CZ230593A3 - Liquid detergents with arylboric acid - Google Patents
Liquid detergents with arylboric acid Download PDFInfo
- Publication number
- CZ230593A3 CZ230593A3 CS932305A CS230593A CZ230593A3 CZ 230593 A3 CZ230593 A3 CZ 230593A3 CS 932305 A CS932305 A CS 932305A CS 230593 A CS230593 A CS 230593A CZ 230593 A3 CZ230593 A3 CZ 230593A3
- Authority
- CZ
- Czechia
- Prior art keywords
- acid
- alkyl
- amine
- derivative
- weight
- Prior art date
Links
- 239000003599 detergent Substances 0.000 title claims abstract description 88
- 239000007788 liquid Substances 0.000 title claims abstract description 55
- 239000002253 acid Substances 0.000 title claims abstract description 43
- 239000000203 mixture Substances 0.000 claims abstract description 142
- 108091005804 Peptidases Proteins 0.000 claims abstract description 72
- 102000035195 Peptidases Human genes 0.000 claims abstract description 70
- 150000001412 amines Chemical class 0.000 claims abstract description 56
- 102000004190 Enzymes Human genes 0.000 claims abstract description 49
- 108090000790 Enzymes Proteins 0.000 claims abstract description 49
- 239000004094 surface-active agent Substances 0.000 claims abstract description 37
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 35
- 150000003839 salts Chemical class 0.000 claims abstract description 32
- 150000001543 aryl boronic acids Chemical class 0.000 claims abstract description 26
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 23
- 239000001257 hydrogen Substances 0.000 claims abstract description 22
- 150000003573 thiols Chemical class 0.000 claims abstract description 22
- 125000003118 aryl group Chemical group 0.000 claims abstract description 17
- 150000002148 esters Chemical class 0.000 claims abstract description 12
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 11
- 150000002367 halogens Chemical class 0.000 claims abstract description 11
- 125000000449 nitro group Chemical class [O-][N+](*)=O 0.000 claims abstract description 11
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 claims abstract description 11
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 claims abstract description 11
- 150000002431 hydrogen Chemical class 0.000 claims abstract description 10
- 125000003107 substituted aryl group Chemical group 0.000 claims abstract description 10
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 claims abstract 4
- 125000000217 alkyl group Chemical group 0.000 claims description 58
- -1 nonionic Chemical group 0.000 claims description 52
- 229940088598 enzyme Drugs 0.000 claims description 48
- 102000004882 Lipase Human genes 0.000 claims description 47
- 108090001060 Lipase Proteins 0.000 claims description 47
- 239000004367 Lipase Substances 0.000 claims description 47
- 235000019421 lipase Nutrition 0.000 claims description 47
- 239000004365 Protease Substances 0.000 claims description 25
- 150000001875 compounds Chemical class 0.000 claims description 21
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 21
- 239000003795 chemical substances by application Substances 0.000 claims description 20
- 229920005646 polycarboxylate Polymers 0.000 claims description 17
- 239000000194 fatty acid Substances 0.000 claims description 16
- 150000004665 fatty acids Chemical class 0.000 claims description 16
- 239000002689 soil Substances 0.000 claims description 16
- 235000014113 dietary fatty acids Nutrition 0.000 claims description 14
- 229930195729 fatty acid Natural products 0.000 claims description 14
- 239000003945 anionic surfactant Substances 0.000 claims description 13
- 239000004615 ingredient Substances 0.000 claims description 13
- 108010065511 Amylases Proteins 0.000 claims description 12
- 102000013142 Amylases Human genes 0.000 claims description 12
- 235000019418 amylase Nutrition 0.000 claims description 12
- 239000004382 Amylase Substances 0.000 claims description 11
- 108010059892 Cellulase Proteins 0.000 claims description 11
- 229940106157 cellulase Drugs 0.000 claims description 10
- 239000002736 nonionic surfactant Substances 0.000 claims description 10
- 238000004140 cleaning Methods 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 9
- 125000000129 anionic group Chemical group 0.000 claims description 6
- 108090000623 proteins and genes Proteins 0.000 claims description 6
- MTCFGRXMJLQNBG-UHFFFAOYSA-N Serine Natural products OCC(N)C(O)=O MTCFGRXMJLQNBG-UHFFFAOYSA-N 0.000 claims description 5
- 150000008051 alkyl sulfates Chemical class 0.000 claims description 5
- 108010020132 microbial serine proteinases Proteins 0.000 claims description 5
- 239000000758 substrate Substances 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 101710180012 Protease 7 Proteins 0.000 claims description 3
- 241000223258 Thermomyces lanuginosus Species 0.000 claims description 3
- 125000002091 cationic group Chemical group 0.000 claims description 3
- 238000010367 cloning Methods 0.000 claims description 2
- 230000002708 enhancing effect Effects 0.000 claims description 2
- SFDJOSRHYKHMOK-UHFFFAOYSA-N nitramide Chemical class N[N+]([O-])=O SFDJOSRHYKHMOK-UHFFFAOYSA-N 0.000 claims description 2
- 102100037486 Reverse transcriptase/ribonuclease H Human genes 0.000 claims 2
- UMOPBIVXPOETPG-UHFFFAOYSA-N (2-acetamidophenyl)boronic acid Chemical compound CC(=O)NC1=CC=CC=C1B(O)O UMOPBIVXPOETPG-UHFFFAOYSA-N 0.000 claims 1
- 241000228212 Aspergillus Species 0.000 claims 1
- 101710084378 Lipase 2 Proteins 0.000 claims 1
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 abstract 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 30
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 24
- 125000004432 carbon atom Chemical group C* 0.000 description 21
- 239000000463 material Substances 0.000 description 21
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 18
- 239000011734 sodium Substances 0.000 description 18
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 16
- 239000002585 base Substances 0.000 description 16
- 229910052708 sodium Inorganic materials 0.000 description 16
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 15
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 15
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 15
- QBLFZIBJXUQVRF-UHFFFAOYSA-N (4-bromophenyl)boronic acid Chemical compound OB(O)C1=CC=C(Br)C=C1 QBLFZIBJXUQVRF-UHFFFAOYSA-N 0.000 description 14
- 239000007859 condensation product Substances 0.000 description 14
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 13
- 235000010338 boric acid Nutrition 0.000 description 13
- 229910052783 alkali metal Inorganic materials 0.000 description 12
- 229910000323 aluminium silicate Inorganic materials 0.000 description 12
- 230000002209 hydrophobic effect Effects 0.000 description 12
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 12
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 11
- 235000013772 propylene glycol Nutrition 0.000 description 11
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 10
- 150000007513 acids Chemical class 0.000 description 10
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 10
- 150000001768 cations Chemical class 0.000 description 10
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 10
- 230000000694 effects Effects 0.000 description 10
- 239000003112 inhibitor Substances 0.000 description 10
- 235000019626 lipase activity Nutrition 0.000 description 10
- 229910052700 potassium Inorganic materials 0.000 description 10
- 239000011591 potassium Substances 0.000 description 10
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 9
- 150000001340 alkali metals Chemical class 0.000 description 9
- JMZFEHDNIAQMNB-UHFFFAOYSA-N m-aminophenylboronic acid Chemical compound NC1=CC=CC(B(O)O)=C1 JMZFEHDNIAQMNB-UHFFFAOYSA-N 0.000 description 9
