CS256366B2 - Method of new 3-(1-piperidinylalkyl)-4h-pyridol(1,2-pyrimidine-4-on derivatives production - Google Patents
Method of new 3-(1-piperidinylalkyl)-4h-pyridol(1,2-pyrimidine-4-on derivatives production Download PDFInfo
- Publication number
- CS256366B2 CS256366B2 CS812134A CS213481A CS256366B2 CS 256366 B2 CS256366 B2 CS 256366B2 CS 812134 A CS812134 A CS 812134A CS 213481 A CS213481 A CS 213481A CS 256366 B2 CS256366 B2 CS 256366B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- parts
- piperidinyl
- methyl
- pyrido
- pyrimidin
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 11
- 238000004519 manufacturing process Methods 0.000 title claims description 4
- 150000001875 compounds Chemical class 0.000 claims abstract description 36
- 125000003386 piperidinyl group Chemical group 0.000 claims abstract description 5
- -1 C 1 -C 4 alkyl Chemical group 0.000 claims description 48
- 239000011541 reaction mixture Substances 0.000 claims description 16
- 239000002253 acid Substances 0.000 claims description 15
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 12
- 150000003839 salts Chemical class 0.000 claims description 12
- 229910052739 hydrogen Inorganic materials 0.000 claims description 11
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 10
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 9
- 239000001257 hydrogen Substances 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 125000001424 substituent group Chemical group 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 125000005843 halogen group Chemical group 0.000 claims description 5
- 238000009835 boiling Methods 0.000 claims description 4
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims description 3
- 239000003960 organic solvent Substances 0.000 claims description 3
- 125000004185 ester group Chemical group 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 125000004076 pyridyl group Chemical group 0.000 claims description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 2
- 125000001544 thienyl group Chemical group 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims 1
- 229940082988 antihypertensives serotonin antagonists Drugs 0.000 abstract description 3
- 239000003420 antiserotonin agent Substances 0.000 abstract description 3
- 230000003389 potentiating effect Effects 0.000 abstract 1
- 239000000203 mixture Substances 0.000 description 49
- 239000000243 solution Substances 0.000 description 43
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 30
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 29
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 27
- 239000002585 base Substances 0.000 description 22
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 21
- QZAYGJVTTNCVMB-UHFFFAOYSA-N serotonin Chemical compound C1=C(O)C=C2C(CCN)=CNC2=C1 QZAYGJVTTNCVMB-UHFFFAOYSA-N 0.000 description 18
- 239000000047 product Substances 0.000 description 16
- 239000004480 active ingredient Substances 0.000 description 14
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 11
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Inorganic materials [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- 241000700159 Rattus Species 0.000 description 10
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 10
- 239000000543 intermediate Substances 0.000 description 10
- 239000002904 solvent Substances 0.000 description 10
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 9
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- 239000013543 active substance Substances 0.000 description 9
- 229940076279 serotonin Drugs 0.000 description 9
- 239000007858 starting material Substances 0.000 description 9
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 8
- 239000003826 tablet Substances 0.000 description 8
- DNCYBUMDUBHIJZ-UHFFFAOYSA-N 1h-pyrimidin-6-one Chemical class O=C1C=CN=CN1 DNCYBUMDUBHIJZ-UHFFFAOYSA-N 0.000 description 7
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 7
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 7
- 229960001701 chloroform Drugs 0.000 description 7
- 238000001914 filtration Methods 0.000 description 7
- 238000010992 reflux Methods 0.000 description 7
- 239000000725 suspension Substances 0.000 description 7
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 6
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 6
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 6
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 6
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 6
- 229910000029 sodium carbonate Inorganic materials 0.000 description 6
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 5
- 239000002202 Polyethylene glycol Substances 0.000 description 5
- 210000001367 artery Anatomy 0.000 description 5
- 239000002775 capsule Substances 0.000 description 5
- 239000003054 catalyst Substances 0.000 description 5
- 229920002055 compound 48/80 Polymers 0.000 description 5
- 239000000706 filtrate Substances 0.000 description 5
- 239000000796 flavoring agent Substances 0.000 description 5
- 235000019634 flavors Nutrition 0.000 description 5
- 229920001223 polyethylene glycol Polymers 0.000 description 5
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 5
