1196270B (de) | Elektrisches Kupplungsstueck | |
| DE2223892A1 (de) | Verfahren zum herstellen von elektrischen stromleiterplatten | |
| EP0271163B1 (de) | Verfahren zum Herstellen von elektrischen Schaltungsplatten | |
| DE4445658C2 (de) | Verfahren zur Bestückung einer Grundleiste eines Steckverbinders für eine Printplatte mit Kontaktanschlüssen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| ENJ | Ceased due to non-payment of renewal fee |