- 150000003863 ammonium salts Chemical class 0.000 description 8
- 230000001580 bacterial effect Effects 0.000 description 8
- 239000004327 boric acid Substances 0.000 description 8
- 239000002738 chelating agent Substances 0.000 description 8
- 230000005764 inhibitory process Effects 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- 229940024999 proteolytic enzymes for treatment of wounds and ulcers Drugs 0.000 description 8
- 238000005406 washing Methods 0.000 description 8
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 7
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 7
- 150000001299 aldehydes Chemical class 0.000 description 7
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical group OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 7
- 239000008103 glucose Substances 0.000 description 7
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 6
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 6
- 108010056079 Subtilisins Proteins 0.000 description 6
- 102000005158 Subtilisins Human genes 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 6
- 125000003342 alkenyl group Chemical group 0.000 description 6
- 125000002947 alkylene group Chemical group 0.000 description 6
- 229910052796 boron Inorganic materials 0.000 description 6
- 125000001183 hydrocarbyl group Chemical group 0.000 description 6
- 230000002366 lipolytic effect Effects 0.000 description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 150000003871 sulfonates Chemical class 0.000 description 6
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 5
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 5
- 108090000787 Subtilisin Proteins 0.000 description 5
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 5
- 125000005619 boric acid group Chemical class 0.000 description 5
- 150000001720 carbohydrates Chemical group 0.000 description 5
- 150000007942 carboxylates Chemical group 0.000 description 5
- 229960004106 citric acid Drugs 0.000 description 5
- 239000000835 fiber Substances 0.000 description 5
- 230000002401 inhibitory effect Effects 0.000 description 5
- 230000003993 interaction Effects 0.000 description 5
- 238000005342 ion exchange Methods 0.000 description 5
- 239000011159 matrix material Substances 0.000 description 5
- 229920006395 saturated elastomer Polymers 0.000 description 5
- 238000003860 storage Methods 0.000 description 5
- 235000000346 sugar Nutrition 0.000 description 5
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 4
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 4
- 108010084185 Cellulases Proteins 0.000 description 4
- 102000005575 Cellulases Human genes 0.000 description 4
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerol Natural products OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 4
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 4
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical class OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 239000004280 Sodium formate Substances 0.000 description 4
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 4
- 239000000654 additive Substances 0.000 description 4
- 229920001577 copolymer Polymers 0.000 description 4
- 230000002538 fungal effect Effects 0.000 description 4
- 150000008195 galaktosides Chemical class 0.000 description 4
- 125000001165 hydrophobic group Chemical group 0.000 description 4
- 239000002563 ionic surfactant Substances 0.000 description 4
- 229910052744 lithium Inorganic materials 0.000 description 4
- 239000003921 oil Substances 0.000 description 4
- 235000019198 oils Nutrition 0.000 description 4
- 125000006353 oxyethylene group Chemical group 0.000 description 4
- 229920000642 polymer Polymers 0.000 description 4
- 230000003389 potentiating effect Effects 0.000 description 4
- 239000011347 resin Substances 0.000 description 4
- 229920005989 resin Polymers 0.000 description 4
- 150000004760 silicates Chemical class 0.000 description 4
- HLBBKKJFGFRGMU-UHFFFAOYSA-M sodium formate Chemical compound [Na+].[O-]C=O HLBBKKJFGFRGMU-UHFFFAOYSA-M 0.000 description 4
- 235000019254 sodium formate Nutrition 0.000 description 4
- 125000001424 substituent group Chemical group 0.000 description 4
- 235000011044 succinic acid Nutrition 0.000 description 4
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 4
- 229910021653 sulphate ion Inorganic materials 0.000 description 4
- CIOXZGOUEYHNBF-UHFFFAOYSA-N (carboxymethoxy)succinic acid Chemical compound OC(=O)COC(C(O)=O)CC(O)=O CIOXZGOUEYHNBF-UHFFFAOYSA-N 0.000 description 3
- CFPOJWPDQWJEMO-UHFFFAOYSA-N 2-(1,2-dicarboxyethoxy)butanedioic acid Chemical compound OC(=O)CC(C(O)=O)OC(C(O)=O)CC(O)=O CFPOJWPDQWJEMO-UHFFFAOYSA-N 0.000 description 3
- ZNRGSYUVFVNSAW-UHFFFAOYSA-N 3-nitrophenylboronic acid Chemical compound OB(O)C1=CC=CC([N+]([O-])=O)=C1 ZNRGSYUVFVNSAW-UHFFFAOYSA-N 0.000 description 3
- DCXYFEDJOCDNAF-UHFFFAOYSA-N Asparagine Natural products OC(=O)C(N)CC(N)=O DCXYFEDJOCDNAF-UHFFFAOYSA-N 0.000 description 3
- BTBUEUYNUDRHOZ-UHFFFAOYSA-N Borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 description 3
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- DCXYFEDJOCDNAF-REOHCLBHSA-N L-asparagine Chemical compound OC(=O)[C@@H](N)CC(N)=O DCXYFEDJOCDNAF-REOHCLBHSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 229930182556 Polyacetal Natural products 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 102000012479 Serine Proteases Human genes 0.000 description 3
- 108010022999 Serine Proteases Proteins 0.000 description 3
- ULUAUXLGCMPNKK-UHFFFAOYSA-N Sulfobutanedioic acid Chemical class OC(=O)CC(C(O)=O)S(O)(=O)=O ULUAUXLGCMPNKK-UHFFFAOYSA-N 0.000 description 3
- 240000008042 Zea mays Species 0.000 description 3
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 3
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 3
- VVBXXVAFSPEIJQ-CVIPOMFBSA-N [(2r)-3-[[(2r)-1-[[(2s,5r,8r,11r,12s,15s,18s,21s)-15-[3-(diaminomethylideneamino)propyl]-21-hydroxy-5-[(4-hydroxyphenyl)methyl]-4,11-dimethyl-2-(2-methylpropyl)-3,6,9,13,16,22-hexaoxo-8-propan-2-yl-10-oxa-1,4,7,14,17-pentazabicyclo[16.3.1]docosan-12-yl]am Chemical compound C([C@@H]1C(=O)N[C@@H](C(=O)O[C@H](C)[C@@H](C(N[C@@H](CCCN=C(N)N)C(=O)N[C@H]2CC[C@H](O)N(C2=O)[C@@H](CC(C)C)C(=O)N1C)=O)NC(=O)[C@H](NC(=O)[C@H](O)COS(O)(=O)=O)CC(C)C)C(C)C)C1=CC=C(O)C=C1 VVBXXVAFSPEIJQ-CVIPOMFBSA-N 0.000 description 3
- 150000004996 alkyl benzenes Chemical class 0.000 description 3
- 125000005907 alkyl ester group Chemical group 0.000 description 3
- 150000005215 alkyl ethers Chemical class 0.000 description 3
- WQZGKKKJIJFFOK-PHYPRBDBSA-N alpha-D-galactose Chemical group OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@H]1O WQZGKKKJIJFFOK-PHYPRBDBSA-N 0.000 description 3
- 229960001230 asparagine Drugs 0.000 description 3
- 235000009582 asparagine Nutrition 0.000 description 3
- 239000001110 calcium chloride Substances 0.000 description 3
- 229910001628 calcium chloride Inorganic materials 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 239000004927 clay Substances 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 230000005494 condensation Effects 0.000 description 3
- 235000005822 corn Nutrition 0.000 description 3
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 3
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 239000002270 dispersing agent Substances 0.000 description 3
- 229930182830 galactose Chemical group 0.000 description 3
- 229940083124 ganglion-blocking antiadrenergic secondary and tertiary amines Drugs 0.000 description 3
- 235000011187 glycerol Nutrition 0.000 description 3
- 125000003147 glycosyl group Chemical group 0.000 description 3
- 125000000623 heterocyclic group Chemical class 0.000 description 3