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 5
- 150000003254 radicals Chemical group 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- 210000002784 stomach Anatomy 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric Acid Chemical compound [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 230000008602 contraction Effects 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 4
- 230000002496 gastric effect Effects 0.000 description 4
- 239000011777 magnesium Substances 0.000 description 4
- 229910052749 magnesium Inorganic materials 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 239000008194 pharmaceutical composition Substances 0.000 description 4
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 4
- 239000008213 purified water Substances 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- FTLYMKDSHNWQKD-UHFFFAOYSA-N (2,4,5-trichlorophenyl)boronic acid Chemical compound OB(O)C1=CC(Cl)=C(Cl)C=C1Cl FTLYMKDSHNWQKD-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 3
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 3
- 229920002472 Starch Polymers 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 235000019270 ammonium chloride Nutrition 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 201000010099 disease Diseases 0.000 description 3
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 3
- 210000004907 gland Anatomy 0.000 description 3
- 235000011187 glycerol Nutrition 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- 238000002347 injection Methods 0.000 description 3
- 239000007924 injection Substances 0.000 description 3
- 239000008101 lactose Substances 0.000 description 3
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 3
- WSFSSNUMVMOOMR-BJUDXGSMSA-N methanone Chemical compound O=[11CH2] WSFSSNUMVMOOMR-BJUDXGSMSA-N 0.000 description 3
- 235000010270 methyl p-hydroxybenzoate Nutrition 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 235000010232 propyl p-hydroxybenzoate Nutrition 0.000 description 3
- QELSKZZBTMNZEB-UHFFFAOYSA-N propylparaben Chemical compound CCCOC(=O)C1=CC=C(O)C=C1 QELSKZZBTMNZEB-UHFFFAOYSA-N 0.000 description 3
- 229940085605 saccharin sodium Drugs 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- 238000010898 silica gel chromatography Methods 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 3
- 235000019698 starch Nutrition 0.000 description 3
- 239000012258 stirred mixture Substances 0.000 description 3
- 229960005137 succinic acid Drugs 0.000 description 3
- 239000000829 suppository Substances 0.000 description 3
- BHWNQRHBJTYLBS-UHFFFAOYSA-N (3-methylphenyl)-(1-methylpiperidin-4-yl)methanone Chemical compound C1CN(C)CCC1C(=O)C1=CC=CC(C)=C1 BHWNQRHBJTYLBS-UHFFFAOYSA-N 0.000 description 2
- AVGQTJUPLKNPQP-UHFFFAOYSA-N 1,1,1-trichloropropane Chemical compound CCC(Cl)(Cl)Cl AVGQTJUPLKNPQP-UHFFFAOYSA-N 0.000 description 2
- VVKRQHYODGRELZ-UHFFFAOYSA-N 1-[4-(4-fluoro-2-hydroxybenzoyl)piperidin-1-yl]ethanone Chemical compound C1CN(C(=O)C)CCC1C(=O)C1=CC=C(F)C=C1O VVKRQHYODGRELZ-UHFFFAOYSA-N 0.000 description 2
- LOUGYXZSURQALL-UHFFFAOYSA-N 2,3-dihydroxybutanoic acid Chemical compound CC(O)C(O)C(O)=O LOUGYXZSURQALL-UHFFFAOYSA-N 0.000 description 2
- VRHYRTCKFPDZFY-UHFFFAOYSA-N 2-(1-benzylpiperidin-4-yl)-2-thiophen-2-ylacetonitrile Chemical compound C=1C=CSC=1C(C#N)C(CC1)CCN1CC1=CC=CC=C1 VRHYRTCKFPDZFY-UHFFFAOYSA-N 0.000 description 2
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 2
- LFTGLYCNMGGMKL-UHFFFAOYSA-N 3-(2-chloroethyl)-2-methylpyrido[1,2-a]pyrimidin-4-one Chemical compound C1=CC=CN2C(=O)C(CCCl)=C(C)N=C21 LFTGLYCNMGGMKL-UHFFFAOYSA-N 0.000 description 2
- KAIRZPVWWIMPFT-UHFFFAOYSA-N 3-piperidin-4-yl-1h-indole Chemical compound C1CNCCC1C1=CNC2=CC=CC=C12 KAIRZPVWWIMPFT-UHFFFAOYSA-N 0.000 description 2
- MYGXGCCFTPKWIH-UHFFFAOYSA-N 4-chloro-1-methylpiperidine Chemical compound CN1CCC(Cl)CC1 MYGXGCCFTPKWIH-UHFFFAOYSA-N 0.000 description 2
- VRJHQPZVIGNGMX-UHFFFAOYSA-N 4-piperidinone Chemical class O=C1CCNCC1 VRJHQPZVIGNGMX-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 239000001856 Ethyl cellulose Substances 0.000 description 2
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- LCTONWCANYUPML-UHFFFAOYSA-N Pyruvic acid Chemical compound CC(=O)C(O)=O LCTONWCANYUPML-UHFFFAOYSA-N 0.000 description 2
- 235000002357 Ribes grossularia Nutrition 0.000 description 2
- 244000171263 Ribes grossularia Species 0.000 description 2
- 240000007651 Rubus glaucus Species 0.000 description 2
- 235000011034 Rubus glaucus Nutrition 0.000 description 2
- 235000009122 Rubus idaeus Nutrition 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- 244000299461 Theobroma cacao Species 0.000 description 2
- 235000009470 Theobroma cacao Nutrition 0.000 description 2
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 239000005557 antagonist Substances 0.000 description 2
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- WBYWAXJHAXSJNI-UHFFFAOYSA-N cinnamic acid Chemical compound OC(=O)C=CC1=CC=CC=C1 WBYWAXJHAXSJNI-UHFFFAOYSA-N 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 239000003937 drug carrier Substances 0.000 description 2
