CZ285845B6 - 1,2,4-Oxadiazolylfenoxyalkylisoxazoly a jejich použití jako protivirových prostředků - Google Patents
1,2,4-Oxadiazolylfenoxyalkylisoxazoly a jejich použití jako protivirových prostředků Download PDFInfo
- Publication number
- CZ285845B6 CZ285845B6 CZ93597A CZ59793A CZ285845B6 CZ 285845 B6 CZ285845 B6 CZ 285845B6 CZ 93597 A CZ93597 A CZ 93597A CZ 59793 A CZ59793 A CZ 59793A CZ 285845 B6 CZ285845 B6 CZ 285845B6
- Authority
- CZ
- Czechia
- Prior art keywords
- formula
- compound
- mmol
- alkoxy
- alkyl
- Prior art date
Links
- 239000003443 antiviral agent Substances 0.000 title abstract description 3
- 150000001875 compounds Chemical class 0.000 claims abstract description 323
- -1 cyano 2,2,2-trifluoroethyl Chemical group 0.000 claims abstract description 101
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 58
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 47
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims abstract description 34
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 34
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 29
- 239000002253 acid Substances 0.000 claims abstract description 20
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 19
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims abstract description 19
- 125000004953 trihalomethyl group Chemical group 0.000 claims abstract description 17
- 125000006371 dihalo methyl group Chemical group 0.000 claims abstract description 13
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims abstract description 13
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 12
- 150000002367 halogens Chemical class 0.000 claims abstract description 12
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims abstract description 11
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 11
- 239000001257 hydrogen Substances 0.000 claims abstract description 11
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims abstract description 10
- 125000003282 alkyl amino group Chemical group 0.000 claims abstract description 9
- 125000005113 hydroxyalkoxy group Chemical group 0.000 claims abstract description 9
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 9
- 150000003839 salts Chemical class 0.000 claims abstract description 8
- 125000002947 alkylene group Chemical group 0.000 claims abstract description 7
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims abstract description 7
- 125000004663 dialkyl amino group Chemical group 0.000 claims abstract description 5
- 125000004970 halomethyl group Chemical group 0.000 claims abstract description 5
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 50
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 15
- 230000000840 anti-viral effect Effects 0.000 claims description 12
- 239000008194 pharmaceutical composition Substances 0.000 claims description 7
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 6
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 5
- 241000124008 Mammalia Species 0.000 claims description 4
- 239000003085 diluting agent Substances 0.000 claims description 4
- 208000015181 infectious disease Diseases 0.000 claims description 4
- 239000003814 drug Substances 0.000 claims description 2
- 239000003937 drug carrier Substances 0.000 claims 3
- 125000004429 atom Chemical group 0.000 claims 1
- 125000004205 trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 claims 1
- 150000007513 acids Chemical class 0.000 abstract 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 abstract 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 183
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 105
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical class CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 104
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 90
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 68
- 238000000034 method Methods 0.000 description 67
- 239000000243 solution Substances 0.000 description 63
- 239000007787 solid Substances 0.000 description 51
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 46
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 42
- 230000002829 reductive effect Effects 0.000 description 42
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 40
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 36
- IJKVHSBPTUYDLN-UHFFFAOYSA-N dihydroxy(oxo)silane Chemical compound O[Si](O)=O IJKVHSBPTUYDLN-UHFFFAOYSA-N 0.000 description 36
- 239000000203 mixture Substances 0.000 description 36
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 34
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 33
- 239000003480 eluent Substances 0.000 description 33
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 33
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 32
- 238000004587 chromatography analysis Methods 0.000 description 29
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 26
- 239000012074 organic phase Substances 0.000 description 25
