CZ13193A3 - Novel herbicidal composition - Google Patents
Novel herbicidal composition Download PDFInfo
- Publication number
- CZ13193A3 CZ13193A3 CZ93131A CZ13193A CZ13193A3 CZ 13193 A3 CZ13193 A3 CZ 13193A3 CZ 93131 A CZ93131 A CZ 93131A CZ 13193 A CZ13193 A CZ 13193A CZ 13193 A3 CZ13193 A3 CZ 13193A3
- Authority
- CZ
- Czechia
- Prior art keywords
- group
- methoxyethoxy
- formula
- compound
- atom
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title claims description 64
- 230000002363 herbicidal effect Effects 0.000 title claims description 39
- 125000005843 halogen group Chemical group 0.000 claims abstract description 17
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 10
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 8
- FGGUUGIYSOGQED-UHFFFAOYSA-N 1,2-oxazol-4-yl(phenyl)methanone Chemical class C=1C=CC=CC=1C(=O)C=1C=NOC=1 FGGUUGIYSOGQED-UHFFFAOYSA-N 0.000 claims abstract description 7
- 150000001875 compounds Chemical class 0.000 claims description 97
- 241000196324 Embryophyta Species 0.000 claims description 61
- 239000003085 diluting agent Substances 0.000 claims description 21
- 239000004094 surface-active agent Substances 0.000 claims description 17
- 238000000034 method Methods 0.000 claims description 16
- 239000000460 chlorine Substances 0.000 claims description 13
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 10
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 8
- 229910052801 chlorine Inorganic materials 0.000 claims description 8
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 8
- 229910052731 fluorine Inorganic materials 0.000 claims description 8
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 8
- 239000004480 active ingredient Substances 0.000 claims description 7
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 7
- 125000001153 fluoro group Chemical group F* 0.000 claims description 6
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 6
- 125000006432 1-methyl cyclopropyl group Chemical group [H]C([H])([H])C1(*)C([H])([H])C1([H])[H] 0.000 claims description 4
- 239000003153 chemical reaction reagent Substances 0.000 claims description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- NJEMPRIUAXLUIL-UHFFFAOYSA-N [2-bromo-3-(2-methoxyethoxy)-4-methylsulfanylphenyl]-(5-cyclopropyl-1,2-oxazol-4-yl)methanone Chemical compound C1=C(SC)C(OCCOC)=C(Br)C(C(=O)C2=C(ON=C2)C2CC2)=C1 NJEMPRIUAXLUIL-UHFFFAOYSA-N 0.000 claims description 3
- GHBLYSGFPRHIHB-UHFFFAOYSA-N [2-bromo-3-(2-methoxyethoxy)-4-methylsulfonylphenyl]-(5-cyclopropyl-1,2-oxazol-4-yl)methanone Chemical compound C1=C(S(C)(=O)=O)C(OCCOC)=C(Br)C(C(=O)C2=C(ON=C2)C2CC2)=C1 GHBLYSGFPRHIHB-UHFFFAOYSA-N 0.000 claims description 3
- 150000002443 hydroxylamines Chemical class 0.000 claims description 3
- LDCDKZQAGKAVMF-UHFFFAOYSA-N (5-cyclopropyl-1,2-oxazol-4-yl)-[2,4-dibromo-3-(2-methoxyethoxy)phenyl]methanone Chemical compound COCCOC1=C(Br)C=CC(C(=O)C2=C(ON=C2)C2CC2)=C1Br LDCDKZQAGKAVMF-UHFFFAOYSA-N 0.000 claims description 2
- QGUCRPMWRSGGSK-UHFFFAOYSA-N (5-cyclopropyl-1,2-oxazol-4-yl)-[3-(2-methoxyethoxy)-2-methylsulfanylphenyl]methanone Chemical compound COCCOC1=CC=CC(C(=O)C2=C(ON=C2)C2CC2)=C1SC QGUCRPMWRSGGSK-UHFFFAOYSA-N 0.000 claims description 2
- XVQJRXGZXRQBJO-UHFFFAOYSA-N (5-cyclopropyl-1,2-oxazol-4-yl)-[3-(2-methoxyethoxy)-2-methylsulfinylphenyl]methanone Chemical compound COCCOC1=CC=CC(C(=O)C2=C(ON=C2)C2CC2)=C1S(C)=O XVQJRXGZXRQBJO-UHFFFAOYSA-N 0.000 claims description 2
- BLVRHZANWIIEQS-UHFFFAOYSA-N (5-cyclopropyl-1,2-oxazol-4-yl)-[3-(2-methoxyethoxy)-2-methylsulfonylphenyl]methanone Chemical compound COCCOC1=CC=CC(C(=O)C2=C(ON=C2)C2CC2)=C1S(C)(=O)=O BLVRHZANWIIEQS-UHFFFAOYSA-N 0.000 claims description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical group FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- TZSKTNHNLHZABD-UHFFFAOYSA-N [2-bromo-3-(2-methoxyethoxy)-4-methylsulfinylphenyl]-(5-cyclopropyl-1,2-oxazol-4-yl)methanone Chemical compound C1=C(S(C)=O)C(OCCOC)=C(Br)C(C(=O)C2=C(ON=C2)C2CC2)=C1 TZSKTNHNLHZABD-UHFFFAOYSA-N 0.000 claims description 2
- WAJBQZLQPSIAPD-UHFFFAOYSA-N [2-bromo-3-(2-methoxyethoxy)-4-methylsulfonylphenyl]-[5-(1-methylcyclopropyl)-1,2-oxazol-4-yl]methanone Chemical compound C1=C(S(C)(=O)=O)C(OCCOC)=C(Br)C(C(=O)C2=C(ON=C2)C2(C)CC2)=C1 WAJBQZLQPSIAPD-UHFFFAOYSA-N 0.000 claims description 2
- OBUBDKUSBARGST-UHFFFAOYSA-N [2-chloro-3-(2-methoxyethoxy)-4-methylsulfonylphenyl]-(5-cyclopropyl-1,2-oxazol-4-yl)methanone Chemical compound C1=C(S(C)(=O)=O)C(OCCOC)=C(Cl)C(C(=O)C2=C(ON=C2)C2CC2)=C1 OBUBDKUSBARGST-UHFFFAOYSA-N 0.000 claims description 2