- 210000005069 ears Anatomy 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- TWKTXHSUZOVDOL-UHFFFAOYSA-N ethyl 4-(4-methylbenzoyl)piperidine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCC1C(=O)C1=CC=C(C)C=C1 TWKTXHSUZOVDOL-UHFFFAOYSA-N 0.000 description 2
- 235000019325 ethyl cellulose Nutrition 0.000 description 2
- 229920001249 ethyl cellulose Polymers 0.000 description 2
- 239000008103 glucose Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 239000008172 hydrogenated vegetable oil Substances 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 125000000814 indol-3-yl group Chemical group [H]C1=C([H])C([H])=C2N([H])C([H])=C([*])C2=C1[H] 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 235000014655 lactic acid Nutrition 0.000 description 2
- BJEPYKJPYRNKOW-UHFFFAOYSA-N malic acid Chemical compound OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 2
- 229920000609 methyl cellulose Polymers 0.000 description 2
- 239000001923 methylcellulose Substances 0.000 description 2
- LXCFILQKKLGQFO-UHFFFAOYSA-N methylparaben Chemical compound COC(=O)C1=CC=C(O)C=C1 LXCFILQKKLGQFO-UHFFFAOYSA-N 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 229940100688 oral solution Drugs 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 238000007911 parenteral administration Methods 0.000 description 2
- 239000000825 pharmaceutical preparation Substances 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- SUSQOBVLVYHIEX-UHFFFAOYSA-N phenylacetonitrile Chemical compound N#CCC1=CC=CC=C1 SUSQOBVLVYHIEX-UHFFFAOYSA-N 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 239000006187 pill Substances 0.000 description 2
- 150000003053 piperidines Chemical class 0.000 description 2
- 229940068918 polyethylene glycol 400 Drugs 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 229960003415 propylparaben Drugs 0.000 description 2
- 125000006239 protecting group Chemical group 0.000 description 2
- 230000035939 shock Effects 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000000600 sorbitol Substances 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- 238000007910 systemic administration Methods 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 150000003626 triacylglycerols Chemical class 0.000 description 2
- 239000008215 water for injection Substances 0.000 description 2
- 238000005303 weighing Methods 0.000 description 2
- YWVNOFAHALYKJS-UHFFFAOYSA-N (2-methylphenyl)-piperidin-4-ylmethanone;hydrobromide Chemical compound Br.CC1=CC=CC=C1C(=O)C1CCNCC1 YWVNOFAHALYKJS-UHFFFAOYSA-N 0.000 description 1
- NKIWAZKLNJCAHZ-UHFFFAOYSA-N (3-methylphenyl)-piperidin-4-ylmethanone;hydrobromide Chemical compound Br.CC1=CC=CC(C(=O)C2CCNCC2)=C1 NKIWAZKLNJCAHZ-UHFFFAOYSA-N 0.000 description 1
- FROIULQFNHDIGW-UHFFFAOYSA-N (4-bromophenyl)-(1-methylpiperidin-4-yl)methanone Chemical compound C1CN(C)CCC1C(=O)C1=CC=C(Br)C=C1 FROIULQFNHDIGW-UHFFFAOYSA-N 0.000 description 1
- RZYOQCTVBGUEHL-UHFFFAOYSA-N (4-bromophenyl)-piperidin-4-ylmethanone;hydrobromide Chemical compound Br.C1=CC(Br)=CC=C1C(=O)C1CCNCC1 RZYOQCTVBGUEHL-UHFFFAOYSA-N 0.000 description 1
- USLPSTUNNWIRHD-UHFFFAOYSA-N (4-fluoro-2-hydroxyphenyl)-piperidin-4-ylmethanone;hydrochloride Chemical compound Cl.OC1=CC(F)=CC=C1C(=O)C1CCNCC1 USLPSTUNNWIRHD-UHFFFAOYSA-N 0.000 description 1
- FEKLBAMEZXSKQK-UHFFFAOYSA-N (4-fluorophenyl)-(4-methylpiperidin-4-yl)methanone;hydrobromide Chemical compound Br.C=1C=C(F)C=CC=1C(=O)C1(C)CCNCC1 FEKLBAMEZXSKQK-UHFFFAOYSA-N 0.000 description 1
- GPKDBZQZPNOBGM-UHFFFAOYSA-N (4-fluorophenyl)-piperidin-4-ylmethanone;hydron;chloride Chemical compound [Cl-].C1=CC(F)=CC=C1C(=O)C1CC[NH2+]CC1 GPKDBZQZPNOBGM-UHFFFAOYSA-N 0.000 description 1
- CWRODDRQXUGEOY-UHFFFAOYSA-N (4-methylphenyl)-piperidin-4-ylmethanone;hydrobromide Chemical compound Br.C1=CC(C)=CC=C1C(=O)C1CCNCC1 CWRODDRQXUGEOY-UHFFFAOYSA-N 0.000 description 1
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 1
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 description 1
- SEPPVOUBHWNCAW-FNORWQNLSA-N (E)-4-oxonon-2-enal Chemical compound CCCCCC(=O)\C=C\C=O SEPPVOUBHWNCAW-FNORWQNLSA-N 0.000 description 1
- IWYDHOAUDWTVEP-ZETCQYMHSA-N (S)-mandelic acid Chemical compound OC(=O)[C@@H](O)C1=CC=CC=C1 IWYDHOAUDWTVEP-ZETCQYMHSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- PAAZPARNPHGIKF-UHFFFAOYSA-N 1,2-dibromoethane Chemical compound BrCCBr PAAZPARNPHGIKF-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- OGFAWKRXZLGJSK-UHFFFAOYSA-N 1-(2,4-dihydroxyphenyl)-2-(4-nitrophenyl)ethanone Chemical compound OC1=CC(O)=CC=C1C(=O)CC1=CC=C([N+]([O-])=O)C=C1 OGFAWKRXZLGJSK-UHFFFAOYSA-N 0.000 description 1
- OFRGRJFCOFCRLY-UHFFFAOYSA-N 1-[4-(2-fluoro-4-methoxybenzoyl)piperidin-1-yl]ethanone Chemical compound FC1=CC(OC)=CC=C1C(=O)C1CCN(C(C)=O)CC1 OFRGRJFCOFCRLY-UHFFFAOYSA-N 0.000 description 1
- OHCPVLJEAHBMEG-UHFFFAOYSA-N 1-acetylpiperidine-4-carbonyl chloride Chemical compound CC(=O)N1CCC(C(Cl)=O)CC1 OHCPVLJEAHBMEG-UHFFFAOYSA-N 0.000 description 1
- SJZKULRDWHPHGG-UHFFFAOYSA-N 1-benzylpiperidin-4-one Chemical compound C1CC(=O)CCN1CC1=CC=CC=C1 SJZKULRDWHPHGG-UHFFFAOYSA-N 0.000 description 1
- CKJUFUGVCGDYHH-UHFFFAOYSA-N 1-benzylpiperidine-4-carbonitrile Chemical compound C1CC(C#N)CCN1CC1=CC=CC=C1 CKJUFUGVCGDYHH-UHFFFAOYSA-N 0.000 description 1