- 230000001965 increasing effect Effects 0.000 description 3
- NNCAWEWCFVZOGF-UHFFFAOYSA-N mepiquat Chemical compound C[N+]1(C)CCCCC1 NNCAWEWCFVZOGF-UHFFFAOYSA-N 0.000 description 3
- 229920000728 polyester Polymers 0.000 description 3
- 238000006116 polymerization reaction Methods 0.000 description 3
- 229920005862 polyol Polymers 0.000 description 3
- 150000003077 polyols Chemical class 0.000 description 3
- 229920006324 polyoxymethylene Polymers 0.000 description 3
- 230000002441 reversible effect Effects 0.000 description 3
- HELHAJAZNSDZJO-OLXYHTOASA-L sodium L-tartrate Chemical compound [Na+].[Na+].[O-]C(=O)[C@H](O)[C@@H](O)C([O-])=O HELHAJAZNSDZJO-OLXYHTOASA-L 0.000 description 3
- 239000001433 sodium tartrate Substances 0.000 description 3
- 229960002167 sodium tartrate Drugs 0.000 description 3
- 235000011004 sodium tartrates Nutrition 0.000 description 3
- 229920002994 synthetic fiber Polymers 0.000 description 3
- 239000012209 synthetic fiber Substances 0.000 description 3
- 239000006188 syrup Substances 0.000 description 3
- 235000020357 syrup Nutrition 0.000 description 3
- QEMXHQIAXOOASZ-UHFFFAOYSA-N tetramethylammonium Chemical compound C[N+](C)(C)C QEMXHQIAXOOASZ-UHFFFAOYSA-N 0.000 description 3
- OWEGMIWEEQEYGQ-UHFFFAOYSA-N 100676-05-9 Natural products OC1C(O)C(O)C(CO)OC1OCC1C(O)C(O)C(O)C(OC2C(OC(O)C(O)C2O)CO)O1 OWEGMIWEEQEYGQ-UHFFFAOYSA-N 0.000 description 2
- QDCPNGVVOWVKJG-VAWYXSNFSA-N 2-[(e)-dodec-1-enyl]butanedioic acid Chemical group CCCCCCCCCC\C=C\C(C(O)=O)CC(O)=O QDCPNGVVOWVKJG-VAWYXSNFSA-N 0.000 description 2
- YLAXZGYLWOGCBF-UHFFFAOYSA-N 2-dodecylbutanedioic acid Chemical compound CCCCCCCCCCCCC(C(O)=O)CC(O)=O YLAXZGYLWOGCBF-UHFFFAOYSA-N 0.000 description 2
- NKVJCKOMRJVZLO-UHFFFAOYSA-N 3,6,7-trioxabicyclo[7.2.2]trideca-1(11),9,12-triene-2,8-dione Chemical compound O=C1OCCOOC(=O)C2=CC=C1C=C2 NKVJCKOMRJVZLO-UHFFFAOYSA-N 0.000 description 2
- RSWGJHLUYNHPMX-UHFFFAOYSA-N Abietic-Saeure Natural products C12CCC(C(C)C)=CC2=CCC2C1(C)CCCC2(C)C(O)=O RSWGJHLUYNHPMX-UHFFFAOYSA-N 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical class NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 2
- 244000060011 Cocos nucifera Species 0.000 description 2
- 235000013162 Cocos nucifera Nutrition 0.000 description 2
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical class OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 2
- 241000223198 Humicola Species 0.000 description 2
- IMQLKJBTEOYOSI-GPIVLXJGSA-N Inositol-hexakisphosphate Chemical compound OP(O)(=O)O[C@H]1[C@H](OP(O)(O)=O)[C@@H](OP(O)(O)=O)[C@H](OP(O)(O)=O)[C@H](OP(O)(O)=O)[C@@H]1OP(O)(O)=O IMQLKJBTEOYOSI-GPIVLXJGSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- HNDVDQJCIGZPNO-YFKPBYRVSA-N L-histidine Chemical compound OC(=O)[C@@H](N)CC1=CN=CN1 HNDVDQJCIGZPNO-YFKPBYRVSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-PICCSMPSSA-N Maltose Natural products O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O[C@@H]1[C@@H](CO)OC(O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-PICCSMPSSA-N 0.000 description 2
- 239000004594 Masterbatch (MB) Substances 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- 229920000388 Polyphosphate Polymers 0.000 description 2
- KHPCPRHQVVSZAH-HUOMCSJISA-N Rosin Natural products O(C/C=C/c1ccccc1)[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H](CO)O1 KHPCPRHQVVSZAH-HUOMCSJISA-N 0.000 description 2
- 229910004298 SiO 2 Inorganic materials 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- UYXTWWCETRIEDR-UHFFFAOYSA-N Tributyrin Chemical compound CCCC(=O)OCC(OC(=O)CCC)COC(=O)CCC UYXTWWCETRIEDR-UHFFFAOYSA-N 0.000 description 2
- 229910021536 Zeolite Inorganic materials 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 230000002411 adverse Effects 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- QMKYBPDZANOJGF-UHFFFAOYSA-N benzene-1,3,5-tricarboxylic acid Chemical compound OC(=O)C1=CC(C(O)=O)=CC(C(O)=O)=C1 QMKYBPDZANOJGF-UHFFFAOYSA-N 0.000 description 2
- 229940092714 benzenesulfonic acid Drugs 0.000 description 2
- GUBGYTABKSRVRQ-QUYVBRFLSA-N beta-maltose Chemical compound OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O GUBGYTABKSRVRQ-QUYVBRFLSA-N 0.000 description 2
- 150000001639 boron compounds Chemical class 0.000 description 2
- ZADPBFCGQRWHPN-UHFFFAOYSA-N boronic acid Chemical compound OBO ZADPBFCGQRWHPN-UHFFFAOYSA-N 0.000 description 2
- 125000005620 boronic acid group Chemical class 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 239000013530 defoamer Substances 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- ILRSCQWREDREME-UHFFFAOYSA-N dodecanamide Chemical compound CCCCCCCCCCCC(N)=O ILRSCQWREDREME-UHFFFAOYSA-N 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 239000002532 enzyme inhibitor Substances 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 229930182478 glucoside Natural products 0.000 description 2
- 150000008131 glucosides Chemical class 0.000 description 2
- 150000004676 glycans Chemical class 0.000 description 2
- 239000004519 grease Substances 0.000 description 2
- HSEMFIZWXHQJAE-UHFFFAOYSA-N hexadecanamide Chemical compound CCCCCCCCCCCCCCCC(N)=O HSEMFIZWXHQJAE-UHFFFAOYSA-N 0.000 description 2
- HNDVDQJCIGZPNO-UHFFFAOYSA-N histidine Natural products OC(=O)C(N)CC1=CN=CN1 HNDVDQJCIGZPNO-UHFFFAOYSA-N 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 230000005661 hydrophobic surface Effects 0.000 description 2
- 230000001900 immune effect Effects 0.000 description 2
- 230000000977 initiatory effect Effects 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- SUMDYPCJJOFFON-UHFFFAOYSA-N isethionic acid Chemical compound OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 125000005647 linker group Chemical group 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- MBKDYNNUVRNNRF-UHFFFAOYSA-N medronic acid Chemical compound OP(O)(=O)CP(O)(O)=O MBKDYNNUVRNNRF-UHFFFAOYSA-N 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- XJRBAMWJDBPFIM-UHFFFAOYSA-N methyl vinyl ether Chemical compound COC=C XJRBAMWJDBPFIM-UHFFFAOYSA-N 0.000 description 2
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical class OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 2
- LYRFLYHAGKPMFH-UHFFFAOYSA-N octadecanamide Chemical compound CCCCCCCCCCCCCCCCCC(N)=O LYRFLYHAGKPMFH-UHFFFAOYSA-N 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 125000005702 oxyalkylene group Chemical group 0.000 description 2
- 239000002304 perfume Substances 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- PTMHPRAIXMAOOB-UHFFFAOYSA-N phosphoramidic acid Chemical class NP(O)(O)=O PTMHPRAIXMAOOB-UHFFFAOYSA-N 0.000 description 2
- 229920000233 poly(alkylene oxides) Polymers 0.000 description 2
- 239000001205 polyphosphate Substances 0.000 description 2
- 235000011176 polyphosphates Nutrition 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 235000018102 proteins Nutrition 0.000 description 2
- 102000004169 proteins and genes Human genes 0.000 description 2
- 230000002797 proteolythic effect Effects 0.000 description 2
- 239000002994 raw material Substances 0.000 description 2
- 238000006268 reductive amination reaction Methods 0.000 description 2
- 150000003333 secondary alcohols Chemical class 0.000 description 2
- 239000000344 soap Substances 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 2
- 229960000999 sodium citrate dihydrate Drugs 0.000 description 2
- 229940079842 sodium cumenesulfonate Drugs 0.000 description 2
- 235000019832 sodium triphosphate Nutrition 0.000 description 2
- QEKATQBVVAZOAY-UHFFFAOYSA-M sodium;4-propan-2-ylbenzenesulfonate Chemical compound [Na+].CC(C)C1=CC=C(S([O-])(=O)=O)C=C1 QEKATQBVVAZOAY-UHFFFAOYSA-M 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000001384 succinic acid Substances 0.000 description 2
