CS212758B2 - Method of preparing p-aminobenzoic acid derivatives and salts thereof - Google Patents
Method of preparing p-aminobenzoic acid derivatives and salts thereof Download PDFInfo
- Publication number
- CS212758B2 CS212758B2 CS761599A CS159976A CS212758B2 CS 212758 B2 CS212758 B2 CS 212758B2 CS 761599 A CS761599 A CS 761599A CS 159976 A CS159976 A CS 159976A CS 212758 B2 CS212758 B2 CS 212758B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- mixture
- water
- ethanol
- formula
- ethyl
- Prior art date
Links
- 150000003839 salts Chemical class 0.000 title claims abstract description 17
- ALYNCZNDIQEVRV-UHFFFAOYSA-N 4-aminobenzoic acid Chemical class NC1=CC=C(C(O)=O)C=C1 ALYNCZNDIQEVRV-UHFFFAOYSA-N 0.000 title claims description 19
- 238000000034 method Methods 0.000 title claims description 16
- 150000001875 compounds Chemical class 0.000 claims abstract description 27
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 17
- 239000001257 hydrogen Substances 0.000 claims abstract description 14
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 14
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 10
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims abstract description 10
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims abstract description 3
- 238000002360 preparation method Methods 0.000 claims description 81
- -1 benzyloxy, phenyl Chemical group 0.000 claims description 58
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 31
- 239000002253 acid Substances 0.000 claims description 22
- 125000004432 carbon atom Chemical group C* 0.000 claims description 11
- 229910052736 halogen Inorganic materials 0.000 claims description 9
- 150000002367 halogens Chemical group 0.000 claims description 9
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 8
- 229910052783 alkali metal Inorganic materials 0.000 claims description 7
- 150000001340 alkali metals Chemical class 0.000 claims description 7
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 7
- 238000006243 chemical reaction Methods 0.000 claims description 6
- 239000000460 chlorine Substances 0.000 claims description 6
- 230000007062 hydrolysis Effects 0.000 claims description 5
- 238000006460 hydrolysis reaction Methods 0.000 claims description 5
- 230000009467 reduction Effects 0.000 claims description 4
- 238000006722 reduction reaction Methods 0.000 claims description 4
- 125000001544 thienyl group Chemical group 0.000 claims description 4
- 125000002252 acyl group Chemical group 0.000 claims description 3
- 125000004442 acylamino group Chemical group 0.000 claims description 3
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 3
- 230000003647 oxidation Effects 0.000 claims description 3
- 238000007254 oxidation reaction Methods 0.000 claims description 3
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims 2
- 229910052794 bromium Chemical group 0.000 claims 2
- 229910052801 chlorine Inorganic materials 0.000 claims 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 2
- 230000035484 reaction time Effects 0.000 claims 2
- 239000000203 mixture Substances 0.000 abstract description 178
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 abstract description 166
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 abstract description 56
- 239000005711 Benzoic acid Substances 0.000 abstract description 16
- 235000010233 benzoic acid Nutrition 0.000 abstract description 16
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 abstract description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract description 5
- NYNAMTQEBMCHNG-UHFFFAOYSA-N 4-(benzylamino)benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1NCC1=CC=CC=C1 NYNAMTQEBMCHNG-UHFFFAOYSA-N 0.000 abstract description 4
- PKQFILWCWUDHRT-UHFFFAOYSA-N ethyl 4-(benzylamino)benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1NCC1=CC=CC=C1 PKQFILWCWUDHRT-UHFFFAOYSA-N 0.000 abstract description 4