- QSSXJPIWXQTSIX-UHFFFAOYSA-N 1-bromo-2-methylbenzene Chemical compound CC1=CC=CC=C1Br QSSXJPIWXQTSIX-UHFFFAOYSA-N 0.000 description 1
- MFJNOXOAIFNSBX-UHFFFAOYSA-N 1-fluoro-3-methoxybenzene Chemical compound COC1=CC=CC(F)=C1 MFJNOXOAIFNSBX-UHFFFAOYSA-N 0.000 description 1
- JDUMICHRQFXDJN-UHFFFAOYSA-N 1H-pyrimidin-6-one dihydrochloride Chemical compound Cl.Cl.O=C1C=CN=CN1 JDUMICHRQFXDJN-UHFFFAOYSA-N 0.000 description 1
- 150000003930 2-aminopyridines Chemical class 0.000 description 1
- LODHFNUFVRVKTH-ZHACJKMWSA-N 2-hydroxy-n'-[(e)-3-phenylprop-2-enoyl]benzohydrazide Chemical compound OC1=CC=CC=C1C(=O)NNC(=O)\C=C\C1=CC=CC=C1 LODHFNUFVRVKTH-ZHACJKMWSA-N 0.000 description 1
- UUXFTJCUPHVPKZ-UHFFFAOYSA-N 2-methylpyrido[1,2-a]pyrimidin-4-one Chemical compound C1=CC=CC2=NC(C)=CC(=O)N21 UUXFTJCUPHVPKZ-UHFFFAOYSA-N 0.000 description 1
- CLSHQIDDCJTHAJ-UHFFFAOYSA-N 2-thienylacetonitrile Chemical compound N#CCC1=CC=CS1 CLSHQIDDCJTHAJ-UHFFFAOYSA-N 0.000 description 1
- VUZKVMTVHWBSCQ-UHFFFAOYSA-N 3-(2-chloroethyl)-2,6-dimethylpyrido[1,2-a]pyrimidin-4-one Chemical compound C1=CC=C(C)N2C(=O)C(CCCl)=C(C)N=C21 VUZKVMTVHWBSCQ-UHFFFAOYSA-N 0.000 description 1
- TUXBVLXGIDGWBF-UHFFFAOYSA-N 3-(2-chloroethyl)-2,8-dimethylpyrido[1,2-a]pyrimidin-4-one Chemical compound C1=C(C)C=CN2C1=NC(C)=C(CCCl)C2=O TUXBVLXGIDGWBF-UHFFFAOYSA-N 0.000 description 1
- NRHWMTXVGBMTEZ-UHFFFAOYSA-N 3-[2-[4-(1h-indol-3-yl)piperidin-1-yl]ethyl]-2,6-dimethylpyrido[1,2-a]pyrimidin-4-one Chemical compound C1=CC=C2C(C3CCN(CC3)CCC=3C(=O)N4C(C)=CC=CC4=NC=3C)=CNC2=C1 NRHWMTXVGBMTEZ-UHFFFAOYSA-N 0.000 description 1
- HSGCJQOHNKGBGC-UHFFFAOYSA-N 3-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-2-methylpyrido[1,2-a]pyrimidin-4-one;phosphoric acid Chemical compound OP(O)(O)=O.CC=1N=C2C=CC=CN2C(=O)C=1CCN(CC1)CCC1C(=O)C1=CC=C(F)C=C1 HSGCJQOHNKGBGC-UHFFFAOYSA-N 0.000 description 1
- JRRMRKNRZXMGEZ-UHFFFAOYSA-N 3-[2-[4-[(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]ethyl]-2-methylpyrido[1,2-a]pyrimidin-4-one Chemical compound CC=1N=C2C=CC=CN2C(=O)C=1CCN(CC1)CCC1C(O)C1=CC=C(F)C=C1 JRRMRKNRZXMGEZ-UHFFFAOYSA-N 0.000 description 1
- HXCNRYXBZNHDNE-UHFFFAOYSA-N 3-[2-[4-[(4-fluorophenyl)-oxomethyl]-1-piperidinyl]ethyl]-2-methyl-4-pyrido[1,2-a]pyrimidinone Chemical compound CC=1N=C2C=CC=CN2C(=O)C=1CCN(CC1)CCC1C(=O)C1=CC=C(F)C=C1 HXCNRYXBZNHDNE-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- BOHCMQZJWOGWTA-UHFFFAOYSA-N 3-methylbenzonitrile Chemical compound CC1=CC=CC(C#N)=C1 BOHCMQZJWOGWTA-UHFFFAOYSA-N 0.000 description 1
- WUBBRNOQWQTFEX-UHFFFAOYSA-N 4-aminosalicylic acid Chemical compound NC1=CC=C(C(O)=O)C(O)=C1 WUBBRNOQWQTFEX-UHFFFAOYSA-N 0.000 description 1
- HQSCPPCMBMFJJN-UHFFFAOYSA-N 4-bromobenzonitrile Chemical compound BrC1=CC=C(C#N)C=C1 HQSCPPCMBMFJJN-UHFFFAOYSA-N 0.000 description 1
- GCNTZFIIOFTKIY-UHFFFAOYSA-N 4-hydroxypyridine Chemical compound OC1=CC=NC=C1 GCNTZFIIOFTKIY-UHFFFAOYSA-N 0.000 description 1
- LLBZPESJRQGYMB-UHFFFAOYSA-N 4-one Natural products O1C(C(=O)CC)CC(C)C11C2(C)CCC(C3(C)C(C(C)(CO)C(OC4C(C(O)C(O)C(COC5C(C(O)C(O)CO5)OC5C(C(OC6C(C(O)C(O)C(CO)O6)O)C(O)C(CO)O5)OC5C(C(O)C(O)C(C)O5)O)O4)O)CC3)CC3)=C3C2(C)CC1 LLBZPESJRQGYMB-UHFFFAOYSA-N 0.000 description 1
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 1
- FZLSDZZNPXXBBB-KDURUIRLSA-N 5-chloro-N-[3-cyclopropyl-5-[[(3R,5S)-3,5-dimethylpiperazin-1-yl]methyl]phenyl]-4-(6-methyl-1H-indol-3-yl)pyrimidin-2-amine Chemical compound C[C@H]1CN(Cc2cc(Nc3ncc(Cl)c(n3)-c3c[nH]c4cc(C)ccc34)cc(c2)C2CC2)C[C@@H](C)N1 FZLSDZZNPXXBBB-KDURUIRLSA-N 0.000 description 1
- BOWIYVAXBCLKOR-UHFFFAOYSA-N 7-chloro-3-[2-[4-(1h-indol-3-yl)piperidin-1-yl]ethyl]-2-methylpyrido[1,2-a]pyrimidin-4-one Chemical compound C1=CC=C2C(C3CCN(CC3)CCC=3C(=O)N4C=C(Cl)C=CC4=NC=3C)=CNC2=C1 BOWIYVAXBCLKOR-UHFFFAOYSA-N 0.000 description 1
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- PJLGFPGHPSCVRR-UHFFFAOYSA-N CC1=C(C(=O)N2C=C(C=CC2=N1)Cl)CCN3CCC(CC3)(C)C(=O)C4=CC=C(C=C4)F Chemical compound CC1=C(C(=O)N2C=C(C=CC2=N1)Cl)CCN3CCC(CC3)(C)C(=O)C4=CC=C(C=C4)F PJLGFPGHPSCVRR-UHFFFAOYSA-N 0.000 description 1
- BVLVFAIRXRBHIO-UHFFFAOYSA-N CC1=C(C(=O)N2C=CC=CC2=N1)CCN3CCC(CC3)C4=CNC5=C4C=C(C=C5)OC Chemical compound CC1=C(C(=O)N2C=CC=CC2=N1)CCN3CCC(CC3)C4=CNC5=C4C=C(C=C5)OC BVLVFAIRXRBHIO-UHFFFAOYSA-N 0.000 description 1
- JSRXTNKUHGGCTF-UHFFFAOYSA-N CC1=C(C(=O)N2C=CC=CC2=N1)CCN3CCC(CC3)CC4=CC=C(C=C4)F Chemical compound CC1=C(C(=O)N2C=CC=CC2=N1)CCN3CCC(CC3)CC4=CC=C(C=C4)F JSRXTNKUHGGCTF-UHFFFAOYSA-N 0.000 description 1
- YPZSPGKTAUIXON-UHFFFAOYSA-N CC=1N=C2N(C(C1CCN1CCC(CC1)C1=CNC3=C(C=CC=C13)C)=O)C=CC=C2 Chemical compound CC=1N=C2N(C(C1CCN1CCC(CC1)C1=CNC3=C(C=CC=C13)C)=O)C=CC=C2 YPZSPGKTAUIXON-UHFFFAOYSA-N 0.000 description 1
- JZYXFPKEDPLRRU-UHFFFAOYSA-N COC1=CC=C(C(=O)C2CCN(CC2)CCC2=C(N=C3N(C2=O)C=C(C=C3)C)C)C=C1 Chemical compound COC1=CC=C(C(=O)C2CCN(CC2)CCC2=C(N=C3N(C2=O)C=C(C=C3)C)C)C=C1 JZYXFPKEDPLRRU-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- 108020004705 Codon Proteins 0.000 description 1
- 206010010904 Convulsion Diseases 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 238000003747 Grignard reaction Methods 0.000 description 1