- 150000008163 sugars Chemical class 0.000 description 2
- 239000003760 tallow Substances 0.000 description 2
- KKEYFWRCBNTPAC-UHFFFAOYSA-L terephthalate(2-) Chemical compound [O-]C(=O)C1=CC=C(C([O-])=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-L 0.000 description 2
- FAGUFWYHJQFNRV-UHFFFAOYSA-N tetraethylenepentamine Chemical class NCCNCCNCCNCCN FAGUFWYHJQFNRV-UHFFFAOYSA-N 0.000 description 2
- KHPCPRHQVVSZAH-UHFFFAOYSA-N trans-cinnamyl beta-D-glucopyranoside Natural products OC1C(O)C(O)C(CO)OC1OCC=CC1=CC=CC=C1 KHPCPRHQVVSZAH-UHFFFAOYSA-N 0.000 description 2
- SOBHUZYZLFQYFK-UHFFFAOYSA-K trisodium;hydroxy-[[phosphonatomethyl(phosphonomethyl)amino]methyl]phosphinate Chemical compound [Na+].[Na+].[Na+].OP(O)(=O)CN(CP(O)([O-])=O)CP([O-])([O-])=O SOBHUZYZLFQYFK-UHFFFAOYSA-K 0.000 description 2
- 239000010457 zeolite Substances 0.000 description 2
- 239000002888 zwitterionic surfactant Substances 0.000 description 2
- IBTSWKLSEOGJGJ-UHFFFAOYSA-N (3-acetamidophenyl)boronic acid Chemical compound CC(=O)NC1=CC=CC(B(O)O)=C1 IBTSWKLSEOGJGJ-UHFFFAOYSA-N 0.000 description 1
- CAYQIZIAYYNFCS-UHFFFAOYSA-N (4-chlorophenyl)boronic acid Chemical compound OB(O)C1=CC=C(Cl)C=C1 CAYQIZIAYYNFCS-UHFFFAOYSA-N 0.000 description 1
- VOAAEKKFGLPLLU-UHFFFAOYSA-N (4-methoxyphenyl)boronic acid Chemical compound COC1=CC=C(B(O)O)C=C1 VOAAEKKFGLPLLU-UHFFFAOYSA-N 0.000 description 1
- ILAPVZVYHKSGFM-UHFFFAOYSA-N 1-(carboxymethoxy)ethane-1,1,2-tricarboxylic acid Chemical class OC(=O)COC(C(O)=O)(C(O)=O)CC(O)=O ILAPVZVYHKSGFM-UHFFFAOYSA-N 0.000 description 1
- QPKFVRWIISEVCW-UHFFFAOYSA-N 1-butane boronic acid Chemical compound CCCCB(O)O QPKFVRWIISEVCW-UHFFFAOYSA-N 0.000 description 1
- VJSWLXWONORKLD-UHFFFAOYSA-N 2,4,6-trihydroxybenzene-1,3,5-trisulfonic acid Chemical compound OC1=C(S(O)(=O)=O)C(O)=C(S(O)(=O)=O)C(O)=C1S(O)(=O)=O VJSWLXWONORKLD-UHFFFAOYSA-N 0.000 description 1
- QDCPNGVVOWVKJG-UHFFFAOYSA-N 2-dodec-1-enylbutanedioic acid Chemical compound CCCCCCCCCCC=CC(C(O)=O)CC(O)=O QDCPNGVVOWVKJG-UHFFFAOYSA-N 0.000 description 1
- GCVQVCAAUXFNGJ-UHFFFAOYSA-N 2-hexadecylbutanedioic acid Chemical compound CCCCCCCCCCCCCCCCC(C(O)=O)CC(O)=O GCVQVCAAUXFNGJ-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- PSZAEHPBBUYICS-UHFFFAOYSA-N 2-methylidenepropanedioic acid Chemical class OC(=O)C(=C)C(O)=O PSZAEHPBBUYICS-UHFFFAOYSA-N 0.000 description 1
- DXPLEDYRQHTBDJ-UHFFFAOYSA-N 2-pentadec-1-enylbutanedioic acid Chemical compound CCCCCCCCCCCCCC=CC(C(O)=O)CC(O)=O DXPLEDYRQHTBDJ-UHFFFAOYSA-N 0.000 description 1
- MWTDCUHMQIAYDT-UHFFFAOYSA-N 2-tetradecylbutanedioic acid Chemical compound CCCCCCCCCCCCCCC(C(O)=O)CC(O)=O MWTDCUHMQIAYDT-UHFFFAOYSA-N 0.000 description 1
- CJAZCKUGLFWINJ-UHFFFAOYSA-N 3,4-dihydroxybenzene-1,2-disulfonic acid Chemical class OC1=CC=C(S(O)(=O)=O)C(S(O)(=O)=O)=C1O CJAZCKUGLFWINJ-UHFFFAOYSA-N 0.000 description 1
- KWYJDIUEHHCHCZ-UHFFFAOYSA-N 3-[2-[bis(2-carboxyethyl)amino]ethyl-(2-carboxyethyl)amino]propanoic acid Chemical class OC(=O)CCN(CCC(O)=O)CCN(CCC(O)=O)CCC(O)=O KWYJDIUEHHCHCZ-UHFFFAOYSA-N 0.000 description 1
- QJRVOJKLQNSNDB-UHFFFAOYSA-N 4-dodecan-3-ylbenzenesulfonic acid Chemical compound CCCCCCCCCC(CC)C1=CC=C(S(O)(=O)=O)C=C1 QJRVOJKLQNSNDB-UHFFFAOYSA-N 0.000 description 1
- 241000607534 Aeromonas Species 0.000 description 1
- 229910017090 AlO 2 Inorganic materials 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 240000006439 Aspergillus oryzae Species 0.000 description 1
- 235000002247 Aspergillus oryzae Nutrition 0.000 description 1
- WBOFHMRFIDVEBT-UHFFFAOYSA-N B(O)O.C(C)(=O)NC1=CC=CC=C1 Chemical compound B(O)O.C(C)(=O)NC1=CC=CC=C1 WBOFHMRFIDVEBT-UHFFFAOYSA-N 0.000 description 1
- 241000193830 Bacillus <bacterium> Species 0.000 description 1
- 241000194108 Bacillus licheniformis Species 0.000 description 1
- 244000063299 Bacillus subtilis Species 0.000 description 1
- 235000014469 Bacillus subtilis Nutrition 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 125000002853 C1-C4 hydroxyalkyl group Chemical group 0.000 description 1
- 101100126625 Caenorhabditis elegans itr-1 gene Proteins 0.000 description 1
- CBOCVOKPQGJKKJ-UHFFFAOYSA-L Calcium formate Chemical compound [Ca+2].[O-]C=O.[O-]C=O CBOCVOKPQGJKKJ-UHFFFAOYSA-L 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- XXAXVMUWHZHZMJ-UHFFFAOYSA-N Chymopapain Chemical compound OC1=CC(S(O)(=O)=O)=CC(S(O)(=O)=O)=C1O XXAXVMUWHZHZMJ-UHFFFAOYSA-N 0.000 description 1
- 108090000317 Chymotrypsin Proteins 0.000 description 1
- WQZGKKKJIJFFOK-QTVWNMPRSA-N D-mannopyranose Chemical compound OC[C@H]1OC(O)[C@@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-QTVWNMPRSA-N 0.000 description 1
- 229920002307 Dextran Polymers 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- DBVJJBKOTRCVKF-UHFFFAOYSA-N Etidronic acid Chemical class OP(=O)(O)C(O)(C)P(O)(O)=O DBVJJBKOTRCVKF-UHFFFAOYSA-N 0.000 description 1
- 108010088842 Fibrinolysin Proteins 0.000 description 1
- RFSUNEUAIZKAJO-ARQDHWQXSA-N Fructose Chemical compound OC[C@H]1O[C@](O)(CO)[C@@H](O)[C@@H]1O RFSUNEUAIZKAJO-ARQDHWQXSA-N 0.000 description 1
- 229930091371 Fructose Natural products 0.000 description 1
- 239000005715 Fructose Substances 0.000 description 1
- 108010073178 Glucan 1,4-alpha-Glucosidase Proteins 0.000 description 1
- HHLFWLYXYJOTON-UHFFFAOYSA-N Glyoxylic acid Natural products OC(=O)C=O HHLFWLYXYJOTON-UHFFFAOYSA-N 0.000 description 1
- 241000223200 Humicola grisea var. thermoidea Species 0.000 description 1
- 241001480714 Humicola insolens Species 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 240000007472 Leucaena leucocephala Species 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- JLVVSXFLKOJNIY-UHFFFAOYSA-N Magnesium ion Chemical group [Mg+2] JLVVSXFLKOJNIY-UHFFFAOYSA-N 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 239000006057 Non-nutritive feed additive Substances 0.000 description 1
- 239000004677 Nylon Substances 0.000 description 1
- TTZMPOZCBFTTPR-UHFFFAOYSA-N O=P1OCO1 Chemical class O=P1OCO1 TTZMPOZCBFTTPR-UHFFFAOYSA-N 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- 235000019482 Palm oil Nutrition 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- IMQLKJBTEOYOSI-UHFFFAOYSA-N Phytic acid Natural products OP(O)(=O)OC1C(OP(O)(O)=O)C(OP(O)(O)=O)C(OP(O)(O)=O)C(OP(O)(O)=O)C1OP(O)(O)=O IMQLKJBTEOYOSI-UHFFFAOYSA-N 0.000 description 1
- 102000003827 Plasma Kallikrein Human genes 0.000 description 1
- 108090000113 Plasma Kallikrein Proteins 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 241000589516 Pseudomonas Species 0.000 description 1
- 241000589540 Pseudomonas fluorescens Species 0.000 description 1
- 241000589538 Pseudomonas fragi Species 0.000 description 1
- 241000145542 Pseudomonas marginata Species 0.000 description 1
- 241000204735 Pseudomonas nitroreducens Species 0.000 description 1
- 101000968491 Pseudomonas sp. (strain 109) Triacylglycerol lipase Proteins 0.000 description 1
- 241000589614 Pseudomonas stutzeri Species 0.000 description 1
- 229940122055 Serine protease inhibitor Drugs 0.000 description 1
- 244000297179 Syringa vulgaris Species 0.000 description 1
- 235000004338 Syringa vulgaris Nutrition 0.000 description 1
- 108090000190 Thrombin Proteins 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- JTPLPDIKCDKODU-UHFFFAOYSA-N acetic acid;2-(2-aminoethylamino)ethanol Chemical class CC(O)=O.CC(O)=O.CC(O)=O.NCCNCCO JTPLPDIKCDKODU-UHFFFAOYSA-N 0.000 description 1
- RUSUZAGBORAKPY-UHFFFAOYSA-N acetic acid;n'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine Chemical class CC(O)=O.CC(O)=O.CC(O)=O.CC(O)=O.CC(O)=O.CC(O)=O.NCCNCCNCCN RUSUZAGBORAKPY-UHFFFAOYSA-N 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 150000001334 alicyclic compounds Chemical class 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 229910052910 alkali metal silicate Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 125000006177 alkyl benzyl group Chemical group 0.000 description 1