- MPQJFRMBGJVSJT-UHFFFAOYSA-N [2-chloro-3-(2-methoxyethoxy)-4-methylsulfonylphenyl]-(5-methyl-1,2-oxazol-4-yl)methanone Chemical compound C1=C(S(C)(=O)=O)C(OCCOC)=C(Cl)C(C(=O)C2=C(ON=C2)C)=C1 MPQJFRMBGJVSJT-UHFFFAOYSA-N 0.000 claims description 2
- YUTDJNIAQZNWLI-UHFFFAOYSA-N [2-chloro-3-(2-methoxyethoxy)-4-methylsulfonylphenyl]-(5-propan-2-yl-1,2-oxazol-4-yl)methanone Chemical compound C1=C(S(C)(=O)=O)C(OCCOC)=C(Cl)C(C(=O)C2=C(ON=C2)C(C)C)=C1 YUTDJNIAQZNWLI-UHFFFAOYSA-N 0.000 claims description 2
- BQZGGBTVYKHAIP-UHFFFAOYSA-N [4-bromo-3-(2-methoxyethoxy)-2-methylsulfonylphenyl]-(5-cyclopropyl-1,2-oxazol-4-yl)methanone Chemical compound COCCOC1=C(Br)C=CC(C(=O)C2=C(ON=C2)C2CC2)=C1S(C)(=O)=O BQZGGBTVYKHAIP-UHFFFAOYSA-N 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 239000011737 fluorine Chemical group 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 125000002524 organometallic group Chemical group 0.000 claims description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 2
- URDLBRLKKHGCFJ-UHFFFAOYSA-N [2-bromo-3-(2-methoxyethoxy)-4-methylsulfonylphenyl]-(5-methyl-1,2-oxazol-4-yl)methanone Chemical compound C1=C(S(C)(=O)=O)C(OCCOC)=C(Br)C(C(=O)C2=C(ON=C2)C)=C1 URDLBRLKKHGCFJ-UHFFFAOYSA-N 0.000 claims 1
- 229910052739 hydrogen Inorganic materials 0.000 abstract description 25
- 239000004009 herbicide Substances 0.000 abstract description 4
- 239000001257 hydrogen Substances 0.000 abstract description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract 1
- 125000005346 substituted cycloalkyl group Chemical group 0.000 abstract 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 24
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 24
- 230000012010 growth Effects 0.000 description 24
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 23
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 22
- 239000000243 solution Substances 0.000 description 20
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 18
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 18
- -1 2-Bromo-3- (2-methoxyethoxy) -4-methylsulfonylbenzoyl Chemical group 0.000 description 15
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 15
- 239000007787 solid Substances 0.000 description 14
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 12
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 12
- 239000000706 filtrate Substances 0.000 description 12
- 239000007788 liquid Substances 0.000 description 12
- 239000000969 carrier Substances 0.000 description 11
- 239000000843 powder Substances 0.000 description 11
- 238000010992 reflux Methods 0.000 description 11
- 239000002904 solvent Substances 0.000 description 11
- 239000002689 soil Substances 0.000 description 10
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 9
- 239000003921 oil Substances 0.000 description 9
- 235000019198 oils Nutrition 0.000 description 9
- 238000005507 spraying Methods 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- 239000012141 concentrate Substances 0.000 description 8
- 235000008504 concentrate Nutrition 0.000 description 8
- 229940125904 compound 1 Drugs 0.000 description 7
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- CTAPFRYPJLPFDF-UHFFFAOYSA-N isoxazole Chemical compound C=1C=NOC=1 CTAPFRYPJLPFDF-UHFFFAOYSA-N 0.000 description 6
- 150000002545 isoxazoles Chemical class 0.000 description 6
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 5
- 239000013543 active substance Substances 0.000 description 5
- 235000019441 ethanol Nutrition 0.000 description 5
- 239000000284 extract Substances 0.000 description 5
- 239000012442 inert solvent Substances 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical group Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 244000067505 Xanthium strumarium Species 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- MZZBPDKVEFVLFF-UHFFFAOYSA-N cyanazine Chemical compound CCNC1=NC(Cl)=NC(NC(C)(C)C#N)=N1 MZZBPDKVEFVLFF-UHFFFAOYSA-N 0.000 description 4
- 238000000227 grinding Methods 0.000 description 4
- 230000002262 irrigation Effects 0.000 description 4
- 238000003973 irrigation Methods 0.000 description 4
- 239000010410 layer Substances 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- 238000005580 one pot reaction Methods 0.000 description 4
- 239000004033 plastic Substances 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 239000004550 soluble concentrate Substances 0.000 description 4
- 240000006995 Abutilon theophrasti Species 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 235000013479 Amaranthus retroflexus Nutrition 0.000 description 3
- 244000237956 Amaranthus retroflexus Species 0.000 description 3
- 241000209764 Avena fatua Species 0.000 description 3
- 235000007320 Avena fatua Nutrition 0.000 description 3
- 235000008427 Brassica arvensis Nutrition 0.000 description 3