- 206010022714 Intestinal ulcer Diseases 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- UEQUQVLFIPOEMF-UHFFFAOYSA-N Mianserin Chemical compound C1C2=CC=CC=C2N2CCN(C)CC2C2=CC=CC=C21 UEQUQVLFIPOEMF-UHFFFAOYSA-N 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- 208000007101 Muscle Cramp Diseases 0.000 description 1
- JCMWSVNNSPUNER-UHFFFAOYSA-N N,O-dimethyltyramine Chemical compound CNCCC1=CC=C(OC)C=C1 JCMWSVNNSPUNER-UHFFFAOYSA-N 0.000 description 1
- WHNWPMSKXPGLAX-UHFFFAOYSA-N N-Vinyl-2-pyrrolidone Chemical compound C=CN1CCCC1=O WHNWPMSKXPGLAX-UHFFFAOYSA-N 0.000 description 1
- 238000007126 N-alkylation reaction Methods 0.000 description 1
- ODRBIMZXRDKMBN-UHFFFAOYSA-N O.Cl.Cl.N1=CNC(C=C1)=O Chemical compound O.Cl.Cl.N1=CNC(C=C1)=O ODRBIMZXRDKMBN-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-N R-2-phenyl-2-hydroxyacetic acid Natural products OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 1
- 241000700157 Rattus norvegicus Species 0.000 description 1
- YGSDEFSMJLZEOE-UHFFFAOYSA-N Salicylic acid Natural products OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 1
- 239000004141 Sodium laurylsulphate Substances 0.000 description 1
- 208000005392 Spasm Diseases 0.000 description 1
- 208000007107 Stomach Ulcer Diseases 0.000 description 1
- 235000006650 Syzygium cordatum Nutrition 0.000 description 1
- 235000006651 Syzygium guineense Nutrition 0.000 description 1
- 240000005334 Syzygium guineense Species 0.000 description 1
- 206010046996 Varicose vein Diseases 0.000 description 1
- 241000212749 Zesius chrysomallus Species 0.000 description 1
- QCPLFZQQQQDDEW-UHFFFAOYSA-N [1-(3-chloropropyl)piperidin-4-yl]-(4-fluorophenyl)methanone Chemical compound C1=CC(F)=CC=C1C(=O)C1CCN(CCCCl)CC1 QCPLFZQQQQDDEW-UHFFFAOYSA-N 0.000 description 1
- PLIHPKDYFLVYCZ-UHFFFAOYSA-N [5-[(4-benzhydrylpiperazin-1-yl)methyl]-1-methylbenzimidazol-2-yl]methanol Chemical compound C=1C=C2N(C)C(CO)=NC2=CC=1CN(CC1)CCN1C(C=1C=CC=CC=1)C1=CC=CC=C1 PLIHPKDYFLVYCZ-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- ICSNLGPSRYBMBD-UHFFFAOYSA-N alpha-aminopyridine Natural products NC1=CC=CC=N1 ICSNLGPSRYBMBD-UHFFFAOYSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 125000004103 aminoalkyl group Chemical group 0.000 description 1
- 230000008485 antagonism Effects 0.000 description 1
- 230000001773 anti-convulsant effect Effects 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000017531 blood circulation Effects 0.000 description 1
- 210000004204 blood vessel Anatomy 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 210000000621 bronchi Anatomy 0.000 description 1
- 206010006451 bronchitis Diseases 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 229940125692 cardiovascular agent Drugs 0.000 description 1
- 239000002327 cardiovascular agent Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 235000010980 cellulose Nutrition 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- RSUVYMGADVXGOU-BUHFOSPRSA-N cinanserin Chemical compound CN(C)CCCSC1=CC=CC=C1NC(=O)\C=C\C1=CC=CC=C1 RSUVYMGADVXGOU-BUHFOSPRSA-N 0.000 description 1
- 229950001684 cinanserin Drugs 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 1
- 229940075614 colloidal silicon dioxide Drugs 0.000 description 1
- 239000007891 compressed tablet Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 230000036461 convulsion Effects 0.000 description 1
- 239000006184 cosolvent Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- ZHGASCUQXLPSDT-UHFFFAOYSA-N cyclohexanesulfonic acid Chemical compound OS(=O)(=O)C1CCCCC1 ZHGASCUQXLPSDT-UHFFFAOYSA-N 0.000 description 1
- JJCFRYNCJDLXIK-UHFFFAOYSA-N cyproheptadine Chemical compound C1CN(C)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 JJCFRYNCJDLXIK-UHFFFAOYSA-N 0.000 description 1
- 229960001140 cyproheptadine Drugs 0.000 description 1
- 229940075894 denatured ethanol Drugs 0.000 description 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- HCPOCMMGKBZWSJ-UHFFFAOYSA-N ethyl 3-hydrazinyl-3-oxopropanoate Chemical compound CCOC(=O)CC(=O)NN HCPOCMMGKBZWSJ-UHFFFAOYSA-N 0.000 description 1
- FZEOURQRKPFNQR-UHFFFAOYSA-N ethyl 4-(2-methylbenzoyl)piperidine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCC1C(=O)C1=CC=CC=C1C FZEOURQRKPFNQR-UHFFFAOYSA-N 0.000 description 1
- STVXKKCCKHGSCV-UHFFFAOYSA-N ethyl 4-(3-methylbenzoyl)piperidine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCC1C(=O)C1=CC=CC(C)=C1 STVXKKCCKHGSCV-UHFFFAOYSA-N 0.000 description 1
- WMYNMWHPJYJFSI-UHFFFAOYSA-N ethyl 4-(4-bromobenzoyl)piperidine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCC1C(=O)C1=CC=C(Br)C=C1 WMYNMWHPJYJFSI-UHFFFAOYSA-N 0.000 description 1
- PJAWRYMRVPYMAZ-UHFFFAOYSA-N ethyl 4-(4-fluorobenzoyl)-4-methylpiperidine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCC1(C)C(=O)C1=CC=C(F)C=C1 PJAWRYMRVPYMAZ-UHFFFAOYSA-N 0.000 description 1
- LAVVCNRWDYAVHB-UHFFFAOYSA-N ethyl 4-(thiophene-2-carbonyl)piperidine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCC1C(=O)C1=CC=CS1 LAVVCNRWDYAVHB-UHFFFAOYSA-N 0.000 description 1
- XYIBRDXRRQCHLP-UHFFFAOYSA-N ethyl acetoacetate Chemical compound CCOC(=O)CC(C)=O XYIBRDXRRQCHLP-UHFFFAOYSA-N 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 210000004051 gastric juice Anatomy 0.000 description 1