- 239000011541 reaction mixture Substances 0.000 description 25
- 239000012267 brine Substances 0.000 description 24
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 24
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 22
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 22
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 22
- 239000003921 oil Substances 0.000 description 22
- 235000019198 oils Nutrition 0.000 description 22
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 21
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 21
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 20
- 235000019341 magnesium sulphate Nutrition 0.000 description 20
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 20
- SFZULDYEOVSIKM-UHFFFAOYSA-N chembl321317 Chemical compound C1=CC(C(=N)NO)=CC=C1C1=CC=C(C=2C=CC(=CC=2)C(=N)NO)O1 SFZULDYEOVSIKM-UHFFFAOYSA-N 0.000 description 18
- 238000006243 chemical reaction Methods 0.000 description 17
- 239000000543 intermediate Substances 0.000 description 17
- 229910000027 potassium carbonate Inorganic materials 0.000 description 17
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Inorganic materials [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 17
- 239000012230 colorless oil Substances 0.000 description 16
- 235000011181 potassium carbonates Nutrition 0.000 description 16
- 238000002360 preparation method Methods 0.000 description 16
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 16
- 239000012442 inert solvent Substances 0.000 description 15
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 14
- WFYGXOWFEIOHCZ-UHFFFAOYSA-N 4-hydroxy-3,5-dimethylbenzonitrile Chemical compound CC1=CC(C#N)=CC(C)=C1O WFYGXOWFEIOHCZ-UHFFFAOYSA-N 0.000 description 13
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 13
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 12
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 12
- 150000004820 halides Chemical class 0.000 description 12
- 229910052783 alkali metal Inorganic materials 0.000 description 11
- 239000002585 base Substances 0.000 description 11
- CTAPFRYPJLPFDF-UHFFFAOYSA-N isoxazole Chemical compound C=1C=NOC=1 CTAPFRYPJLPFDF-UHFFFAOYSA-N 0.000 description 11
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 11
- 239000002904 solvent Substances 0.000 description 11
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 10
- 150000001340 alkali metals Chemical class 0.000 description 10
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 9
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 9
- 238000003756 stirring Methods 0.000 description 9
- GOJOHHBMSHTFRG-UHFFFAOYSA-N 5-(5-bromopentyl)-3-methyl-1,2-oxazole Chemical compound CC=1C=C(CCCCCBr)ON=1 GOJOHHBMSHTFRG-UHFFFAOYSA-N 0.000 description 8
- 150000008065 acid anhydrides Chemical group 0.000 description 8
- 239000000706 filtrate Substances 0.000 description 8
- CHZCERSEMVWNHL-UHFFFAOYSA-N 2-hydroxybenzonitrile Chemical compound OC1=CC=CC=C1C#N CHZCERSEMVWNHL-UHFFFAOYSA-N 0.000 description 7
- 239000000460 chlorine Substances 0.000 description 7
- 239000000284 extract Substances 0.000 description 7
- 150000002431 hydrogen Chemical class 0.000 description 7
- 230000002401 inhibitory effect Effects 0.000 description 7
- 230000008018 melting Effects 0.000 description 7
- 238000002844 melting Methods 0.000 description 7
- 239000000843 powder Substances 0.000 description 7
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 6
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- CSRZQMIRAZTJOY-UHFFFAOYSA-N trimethylsilyl iodide Chemical compound C[Si](C)(C)I CSRZQMIRAZTJOY-UHFFFAOYSA-N 0.000 description 6
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 6
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 5
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 5
- 239000008346 aqueous phase Substances 0.000 description 5
- 238000011065 in-situ storage Methods 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- 235000017557 sodium bicarbonate Nutrition 0.000 description 5
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 5
- 229910052938 sodium sulfate Inorganic materials 0.000 description 5
- 235000011152 sodium sulphate Nutrition 0.000 description 5
- FKHIFSZMMVMEQY-UHFFFAOYSA-N talc Chemical compound [Mg+2].[O-][Si]([O-])=O FKHIFSZMMVMEQY-UHFFFAOYSA-N 0.000 description 5
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 4
- VEUMBMHMMCOFAG-UHFFFAOYSA-N 2,3-dihydrooxadiazole Chemical compound N1NC=CO1 VEUMBMHMMCOFAG-UHFFFAOYSA-N 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 4
- CVNOWLNNPYYEOH-UHFFFAOYSA-N 4-cyanophenol Chemical compound OC1=CC=C(C#N)C=C1 CVNOWLNNPYYEOH-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 4
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 4
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 150000001335 aliphatic alkanes Chemical class 0.000 description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 4
- 229910052794 bromium Inorganic materials 0.000 description 4