- 244000024671 Brassica kaber Species 0.000 description 3
- 235000004977 Brassica sinapistrum Nutrition 0.000 description 3
- 229920000742 Cotton Polymers 0.000 description 3
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 3
- 244000285774 Cyperus esculentus Species 0.000 description 3
- 244000058871 Echinochloa crus-galli Species 0.000 description 3
- 235000014820 Galium aparine Nutrition 0.000 description 3
- 240000005702 Galium aparine Species 0.000 description 3
- 235000010469 Glycine max Nutrition 0.000 description 3
- 244000068988 Glycine max Species 0.000 description 3
- 241000207890 Ipomoea purpurea Species 0.000 description 3
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 3
- 240000007594 Oryza sativa Species 0.000 description 3
- 235000007164 Oryza sativa Nutrition 0.000 description 3
- 235000011999 Panicum crusgalli Nutrition 0.000 description 3
- 240000003461 Setaria viridis Species 0.000 description 3
- 235000002248 Setaria viridis Nutrition 0.000 description 3
- 235000021307 Triticum Nutrition 0.000 description 3
- 244000098338 Triticum aestivum Species 0.000 description 3
- 240000008042 Zea mays Species 0.000 description 3
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 3
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 3
- 239000001089 [(2R)-oxolan-2-yl]methanol Substances 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 244000038559 crop plants Species 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- IIEWJVIFRVWJOD-UHFFFAOYSA-N ethyl cyclohexane Natural products CCC1CCCCC1 IIEWJVIFRVWJOD-UHFFFAOYSA-N 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 239000004615 ingredient Substances 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 239000011777 magnesium Substances 0.000 description 3
- 229910052749 magnesium Inorganic materials 0.000 description 3
- 235000009973 maize Nutrition 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 235000009566 rice Nutrition 0.000 description 3
- 239000007921 spray Substances 0.000 description 3
- 239000012258 stirred mixture Substances 0.000 description 3
- BSYVTEYKTMYBMK-UHFFFAOYSA-N tetrahydrofurfuryl alcohol Chemical compound OCC1CCCO1 BSYVTEYKTMYBMK-UHFFFAOYSA-N 0.000 description 3
- 239000002562 thickening agent Substances 0.000 description 3
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 3
- XBYZOHTXPQOOJM-UHFFFAOYSA-N 1,2-oxazol-3-yl(phenyl)methanone Chemical compound C=1C=CC=CC=1C(=O)C=1C=CON=1 XBYZOHTXPQOOJM-UHFFFAOYSA-N 0.000 description 2
- YYRSBGOHCHUVGO-UHFFFAOYSA-N 2-[3-(2-methoxyethoxy)-2-methylsulfanylphenyl]-4,4-dimethyl-5h-1,3-oxazole Chemical compound COCCOC1=CC=CC(C=2OCC(C)(C)N=2)=C1SC YYRSBGOHCHUVGO-UHFFFAOYSA-N 0.000 description 2
- UJARCFFIRABCHM-UHFFFAOYSA-N 2-[3-(2-methoxyethoxy)phenyl]-4,4-dimethyl-5h-1,3-oxazole Chemical compound COCCOC1=CC=CC(C=2OCC(C)(C)N=2)=C1 UJARCFFIRABCHM-UHFFFAOYSA-N 0.000 description 2
- WYJIYQOATRNIPS-UHFFFAOYSA-N 2-methoxyethyl 3-(2-methoxyethoxy)benzoate Chemical compound COCCOC(=O)C1=CC=CC(OCCOC)=C1 WYJIYQOATRNIPS-UHFFFAOYSA-N 0.000 description 2
- UPMXNNIRAGDFEH-UHFFFAOYSA-N 3,5-dibromo-4-hydroxybenzonitrile Chemical compound OC1=C(Br)C=C(C#N)C=C1Br UPMXNNIRAGDFEH-UHFFFAOYSA-N 0.000 description 2
- ZDBKQHIFUZABMJ-UHFFFAOYSA-N 3-(2-methoxyethoxy)benzoic acid Chemical compound COCCOC1=CC=CC(C(O)=O)=C1 ZDBKQHIFUZABMJ-UHFFFAOYSA-N 0.000 description 2
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 2
- IJFXRHURBJZNAO-UHFFFAOYSA-N 3-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=CC(O)=C1 IJFXRHURBJZNAO-UHFFFAOYSA-N 0.000 description 2
- XVYXWIJBUJAJSN-UHFFFAOYSA-N 4-bromo-3-(2-methoxyethoxy)-2-methylsulfonylbenzoic acid Chemical compound COCCOC1=C(Br)C=CC(C(O)=O)=C1S(C)(=O)=O XVYXWIJBUJAJSN-UHFFFAOYSA-N 0.000 description 2
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 2
- 241001621841 Alopecurus myosuroides Species 0.000 description 2
- 239000005995 Aluminium silicate Substances 0.000 description 2
- 235000005853 Cyperus esculentus Nutrition 0.000 description 2
- LBGPXIPGGRQBJW-UHFFFAOYSA-N Difenzoquat Chemical compound C[N+]=1N(C)C(C=2C=CC=CC=2)=CC=1C1=CC=CC=C1 LBGPXIPGGRQBJW-UHFFFAOYSA-N 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- ATHHXGZTWNVVOU-UHFFFAOYSA-N N-methylformamide Chemical compound CNC=O ATHHXGZTWNVVOU-UHFFFAOYSA-N 0.000 description 2
- 238000005481 NMR spectroscopy Methods 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical class OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 2
- 150000001241 acetals Chemical class 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 235000012211 aluminium silicate Nutrition 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- MXWJVTOOROXGIU-UHFFFAOYSA-N atrazine Chemical compound CCNC1=NC(Cl)=NC(NC(C)C)=N1 MXWJVTOOROXGIU-UHFFFAOYSA-N 0.000 description 2