- 210000001156 gastric mucosa Anatomy 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 229960004275 glycolic acid Drugs 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 208000014617 hemorrhoid Diseases 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- 229960001340 histamine Drugs 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- CBOIHMRHGLHBPB-UHFFFAOYSA-N hydroxymethyl Chemical group O[CH2] CBOIHMRHGLHBPB-UHFFFAOYSA-N 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- WZHJKEUHNJHDLS-QTGUNEKASA-N metergoline Chemical compound C([C@H]1CN([C@H]2[C@@H](C=3C=CC=C4N(C)C=C(C=34)C2)C1)C)NC(=O)OCC1=CC=CC=C1 WZHJKEUHNJHDLS-QTGUNEKASA-N 0.000 description 1
- 229960004650 metergoline Drugs 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- 229960003955 mianserin Drugs 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000000199 molecular distillation Methods 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- 239000007935 oral tablet Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 239000003182 parenteral nutrition solution Substances 0.000 description 1
- WHLAAOUBNDBWLA-UHFFFAOYSA-N phenyl(piperidin-4-yl)methanone;hydrobromide Chemical compound Br.C=1C=CC=CC=1C(=O)C1CCNCC1 WHLAAOUBNDBWLA-UHFFFAOYSA-N 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- JUOYGTQAFOURCO-UHFFFAOYSA-N piperidin-4-yl(thiophen-2-yl)methanone;hydrobromide Chemical compound Br.C=1C=CSC=1C(=O)C1CCNCC1 JUOYGTQAFOURCO-UHFFFAOYSA-N 0.000 description 1
- FIADGNVRKBPQEU-UHFFFAOYSA-N pizotifen Chemical compound C1CN(C)CCC1=C1C2=CC=CC=C2CCC2=C1C=CS2 FIADGNVRKBPQEU-UHFFFAOYSA-N 0.000 description 1
- 229960004572 pizotifen Drugs 0.000 description 1
- 239000002574 poison Substances 0.000 description 1
- 231100000614 poison Toxicity 0.000 description 1
- 229940093429 polyethylene glycol 6000 Drugs 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 229940069328 povidone Drugs 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- CSIGAEASXSGNKS-UHFFFAOYSA-N propane-1,1,3-triol Chemical compound OCCC(O)O CSIGAEASXSGNKS-UHFFFAOYSA-N 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 230000028327 secretion Effects 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- DKGZKTPJOSAWFA-UHFFFAOYSA-N spiperone Chemical compound C1=CC(F)=CC=C1C(=O)CCCN1CCC2(C(NCN2C=2C=CC=CC=2)=O)CC1 DKGZKTPJOSAWFA-UHFFFAOYSA-N 0.000 description 1
- 229950001675 spiperone Drugs 0.000 description 1
- 239000008223 sterile water Substances 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- IMCGHZIGRANKHV-AJNGGQMLSA-N tert-butyl (3s,5s)-2-oxo-5-[(2s,4s)-5-oxo-4-propan-2-yloxolan-2-yl]-3-propan-2-ylpyrrolidine-1-carboxylate Chemical compound O1C(=O)[C@H](C(C)C)C[C@H]1[C@H]1N(C(=O)OC(C)(C)C)C(=O)[C@H](C(C)C)C1 IMCGHZIGRANKHV-AJNGGQMLSA-N 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 208000027185 varicose disease Diseases 0.000 description 1
- 230000002792 vascular Effects 0.000 description 1
- 210000003462 vein Anatomy 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P11/00—Drugs for disorders of the respiratory system
- A61P11/08—Bronchodilators
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/08—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms
- C07D211/18—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D211/30—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms with hydrocarbon radicals, substituted by doubly bound oxygen or sulfur atoms or by two oxygen or sulfur atoms singly bound to the same carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/08—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms
- C07D211/18—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D211/34—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms with hydrocarbon radicals, substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/68—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D211/70—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Pulmonology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US13484580A | 1980-03-28 | 1980-03-28 | |
| US06/191,632 US4342870A (en) | 1980-03-28 | 1980-09-29 | Novel 3-(1-piperidinylalkyl)-4H-pyrido[1,2-a]pyrimidin-4-one derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS256366B2 true CS256366B2 (en) | 1988-04-15 |
Family
ID=26832744
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS812134A CS256366B2 (en) | 1980-03-28 | 1981-03-24 | Method of new 3-(1-piperidinylalkyl)-4h-pyridol(1,2-pyrimidine-4-on derivatives production |
Country Status (22)
| Country | Link |
|---|---|
| US (1) | US4342870A (fr) |
| EP (1) | EP0037265B1 (fr) |
| AU (1) | AU537700B2 (fr) |
| BG (1) | BG36199A3 (fr) |
| CA (1) | CA1163994A (fr) |
| CS (1) | CS256366B2 (fr) |
| DE (1) | DE3168433D1 (fr) |
| DK (1) | DK159390C (fr) |
| ES (1) | ES500814A0 (fr) |
| FI (1) | FI71737C (fr) |
| GR (1) | GR72488B (fr) |
| HU (1) | HU187329B (fr) |
| IE (1) | IE51319B1 (fr) |
| IL (1) | IL62494A (fr) |
| MA (1) | MA19107A1 (fr) |
| NO (1) | NO156752C (fr) |
| NZ (1) | NZ196522A (fr) |
| PH (1) | PH16530A (fr) |
| PT (1) | PT72740B (fr) |
| RO (1) | RO82508A (fr) |
| SU (1) | SU1068037A3 (fr) |
| YU (1) | YU43010B (fr) |
Families Citing this family (42)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4443451A (en) * | 1981-07-15 | 1984-04-17 | Janssen Pharmaceutica N.V. | Bicyclic pyrimidin-5-one derivatives |