- 239000008194 pharmaceutical composition Substances 0.000 abstract description 4
- 230000002402 anti-lipaemic effect Effects 0.000 abstract description 3
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 abstract description 3
- 208000031226 Hyperlipidaemia Diseases 0.000 abstract description 2
- 125000003118 aryl group Chemical group 0.000 abstract description 2
- 239000003937 drug carrier Substances 0.000 abstract description 2
- 239000003960 organic solvent Substances 0.000 abstract description 2
- 239000003085 diluting agent Substances 0.000 abstract 2
- ATWTWCPPIGTUDC-UHFFFAOYSA-N 4-(3-phenylpropylamino)benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1NCCCC1=CC=CC=C1 ATWTWCPPIGTUDC-UHFFFAOYSA-N 0.000 abstract 1
- ZTRSGBHHPFPTEC-UHFFFAOYSA-N 4-[(4-methoxyphenyl)methylamino]benzoic acid Chemical compound C1=CC(OC)=CC=C1CNC1=CC=C(C(O)=O)C=C1 ZTRSGBHHPFPTEC-UHFFFAOYSA-N 0.000 abstract 1
- XZMCDFZZKTWFGF-UHFFFAOYSA-N Cyanamide Chemical compound NC#N XZMCDFZZKTWFGF-UHFFFAOYSA-N 0.000 abstract 1
- 125000004848 alkoxyethyl group Chemical group 0.000 abstract 1
- 150000005417 aminobenzoic acid derivatives Chemical class 0.000 abstract 1
- 125000001475 halogen functional group Chemical group 0.000 abstract 1
- 239000008223 sterile water Substances 0.000 abstract 1
- 125000001424 substituent group Chemical group 0.000 abstract 1
- 125000003107 substituted aryl group Chemical group 0.000 abstract 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 316
- 239000013078 crystal Substances 0.000 description 105
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 84
- 239000000243 solution Substances 0.000 description 71
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 65
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 51
- 239000007787 solid Substances 0.000 description 49
- 238000001953 recrystallisation Methods 0.000 description 42
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 36
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 35
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 33
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 32
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 27
- 239000003921 oil Substances 0.000 description 25
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 24
- 230000002829 reductive effect Effects 0.000 description 22
- 238000010992 reflux Methods 0.000 description 22
- BLFLLBZGZJTVJG-UHFFFAOYSA-N benzocaine Chemical compound CCOC(=O)C1=CC=C(N)C=C1 BLFLLBZGZJTVJG-UHFFFAOYSA-N 0.000 description 21
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 18
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 18
- 238000002844 melting Methods 0.000 description 17
- 230000008018 melting Effects 0.000 description 17
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 16
- 235000019341 magnesium sulphate Nutrition 0.000 description 16
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 16
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 15
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 14
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 12
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 12
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 11
- 238000001914 filtration Methods 0.000 description 11
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 11
- 239000000047 product Substances 0.000 description 11
- 239000002904 solvent Substances 0.000 description 11
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 10
- ZMXDDKWLCZADIW-UHFFFAOYSA-N dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 10
- 239000000126 substance Substances 0.000 description 10
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- 210000004369 blood Anatomy 0.000 description 9
- 239000008280 blood Substances 0.000 description 9
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 8