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical class ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 2
- 235000013339 cereals Nutrition 0.000 description 2
- JXCGFZXSOMJFOA-UHFFFAOYSA-N chlorotoluron Chemical compound CN(C)C(=O)NC1=CC=C(C)C(Cl)=C1 JXCGFZXSOMJFOA-UHFFFAOYSA-N 0.000 description 2
- 230000001276 controlling effect Effects 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- IWEDIXLBFLAXBO-UHFFFAOYSA-N dicamba Chemical compound COC1=C(Cl)C=CC(Cl)=C1C(O)=O IWEDIXLBFLAXBO-UHFFFAOYSA-N 0.000 description 2
- WQOXQRCZOLPYPM-UHFFFAOYSA-N dimethyl disulfide Chemical compound CSSC WQOXQRCZOLPYPM-UHFFFAOYSA-N 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 235000005489 dwarf bean Nutrition 0.000 description 2
- RZILCCPWPBTYDO-UHFFFAOYSA-N fluometuron Chemical compound CN(C)C(=O)NC1=CC=CC(C(F)(F)F)=C1 RZILCCPWPBTYDO-UHFFFAOYSA-N 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- HJOVHMDZYOCNQW-UHFFFAOYSA-N isophorone Chemical compound CC1=CC(=O)CC(C)(C)C1 HJOVHMDZYOCNQW-UHFFFAOYSA-N 0.000 description 2
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 2
- 235000014666 liquid concentrate Nutrition 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 125000004434 sulfur atom Chemical group 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 239000004546 suspension concentrate Substances 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 235000015112 vegetable and seed oil Nutrition 0.000 description 2
- 239000008158 vegetable oil Substances 0.000 description 2
- 230000000007 visual effect Effects 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- GHYOCDFICYLMRF-UTIIJYGPSA-N (2S,3R)-N-[(2S)-3-(cyclopenten-1-yl)-1-[(2R)-2-methyloxiran-2-yl]-1-oxopropan-2-yl]-3-hydroxy-3-(4-methoxyphenyl)-2-[[(2S)-2-[(2-morpholin-4-ylacetyl)amino]propanoyl]amino]propanamide Chemical compound C1(=CCCC1)C[C@@H](C(=O)[C@@]1(OC1)C)NC([C@H]([C@@H](C1=CC=C(C=C1)OC)O)NC([C@H](C)NC(CN1CCOCC1)=O)=O)=O GHYOCDFICYLMRF-UTIIJYGPSA-N 0.000 description 1
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 1
- MTQKMPGBALVEDL-ZPCKWCKBSA-N (z,12r)-12-hydroxy-2-sulfooctadec-9-enoic acid Chemical compound CCCCCC[C@@H](O)C\C=C/CCCCCCC(C(O)=O)S(O)(=O)=O MTQKMPGBALVEDL-ZPCKWCKBSA-N 0.000 description 1
- WURBVZBTWMNKQT-UHFFFAOYSA-N 1-(4-chlorophenoxy)-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-one Chemical compound C1=NC=NN1C(C(=O)C(C)(C)C)OC1=CC=C(Cl)C=C1 WURBVZBTWMNKQT-UHFFFAOYSA-N 0.000 description 1
- QCEHEPAGFLYJKX-UHFFFAOYSA-N 1-[2-bromo-3-(2-methoxyethoxy)-4-methylsulfonylphenyl]-3-cyclopropyl-2-(ethoxymethylidene)propane-1,3-dione Chemical compound C=1C=C(S(C)(=O)=O)C(OCCOC)=C(Br)C=1C(=O)C(=COCC)C(=O)C1CC1 QCEHEPAGFLYJKX-UHFFFAOYSA-N 0.000 description 1
- BANHPDPBCVUSMZ-UHFFFAOYSA-N 1-[2-bromo-3-(2-methoxyethoxy)-4-methylsulfonylphenyl]-3-cyclopropylpropane-1,3-dione Chemical compound C1=C(S(C)(=O)=O)C(OCCOC)=C(Br)C(C(=O)CC(=O)C2CC2)=C1 BANHPDPBCVUSMZ-UHFFFAOYSA-N 0.000 description 1
- UNILWMWFPHPYOR-KXEYIPSPSA-M 1-[6-[2-[3-[3-[3-[2-[2-[3-[[2-[2-[[(2r)-1-[[2-[[(2r)-1-[3-[2-[2-[3-[[2-(2-amino-2-oxoethoxy)acetyl]amino]propoxy]ethoxy]ethoxy]propylamino]-3-hydroxy-1-oxopropan-2-yl]amino]-2-oxoethyl]amino]-3-[(2r)-2,3-di(hexadecanoyloxy)propyl]sulfanyl-1-oxopropan-2-yl Chemical compound O=C1C(SCCC(=O)NCCCOCCOCCOCCCNC(=O)COCC(=O)N[C@@H](CSC[C@@H](COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC)C(=O)NCC(=O)N[C@H](CO)C(=O)NCCCOCCOCCOCCCNC(=O)COCC(N)=O)CC(=O)N1CCNC(=O)CCCCCN\1C2=CC=C(S([O-])(=O)=O)C=C2CC/1=C/C=C/C=C/C1=[N+](CC)C2=CC=C(S([O-])(=O)=O)C=C2C1 UNILWMWFPHPYOR-KXEYIPSPSA-M 0.000 description 1
- XTIGGAHUZJWQMD-UHFFFAOYSA-N 1-chloro-2-methoxyethane Chemical compound COCCCl XTIGGAHUZJWQMD-UHFFFAOYSA-N 0.000 description 1
- 239000005631 2,4-Dichlorophenoxyacetic acid Substances 0.000 description 1
- OVSKIKFHRZPJSS-DOMIDYPGSA-N 2-(2,4-dichlorophenoxy)acetic acid Chemical compound OC(=O)[14CH2]OC1=CC=C(Cl)C=C1Cl OVSKIKFHRZPJSS-DOMIDYPGSA-N 0.000 description 1
- SURCGQGDUADKBL-UHFFFAOYSA-N 2-(2-hydroxyethylamino)-5-nitrobenzo[de]isoquinoline-1,3-dione Chemical compound [O-][N+](=O)C1=CC(C(N(NCCO)C2=O)=O)=C3C2=CC=CC3=C1 SURCGQGDUADKBL-UHFFFAOYSA-N 0.000 description 1
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- MNDUCUJMYSLXFH-UHFFFAOYSA-N 2-bromo-3-(2-methoxyethoxy)-4-methylsulfanylbenzoic acid Chemical compound COCCOC1=C(Br)C(C(O)=O)=CC=C1SC MNDUCUJMYSLXFH-UHFFFAOYSA-N 0.000 description 1
- CVZIHFDEYGAQLW-UHFFFAOYSA-N 2-bromo-3-(2-methoxyethoxy)-4-methylsulfonylbenzoyl chloride Chemical compound COCCOC1=C(Br)C(C(Cl)=O)=CC=C1S(C)(=O)=O CVZIHFDEYGAQLW-UHFFFAOYSA-N 0.000 description 1