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 239000013058 crude material Substances 0.000 description 4
- FAMRKDQNMBBFBR-BQYQJAHWSA-N diethyl azodicarboxylate Substances CCOC(=O)\N=N\C(=O)OCC FAMRKDQNMBBFBR-BQYQJAHWSA-N 0.000 description 4
- FAMRKDQNMBBFBR-UHFFFAOYSA-N ethyl n-ethoxycarbonyliminocarbamate Chemical compound CCOC(=O)N=NC(=O)OCC FAMRKDQNMBBFBR-UHFFFAOYSA-N 0.000 description 4
- 239000012065 filter cake Substances 0.000 description 4
- 150000007529 inorganic bases Chemical class 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 239000000741 silica gel Substances 0.000 description 4
- 229910002027 silica gel Inorganic materials 0.000 description 4
- 235000009518 sodium iodide Nutrition 0.000 description 4
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 3
- DHTGEEMLNWMWLC-UHFFFAOYSA-N 4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenol Chemical compound C1=CC(O)=CC=C1C1=NOC(C(F)(F)F)=N1 DHTGEEMLNWMWLC-UHFFFAOYSA-N 0.000 description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 241000700605 Viruses Species 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 3
- 125000004093 cyano group Chemical group *C#N 0.000 description 3
- ZOOSILUVXHVRJE-UHFFFAOYSA-N cyclopropanecarbonyl chloride Chemical compound ClC(=O)C1CC1 ZOOSILUVXHVRJE-UHFFFAOYSA-N 0.000 description 3
- 230000000120 cytopathologic effect Effects 0.000 description 3
- 238000005661 deetherification reaction Methods 0.000 description 3
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- MVCQUSKTBSVSRY-UHFFFAOYSA-N n-(2-methoxyethylidene)hydroxylamine Chemical compound COCC=NO MVCQUSKTBSVSRY-UHFFFAOYSA-N 0.000 description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 description 3
- 150000007530 organic bases Chemical class 0.000 description 3
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 3
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- FGTJJHCZWOVVNH-UHFFFAOYSA-N tert-butyl-[tert-butyl(dimethyl)silyl]oxy-dimethylsilane Chemical compound CC(C)(C)[Si](C)(C)O[Si](C)(C)C(C)(C)C FGTJJHCZWOVVNH-UHFFFAOYSA-N 0.000 description 3
- BCNZYOJHNLTNEZ-UHFFFAOYSA-N tert-butyldimethylsilyl chloride Chemical compound CC(C)(C)[Si](C)(C)Cl BCNZYOJHNLTNEZ-UHFFFAOYSA-N 0.000 description 3
- 238000010626 work up procedure Methods 0.000 description 3
- 125000006698 (C1-C3) dialkylamino group Chemical group 0.000 description 2
- 125000006699 (C1-C3) hydroxyalkyl group Chemical group 0.000 description 2
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 description 2
- IFDZZSXEPSSHNC-ONEGZZNKSA-N (ne)-n-propylidenehydroxylamine Chemical compound CC\C=N\O IFDZZSXEPSSHNC-ONEGZZNKSA-N 0.000 description 2
- 125000004509 1,3,4-oxadiazol-2-yl group Chemical group O1C(=NN=C1)* 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- YZWKKMVJZFACSU-UHFFFAOYSA-N 1-bromopentane Chemical compound CCCCCBr YZWKKMVJZFACSU-UHFFFAOYSA-N 0.000 description 2
- VADKRMSMGWJZCF-UHFFFAOYSA-N 2-bromophenol Chemical compound OC1=CC=CC=C1Br VADKRMSMGWJZCF-UHFFFAOYSA-N 0.000 description 2
- YRSSHOVRSMQULE-UHFFFAOYSA-N 3,5-dichloro-4-hydroxybenzonitrile Chemical compound OC1=C(Cl)C=C(C#N)C=C1Cl YRSSHOVRSMQULE-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical class [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- CWHYLHUGGLZUOI-UHFFFAOYSA-N CCOCC=NO Chemical compound CCOCC=NO CWHYLHUGGLZUOI-UHFFFAOYSA-N 0.000 description 2
- UJPOEFZIGXLDMP-UHFFFAOYSA-N COCCC=NO Chemical compound COCCC=NO UJPOEFZIGXLDMP-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical group ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- 241000709661 Enterovirus Species 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- 238000003820 Medium-pressure liquid chromatography Methods 0.000 description 2
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 229910001516 alkali metal iodide Inorganic materials 0.000 description 2
- 125000005236 alkanoylamino group Chemical group 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 150000001450 anions Chemical class 0.000 description 2
- 150000001649 bromium compounds Chemical group 0.000 description 2
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- JXTHNDFMNIQAHM-UHFFFAOYSA-N dichloroacetic acid Chemical compound OC(=O)C(Cl)Cl JXTHNDFMNIQAHM-UHFFFAOYSA-N 0.000 description 2
- 238000006266 etherification reaction Methods 0.000 description 2
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 2
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 150000002545 isoxazoles Chemical class 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- SNMVRZFUUCLYTO-UHFFFAOYSA-N n-propyl chloride Chemical compound CCCCl SNMVRZFUUCLYTO-UHFFFAOYSA-N 0.000 description 2
- 125000002524 organometallic group Chemical group 0.000 description 2
- WCPAKWJPBJAGKN-UHFFFAOYSA-N oxadiazole Chemical compound C1=CON=N1 WCPAKWJPBJAGKN-UHFFFAOYSA-N 0.000 description 2