| US4548938A (en) * | 1981-07-15 | 1985-10-22 | Janssen Pharmaceutica N.V. | 5-H-1,3,4-thiadiazolo[3,2-a]pyrimidin-5-one compounds |
| US4355037A (en) * | 1981-11-12 | 1982-10-19 | Hoechst-Roussel Pharmaceuticals | 3-(4-Piperidyl)-1,2-benzisoxales |
| US4485107A (en) * | 1982-11-01 | 1984-11-27 | Janssen Pharmaceutica N.V. | [[Bis(aryl)methylene]-1-piperidinyl]alkyl-pyrimidinones |
| US4581171A (en) * | 1983-07-27 | 1986-04-08 | Janssen Pharmaceutica, N.V. | [[Bis(aryl)methylene]-1-piperidinyl]alkyl-pyrimidinones useful for treating psychotropic disorders |
| US4888426A (en) * | 1983-11-30 | 1989-12-19 | Janssen Pharmaceutica N.V. | 1-(5-methyl-furan-2-ylmethyl)-N-(4-piperidinyl)imidazo [4,5-6]pyridine-2-amine |
| US4695569A (en) * | 1983-11-30 | 1987-09-22 | Janssen Pharmaceutica N.V. | Bicyclic heterocyclyl containing N-(bicyclic heterocyclyl)-4-piperidinamines |
| PH23995A (en) * | 1984-01-09 | 1990-02-09 | Janssen Pharmaceutica Nv | 4((bicycle heterocyclyl)-methyl and hetero)piperidines |
| US4548939A (en) * | 1984-10-01 | 1985-10-22 | Janssen Pharmaceutica N. V. | 1H-Indol-3-yl containing 1,3-dimethyl-1H-purine-2,6-diones |
| US4804663A (en) * | 1985-03-27 | 1989-02-14 | Janssen Pharmaceutica N.V. | 3-piperidinyl-substituted 1,2-benzisoxazoles and 1,2-benzisothiazoles |
| ES2094718T3 (es) * | 1986-09-22 | 1997-02-01 | Janssen Pharmaceutica Nv | Antagonistas de la serotonine para el tratamiento de heridas. |
| IL90879A0 (en) * | 1988-09-02 | 1990-02-09 | Janssen Pharmaceutica Nv | 3-piperidinyl-indazole derivatives,their preparation and antihypertensive compositions containing them |
| CA2000786C (fr) * | 1988-11-07 | 1999-01-26 | Cornelus G. M. Janssen | 3-piperidinyl-1,2-benzisoxazoles |
| WO1990006303A1 (fr) * | 1988-12-02 | 1990-06-14 | Pfizer Inc. | Derives arylpiperidine |
| JPH04504263A (ja) * | 1989-03-23 | 1992-07-30 | マリンクロッド・インコーポレイテッド | 放射性沃素又は臭素標識ピペリジン化合物、並びに上記化合物の及び上記化合物を含む組成物の製法 |
| DE4138756A1 (de) * | 1991-11-26 | 1993-05-27 | Troponwerke Gmbh & Co Kg | Kombination mit neuroprotektiver wirkung |
| US5266571A (en) * | 1992-01-09 | 1993-11-30 | Amer Moh Samir | Treatment of hemorrhoids with 5-HT2 antagonists |
| EP0626968B1 (fr) * | 1992-02-13 | 2001-09-26 | Merrell Pharmaceuticals Inc. | Derives piperidinyles thiacycliques |
| DK0672043T3 (da) * | 1992-07-13 | 2001-08-27 | Janssen Pharmaceutica Nv | Hidtil ukendte 4-(3-benzofuranyl)-piperidinyl- og 4-(3-benzothienyl)-piperidinyl-derivater og farmaceutiske præparater indeholdende dem |
| HU219487B (hu) * | 1993-11-19 | 2001-04-28 | Janssen Pharmaceutica Nv. | Riszperidont tartalmazó mikrorészecskék, eljárás előállításukra, alkalmazásuk és ezeket tartalmazó gyógyászati készítmények és előállításuk |
| ES2085234B1 (es) * | 1994-02-24 | 1997-01-16 | Vita Invest Sa | Agente activo sobre el sistema nervioso central, procedimiento para su preparacion y composiciones farmaceuticas que lo contienen. |
| TW421649B (en) * | 1995-01-31 | 2001-02-11 | Janssen Pharmaceutica Nv | 4-(1H-indol-1yl)-1-piperidinyl derivatives |
| US5753664A (en) * | 1995-03-16 | 1998-05-19 | Takeda Chemical Industries, Ltd. | Heterocyclic compounds, their production and use |
| CN100390146C (zh) * | 2002-11-13 | 2008-05-28 | 斯索恩有限公司 | 制备利培酮的方法和用于该方法的中间体 |
| EP1615923A1 (fr) * | 2003-04-22 | 2006-01-18 | Synthon B.V. | Monochlorhydrates de risperidone |
| CN101970427A (zh) | 2008-02-29 | 2011-02-09 | Vm生物医药公司 | 治疗疼痛症状及其它失调的方法 |
| MX354074B (es) | 2012-02-10 | 2018-02-12 | Ptc Therapeutics Inc | Compuestos para tratar la atrofia muscular espinal. |
| JP6092264B2 (ja) | 2012-03-01 | 2017-03-08 | ピーティーシー セラピューティクス, インコーポレイテッド | 脊髄性筋委縮症を処置するための化合物 |
| CN104470909B (zh) | 2012-03-23 | 2018-04-24 | Ptc医疗公司 | 用于治疗脊髓性肌萎缩的化合物 |
| EP2970188A4 (fr) * | 2013-03-15 | 2016-10-19 | Vm Therapeutics Llc | Nouvelles formes cristallines |
| US10195202B2 (en) | 2013-12-19 | 2019-02-05 | Ptc Therapeutics, Inc. | Methods for modulating the amount of RNA transcripts |
| EP4249472A3 (fr) | 2015-05-30 | 2023-12-13 | PTC Therapeutics, Inc. | Procédés de modulation de l'épissage de l'arn |
| MX391850B (es) | 2015-12-10 | 2025-03-19 | Ptc Therapeutics Inc | Compuestos para usarse en el tratamiento o mejoramiento de la enfermedad de huntington |
| MX2019005588A (es) | 2016-11-28 | 2019-10-15 | Ptc Therapeutics Inc | Metodos para modular corte y empalme de arn. |
| CA3066224A1 (fr) | 2017-06-05 | 2018-12-13 | Ptc Therapeutics Inc. | Composes permettant de traiter la maladie de huntington |
| KR20200017476A (ko) | 2017-06-14 | 2020-02-18 | 피티씨 테라퓨틱스, 인크. | Rna 스플라이싱의 변경 방법 |
| MX2019015580A (es) | 2017-06-28 | 2020-07-28 | Ptc Therapeutics Inc | Metodos para tratar la enfermedad de huntington. |
| US11382918B2 (en) | 2017-06-28 | 2022-07-12 | Ptc Therapeutics, Inc. | Methods for treating Huntington's Disease |
| JP7399870B2 (ja) | 2018-03-27 | 2023-12-18 | ピーティーシー セラピューティクス, インコーポレイテッド | ハンチントン病を処置するための化合物 |
| HUE068060T2 (hu) | 2018-06-27 | 2024-12-28 | Ptc Therapeutics Inc | Heterociklikus és heteroaril vegyületek Huntington-kór kezelésére |
| US11685746B2 (en) | 2018-06-27 | 2023-06-27 | Ptc Therapeutics, Inc. | Heteroaryl compounds for treating Huntington's disease |