- 125000005037 alkyl phenyl group Chemical group 0.000 description 1
- 230000009435 amidation Effects 0.000 description 1
- 238000007112 amidation reaction Methods 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 235000001014 amino acid Nutrition 0.000 description 1
- 229940024606 amino acid Drugs 0.000 description 1
- 125000000539 amino acid group Chemical group 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 229940025131 amylases Drugs 0.000 description 1
- 230000003625 amylolytic effect Effects 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 230000003373 anti-fouling effect Effects 0.000 description 1
- 239000002518 antifoaming agent Substances 0.000 description 1
- 239000002519 antifouling agent Substances 0.000 description 1
- 230000000712 assembly Effects 0.000 description 1
- 238000000429 assembly Methods 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 150000003851 azoles Chemical class 0.000 description 1
- 244000052616 bacterial pathogen Species 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- PXXJHWLDUBFPOL-UHFFFAOYSA-N benzamidine Chemical compound NC(=N)C1=CC=CC=C1 PXXJHWLDUBFPOL-UHFFFAOYSA-N 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000007844 bleaching agent Substances 0.000 description 1
- 238000006664 bond formation reaction Methods 0.000 description 1
- 238000005282 brightening Methods 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- OVYQSRKFHNKIBM-UHFFFAOYSA-N butanedioic acid Chemical compound OC(=O)CCC(O)=O.OC(=O)CCC(O)=O OVYQSRKFHNKIBM-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 229940044172 calcium formate Drugs 0.000 description 1
- 235000019255 calcium formate Nutrition 0.000 description 1
- 239000004281 calcium formate Substances 0.000 description 1
- 235000014633 carbohydrates Nutrition 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000001734 carboxylic acid salts Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 150000001767 cationic compounds Chemical class 0.000 description 1
- 239000003093 cationic surfactant Substances 0.000 description 1
- 230000001413 cellular effect Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 229960002376 chymotrypsin Drugs 0.000 description 1
- 239000003240 coconut oil Substances 0.000 description 1
- 235000019864 coconut oil Nutrition 0.000 description 1
- 238000013329 compounding Methods 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 150000001923 cyclic compounds Chemical class 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- TUTWLYPCGCUWQI-UHFFFAOYSA-N decanamide Chemical compound CCCCCCCCCC(N)=O TUTWLYPCGCUWQI-UHFFFAOYSA-N 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 230000001079 digestive effect Effects 0.000 description 1
- 235000011180 diphosphates Nutrition 0.000 description 1
- JIBFYZIQZVPIBC-UHFFFAOYSA-L dipotassium;2-(carboxymethoxy)propanedioate Chemical compound [K+].[K+].OC(=O)COC(C([O-])=O)C([O-])=O JIBFYZIQZVPIBC-UHFFFAOYSA-L 0.000 description 1
- 229940042399 direct acting antivirals protease inhibitors Drugs 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 229940125532 enzyme inhibitor Drugs 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- IFQUWYZCAGRUJN-UHFFFAOYSA-N ethylenediaminediacetic acid Chemical class OC(=O)CNCCNCC(O)=O IFQUWYZCAGRUJN-UHFFFAOYSA-N 0.000 description 1
- 235000019197 fats Nutrition 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 229930182479 fructoside Natural products 0.000 description 1
- 150000008132 fructosides Chemical class 0.000 description 1
- 125000002519 galactosyl group Chemical group C1([C@H](O)[C@@H](O)[C@@H](O)[C@H](O1)CO)* 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 125000002791 glucosyl group Chemical group C1([C@H](O)[C@@H](O)[C@H](O)[C@H](O1)CO)* 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000002402 hexoses Chemical class 0.000 description 1
- 235000019534 high fructose corn syrup Nutrition 0.000 description 1
- 235000014304 histidine Nutrition 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 239000003752 hydrotrope Substances 0.000 description 1
- 230000028993 immune response Effects 0.000 description 1
- 230000000951 immunodiffusion Effects 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 229940045996 isethionic acid Drugs 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 238000010412 laundry washing Methods 0.000 description 1
- 229940116335 lauramide Drugs 0.000 description 1
- 239000012669 liquid formulation Substances 0.000 description 1
- 229910003002 lithium salt Inorganic materials 0.000 description 1
- 159000000002 lithium salts Chemical class 0.000 description 1
- 229910001425 magnesium ion Inorganic materials 0.000 description 1
- HCWCAKKEBCNQJP-UHFFFAOYSA-N magnesium orthosilicate Chemical compound [Mg+2].[Mg+2].[O-][Si]([O-])([O-])[O-] HCWCAKKEBCNQJP-UHFFFAOYSA-N 0.000 description 1
- 239000000391 magnesium silicate Substances 0.000 description 1
- 229910052919 magnesium silicate Inorganic materials 0.000 description 1
- 235000019792 magnesium silicate Nutrition 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 229910001437 manganese ion Inorganic materials 0.000 description 1
- 125000002960 margaryl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- HNEGQIOMVPPMNR-NSCUHMNNSA-N mesaconic acid Chemical compound OC(=O)C(/C)=C/C(O)=O HNEGQIOMVPPMNR-NSCUHMNNSA-N 0.000 description 1
- 108010003855 mesentericopeptidase Proteins 0.000 description 1
- 125000005341 metaphosphate group Chemical group 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- 150000002763 monocarboxylic acids Chemical class 0.000 description 1
- QEALYLRSRQDCRA-UHFFFAOYSA-N myristamide Chemical compound CCCCCCCCCCCCCC(N)=O QEALYLRSRQDCRA-UHFFFAOYSA-N 0.000 description 1
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000017074 necrotic cell death Effects 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- FATBGEAMYMYZAF-KTKRTIGZSA-N oleamide Chemical compound CCCCCCCC\C=C/CCCCCCCC(N)=O FATBGEAMYMYZAF-KTKRTIGZSA-N 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- FATBGEAMYMYZAF-UHFFFAOYSA-N oleicacidamide-heptaglycolether Natural products CCCCCCCCC=CCCCCCCCC(N)=O FATBGEAMYMYZAF-UHFFFAOYSA-N 0.000 description 1
- 239000004006 olive oil Substances 0.000 description 1
- 235000008390 olive oil Nutrition 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- MPQXHAGKBWFSNV-UHFFFAOYSA-N oxidophosphanium Chemical class [PH3]=O MPQXHAGKBWFSNV-UHFFFAOYSA-N 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 239000002540 palm oil Substances 0.000 description 1
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 125000002958 pentadecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000137 peptide hydrolase inhibitor Substances 0.000 description 1
- 235000020030 perry Nutrition 0.000 description 1
- 239000008363 phosphate buffer Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 229940068041 phytic acid Drugs 0.000 description 1
- 239000000467 phytic acid Substances 0.000 description 1
- 235000002949 phytic acid Nutrition 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229940012957 plasmin Drugs 0.000 description 1
- 229920001983 poloxamer Polymers 0.000 description 1
- 229920000058 polyacrylate Polymers 0.000 description 1
- 229920001748 polybutylene Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920000139 polyethylene terephthalate Polymers 0.000 description 1
- 239000005020 polyethylene terephthalate Substances 0.000 description 1
- 229920001444 polymaleic acid Polymers 0.000 description 1
- 239000003505 polymerization initiator Substances 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920001282 polysaccharide Polymers 0.000 description 1