- 150000002923 oximes Chemical class 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 125000004430 oxygen atom Chemical group O* 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 239000002798 polar solvent Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 230000002441 reversible effect Effects 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- 230000007017 scission Effects 0.000 description 2
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 2
- 238000010998 test method Methods 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 238000005809 transesterification reaction Methods 0.000 description 2
- 230000029812 viral genome replication Effects 0.000 description 2
- ALHZEIINTQJLOT-UHFFFAOYSA-N (1-chloro-1-oxopropan-2-yl) acetate Chemical compound ClC(=O)C(C)OC(C)=O ALHZEIINTQJLOT-UHFFFAOYSA-N 0.000 description 1
- RQHMQURGSQBBJY-UHFFFAOYSA-N (2,2-dichloroacetyl) 2,2-dichloroacetate Chemical compound ClC(Cl)C(=O)OC(=O)C(Cl)Cl RQHMQURGSQBBJY-UHFFFAOYSA-N 0.000 description 1
- HZDNNJABYXNPPV-UHFFFAOYSA-N (2-chloro-2-oxoethyl) acetate Chemical compound CC(=O)OCC(Cl)=O HZDNNJABYXNPPV-UHFFFAOYSA-N 0.000 description 1
- MDYHWQQHEWDJKR-UHFFFAOYSA-N (5-methyl-1,2-oxazol-3-yl)methanol Chemical compound CC1=CC(CO)=NO1 MDYHWQQHEWDJKR-UHFFFAOYSA-N 0.000 description 1
- 125000006559 (C1-C3) alkylamino group Chemical group 0.000 description 1
- FZENGILVLUJGJX-IHWYPQMZSA-N (Z)-acetaldehyde oxime Chemical compound C\C=N/O FZENGILVLUJGJX-IHWYPQMZSA-N 0.000 description 1
- XQDANBKPALOMEF-HYXAFXHYSA-N (nz)-n-(cyclopropylmethylidene)hydroxylamine Chemical compound O\N=C/C1CC1 XQDANBKPALOMEF-HYXAFXHYSA-N 0.000 description 1
- VNSJUZIHZNZLKM-UHFFFAOYSA-N 1,1,2-triethoxyethane Chemical compound CCOCC(OCC)OCC VNSJUZIHZNZLKM-UHFFFAOYSA-N 0.000 description 1
- FKZYYYDRLJCHGL-UHFFFAOYSA-N 1,1,3-trimethoxypropane Chemical compound COCCC(OC)OC FKZYYYDRLJCHGL-UHFFFAOYSA-N 0.000 description 1
- 125000004505 1,2,4-oxadiazol-5-yl group Chemical group O1N=CN=C1* 0.000 description 1
- BBVIDBNAYOIXOE-UHFFFAOYSA-N 1,2,4-oxadiazole Chemical group C=1N=CON=1 BBVIDBNAYOIXOE-UHFFFAOYSA-N 0.000 description 1
- 125000004066 1-hydroxyethyl group Chemical group [H]OC([H])([*])C([H])([H])[H] 0.000 description 1
- AVFZOVWCLRSYKC-UHFFFAOYSA-N 1-methylpyrrolidine Chemical compound CN1CCCC1 AVFZOVWCLRSYKC-UHFFFAOYSA-N 0.000 description 1
- WRGQAWAVRAVFMC-UHFFFAOYSA-N 2,6-dichloro-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenol Chemical compound C1=C(Cl)C(O)=C(Cl)C=C1C1=NOC(C(F)(F)F)=N1 WRGQAWAVRAVFMC-UHFFFAOYSA-N 0.000 description 1
- ITUYVBZOLSFUNQ-UHFFFAOYSA-N 2,6-dimethyl-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenol Chemical compound CC1=C(O)C(C)=CC(C=2N=C(ON=2)C(F)(F)F)=C1 ITUYVBZOLSFUNQ-UHFFFAOYSA-N 0.000 description 1
- FNORQWNVAYJADI-UHFFFAOYSA-N 2-(2,2,2-trifluoroethylidene)-1,3-dithiane Chemical compound FC(F)(F)C=C1SCCCS1 FNORQWNVAYJADI-UHFFFAOYSA-N 0.000 description 1
- LLVRUWOQQUDNTN-UHFFFAOYSA-N 2-(2-hydroxyethyl)-1,2-oxazol-3-one Chemical class OCCN1OC=CC1=O LLVRUWOQQUDNTN-UHFFFAOYSA-N 0.000 description 1
- LDLCZOVUSADOIV-UHFFFAOYSA-N 2-bromoethanol Chemical compound OCCBr LDLCZOVUSADOIV-UHFFFAOYSA-N 0.000 description 1
- JVDWMKGGFJXAKU-UHFFFAOYSA-N 2-ethyl-1,2-oxazol-3-one Chemical class CCN1OC=CC1=O JVDWMKGGFJXAKU-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- JJKWHOSQTYYFAE-UHFFFAOYSA-N 2-methoxyacetyl chloride Chemical compound COCC(Cl)=O JJKWHOSQTYYFAE-UHFFFAOYSA-N 0.000 description 1
- GUGQQGROXHPINL-UHFFFAOYSA-N 2-oxobutanoyl chloride Chemical compound CCC(=O)C(Cl)=O GUGQQGROXHPINL-UHFFFAOYSA-N 0.000 description 1
- JTNCEQNHURODLX-UHFFFAOYSA-N 2-phenylethanimidamide Chemical compound NC(=N)CC1=CC=CC=C1 JTNCEQNHURODLX-UHFFFAOYSA-N 0.000 description 1
- BCHZICNRHXRCHY-UHFFFAOYSA-N 2h-oxazine Chemical group N1OC=CC=C1 BCHZICNRHXRCHY-UHFFFAOYSA-N 0.000 description 1
- UATOHANEKRDUEU-UHFFFAOYSA-N 3,5-dichloro-N',4-dihydroxybenzenecarboximidamide Chemical compound ONC(=N)C1=CC(Cl)=C(O)C(Cl)=C1 UATOHANEKRDUEU-UHFFFAOYSA-N 0.000 description 1
- DIBNDOHJBRQSCI-UHFFFAOYSA-N 3,5-dichloro-n'-hydroxy-4-[3-(3-methyl-1,2-oxazol-5-yl)propoxy]benzenecarboximidamide Chemical compound O1N=C(C)C=C1CCCOC1=C(Cl)C=C(C(=N)NO)C=C1Cl DIBNDOHJBRQSCI-UHFFFAOYSA-N 0.000 description 1
- XZNZJDPPWWFJAL-UHFFFAOYSA-N 3,5-difluoro-4-hydroxybenzonitrile Chemical compound OC1=C(F)C=C(C#N)C=C1F XZNZJDPPWWFJAL-UHFFFAOYSA-N 0.000 description 1
- MESTWHQPIKZYGS-UHFFFAOYSA-N 3,5-difluoro-n'-hydroxy-4-[3-(3-methyl-1,2-oxazol-5-yl)propoxy]benzenecarboximidamide Chemical compound O1N=C(C)C=C1CCCOC1=C(F)C=C(C(=N)NO)C=C1F MESTWHQPIKZYGS-UHFFFAOYSA-N 0.000 description 1
- YCCZNNXPXVCFDY-UHFFFAOYSA-N 3,5-dimethoxy-4-[3-(3-methyl-1,2-oxazol-5-yl)propoxy]benzonitrile Chemical compound COC1=CC(C#N)=CC(OC)=C1OCCCC1=CC(C)=NO1 YCCZNNXPXVCFDY-UHFFFAOYSA-N 0.000 description 1
- FICAQKBMCKEFDI-UHFFFAOYSA-N 3,5-dimethyl-1,2-oxazole Chemical compound CC=1C=C(C)ON=1 FICAQKBMCKEFDI-UHFFFAOYSA-N 0.000 description 1
- NTPDIYPZAUXUOM-UHFFFAOYSA-N 3,5-dimethyl-4-[3-(3-methyl-1,2-oxazol-5-yl)propoxy]benzonitrile Chemical compound O1N=C(C)C=C1CCCOC1=C(C)C=C(C#N)C=C1C NTPDIYPZAUXUOM-UHFFFAOYSA-N 0.000 description 1