- 239000007788 liquid Substances 0.000 description 8
- 229940064734 aminobenzoate Drugs 0.000 description 7
- 239000012044 organic layer Substances 0.000 description 7
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- 241000124008 Mammalia Species 0.000 description 6
- 150000007513 acids Chemical class 0.000 description 6
- CMDKPGRTAQVGFQ-RMKNXTFCSA-N cinoxate Chemical compound CCOCCOC(=O)\C=C\C1=CC=C(OC)C=C1 CMDKPGRTAQVGFQ-RMKNXTFCSA-N 0.000 description 6
- 239000000284 extract Substances 0.000 description 6
- 239000000706 filtrate Substances 0.000 description 6
- 239000011734 sodium Substances 0.000 description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- 229930182558 Sterol Natural products 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 239000012259 ether extract Substances 0.000 description 5
- 150000002431 hydrogen Chemical class 0.000 description 5
- WVDDGKGOMKODPV-UHFFFAOYSA-N hydroxymethyl benzene Natural products OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 5
- 239000005457 ice water Substances 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- 235000003702 sterols Nutrition 0.000 description 5
- 238000012360 testing method Methods 0.000 description 5
- NPANKSZVBOAPFP-UHFFFAOYSA-N 3-(4-chlorophenyl)propyl methanesulfonate Chemical compound CS(=O)(=O)OCCCC1=CC=C(Cl)C=C1 NPANKSZVBOAPFP-UHFFFAOYSA-N 0.000 description 4
- 125000006201 3-phenylpropyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 4
- ZNEFGWKIWCVYPY-UHFFFAOYSA-N 4-[3-(4-chlorophenyl)propylamino]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1NCCCC1=CC=C(Cl)C=C1 ZNEFGWKIWCVYPY-UHFFFAOYSA-N 0.000 description 4
- FDXBUMXUJRZANT-UHFFFAOYSA-N 6-phenylhexan-1-ol Chemical compound OCCCCCCC1=CC=CC=C1 FDXBUMXUJRZANT-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- 229960000583 acetic acid Drugs 0.000 description 4
- 229960004050 aminobenzoic acid Drugs 0.000 description 4
- 125000003710 aryl alkyl group Chemical group 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 239000002775 capsule Substances 0.000 description 4
- 235000013305 food Nutrition 0.000 description 4
- 238000005932 reductive alkylation reaction Methods 0.000 description 4
- 239000000741 silica gel Substances 0.000 description 4
- 229910002027 silica gel Inorganic materials 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 235000009518 sodium iodide Nutrition 0.000 description 4
- 150000003432 sterols Chemical class 0.000 description 4
- 239000003826 tablet Substances 0.000 description 4
- FPNKNAFCJDIAFT-UHFFFAOYSA-N (4-decoxyphenyl)methanol Chemical compound CCCCCCCCCCOC1=CC=C(CO)C=C1 FPNKNAFCJDIAFT-UHFFFAOYSA-N 0.000 description 3
- AKKYADYOXUCSIZ-UHFFFAOYSA-N (4-decylphenyl)methanol Chemical compound CCCCCCCCCCC1=CC=C(CO)C=C1 AKKYADYOXUCSIZ-UHFFFAOYSA-N 0.000 description 3
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Natural products CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- 238000004458 analytical method Methods 0.000 description 3
- 239000003524 antilipemic agent Substances 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 229940079593 drug Drugs 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- KWWQSZAAIIHKEA-UHFFFAOYSA-N ethyl 4-[(4-methoxyphenyl)methylamino]benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1NCC1=CC=C(OC)C=C1 KWWQSZAAIIHKEA-UHFFFAOYSA-N 0.000 description 3
- DEKLNEJTQWIVAB-UHFFFAOYSA-N ethyl 4-[3-(4-chlorophenyl)propylamino]benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1NCCCC1=CC=C(Cl)C=C1 DEKLNEJTQWIVAB-UHFFFAOYSA-N 0.000 description 3
- 239000012362 glacial acetic acid Substances 0.000 description 3
- 125000005446 heptyloxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 3
- 230000000055 hyoplipidemic effect Effects 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- 210000002966 serum Anatomy 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 150000003626 triacylglycerols Chemical class 0.000 description 3