- 239000005017 polysaccharide Substances 0.000 description 1
- 150000004804 polysaccharides Polymers 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 229920001290 polyvinyl ester Polymers 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 150000003138 primary alcohols Chemical class 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 239000003223 protective agent Substances 0.000 description 1
- DNXIASIHZYFFRO-UHFFFAOYSA-N pyrazoline Chemical compound C1CN=NC1 DNXIASIHZYFFRO-UHFFFAOYSA-N 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 150000004023 quaternary phosphonium compounds Chemical class 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 239000013049 sediment Substances 0.000 description 1
- 239000003001 serine protease inhibitor Substances 0.000 description 1
- 229940071207 sesquicarbonate Drugs 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- NVIFVTYDZMXWGX-UHFFFAOYSA-N sodium metaborate Chemical compound [Na+].[O-]B=O NVIFVTYDZMXWGX-UHFFFAOYSA-N 0.000 description 1
- 229940045919 sodium polymetaphosphate Drugs 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 229910000031 sodium sesquicarbonate Inorganic materials 0.000 description 1
- 235000018341 sodium sesquicarbonate Nutrition 0.000 description 1
- GIPRGFRQMWSHAK-UHFFFAOYSA-M sodium;2-propan-2-ylbenzenesulfonate Chemical compound [Na+].CC(C)C1=CC=CC=C1S([O-])(=O)=O GIPRGFRQMWSHAK-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 229940037312 stearamide Drugs 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- PJANXHGTPQOBST-UHFFFAOYSA-N stilbene Chemical class C=1C=CC=CC=1C=CC1=CC=CC=C1 PJANXHGTPQOBST-UHFFFAOYSA-N 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- 150000003443 succinic acid derivatives Chemical class 0.000 description 1
- 150000003444 succinic acids Chemical class 0.000 description 1
- DIORMHZUUKOISG-UHFFFAOYSA-N sulfoformic acid Chemical compound OC(=O)S(O)(=O)=O DIORMHZUUKOISG-UHFFFAOYSA-N 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- 150000003457 sulfones Chemical group 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 239000003784 tall oil Substances 0.000 description 1
- 108010075550 termamyl Proteins 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 150000004026 tertiary sulfonium compounds Chemical class 0.000 description 1
- VKFFEYLSKIYTSJ-UHFFFAOYSA-N tetraazanium;phosphonato phosphate Chemical class [NH4+].[NH4+].[NH4+].[NH4+].[O-]P([O-])(=O)OP([O-])([O-])=O VKFFEYLSKIYTSJ-UHFFFAOYSA-N 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 108010074429 thiolsubtilisins Proteins 0.000 description 1
- 229960004072 thrombin Drugs 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- 238000000954 titration curve Methods 0.000 description 1
- 125000002889 tridecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- UFTFJSFQGQCHQW-UHFFFAOYSA-N triformin Chemical compound O=COCC(OC=O)COC=O UFTFJSFQGQCHQW-UHFFFAOYSA-N 0.000 description 1
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 1
- LWIHDJKSTIGBAC-UHFFFAOYSA-K tripotassium phosphate Chemical compound [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 1
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 1
- WCTAGTRAWPDFQO-UHFFFAOYSA-K trisodium;hydrogen carbonate;carbonate Chemical compound [Na+].[Na+].[Na+].OC([O-])=O.[O-]C([O-])=O WCTAGTRAWPDFQO-UHFFFAOYSA-K 0.000 description 1
- GPRLSGONYQIRFK-MNYXATJNSA-N triton Chemical compound [3H+] GPRLSGONYQIRFK-MNYXATJNSA-N 0.000 description 1
- 108010036927 trypsin-like serine protease Proteins 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/16—Organic compounds
- C11D3/38—Products with no well-defined composition, e.g. natural products
- C11D3/386—Preparations containing enzymes, e.g. protease or amylase
- C11D3/38663—Stabilised liquid enzyme compositions
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US69351691A | 1991-04-30 | 1991-04-30 | |
| PCT/US1992/003372 WO1992019707A1 (en) | 1991-04-30 | 1992-04-24 | Liquid detergents with an aryl boronic acid |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CZ230593A3 true CZ230593A3 (en) | 1994-04-13 |
Family
ID=24784992
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS932305A CZ230593A3 (en) | 1991-04-30 | 1992-04-24 | Liquid detergents with arylboric acid |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US5472628A (OSRAM) |
| EP (1) | EP0583383B1 (OSRAM) |
| JP (1) | JPH06507198A (OSRAM) |
| CN (1) | CN1031589C (OSRAM) |
| AU (1) | AU2014892A (OSRAM) |
| BR (1) | BR9205958A (OSRAM) |
| CA (1) | CA2109526C (OSRAM) |
| CZ (1) | CZ230593A3 (OSRAM) |
| DE (1) | DE69206795T2 (OSRAM) |
| HU (1) | HUT65823A (OSRAM) |
| IE (1) | IE921389A1 (OSRAM) |
| MX (1) | MX9202069A (OSRAM) |
| MY (1) | MY131271A (OSRAM) |
| NZ (1) | NZ242537A (OSRAM) |
| PH (1) | PH31069A (OSRAM) |
| PT (1) | PT100446A (OSRAM) |
| SK (1) | SK120993A3 (OSRAM) |
| TR (1) | TR26055A (OSRAM) |
| TW (1) | TW223117B (OSRAM) |
| WO (1) | WO1992019707A1 (OSRAM) |
Families Citing this family (89)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5354491A (en) * | 1992-08-14 | 1994-10-11 | The Procter & Gamble Company | Liquid detergent compositions containing protease and certain β-aminoalkylboronic acids and esters |
| EP0583536B1 (en) * | 1992-08-14 | 1997-03-05 | The Procter & Gamble Company | Liquid detergents containing an alpha-amino boronic acid |
| US5576283A (en) * | 1992-08-14 | 1996-11-19 | The Procter & Gamble Company | Liquid detergents containing a peptide aldehyde |
| US5582762A (en) * | 1992-08-14 | 1996-12-10 | The Procter & Gamble Company | Liquid detergents containing a peptide trifluoromethyl ketone |
| WO1995002046A1 (en) * | 1993-07-09 | 1995-01-19 | Novo Nordisk A/S | Boronic acid or borinic acid derivatives as enzyme stabilizers |
| TR28578A (tr) * | 1993-08-13 | 1996-11-04 | Procter & Gamble | Proteaz ve bazi ›-aminoalkilboronik asit ve esterlerini ihtiva eden sivi deterjan bilesimleri. |
| GB2281210A (en) * | 1993-08-19 | 1995-03-01 | United States Borax Inc | Biocidal compositions containing organoboron compounds |
| US5866525A (en) * | 1993-09-07 | 1999-02-02 | Colgate-Palmolive Company | Laundry detergent compositions containing lipase and soil release polymer |
| US5851973A (en) * | 1993-09-14 | 1998-12-22 | The Procter & Gamble Company | Manual dishwashing composition comprising amylase and lipase enzymes |
| DE69434635D1 (en) | 1993-10-08 | 2006-04-27 | Novo Nordisk As | Amylasevarianten |
| US5431842A (en) * | 1993-11-05 | 1995-07-11 | The Procter & Gamble Company | Liquid detergents with ortho-substituted phenylboronic acids for inhibition of proteolytic enzyme |
| US5693617A (en) * | 1994-03-15 | 1997-12-02 | Proscript, Inc. | Inhibitors of the 26s proteolytic complex and the 20s proteasome contained therein |
| US5834415A (en) * | 1994-04-26 | 1998-11-10 | Novo Nordisk A/S | Naphthalene boronic acids |
| DE4422433A1 (de) * | 1994-06-28 | 1996-01-04 | Cognis Bio Umwelt | Mehrenzymgranulat |
| US6083903A (en) | 1994-10-28 | 2000-07-04 | Leukosite, Inc. | Boronic ester and acid compounds, synthesis and uses |
| DE69621131T2 (de) * | 1995-06-13 | 2002-11-28 | Novozymes A/S, Bagsvaerd | 4-substituierte-phenylboronsäuren als enzymstabilisatoren |
| US5883065A (en) * | 1996-01-22 | 1999-03-16 | The Procter & Gamble Company | Phase separated detergent composition |
| AU769123B2 (en) * | 1998-09-22 | 2004-01-15 | Ortho-Clinical Diagnostics | Stabilisation of peroxidases |
| CN100491525C (zh) | 2000-07-28 | 2009-05-27 | 汉高两合股份公司 | 从芽孢杆菌a7-7(dsm 12368)中提取的新型淀粉分解酶以及含有该新型淀粉分解酶的洗涤剂和清洗剂 |
| PL361363A1 (en) | 2000-11-28 | 2004-10-04 | Henkel Kommanditgesellschaft Auf Aktien | Novel cyclodextrin glucanotransferase (cgtase), obtained from bacillus agaradherens (dsm 9948) and detergents and cleaning agents containing said novel cyclodextrin glucanotransferase |