- JSPQWKCZMWGODU-UHFFFAOYSA-N 3,5-dimethyl-4-pent-4-ynoxybenzonitrile Chemical compound CC1=CC(C#N)=CC(C)=C1OCCCC#C JSPQWKCZMWGODU-UHFFFAOYSA-N 0.000 description 1
- MSQCYRITZVTNLF-UHFFFAOYSA-N 3,5-dimethyl-4-undec-10-ynoxybenzonitrile Chemical compound CC1=CC(C#N)=CC(C)=C1OCCCCCCCCCC#C MSQCYRITZVTNLF-UHFFFAOYSA-N 0.000 description 1
- CTCMNWHSBFPDIT-UHFFFAOYSA-N 3-(3,5-dimethyl-4-undec-10-ynoxyphenyl)-5-(trifluoromethyl)-1,2,4-oxadiazole Chemical compound CC1=C(OCCCCCCCCCC#C)C(C)=CC(C=2N=C(ON=2)C(F)(F)F)=C1 CTCMNWHSBFPDIT-UHFFFAOYSA-N 0.000 description 1
- WLKCJYLGRDETLU-UHFFFAOYSA-N 3-(3-methyl-1,2-oxazol-5-yl)propan-1-ol Chemical compound CC=1C=C(CCCO)ON=1 WLKCJYLGRDETLU-UHFFFAOYSA-N 0.000 description 1
- SZBWMRSPUSHQLU-UHFFFAOYSA-N 3-(ethoxymethyl)-1,2-oxazole Chemical compound CCOCC=1C=CON=1 SZBWMRSPUSHQLU-UHFFFAOYSA-N 0.000 description 1
- LALOXWWHWXJFAM-UHFFFAOYSA-N 3-(methoxymethyl)-1,2-oxazole Chemical compound COCC=1C=CON=1 LALOXWWHWXJFAM-UHFFFAOYSA-N 0.000 description 1
- BFAKEDSNWOYSGK-UHFFFAOYSA-N 3-methyl-4-propyl-1,2-oxazole Chemical compound CCCC1=CON=C1C BFAKEDSNWOYSGK-UHFFFAOYSA-N 0.000 description 1
- CNDMLQPWXMOIBB-UHFFFAOYSA-N 3-pentyl-1,2-oxazole Chemical compound CCCCCC=1C=CON=1 CNDMLQPWXMOIBB-UHFFFAOYSA-N 0.000 description 1
- KPNBGEKVOBNLDU-UHFFFAOYSA-N 4-[3-(3-methyl-1,2-oxazol-5-yl)propoxy]-3-(trifluoromethyl)benzonitrile Chemical compound O1N=C(C)C=C1CCCOC1=CC=C(C#N)C=C1C(F)(F)F KPNBGEKVOBNLDU-UHFFFAOYSA-N 0.000 description 1
- HGAQCFRNWHBAHW-UHFFFAOYSA-N 4-[3-(3-methyl-1,2-oxazol-5-yl)propoxy]-3-nitrobenzonitrile Chemical compound O1N=C(C)C=C1CCCOC1=CC=C(C#N)C=C1[N+]([O-])=O HGAQCFRNWHBAHW-UHFFFAOYSA-N 0.000 description 1
- GPRPSJPFAAGLCA-UHFFFAOYSA-N 4-bromo-2,6-difluorophenol Chemical compound OC1=C(F)C=C(Br)C=C1F GPRPSJPFAAGLCA-UHFFFAOYSA-N 0.000 description 1
- JKPLQGXXESDJLY-UHFFFAOYSA-N 4-hydroxy-3,5-dimethoxybenzonitrile Chemical compound COC1=CC(C#N)=CC(OC)=C1O JKPLQGXXESDJLY-UHFFFAOYSA-N 0.000 description 1
- QXIFYONUKBXFTH-UHFFFAOYSA-N 4-hydroxy-3-(trifluoromethyl)benzonitrile Chemical compound OC1=CC=C(C#N)C=C1C(F)(F)F QXIFYONUKBXFTH-UHFFFAOYSA-N 0.000 description 1
- INBLGVOPOSGVTA-UHFFFAOYSA-N 4-hydroxy-3-nitrobenzonitrile Chemical compound OC1=CC=C(C#N)C=C1[N+]([O-])=O INBLGVOPOSGVTA-UHFFFAOYSA-N 0.000 description 1
- 125000000590 4-methylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 1
- WKCCXMQDJNSMOT-UHFFFAOYSA-N 5-(3-chloropropyl)-3-methyl-1,2-oxazole Chemical compound CC=1C=C(CCCCl)ON=1 WKCCXMQDJNSMOT-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- DKRJIESUHKYBBO-UHFFFAOYSA-N CC1=C(OCCCC#C)C(C)=CC(C=2N=C(ON=2)C(F)(F)F)=C1 Chemical compound CC1=C(OCCCC#C)C(C)=CC(C=2N=C(ON=2)C(F)(F)F)=C1 DKRJIESUHKYBBO-UHFFFAOYSA-N 0.000 description 1
- FVWKKAHZQDUAGF-UHFFFAOYSA-N CC1=C(OCCCC#C)C(C)=CC(C=2N=C(ON=2)C2CC2)=C1 Chemical compound CC1=C(OCCCC#C)C(C)=CC(C=2N=C(ON=2)C2CC2)=C1 FVWKKAHZQDUAGF-UHFFFAOYSA-N 0.000 description 1
- 101150074884 CNX1 gene Proteins 0.000 description 1
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical group FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 1
- SXRSQZLOMIGNAQ-UHFFFAOYSA-N Glutaraldehyde Chemical compound O=CCCCC=O SXRSQZLOMIGNAQ-UHFFFAOYSA-N 0.000 description 1
- 241000710124 Human rhinovirus A2 Species 0.000 description 1
- 241000430519 Human rhinovirus sp. Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- LGSHQFVAOQWNAS-UHFFFAOYSA-N N',4-dihydroxy-3,5-dimethylbenzenecarboximidamide Chemical compound CC1=CC(C(N)=NO)=CC(C)=C1O LGSHQFVAOQWNAS-UHFFFAOYSA-N 0.000 description 1
- YJFXWNSNMVKGNA-UHFFFAOYSA-N N',4-dihydroxybenzenecarboximidamide Chemical compound ON=C(N)C1=CC=C(O)C=C1 YJFXWNSNMVKGNA-UHFFFAOYSA-N 0.000 description 1
- TYTSXHXBMJXBAJ-UHFFFAOYSA-N N'-hydroxy-3,5-dimethyl-4-pent-4-ynoxybenzenecarboximidamide Chemical compound CC1=CC(C(\N)=N\O)=CC(C)=C1OCCCC#C TYTSXHXBMJXBAJ-UHFFFAOYSA-N 0.000 description 1
- AHVYPIQETPWLSZ-UHFFFAOYSA-N N-methyl-pyrrolidine Natural products CN1CC=CC1 AHVYPIQETPWLSZ-UHFFFAOYSA-N 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- 235000019502 Orange oil Nutrition 0.000 description 1
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 150000005215 alkyl ethers Chemical class 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 238000002832 anti-viral assay Methods 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 238000012925 biological evaluation Methods 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 125000001589 carboacyl group Chemical group 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000002738 chelating agent Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 238000011097 chromatography purification Methods 0.000 description 1
- 239000007822 coupling agent Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000007821 culture assay Methods 0.000 description 1