- QXCCIPLTAFLSJQ-UHFFFAOYSA-N 2-chloro-n-(2-ethylphenyl)-n-(methoxymethyl)butanamide Chemical compound CCC(Cl)C(=O)N(COC)C1=CC=CC=C1CC QXCCIPLTAFLSJQ-UHFFFAOYSA-N 0.000 description 1
- MUZDSXFBSVUFGP-UHFFFAOYSA-N 3-(2-methoxyethoxy)-2-methylsulfanylbenzoic acid Chemical compound COCCOC1=CC=CC(C(O)=O)=C1SC MUZDSXFBSVUFGP-UHFFFAOYSA-N 0.000 description 1
- HTOJQBPQOFFNTE-UHFFFAOYSA-N 3-(2-methoxyethoxy)benzoyl chloride Chemical compound COCCOC1=CC=CC(C(Cl)=O)=C1 HTOJQBPQOFFNTE-UHFFFAOYSA-N 0.000 description 1
- CUMCMYMKECWGHO-UHFFFAOYSA-N 3-methyl-1,2-oxazole Chemical compound CC=1C=CON=1 CUMCMYMKECWGHO-UHFFFAOYSA-N 0.000 description 1
- 244000291564 Allium cepa Species 0.000 description 1
- 235000002732 Allium cepa var. cepa Nutrition 0.000 description 1
- 241000219318 Amaranthus Species 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical class [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- 244000105624 Arachis hypogaea Species 0.000 description 1
- 241000209761 Avena Species 0.000 description 1
- 235000007319 Avena orientalis Nutrition 0.000 description 1
- 235000016068 Berberis vulgaris Nutrition 0.000 description 1
- 241000335053 Beta vulgaris Species 0.000 description 1
- 241000219310 Beta vulgaris subsp. vulgaris Species 0.000 description 1
- 235000010662 Bidens pilosa Nutrition 0.000 description 1
- 244000104272 Bidens pilosa Species 0.000 description 1
- 240000007124 Brassica oleracea Species 0.000 description 1
- 235000003899 Brassica oleracea var acephala Nutrition 0.000 description 1
- 235000011301 Brassica oleracea var capitata Nutrition 0.000 description 1
- 235000001169 Brassica oleracea var oleracea Nutrition 0.000 description 1
- 239000005489 Bromoxynil Substances 0.000 description 1
- VBYQDTSYZRAGLV-UHFFFAOYSA-N COCCOC1=C(C=CC(=C1SC)C(=O)O)Br Chemical compound COCCOC1=C(C=CC(=C1SC)C(=O)O)Br VBYQDTSYZRAGLV-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 240000006122 Chenopodium album Species 0.000 description 1
- 235000009344 Chenopodium album Nutrition 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 101150065749 Churc1 gene Proteins 0.000 description 1
- 239000005946 Cypermethrin Substances 0.000 description 1
- 240000006541 Dactyloctenium aegyptium Species 0.000 description 1
- 235000002767 Daucus carota Nutrition 0.000 description 1
- 244000000626 Daucus carota Species 0.000 description 1
- 239000005504 Dicamba Substances 0.000 description 1
- 244000152970 Digitaria sanguinalis Species 0.000 description 1
- 235000010823 Digitaria sanguinalis Nutrition 0.000 description 1
- 235000001950 Elaeis guineensis Nutrition 0.000 description 1
- 244000127993 Elaeis melanococca Species 0.000 description 1
- 239000005533 Fluometuron Substances 0.000 description 1
- 241000219146 Gossypium Species 0.000 description 1
- 244000020551 Helianthus annuus Species 0.000 description 1
- 235000003222 Helianthus annuus Nutrition 0.000 description 1
- 235000007340 Hordeum vulgare Nutrition 0.000 description 1
- 240000005979 Hordeum vulgare Species 0.000 description 1
- 235000021506 Ipomoea Nutrition 0.000 description 1
- 241000207783 Ipomoea Species 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 229920001732 Lignosulfonate Polymers 0.000 description 1
- 235000004431 Linum usitatissimum Nutrition 0.000 description 1
- 240000006240 Linum usitatissimum Species 0.000 description 1
- WSMYVTOQOOLQHP-UHFFFAOYSA-N Malondialdehyde Chemical compound O=CCC=O WSMYVTOQOOLQHP-UHFFFAOYSA-N 0.000 description 1
- 240000004658 Medicago sativa Species 0.000 description 1
- 235000017587 Medicago sativa ssp. sativa Nutrition 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- ZSXGLVDWWRXATF-UHFFFAOYSA-N N,N-dimethylformamide dimethyl acetal Chemical compound COC(OC)N(C)C ZSXGLVDWWRXATF-UHFFFAOYSA-N 0.000 description 1
- 244000046052 Phaseolus vulgaris Species 0.000 description 1
- 235000010582 Pisum sativum Nutrition 0.000 description 1
- 240000004713 Pisum sativum Species 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 102100038239 Protein Churchill Human genes 0.000 description 1
- 241000533293 Sesbania emerus Species 0.000 description 1
- 235000005775 Setaria Nutrition 0.000 description 1
- 241000232088 Setaria <nematode> Species 0.000 description 1
- 241001355178 Setaria faberi Species 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- 235000002594 Solanum nigrum Nutrition 0.000 description 1
- 244000061457 Solanum nigrum Species 0.000 description 1
- 240000006394 Sorghum bicolor Species 0.000 description 1
- 235000007230 Sorghum bicolor Nutrition 0.000 description 1
- 235000021536 Sugar beet Nutrition 0.000 description 1
- 235000002096 Vicia faba var. equina Nutrition 0.000 description 1
- 241001148683 Zostera marina Species 0.000 description 1