| US6858592B2 (en) * | 2001-06-29 | 2005-02-22 | Genzyme Corporation | Aryl boronic acids for treating obesity |
| US7041280B2 (en) * | 2001-06-29 | 2006-05-09 | Genzyme Corporation | Aryl boronate functionalized polymers for treating obesity |
| DE10153792A1 (de) | 2001-10-31 | 2003-05-22 | Henkel Kgaa | Neue Alkalische Protease-Varianten und Wasch- und Reinigungsmittel enthaltend diese neuen Alkalischen Protease-Varianten |
| DE10162728A1 (de) | 2001-12-20 | 2003-07-10 | Henkel Kgaa | Neue Alkalische Protease aus Bacillus gibsonii (DSM 14393) und Wasch-und Reinigungsmittel enthaltend diese neue Alkalische Protease |
| DE10162727A1 (de) | 2001-12-20 | 2003-07-10 | Henkel Kgaa | Neue Alkalische Protease aus Bacillus gibsonii (DSM 14391) und Wasch-und Reinigungsmittel enthaltend diese neue Alkalische Protease |
| DE10163884A1 (de) | 2001-12-22 | 2003-07-10 | Henkel Kgaa | Neue Alkalische Protease aus Bacillus sp. (DSM 14392) und Wasch- und Reinigungsmittel enthaltend diese neue Alkalische Protease |
| KR20040008986A (ko) * | 2002-07-20 | 2004-01-31 | 씨제이 주식회사 | 알칼리성 액체 세제 조성물 |
| US20040029757A1 (en) * | 2002-08-08 | 2004-02-12 | Ecolab Inc. | Hand dishwashing detergent composition and methods for manufacturing and using |
| DE10257387A1 (de) | 2002-12-06 | 2004-06-24 | Henkel Kgaa | Mehrkomponenten-Flüssigwaschmittel |
| US7448556B2 (en) | 2002-08-16 | 2008-11-11 | Henkel Kgaa | Dispenser bottle for at least two active fluids |
| BR0314450A (pt) | 2002-09-09 | 2005-07-26 | Trigen Ltd | Sais de ácido borÈnico com adição de uma base farmaceuticamente aceitável, formulação farmacêutica, e uso dos referidos sais para preparar uma formulação farmacêutica |
| US7531490B2 (en) * | 2004-10-01 | 2009-05-12 | Kao Corporation | Detergent composition comprising calcium gluconate and a mixture of calcium ion sequestering agents |
| JP2009507085A (ja) * | 2005-09-02 | 2009-02-19 | ノボザイムス アクティーゼルスカブ | 濃縮された液体酵素添加剤の安定化 |
| EP2004789B1 (en) | 2006-03-31 | 2012-08-29 | Novozymes A/S | A stabilized liquid enzyme composition |
| US8071345B2 (en) | 2006-03-31 | 2011-12-06 | Novozymes A/S | Stabilized subtilisin composition |
| JO3598B1 (ar) | 2006-10-10 | 2020-07-05 | Infinity Discovery Inc | الاحماض والاسترات البورونية كمثبطات اميد هيدروليز الحامض الدهني |
| DE102007011236A1 (de) | 2007-03-06 | 2008-09-11 | Henkel Ag & Co. Kgaa | Carboxylgruppen tragende Benzophenon-oderBenzoesäureanilid-Derivate als Enzymstabilisatoren |
| EP2139979B1 (en) * | 2007-03-27 | 2015-02-25 | Novozymes A/S | Stable enzyme solutions and method of manufacturing |
| DE102007041754A1 (de) | 2007-09-04 | 2009-03-05 | Henkel Ag & Co. Kgaa | Polycyclische Verbindungen als Enzymstabilisatoren |
| CA2709704C (en) | 2008-01-04 | 2013-08-06 | The Procter & Gamble Company | A laundry detergent composition comprising glycosyl hydrolase |
| US20090209447A1 (en) * | 2008-02-15 | 2009-08-20 | Michelle Meek | Cleaning compositions |
| DE102008010429A1 (de) | 2008-02-21 | 2009-08-27 | Henkel Ag & Co. Kgaa | Harnstoff-Derivate als Enzymstabilisatoren |
| DE102008014760A1 (de) | 2008-03-18 | 2009-09-24 | Henkel Ag & Co. Kgaa | Imidazolium-Salze als Enzymstabilisatoren |
| CA2721060A1 (en) | 2008-04-09 | 2009-10-15 | Infinity Pharmaceuticals, Inc. | Inhibitors of fatty acid amide hydrolase |
| PL3404088T3 (pl) | 2008-06-06 | 2025-04-28 | The Procter & Gamble Company | Kompozycja detergentu zawierająca odmianę z grupy 44 ksyloglukanazy |
| BR112012000531A2 (pt) | 2009-07-09 | 2019-09-24 | Procter & Gamble | composição detergente para lavagem de roupas catalítica que compreende teores relativamente baixos de eletrólito solúvel em água |
| WO2011005730A1 (en) | 2009-07-09 | 2011-01-13 | The Procter & Gamble Company | A catalytic laundry detergent composition comprising relatively low levels of water-soluble electrolyte |
| RU2015143910A (ru) | 2010-02-03 | 2018-12-28 | Инфинити Фармасьютикалз, Инк. | Ингибиторы амид-гидролазы жирных кислот |
| MX2012010572A (es) | 2010-03-12 | 2012-10-09 | Procter & Gamble | Gelificante diamido para utilizar en composiciones de productos de consumo. |
| US8222197B2 (en) | 2010-03-12 | 2012-07-17 | The Procter & Gamble Company | Liquid detergent compositions comprising pH tuneable amido-gellants, and processes for making |
| DE102010038499A1 (de) | 2010-07-27 | 2012-02-02 | Henkel Ag & Co. Kgaa | Stabilisierte flüssige enzymhaltige Tensidzubereitung |
| DE102010038496A1 (de) | 2010-07-27 | 2012-02-02 | Henkel Ag & Co. Kgaa | Stabilisierte flüssige enzymhaltige Tensidzubereitung |
| DE102010038501A1 (de) | 2010-07-27 | 2012-02-02 | Henkel Ag & Co. Kgaa | Stabilisierte flüssige enzymhaltige Tensidzubereitung |
| DE102010038498A1 (de) | 2010-07-27 | 2012-02-02 | Henkel Ag & Co. Kgaa | Stabilisierte flüssige enzymhaltige Tensidzubereitung |
| DE102010038497A1 (de) | 2010-07-27 | 2012-02-02 | Henkel Ag & Co. Kgaa | Stabilisierte flüssige enzymhaltige Tensidzubereitung |
| DE102010038502A1 (de) | 2010-07-27 | 2012-02-02 | Henkel Ag & Co. Kgaa | Stabilisierte flüssige enzymhaltige Tensidzubereitung |
| EP2551335A1 (en) | 2011-07-25 | 2013-01-30 | The Procter & Gamble Company | Enzyme stabilized liquid detergent composition |
| EP2737043B1 (en) | 2011-07-25 | 2017-01-04 | The Procter and Gamble Company | Detergents having acceptable color |
| DE102011118027A1 (de) | 2011-09-12 | 2013-03-14 | Henkel Ag & Co. Kgaa | Verfahren zur Anpassung eines Hydrolytischen Enzyms an eine das hydrolytische Enzym stabilisierende Komponente |
| US20130303427A1 (en) | 2011-09-13 | 2013-11-14 | Susana Fernandez Prieto | MICROCAPSULE COMPOSITIONS COMPRISING pH TUNEABLE DI-AMIDO GELLANTS |
| US20130090280A1 (en) * | 2011-10-06 | 2013-04-11 | Honeywell International Inc. | Cleaning compositions and methods |
| EP2716644B1 (en) | 2012-10-03 | 2017-04-05 | The Procter and Gamble Company | A stable enzyme stabilizer premix |
| CN105189724A (zh) | 2013-03-14 | 2015-12-23 | 诺维信公司 | 含有酶和抑制剂的水溶性膜 |
| WO2014151991A1 (en) * | 2013-03-15 | 2014-09-25 | Amtek Research International Llc | Low resistivity and sustained wettability battery separators |
| WO2014177709A1 (en) | 2013-05-03 | 2014-11-06 | Novozymes A/S | Microencapsulation of detergent enzymes |
| DE102013224250A1 (de) | 2013-11-27 | 2015-05-28 | Henkel Ag & Co. Kgaa | Lipasestabilisierung in Geschirrspülmitteln |
| US20150344818A1 (en) * | 2014-05-30 | 2015-12-03 | The Procter & Gamble Company | Water cluster-dominant alkali surfactant compositions and their use |
| US20150344819A1 (en) * | 2014-05-30 | 2015-12-03 | The Procter & Gamble Company | Water cluster-dominant alkali surfactant compositions and their use |
| US20150344817A1 (en) * | 2014-05-30 | 2015-12-03 | The Procter & Gamble Company | Water cluster-dominant boronic acid alkali surfactant compositions and their use |
| US20150344820A1 (en) * | 2014-05-30 | 2015-12-03 | The Procter & Gamble Company | Compositions and methods for biofilm treatment |
| CN106471110A (zh) * | 2014-07-03 | 2017-03-01 | 诺维信公司 | 改进的非蛋白酶类酶稳定化 |
| US10400230B2 (en) | 2014-12-19 | 2019-09-03 | Novozymes A/S | Protease variants and polynucleotides encoding same |
| EP3950939A3 (en) | 2015-07-06 | 2022-06-08 | Novozymes A/S | Lipase variants and polynucleotides encoding same |
| JP2018531783A (ja) | 2015-10-14 | 2018-11-01 | ノボザイムス アクティーゼルスカブ | 水濾過膜の洗浄 |
| JP6862035B2 (ja) * | 2017-01-20 | 2021-04-21 | 株式会社Adeka | 中性洗浄剤組成物 |
| WO2018202846A1 (en) | 2017-05-05 | 2018-11-08 | Novozymes A/S | Compositions comprising lipase and sulfite |
| EP3645692B1 (en) | 2017-06-30 | 2025-12-31 | Novozymes A/S | ENZYMATIC SUSPENSION COMPOSITION |
| EP3704240A1 (en) | 2017-11-01 | 2020-09-09 | Novozymes A/S | Polypeptides and compositions comprising such polypeptides |