- ATDGTVJJHBUTRL-UHFFFAOYSA-N cyanogen bromide Chemical compound BrC#N ATDGTVJJHBUTRL-UHFFFAOYSA-N 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- RVOJTCZRIKWHDX-UHFFFAOYSA-N cyclohexanecarbonyl chloride Chemical compound ClC(=O)C1CCCCC1 RVOJTCZRIKWHDX-UHFFFAOYSA-N 0.000 description 1
- ZHGASCUQXLPSDT-UHFFFAOYSA-M cyclohexanesulfonate Chemical compound [O-]S(=O)(=O)C1CCCCC1 ZHGASCUQXLPSDT-UHFFFAOYSA-M 0.000 description 1
- 125000004956 cyclohexylene group Chemical group 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 229960005215 dichloroacetic acid Drugs 0.000 description 1
- PBWZKZYHONABLN-UHFFFAOYSA-N difluoroacetic acid Chemical compound OC(=O)C(F)F PBWZKZYHONABLN-UHFFFAOYSA-N 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- MOTZDAYCYVMXPC-UHFFFAOYSA-N dodecyl hydrogen sulfate Chemical compound CCCCCCCCCCCCOS(O)(=O)=O MOTZDAYCYVMXPC-UHFFFAOYSA-N 0.000 description 1
- 229940043264 dodecyl sulfate Drugs 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- CCGKOQOJPYTBIH-UHFFFAOYSA-N ethenone Chemical compound C=C=O CCGKOQOJPYTBIH-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000003818 flash chromatography Methods 0.000 description 1
- ZBHDTYQJAQDBIH-UHFFFAOYSA-N fluoroacetyl chloride Chemical compound FCC(Cl)=O ZBHDTYQJAQDBIH-UHFFFAOYSA-N 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 150000002440 hydroxy compounds Chemical class 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 238000010255 intramuscular injection Methods 0.000 description 1
- 239000007927 intramuscular injection Substances 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- JMMWKPVZQRWMSS-UHFFFAOYSA-N isopropanol acetate Natural products CC(C)OC(C)=O JMMWKPVZQRWMSS-UHFFFAOYSA-N 0.000 description 1
- 229940011051 isopropyl acetate Drugs 0.000 description 1
- GWYFCOCPABKNJV-UHFFFAOYSA-N isovaleric acid Chemical compound CC(C)CC(O)=O GWYFCOCPABKNJV-UHFFFAOYSA-N 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
- JIEUKMVJOSIQLJ-UHFFFAOYSA-N n'-hydroxy-3,5-dimethoxy-4-[3-(3-methyl-1,2-oxazol-5-yl)propoxy]benzenecarboximidamide Chemical compound COC1=CC(C(=N)NO)=CC(OC)=C1OCCCC1=CC(C)=NO1 JIEUKMVJOSIQLJ-UHFFFAOYSA-N 0.000 description 1
- SOZGCLLJFRRECG-UHFFFAOYSA-N n'-hydroxy-3,5-dimethyl-4-[3-(3-methyl-1,2-oxazol-5-yl)propoxy]benzenecarboximidamide Chemical compound O1N=C(C)C=C1CCCOC1=C(C)C=C(C(=N)NO)C=C1C SOZGCLLJFRRECG-UHFFFAOYSA-N 0.000 description 1
- ASUAYLAZQFOQBX-UHFFFAOYSA-N n'-hydroxy-4-[3-(3-methyl-1,2-oxazol-5-yl)propoxy]-3-(trifluoromethyl)benzenecarboximidamide Chemical compound O1N=C(C)C=C1CCCOC1=CC=C(C(N)=NO)C=C1C(F)(F)F ASUAYLAZQFOQBX-UHFFFAOYSA-N 0.000 description 1
- LQQSWYVZJASQGN-UHFFFAOYSA-N n'-hydroxy-4-[3-(3-methyl-1,2-oxazol-5-yl)propoxy]-3-nitrobenzenecarboximidamide Chemical compound O1N=C(C)C=C1CCCOC1=CC=C(C(\N)=N\O)C=C1[N+]([O-])=O LQQSWYVZJASQGN-UHFFFAOYSA-N 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000010502 orange oil Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 150000002902 organometallic compounds Chemical class 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 238000005192 partition Methods 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- 229910000343 potassium bisulfate Inorganic materials 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- KZJPVUDYAMEDRM-UHFFFAOYSA-M silver;2,2,2-trifluoroacetate Chemical compound [Ag+].[O-]C(=O)C(F)(F)F KZJPVUDYAMEDRM-UHFFFAOYSA-M 0.000 description 1
- WBHQBSYUUJJSRZ-UHFFFAOYSA-M sodium bisulfate Chemical compound [Na+].OS([O-])(=O)=O WBHQBSYUUJJSRZ-UHFFFAOYSA-M 0.000 description 1
- 229910000342 sodium bisulfate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 238000007711 solidification Methods 0.000 description 1
- 230000008023 solidification Effects 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- RABAVWHHTGIPHO-UHFFFAOYSA-N tert-butyl-dimethyl-[(5-methyl-1,2-oxazol-3-yl)methoxy]silane Chemical compound CC1=CC(CO[Si](C)(C)C(C)(C)C)=NO1 RABAVWHHTGIPHO-UHFFFAOYSA-N 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- PVFOMCVHYWHZJE-UHFFFAOYSA-N trichloroacetyl chloride Chemical compound ClC(=O)C(Cl)(Cl)Cl PVFOMCVHYWHZJE-UHFFFAOYSA-N 0.000 description 1
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 1
- FIQMHBFVRAXMOP-UHFFFAOYSA-N triphenylphosphane oxide Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)(=O)C1=CC=CC=C1 FIQMHBFVRAXMOP-UHFFFAOYSA-N 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 229910052727 yttrium Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/10—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings linked by a carbon chain containing aromatic rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/12—Antivirals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing three or more hetero rings
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Oncology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Virology (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Communicable Diseases (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US07/869,287 US5349068A (en) | 1992-04-15 | 1992-04-15 | 1,2,4-oxadiazolyl-phenoxyalkylisoxazoles and their use as antiviral agents |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| CZ59793A3 CZ59793A3 (en) | 1994-02-16 |