- YKTSYUJCYHOUJP-UHFFFAOYSA-N [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] Chemical compound [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] YKTSYUJCYHOUJP-UHFFFAOYSA-N 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- XCSGPAVHZFQHGE-UHFFFAOYSA-N alachlor Chemical compound CCC1=CC=CC(CC)=C1N(COC)C(=O)CCl XCSGPAVHZFQHGE-UHFFFAOYSA-N 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 150000004996 alkyl benzenes Chemical class 0.000 description 1
- CBTVGIZVANVGBH-UHFFFAOYSA-N aminomethyl propanol Chemical compound CC(C)(N)CO CBTVGIZVANVGBH-UHFFFAOYSA-N 0.000 description 1
- 239000010775 animal oil Substances 0.000 description 1
- 239000002152 aqueous-organic solution Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 150000001559 benzoic acids Chemical class 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- VEMKTZHHVJILDY-UXHICEINSA-N bioresmethrin Chemical compound CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)OCC1=COC(CC=2C=CC=CC=2)=C1 VEMKTZHHVJILDY-UXHICEINSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 239000006229 carbon black Substances 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 239000011111 cardboard Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 229940125797 compound 12 Drugs 0.000 description 1
- 229940125782 compound 2 Drugs 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000007799 cork Substances 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- KAATUXNTWXVJKI-UHFFFAOYSA-N cypermethrin Chemical compound CC1(C)C(C=C(Cl)Cl)C1C(=O)OC(C#N)C1=CC=CC(OC=2C=CC=CC=2)=C1 KAATUXNTWXVJKI-UHFFFAOYSA-N 0.000 description 1
- 229960005424 cypermethrin Drugs 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- 235000019329 dioctyl sodium sulphosuccinate Nutrition 0.000 description 1
- GVGUFUZHNYFZLC-UHFFFAOYSA-N dodecyl benzenesulfonate;sodium Chemical compound [Na].CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 GVGUFUZHNYFZLC-UHFFFAOYSA-N 0.000 description 1
- ZVQSXJRBFRFWRO-UHFFFAOYSA-N dodecyl benzenesulfonate;sodium Chemical compound [Na].[Na].CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 ZVQSXJRBFRFWRO-UHFFFAOYSA-N 0.000 description 1
- 244000013123 dwarf bean Species 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 239000004495 emulsifiable concentrate Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000006266 etherification reaction Methods 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- MDSSLDOBFUPLGM-UHFFFAOYSA-N ethyl 2,4-dibromo-3-(2-methoxyethoxy)benzoate Chemical compound CCOC(=O)C1=CC=C(Br)C(OCCOC)=C1Br MDSSLDOBFUPLGM-UHFFFAOYSA-N 0.000 description 1
- VWYDDIQFWNNQKU-UHFFFAOYSA-N ethyl 2-bromo-3-(2-methoxyethoxy)-4-methylsulfanylbenzoate Chemical compound CCOC(=O)C1=CC=C(SC)C(OCCOC)=C1Br VWYDDIQFWNNQKU-UHFFFAOYSA-N 0.000 description 1
- NXINMNJHQYLHNL-UHFFFAOYSA-N ethyl 4-bromo-3-(2-methoxyethoxy)-2-methylsulfanylbenzoate Chemical compound CCOC(=O)C1=CC=C(Br)C(OCCOC)=C1SC NXINMNJHQYLHNL-UHFFFAOYSA-N 0.000 description 1
- CZSQKBCFZUKZDU-UHFFFAOYSA-N ethyl 4-bromo-3-(2-methoxyethoxy)-2-methylsulfonylbenzoate Chemical compound CCOC(=O)C1=CC=C(Br)C(OCCOC)=C1S(C)(=O)=O CZSQKBCFZUKZDU-UHFFFAOYSA-N 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000011790 ferrous sulphate Substances 0.000 description 1
- 235000003891 ferrous sulphate Nutrition 0.000 description 1
- 238000003818 flash chromatography Methods 0.000 description 1
- ISXSFOPKZQZDAO-UHFFFAOYSA-N formaldehyde;sodium Chemical compound [Na].O=C ISXSFOPKZQZDAO-UHFFFAOYSA-N 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 229910052736 halogen Chemical group 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 239000002563 ionic surfactant Substances 0.000 description 1
- BAUYGSIQEAFULO-UHFFFAOYSA-L iron(2+) sulfate (anhydrous) Chemical compound [Fe+2].[O-]S([O-])(=O)=O BAUYGSIQEAFULO-UHFFFAOYSA-L 0.000 description 1
- 229910000359 iron(II) sulfate Inorganic materials 0.000 description 1
- PUIYMUZLKQOUOZ-UHFFFAOYSA-N isoproturon Chemical compound CC(C)C1=CC=C(NC(=O)N(C)C)C=C1 PUIYMUZLKQOUOZ-UHFFFAOYSA-N 0.000 description 1
- 239000004922 lacquer Substances 0.000 description 1
- 239000011968 lewis acid catalyst Substances 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- RBNIGDFIUWJJEV-UHFFFAOYSA-N methyl 2-(n-benzoyl-3-chloro-4-fluoroanilino)propanoate Chemical group C=1C=C(F)C(Cl)=CC=1N(C(C)C(=O)OC)C(=O)C1=CC=CC=C1 RBNIGDFIUWJJEV-UHFFFAOYSA-N 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- 239000002420 orchard Substances 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 125000001979 organolithium group Chemical group 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 235000020232 peanut Nutrition 0.000 description 1