| KR20210038845A (ko) | 2018-06-27 | 2021-04-08 | 피티씨 테라퓨틱스, 인크. | 헌팅턴병 치료를 위한 헤테로아릴 화합물 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3412094A (en) * | 1967-06-21 | 1968-11-19 | Searle & Co | 5-alkyl-2-amino-4-azido-6-phenylpyrimidines and congeners |
| US3960863A (en) * | 1974-06-25 | 1976-06-01 | Sankyo Company Limited | Pyrido[1,2-a]pyrimidinone derivatives |
| JPS5146497A (en) * | 1974-10-19 | 1976-04-20 | Masato Aiura | Hobuban |
| JPS525795A (en) * | 1975-06-28 | 1977-01-17 | Sankyo Co Ltd | Preparation of tetrahydro pyridopyrimidinone derivatives |
| HU173438B (hu) * | 1975-11-27 | 1979-05-28 | Chinoin Gyogyszer Es Vegyeszet | Sposob poluchenija novykh proizvodnykh 4-okso-1,6,7,8-/tetragidro-4h-pirido/1,2/pirimidina s zaderzhivajuhhejj vozgoranie aktivnot'ju i protivosvertivajuhhem effektom |
-
1980
- 1980-09-29 US US06/191,632 patent/US4342870A/en not_active Expired - Lifetime
-
1981
- 1981-03-03 GR GR64291A patent/GR72488B/el unknown
- 1981-03-04 CA CA000372258A patent/CA1163994A/fr not_active Expired
- 1981-03-17 AU AU68429/81A patent/AU537700B2/en not_active Ceased
- 1981-03-17 NZ NZ196522A patent/NZ196522A/en unknown
- 1981-03-21 MA MA19313A patent/MA19107A1/fr unknown
- 1981-03-24 CS CS812134A patent/CS256366B2/cs unknown
- 1981-03-24 SU SU813261927A patent/SU1068037A3/ru active
- 1981-03-26 PT PT72740A patent/PT72740B/pt not_active IP Right Cessation
- 1981-03-26 IL IL62494A patent/IL62494A/xx unknown
- 1981-03-26 PH PH25429A patent/PH16530A/en unknown
- 1981-03-26 DK DK138281A patent/DK159390C/da not_active IP Right Cessation
- 1981-03-27 FI FI810956A patent/FI71737C/fi not_active IP Right Cessation
- 1981-03-27 YU YU810/81A patent/YU43010B/xx unknown
- 1981-03-27 DE DE8181301335T patent/DE3168433D1/de not_active Expired
- 1981-03-27 EP EP81301335A patent/EP0037265B1/fr not_active Expired
- 1981-03-27 BG BG051433A patent/BG36199A3/xx unknown
- 1981-03-27 HU HU81783A patent/HU187329B/hu not_active IP Right Cessation
- 1981-03-27 NO NO811058A patent/NO156752C/no unknown
- 1981-03-27 ES ES500814A patent/ES500814A0/es active Granted
- 1981-03-27 IE IE706/81A patent/IE51319B1/en not_active IP Right Cessation
- 1981-03-28 RO RO81103848A patent/RO82508A/fr unknown
Also Published As
| Publication number | Publication date |
|---|---|
| RO82508B (ro) | 1983-08-30 |
| PT72740A (en) | 1981-04-01 |
| NO156752B (no) | 1987-08-10 |
| CA1163994A (fr) | 1984-03-20 |
| IE51319B1 (en) | 1986-12-10 |
| DK138281A (da) | 1981-09-29 |
| ES8300763A1 (es) | 1982-11-01 |
| FI71737C (fi) | 1987-02-09 |
| HU187329B (en) | 1985-12-28 |
| NO156752C (no) | 1987-11-18 |
| RO82508A (fr) | 1983-09-26 |
| FI71737B (fi) | 1986-10-31 |
| PT72740B (en) | 1982-11-16 |
| GR72488B (fr) | 1983-11-14 |
| DK159390B (da) | 1990-10-08 |
| DE3168433D1 (de) | 1985-03-07 |
| DK159390C (da) | 1991-03-04 |
| IL62494A (en) | 1984-08-31 |
| AU6842981A (en) | 1981-10-01 |
| PH16530A (en) | 1983-11-10 |
| SU1068037A3 (ru) | 1984-01-15 |
| YU43010B (en) | 1989-02-28 |
| EP0037265A1 (fr) | 1981-10-07 |
| EP0037265B1 (fr) | 1985-01-23 |
| NZ196522A (en) | 1985-10-11 |
| ES500814A0 (es) | 1982-11-01 |
| IE810706L (en) | 1981-09-28 |
| NO811058L (no) | 1981-09-29 |
| US4342870A (en) | 1982-08-03 |
| FI810956L (fi) | 1981-09-29 |
| IL62494A0 (en) | 1981-05-20 |
| AU537700B2 (en) | 1984-07-05 |
| BG36199A3 (en) | 1984-09-14 |
| MA19107A1 (fr) | 1981-10-01 |
| YU81081A (en) | 1983-12-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CS256366B2 (en) | Method of new 3-(1-piperidinylalkyl)-4h-pyridol(1,2-pyrimidine-4-on derivatives production | |
| EP0110435B1 (fr) | ((Bis(aryl)méthylène)-1-pipéridinyl)alcoyl-pyrimidinones | |
| EP0196132B1 (fr) | Dérivés de 1,2-benzisoxazol-3-yle et 1,2-benzisothiazol-3-yle | |
| EP0070053B1 (fr) | Dérivés bicycliques de pyrimidin-5-one | |
| US4581171A (en) | [[Bis(aryl)methylene]-1-piperidinyl]alkyl-pyrimidinones useful for treating psychotropic disorders | |
| DK173674B1 (da) | Anti-allergiske præparater indeholdende N-heterocyclyl-4-piperidinaminer, N-heterocyclyl-4-piperidinaminer til brug som antiallergikum og hidtil ukendte N-heterocyclyl-4-piperidinaminer samt fremgangsmåde til fremstilling deraf | |
| EP0453042B1 (fr) | 4H-pyrido-(1,2-a)pyrimidin-4-ones substituées sur les positiones 2 et 9 | |
| CZ279903B6 (cs) | Nové substituované thiazolylderiváty a substituované pyridinylderiváty, způsob jejich výroby a antialergické přípravky na jejich bázi | |
| EP0184258B1 (fr) | Dérivés de pipéridinylalkylquinazolines hydroxy ou amino-substituées | |
| EP0037713A1 (fr) | Dérivés de 1,3-dihydro-1-((1-pipéridinyl)alkyl)-2H-benzimidazol-2-one | |
| JPH0215550B2 (fr) | ||
| CZ297220B6 (cs) | Tetrahydro gama -karbolin, zpusob jeho prípravy apouzití, farmaceutická kompozice s jeho obsahem azpusob její prípravy | |
| US4665075A (en) | Derivatives of hydroxy- or amino-substituted (piperidinylalkyl)quinazolines | |
| US4533665A (en) | [[Bis(aryl)methylene]-1-piperidinyl]alkyl-pyrimidinones | |
| HU195793B (en) | Process for the production of new derivatives of 1,2-benziazol -3-il and medical compositions containing thereof as active substance | |
| JPH0433797B2 (fr) | ||
| JPH0480913B2 (fr) | ||
| CZ280767B6 (cs) | 1,2-benzisoxazol-3-ylové a 1,2-benzisothiazol-3-ylové deriváty, způsob jejich výroby a farmaceutické přípravky na jejich bázi |