| CZ285845B6 true CZ285845B6 (cs) | 1999-11-17 |
Family
ID=25353269
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CZ93597A CZ285845B6 (cs) | 1992-04-15 | 1993-04-07 | 1,2,4-Oxadiazolylfenoxyalkylisoxazoly a jejich použití jako protivirových prostředků |
Country Status (26)
| Country | Link |
|---|---|
| US (3) | US5349068A (forum.php) |
| EP (1) | EP0566199B1 (forum.php) |
| JP (1) | JP3103845B2 (forum.php) |
| KR (1) | KR100314158B1 (forum.php) |
| AT (1) | ATE189958T1 (forum.php) |
| AU (1) | AU666528B2 (forum.php) |
| CA (1) | CA2094012C (forum.php) |
| CZ (1) | CZ285845B6 (forum.php) |
| DE (1) | DE69327913T2 (forum.php) |
| DK (1) | DK0566199T3 (forum.php) |
| ES (1) | ES2143487T3 (forum.php) |
| FI (1) | FI112229B (forum.php) |
| GR (1) | GR3033486T3 (forum.php) |
| HU (2) | HU220606B1 (forum.php) |
| IL (1) | IL105372A (forum.php) |
| MX (1) | MX9302169A (forum.php) |
| MY (1) | MY110191A (forum.php) |
| NO (1) | NO302700B1 (forum.php) |
| NZ (1) | NZ247411A (forum.php) |
| PH (1) | PH30454A (forum.php) |
| PT (1) | PT566199E (forum.php) |
| RU (1) | RU2114112C1 (forum.php) |
| SG (1) | SG50663A1 (forum.php) |
| SK (1) | SK279786B6 (forum.php) |
| TW (1) | TW239140B (forum.php) |
| UA (1) | UA35557C2 (forum.php) |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5349068A (en) * | 1992-04-15 | 1994-09-20 | Sterling Winthrop Inc. | 1,2,4-oxadiazolyl-phenoxyalkylisoxazoles and their use as antiviral agents |
| US5552420A (en) * | 1994-05-13 | 1996-09-03 | Sterling Winthrop Inc. | Therapeutic phenoxyalkylazoles and phenoxyalkylazines |
| IL118657A0 (en) * | 1996-06-14 | 1996-10-16 | Arad Dorit | Inhibitors for picornavirus proteases |
| IL122591A0 (en) | 1997-12-14 | 1998-06-15 | Arad Dorit | Pharmaceutical compositions comprising cystein protease inhibitors |
| US6528652B1 (en) * | 1999-01-21 | 2003-03-04 | Chronimed | Composition and device for detecting leukocytes in urine |
| US6348324B1 (en) | 1999-01-21 | 2002-02-19 | Hypoguard America Limited | Composition and device for detecting leukocytes in urine |
| AUPQ105499A0 (en) | 1999-06-18 | 1999-07-08 | Biota Scientific Management Pty Ltd | Antiviral agents |
| AUPR213700A0 (en) * | 2000-12-18 | 2001-01-25 | Biota Scientific Management Pty Ltd | Antiviral agents |
| CN1638776A (zh) * | 2001-06-08 | 2005-07-13 | 西托维亚公司 | 取代的3-芳基-5-芳基-[1,2,4]-噁二唑和类似物 |
| US7129359B2 (en) | 2002-07-09 | 2006-10-31 | National Health Research Institutes | Imidazolidinone compounds |
| WO2003020270A1 (en) * | 2001-08-29 | 2003-03-13 | Viropharma Incorporated | Oxadiazolyl-phenoxyalkylisoxazoles, compositions thereof and methods for their use as anti-picornaviral agents |
| US7429606B2 (en) * | 2001-08-29 | 2008-09-30 | Viropharma Incorporated | Oxadiazolyl-phenoxyalkylisoxazoles, compositions thereof and methods for their use as anti-picornaviral agents |
| DK2193792T3 (da) * | 2001-12-07 | 2012-01-02 | Ana Maria Sandino | Neomycin til forøgelse af overlevelsesraten for vandlevende dyr, der udsættes for IPNV |
| WO2003068222A1 (en) * | 2002-02-14 | 2003-08-21 | Viropharma Incorporated | Methods of reducing rhinovirus contagion and related compositions |
| CN100364531C (zh) * | 2002-12-18 | 2008-01-30 | 西托维亚公司 | 3,5-二取代-[1,2,4]-二唑及类似物和其用途 |
| US7259174B2 (en) * | 2004-05-25 | 2007-08-21 | National Health Research Institutes | Imidazolidinone compounds |
| JP2008509143A (ja) * | 2004-08-04 | 2008-03-27 | シェーリング コーポレイション | 気道疾患の処置のためのプレコナリルを含む薬学的処方物 |
| CA2641604A1 (en) * | 2006-02-09 | 2007-08-23 | Schering Corporation | Pharmaceutical formulations |
| WO2007095043A2 (en) * | 2006-02-09 | 2007-08-23 | Schering Corporation | Pharmaceutical formulations |
| AR059357A1 (es) * | 2006-02-09 | 2008-03-26 | Schering Corp | Formulaciones farmaceuticas |
| JP5415957B2 (ja) | 2006-12-13 | 2014-02-12 | エフ.ホフマン−ラ ロシュ アーゲー | 非ヌクレオシド逆転写酵素阻害剤としての2−(ピペリジン−4−イル)−4−フェノキシ−又はフェニルアミノ−ピリミジン誘導体 |
| KR101031584B1 (ko) * | 2009-04-21 | 2011-04-27 | 파인오토시스템(주) | 전면부가 개폐되는 차량용 적외선 조사장치 |
| CN103102322B (zh) * | 2011-11-14 | 2016-02-24 | 上海交通大学 | 噁唑类化合物及其制备方法、药物组合物及其用途 |
| CN112752761B (zh) | 2018-08-21 | 2024-03-29 | 杏林制药株式会社 | 双环杂芳族环衍生物 |
| EP4025212B8 (en) * | 2019-09-27 | 2025-04-16 | Collaborations Pharmaceuticals, Inc. | Isoxazole-3-carboxamide derivatives and their use for treatment of diseases caused by virus infection |
| US20230218644A1 (en) | 2020-04-16 | 2023-07-13 | Som Innovation Biotech, S.A. | Compounds for use in the treatment of viral infections by respiratory syndrome-related coronavirus |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4843087A (en) * | 1983-08-29 | 1989-06-27 | Sterling Drug Inc. | Di-heterocyclic compounds and their use as antiviral agents |
| US4861791A (en) * | 1983-08-29 | 1989-08-29 | Sterling Drug Inc. | Dihydro-oxazolyl substituted-phenyl-aliphatic lower alkyl and their use as antiviral agents |