- 230000000149 penetrating effect Effects 0.000 description 1
- RLLPVAHGXHCWKJ-UHFFFAOYSA-N permethrin Chemical compound CC1(C)C(C=C(Cl)Cl)C1C(=O)OCC1=CC=CC(OC=2C=CC=CC=2)=C1 RLLPVAHGXHCWKJ-UHFFFAOYSA-N 0.000 description 1
- 229960000490 permethrin Drugs 0.000 description 1
- 230000000361 pesticidal effect Effects 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 230000008635 plant growth Effects 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 239000003352 sequestering agent Substances 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 238000010898 silica gel chromatography Methods 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 229940080264 sodium dodecylbenzenesulfonate Drugs 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 229920005552 sodium lignosulfonate Polymers 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 239000008247 solid mixture Substances 0.000 description 1
- 238000009331 sowing Methods 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 150000003459 sulfonic acid esters Chemical class 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- BSVLMUCZVYWRBS-UHFFFAOYSA-N tert-butyl 2-[2-bromo-3-(2-methoxyethoxy)-4-methylsulfonylbenzoyl]-3-cyclopropyl-3-oxopropanoate Chemical compound C1=C(S(C)(=O)=O)C(OCCOC)=C(Br)C(C(=O)C(C(=O)OC(C)(C)C)C(=O)C2CC2)=C1 BSVLMUCZVYWRBS-UHFFFAOYSA-N 0.000 description 1
- CXPRGLWJJQBWRS-UHFFFAOYSA-N tert-butyl 3-cyclopropyl-3-oxopropanoate Chemical compound CC(C)(C)OC(=O)CC(=O)C1CC1 CXPRGLWJJQBWRS-UHFFFAOYSA-N 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 239000004552 water soluble powder Substances 0.000 description 1
- 239000004563 wettable powder Substances 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D261/00—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings
- C07D261/02—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings
- C07D261/06—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members
- C07D261/08—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D261/00—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings
- C07D261/02—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings
- C07D261/06—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/72—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms
- A01N43/80—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms five-membered rings with one nitrogen atom and either one oxygen atom or one sulfur atom in positions 1,2
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Health & Medical Sciences (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Agronomy & Crop Science (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US85003592A | 1992-03-12 | 1992-03-12 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CZ13193A3 true CZ13193A3 (en) | 1994-02-16 |
Family
ID=25307103
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CZ93131A CZ13193A3 (en) | 1992-03-12 | 1993-02-04 | Novel herbicidal composition |
Country Status (24)
| Country | Link |
|---|---|
| EP (1) | EP0560483A1 (index.php) |
| JP (1) | JPH05255284A (index.php) |
| KR (1) | KR930019652A (index.php) |
| CN (1) | CN1076694A (index.php) |
| AU (1) | AU658044B2 (index.php) |
| BG (1) | BG97400A (index.php) |
| BR (1) | BR9300323A (index.php) |
| CA (1) | CA2088839A1 (index.php) |
| CZ (1) | CZ13193A3 (index.php) |
| FI (1) | FI930495A7 (index.php) |
| HR (1) | HRP930105A2 (index.php) |
| HU (1) | HUT63544A (index.php) |
| IL (1) | IL104613A (index.php) |
| MA (1) | MA22985A1 (index.php) |
| MX (1) | MX9300619A (index.php) |
| NZ (1) | NZ245843A (index.php) |
| PL (1) | PL171954B1 (index.php) |
| RO (1) | RO112028B1 (index.php) |
| RU (1) | RU2104273C1 (index.php) |
| SI (1) | SI9300061A (index.php) |
| SK (1) | SK6593A3 (index.php) |
| TR (1) | TR27434A (index.php) |
| TW (1) | TW254844B (index.php) |
| ZA (1) | ZA93770B (index.php) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB9325618D0 (en) * | 1993-12-15 | 1994-02-16 | Rhone Poulenc Agriculture | New herbicides |
| DE4427998A1 (de) * | 1994-08-08 | 1996-02-15 | Basf Ag | Saccharinderivate |
| KR19980702235A (ko) * | 1995-02-15 | 1998-07-15 | 도미나가 가즈토 | 이속사졸 유도체 |
| US6004904A (en) * | 1995-06-19 | 1999-12-21 | Rhone-Poulenc Inc. | Use of 4-benzoylisoxazoles for the protection of turfgrass |
| GB9526435D0 (en) * | 1995-12-22 | 1996-02-21 | Rhone Poulenc Agriculture | New herbicides |
| GB9606015D0 (en) * | 1996-03-22 | 1996-05-22 | Rhone Poulenc Agriculture | New herbicides |
| US6297198B1 (en) | 1996-05-14 | 2001-10-02 | Syngenta Participations Ag | Isoxazole derivatives and their use as herbicides |
| GB2335658A (en) * | 1998-03-25 | 1999-09-29 | Rhone Poulenc Agriculture | Processes for preparing 1-aryl-3-cyclopropyl-propane-1,3-dione intermediates |