| WO2019086530A1 (en) | 2017-11-01 | 2019-05-09 | Novozymes A/S | Polypeptides and compositions comprising such polypeptides |
| US20210002588A1 (en) | 2018-03-13 | 2021-01-07 | Novozymes A/S | Microencapsulation Using Amino Sugar Oligomers |
| EP3647398B1 (en) | 2018-10-31 | 2024-05-15 | Henkel AG & Co. KGaA | Cleaning compositions containing dispersins v |
| EP3647397A1 (en) | 2018-10-31 | 2020-05-06 | Henkel AG & Co. KGaA | Cleaning compositions containing dispersins iv |
| US20220411773A1 (en) | 2019-12-20 | 2022-12-29 | Novozymes A/S | Polypeptides having proteolytic activity and use thereof |
| EP4305146A1 (en) | 2021-03-12 | 2024-01-17 | Novozymes A/S | Polypeptide variants |
| JP7080385B1 (ja) * | 2021-09-15 | 2022-06-03 | 株式会社Adeka | 食器用液体洗浄剤組成物 |
| CN113698998B (zh) * | 2021-09-26 | 2023-10-13 | 广州立白企业集团有限公司 | 一种稳定的具有抗菌功效的洗涤剂组合物 |
| JP2024035439A (ja) * | 2022-09-02 | 2024-03-14 | ライオン株式会社 | 食器洗い機用液体洗浄剤組成物 |
| JP2024064153A (ja) * | 2022-10-27 | 2024-05-14 | ライオン株式会社 | 繊維製品用液体洗浄剤組成物 |
| CN120344647A (zh) | 2022-12-23 | 2025-07-18 | 诺维信公司 | 包含过氧化氢酶和淀粉酶的洗涤剂组合物 |
Family Cites Families (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3912595A (en) * | 1974-02-25 | 1975-10-14 | Us Health | Method of purifying enzymes using boronic acids covalently bonded to an insoluble support |
| US4261868A (en) * | 1979-08-08 | 1981-04-14 | Lever Brothers Company | Stabilized enzymatic liquid detergent composition containing a polyalkanolamine and a boron compound |
| IT1129814B (it) * | 1980-07-02 | 1986-06-11 | Unilever Nv | Composizione detergente enzimatica liquida |
| US4462922A (en) * | 1981-11-19 | 1984-07-31 | Lever Brothers Company | Enzymatic liquid detergent composition |
| GB8311314D0 (en) * | 1983-04-26 | 1983-06-02 | Unilever Plc | Aqueous enzyme-containing compositions |
| US4537707A (en) * | 1984-05-14 | 1985-08-27 | The Procter & Gamble Company | Liquid detergents containing boric acid and formate to stabilize enzymes |
| US4566985A (en) * | 1984-09-19 | 1986-01-28 | Applied Biochemists, Inc. | Method of cleaning using liquid compositions comprising stabilized mixtures of enzymes |
| US4747977A (en) * | 1984-11-09 | 1988-05-31 | The Procter & Gamble Company | Ethanol-free liquid laundry detergent compositions |
| US4900475A (en) * | 1985-07-26 | 1990-02-13 | Colgate-Palmolive Co. | Stabilized built liquid detergent composition containing enzyme |
| US4842769A (en) * | 1985-07-26 | 1989-06-27 | Colgate-Palmolive Co. | Stabilized fabric softening built detergent composition containing enzymes |
| JPH0697997B2 (ja) * | 1985-08-09 | 1994-12-07 | ギスト ブロカデス ナ−ムロ−ゼ フエンノ−トチヤツプ | 新規の酵素的洗浄剤添加物 |
| EG18543A (en) * | 1986-02-20 | 1993-07-30 | Albright & Wilson | Protected enzyme systems |
| US4842758A (en) * | 1986-10-31 | 1989-06-27 | Colgate-Palmolive Company | Stabilized enzyme system for use in aqueous liquid built detergent compositions |
| US5187157A (en) * | 1987-06-05 | 1993-02-16 | Du Pont Merck Pharmaceutical Company | Peptide boronic acid inhibitors of trypsin-like proteases |
| DK571587D0 (da) * | 1987-11-02 | 1987-11-02 | Novo Industri As | Enzymatisk detergentsammensaetning |
| GB8810822D0 (en) * | 1988-05-06 | 1988-06-08 | Unilever Plc | Liquid detergent compositions |
| US5039446A (en) * | 1988-07-01 | 1991-08-13 | Genencor International, Inc. | Liquid detergent with stabilized enzyme |
| CA2006527A1 (en) * | 1988-12-30 | 1990-06-30 | Martin S. Cardinali | Enzymatic liquid detergent compositions |
| US4959179A (en) * | 1989-01-30 | 1990-09-25 | Lever Brothers Company | Stabilized enzymes liquid detergent composition containing lipase and protease |
| JPH0343073A (ja) * | 1989-02-27 | 1991-02-25 | Occidental Chem Corp | 種々の温度で活性を有する特異な微生物リパーゼ及び該リパーゼを含有する洗剤 |
| EP0399681B1 (en) * | 1989-05-15 | 2000-01-19 | The Clorox Company | Method of laundering fabrics |
| AU661270B2 (en) * | 1990-03-05 | 1995-07-20 | Cephalon, Inc. | Chymotrypsin-like proteases and their inhibitors |
| EP0450702A3 (en) * | 1990-04-06 | 1993-06-02 | Unilever N.V. | Process for preparing liquid enzymatic detergent compositions |
| DK204290D0 (da) * | 1990-08-24 | 1990-08-24 | Novo Nordisk As | Enzymatisk detergentkomposition og fremgangsmaade til enzymstabilisering |
| EP0478050A1 (en) * | 1990-09-24 | 1992-04-01 | Unilever N.V. | Detergent composition |
| EP0486073B1 (en) * | 1990-11-14 | 1996-07-24 | The Procter & Gamble Company | Liquid detergent composition containing lipase and protease |
-
1992
- 1992-04-24 DE DE69206795T patent/DE69206795T2/de not_active Expired - Fee Related
- 1992-04-24 BR BR9205958A patent/BR9205958A/pt not_active Application Discontinuation
- 1992-04-24 JP JP4511919A patent/JPH06507198A/ja active Pending
- 1992-04-24 CZ CS932305A patent/CZ230593A3/cs unknown
- 1992-04-24 CA CA002109526A patent/CA2109526C/en not_active Expired - Fee Related
- 1992-04-24 AU AU20148/92A patent/AU2014892A/en not_active Abandoned
- 1992-04-24 EP EP92912203A patent/EP0583383B1/en not_active Expired - Lifetime
- 1992-04-24 HU HU9303086A patent/HUT65823A/hu unknown
- 1992-04-24 SK SK1209-93A patent/SK120993A3/sk unknown
- 1992-04-24 WO PCT/US1992/003372 patent/WO1992019707A1/en not_active Ceased
- 1992-04-28 PH PH44279A patent/PH31069A/en unknown
- 1992-04-29 NZ NZ242537A patent/NZ242537A/en unknown
- 1992-04-30 MX MX9202069A patent/MX9202069A/es not_active IP Right Cessation
- 1992-04-30 TR TR92/0419A patent/TR26055A/xx unknown
- 1992-04-30 MY MYPI92000758A patent/MY131271A/en unknown
- 1992-04-30 CN CN92104295A patent/CN1031589C/zh not_active Expired - Fee Related
- 1992-04-30 PT PT100446A patent/PT100446A/pt not_active Application Discontinuation
- 1992-06-30 TW TW081105199A patent/TW223117B/zh active
- 1992-07-01 IE IE138992A patent/IE921389A1/en not_active Application Discontinuation
-
1994
- 1994-11-09 US US08/336,884 patent/US5472628A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| TW223117B (OSRAM) | 1994-05-01 |
| TR26055A (tr) | 1994-12-15 |
| DE69206795T2 (de) | 1996-09-05 |
| BR9205958A (pt) | 1994-09-27 |
| NZ242537A (en) | 1995-06-27 |
| MX9202069A (es) | 1992-11-01 |
| PT100446A (pt) | 1993-08-31 |
| HU9303086D0 (en) | 1994-03-28 |
| US5472628A (en) | 1995-12-05 |
| WO1992019707A1 (en) | 1992-11-12 |
| IE921389A1 (en) | 1992-11-04 |
| MY131271A (en) | 2007-07-31 |
| JPH06507198A (ja) | 1994-08-11 |
| EP0583383B1 (en) | 1995-12-13 |
| AU2014892A (en) | 1992-12-21 |
| SK120993A3 (en) | 1994-08-10 |
| PH31069A (en) | 1998-02-05 |
| CN1031589C (zh) | 1996-04-17 |
| CA2109526C (en) | 1998-01-20 |
| DE69206795D1 (de) | 1996-01-25 |
| HUT65823A (en) | 1994-07-28 |
| CA2109526A1 (en) | 1992-10-31 |
| CN1067265A (zh) | 1992-12-23 |
| EP0583383A1 (en) | 1994-02-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CZ230593A3 (en) | Liquid detergents with arylboric acid | |
| AU666660B2 (en) | Built liquid detergents with boric-polyol complex to inhibit proteolytic enzyme | |
| CA2124788C (en) | Liquid laundry detergents with citric acid, cellulase, and boric-diol complex to inhibit proteolytic enzyme | |
| CA2109525C (en) | Liquid detergents with aromatic borate ester to inhibit proteolytic enzyme | |
| EP0583536B1 (en) | Liquid detergents containing an alpha-amino boronic acid | |
| EP0726936B1 (en) | Liquid detergents with ortho-substituted phenylboronic acids for inhibition of proteolytic enzyme | |
| US5422030A (en) | Liquid detergents with aromatic borate ester to inhibit proteolytic enzyme | |
| WO1998013458A1 (en) | Liquid detergents containing proteolytic enzyme and protease inhibitors | |
| WO1995000625A1 (en) | Granular laundry detergent compositions containing lipase and sodium nonanoyloxybenzene sulfonate | |
| EP0830445A1 (en) | Detergent compositions |