| ZA846525B (en) * | 1983-08-29 | 1985-04-24 | Sterling Drug Inc | (substituted)phenyl-aliphatic-isoxazoles useful as antiviral agents and preparation thereof |
| CA1299176C (en) * | 1985-07-02 | 1992-04-21 | Guy Dominic Diana | Process for preparing isoxazole and furan derivatives |
| GB8619433D0 (en) * | 1986-08-08 | 1986-09-17 | Lilly Industries Ltd | Pharmaceutical compounds |
| US4942241A (en) * | 1989-08-21 | 1990-07-17 | Sterling Drug Inc. | 1,2,4-oxadiazolyl-phenoxyalkylisoxazoles and their use as antiviral agents |
| NZ234760A (en) * | 1989-08-18 | 1991-09-25 | Sterling Drug Inc | Antiviral oxazole compounds and compositions |
| US5175178A (en) * | 1989-08-21 | 1992-12-29 | Sterling Drug Inc. | 1,2,4-oxadiazolyl-phenoxyalkylisoxazoles and their use as antiviral agents |
| US4945164A (en) * | 1989-08-18 | 1990-07-31 | Sterling Drug Inc. | 1,3,4-Oxadiazolyl-phenoxyalkylisoxazoles and their use as antiviral agents and intermediates thereof |
| US5175177A (en) * | 1991-07-17 | 1992-12-29 | Sterling Drug Inc. | 1,2,4-oxadiazolyl-phenoxyalkylisoxazoles and their use as antiviral agents |
| US5349068A (en) * | 1992-04-15 | 1994-09-20 | Sterling Winthrop Inc. | 1,2,4-oxadiazolyl-phenoxyalkylisoxazoles and their use as antiviral agents |
-
1992
- 1992-04-15 US US07/869,287 patent/US5349068A/en not_active Expired - Lifetime
-
1993
- 1993-03-31 TW TW082102383A patent/TW239140B/zh not_active IP Right Cessation
- 1993-04-07 CZ CZ93597A patent/CZ285845B6/cs not_active IP Right Cessation
- 1993-04-10 MY MYPI93000665A patent/MY110191A/en unknown
- 1993-04-13 ES ES93201058T patent/ES2143487T3/es not_active Expired - Lifetime
- 1993-04-13 DE DE69327913T patent/DE69327913T2/de not_active Expired - Lifetime
- 1993-04-13 SG SG1996008085A patent/SG50663A1/en unknown
- 1993-04-13 EP EP93201058A patent/EP0566199B1/en not_active Expired - Lifetime
- 1993-04-13 AT AT93201058T patent/ATE189958T1/de active
- 1993-04-13 PT PT93201058T patent/PT566199E/pt unknown
- 1993-04-13 DK DK93201058T patent/DK0566199T3/da active
- 1993-04-14 NO NO19931366A patent/NO302700B1/no not_active IP Right Cessation
- 1993-04-14 IL IL10537293A patent/IL105372A/en not_active IP Right Cessation
- 1993-04-14 KR KR1019930006244A patent/KR100314158B1/ko not_active Expired - Lifetime
- 1993-04-14 RU RU93004675A patent/RU2114112C1/ru active
- 1993-04-14 PH PH46044A patent/PH30454A/en unknown
- 1993-04-14 MX MX9302169A patent/MX9302169A/es unknown
- 1993-04-14 HU HU9301084A patent/HU220606B1/hu unknown
- 1993-04-14 AU AU36881/93A patent/AU666528B2/en not_active Expired
- 1993-04-14 CA CA002094012A patent/CA2094012C/en not_active Expired - Lifetime
- 1993-04-15 SK SK353-93A patent/SK279786B6/sk not_active IP Right Cessation
- 1993-04-15 NZ NZ247411A patent/NZ247411A/en not_active IP Right Cessation
- 1993-04-15 FI FI931707A patent/FI112229B/fi not_active IP Right Cessation
- 1993-04-15 JP JP05088647A patent/JP3103845B2/ja not_active Expired - Lifetime
- 1993-06-15 UA UA93003099A patent/UA35557C2/uk unknown
- 1993-10-01 US US08/131,050 patent/US5464848A/en not_active Expired - Lifetime
-
1995
- 1995-05-19 US US08/444,795 patent/US5643929A/en not_active Expired - Lifetime
- 1995-06-30 HU HU95P/P00642P patent/HU211320A9/hu unknown
-
2000
- 2000-05-24 GR GR20000401183T patent/GR3033486T3/el unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CZ285845B6 (cs) | 1,2,4-Oxadiazolylfenoxyalkylisoxazoly a jejich použití jako protivirových prostředků | |
| JP2024178242A (ja) | Hmox1誘導物質 | |
| KR20130036171A (ko) | 트리시클릭 헤테로시클릭 화합물 | |
| IE59755B1 (en) | Isoxazole and furan derivatives, their preparation and use as antiviral agents | |
| US4843087A (en) | Di-heterocyclic compounds and their use as antiviral agents | |
| EP0137242A2 (en) | (Substituted) Phenyl-aliphatic-isoxazoles useful as antiviral agents and preparation thereof | |
| WO2013164773A1 (en) | Substituted pyrazole compounds as crac modulators | |
| US4939267A (en) | Haloalkoxy phenyl 4,5 dihydro oxazoles | |
| US4942241A (en) | 1,2,4-oxadiazolyl-phenoxyalkylisoxazoles and their use as antiviral agents | |
| US5846986A (en) | Therapeutic phenoxyalkylazoles and phenoxyalkylazines | |
| US4945164A (en) | 1,3,4-Oxadiazolyl-phenoxyalkylisoxazoles and their use as antiviral agents and intermediates thereof | |
| US5175178A (en) | 1,2,4-oxadiazolyl-phenoxyalkylisoxazoles and their use as antiviral agents | |
| AU660024B2 (en) | 1,2,4-oxadiazolyl-phenoxyalkylisoxazoles and their use as antiviral agents | |
| KR100197853B1 (ko) | 옥사디아졸릴-페녹시알킬 이속사졸, 이들의 제조방법 및 이를 함유하는 항비루스제로서 유용한 조성물 | |
| US5002960A (en) | N-haloalkyl-4-(isoxazol-5-yl)alkoxy benzamides | |
| US5110821A (en) | 1,3,4-oxadiazolyl-phenoxyalkylisoxazoles and their use as antiviral agents | |
| JP2002020384A (ja) | ベンゾオキサゾール誘導体,その製法及び除草剤 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| IF00 | In force as of 2000-06-30 in czech republic | ||
| MK4A | Patent expired |
Effective date: 20130407 |