| DE19920791A1 (de) | 1999-05-06 | 2000-11-09 | Bayer Ag | Substituierte Benzoylisoxazole |
| DE10145019A1 (de) * | 2001-09-13 | 2003-04-03 | Bayer Cropscience Gmbh | Kombinationen aus Herbiziden und Safenern |
| CN106681456A (zh) * | 2016-12-06 | 2017-05-17 | 江西鑫田车业有限公司 | 一种cpu冷却用铝制散热器 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB9025469D0 (en) * | 1990-11-22 | 1991-01-09 | Rhone Poulenc Agriculture | New compositions of matter |
| GB8920519D0 (en) * | 1989-09-11 | 1989-10-25 | Rhone Poulenc Ltd | New compositions of matter |
| IL102674A (en) * | 1991-08-05 | 1996-11-14 | Rhone Poulenc Agriculture | 4-Benzoyl isoxazole derivatives process for their preparation and herbicidal compositions containing them |
-
1993
- 1993-02-03 TR TR00114/93A patent/TR27434A/xx unknown
- 1993-02-03 HR HR930105A patent/HRP930105A2/xx not_active Application Discontinuation
- 1993-02-04 AU AU32818/93A patent/AU658044B2/en not_active Ceased
- 1993-02-04 MX MX9300619A patent/MX9300619A/es not_active IP Right Cessation
- 1993-02-04 SK SK6593A patent/SK6593A3/sk unknown
- 1993-02-04 SI SI9300061A patent/SI9300061A/sl unknown
- 1993-02-04 ZA ZA93770A patent/ZA93770B/xx unknown
- 1993-02-04 HU HU9300294A patent/HUT63544A/hu unknown
- 1993-02-04 FI FI930495A patent/FI930495A7/fi not_active Application Discontinuation
- 1993-02-04 CA CA002088839A patent/CA2088839A1/en not_active Abandoned
- 1993-02-04 RO RO93-00121A patent/RO112028B1/ro unknown
- 1993-02-04 MA MA23075A patent/MA22985A1/fr unknown
- 1993-02-04 CZ CZ93131A patent/CZ13193A3/cs unknown
- 1993-02-04 RU RU93004493A patent/RU2104273C1/ru active
- 1993-02-04 NZ NZ245843A patent/NZ245843A/en unknown
- 1993-02-04 CN CN93101487A patent/CN1076694A/zh active Pending
- 1993-02-04 BG BG97400A patent/BG97400A/bg unknown
- 1993-02-04 IL IL104613A patent/IL104613A/xx not_active IP Right Cessation
- 1993-02-04 BR BR9300323A patent/BR9300323A/pt not_active Application Discontinuation
- 1993-02-04 PL PL93297645A patent/PL171954B1/pl unknown
- 1993-02-04 JP JP5017612A patent/JPH05255284A/ja active Pending
- 1993-02-04 EP EP93300817A patent/EP0560483A1/en not_active Ceased
- 1993-02-04 KR KR1019930001501A patent/KR930019652A/ko not_active Withdrawn
- 1993-02-06 TW TW082100808A patent/TW254844B/zh active
Also Published As
| Publication number | Publication date |
|---|---|
| MX9300619A (es) | 1994-07-29 |
| FI930495A7 (fi) | 1993-09-13 |
| IL104613A (en) | 1997-06-10 |
| HRP930105A2 (en) | 1996-04-30 |
| BR9300323A (pt) | 1993-09-14 |
| PL297645A1 (en) | 1993-09-20 |
| AU3281893A (en) | 1993-09-16 |
| CA2088839A1 (en) | 1993-09-13 |
| TR27434A (tr) | 1995-05-23 |
| MA22985A1 (fr) | 1994-07-01 |
| JPH05255284A (ja) | 1993-10-05 |
| TW254844B (index.php) | 1995-08-21 |
| SK6593A3 (en) | 1993-10-06 |
| KR930019652A (ko) | 1993-10-18 |
| RO112028B1 (ro) | 1997-04-30 |
| RU2104273C1 (ru) | 1998-02-10 |
| NZ245843A (en) | 1994-08-26 |
| BG97400A (bg) | 1994-06-30 |
| IL104613A0 (en) | 1993-06-10 |
| PL171954B1 (pl) | 1997-07-31 |
| ZA93770B (en) | 1993-09-08 |
| EP0560483A1 (en) | 1993-09-15 |
| HUT63544A (en) | 1993-09-28 |
| HU9300294D0 (en) | 1993-05-28 |
| SI9300061A (sl) | 1993-12-31 |
| FI930495A0 (fi) | 1993-02-04 |
| AU658044B2 (en) | 1995-03-30 |
| CN1076694A (zh) | 1993-09-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| RU2105761C1 (ru) | Производные 4-бензоилизоксазола, способы их получения, гербицидная композиция, способ борьбы с ростом сорняков | |
| RU2122543C1 (ru) | Производные 4-бензоилизоксазола, способ получения, гербицидная композиция, способ регулирования роста сорняков | |
| RU2055072C1 (ru) | Производные 4-бензилизоксазола, гербицидная композиция и способ подавления роста сорняков | |
| RU2065854C1 (ru) | Производные 4-бензоилизоксазола, способ их получения, гербицидная композиция и способ борьбы с сорняками | |
| RU2124505C1 (ru) | Производное 4-бензоилизоксазола или его приемлемая для сельского хозяйства соль, гербицидная композиция и способ борьбы с сорняками | |
| CZ224592A3 (en) | 5-arylisoxazole derivatives, process of their preparation and herbicidal compositions in which said derivatives are comprised | |
| SK280174B6 (sk) | 2-kyano-1,3-diónové deriváty, spôsob ich prípravy | |
| JP3234684B2 (ja) | 新規な除草剤 | |
| SI9200164A (en) | 4-benzoylisooxazole derivatives, process for their production and their use as herbicides | |
| SK10894A3 (en) | 4-benzoylizoxazole derivatives, method of their preparation and compositions containing them | |
| BG98110A (bg) | Нови хербициди | |
| CZ13193A3 (en) | Novel herbicidal composition | |
| RU2065853C1 (ru) | Производные 4-бензоилизоксазола, способы их получения, гербицидная композиция и способ подавления роста сорняков в локусе |