- WRMNZCZEMHIOCP-UHFFFAOYSA-N 2-phenylethanol Chemical compound OCCC1=CC=CC=C1 WRMNZCZEMHIOCP-UHFFFAOYSA-N 0.000 description 2
- VMJOFTHFJMLIKL-UHFFFAOYSA-N 2-thiophen-2-ylethanol Chemical compound OCCC1=CC=CS1 VMJOFTHFJMLIKL-UHFFFAOYSA-N 0.000 description 2
- YROPKZIQRUBCBO-UHFFFAOYSA-N 4-(11-phenylundecylamino)benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1NCCCCCCCCCCCC1=CC=CC=C1 YROPKZIQRUBCBO-UHFFFAOYSA-N 0.000 description 2
- ZAOAYQPSQDFOCJ-UHFFFAOYSA-N 4-(3-phenylprop-2-enylamino)benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1NCC=CC1=CC=CC=C1 ZAOAYQPSQDFOCJ-UHFFFAOYSA-N 0.000 description 2
- FYYLSCWWCHQDFX-UHFFFAOYSA-N 4-thiophen-2-ylbutan-1-ol Chemical compound OCCCCC1=CC=CS1 FYYLSCWWCHQDFX-UHFFFAOYSA-N 0.000 description 2
- ZWXBHANUTLAJCB-UHFFFAOYSA-N 6-phenylhexyl methanesulfonate Chemical compound CS(=O)(=O)OCCCCCCC1=CC=CC=C1 ZWXBHANUTLAJCB-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- 229920002261 Corn starch Polymers 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 2
- 235000019445 benzyl alcohol Nutrition 0.000 description 2
- 230000036765 blood level Effects 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- UORVGPXVDQYIDP-UHFFFAOYSA-N borane Chemical compound B UORVGPXVDQYIDP-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 125000000490 cinnamyl group Chemical group C(C=CC1=CC=CC=C1)* 0.000 description 2
- 229910017052 cobalt Inorganic materials 0.000 description 2
- 239000010941 cobalt Substances 0.000 description 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 2
- 239000008120 corn starch Substances 0.000 description 2
- JQVDAXLFBXTEQA-UHFFFAOYSA-N dibutylamine Chemical compound CCCCNCCCC JQVDAXLFBXTEQA-UHFFFAOYSA-N 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- 239000002552 dosage form Substances 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 2
- SHQYLPLNZKERSF-UHFFFAOYSA-N ethyl 4-(10-phenyldecylamino)benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1NCCCCCCCCCCC1=CC=CC=C1 SHQYLPLNZKERSF-UHFFFAOYSA-N 0.000 description 2
- GIGGNNKFGUTORV-UHFFFAOYSA-N ethyl 4-(2-thiophen-2-ylethylamino)benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1NCCC1=CC=CS1 GIGGNNKFGUTORV-UHFFFAOYSA-N 0.000 description 2
- WAAPJOADVFRISG-UHFFFAOYSA-N ethyl 4-[(4-decylphenyl)methylamino]benzoate Chemical compound C1=CC(CCCCCCCCCC)=CC=C1CNC1=CC=C(C(=O)OCC)C=C1 WAAPJOADVFRISG-UHFFFAOYSA-N 0.000 description 2
- RULCHCRTVBOSDR-UHFFFAOYSA-N ethyl 4-[3-(2-methoxyphenyl)propylamino]benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1NCCCC1=CC=CC=C1OC RULCHCRTVBOSDR-UHFFFAOYSA-N 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 239000000796 flavoring agent Substances 0.000 description 2
- 235000013355 food flavoring agent Nutrition 0.000 description 2
- 235000003599 food sweetener Nutrition 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 150000002632 lipids Chemical class 0.000 description 2
- 239000007937 lozenge Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 229910052987 metal hydride Inorganic materials 0.000 description 2
- 150000004681 metal hydrides Chemical class 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 229910000510 noble metal Inorganic materials 0.000 description 2
- 231100000252 nontoxic Toxicity 0.000 description 2
- 230000003000 nontoxic effect Effects 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- 239000000546 pharmaceutical excipient Substances 0.000 description 2
- 150000003904 phospholipids Chemical class 0.000 description 2
- 239000006187 pill Substances 0.000 description 2
- QELSKZZBTMNZEB-UHFFFAOYSA-N propylparaben Chemical compound CCCOC(=O)C1=CC=C(O)C=C1 QELSKZZBTMNZEB-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 239000005720 sucrose Substances 0.000 description 2
- 239000003765 sweetening agent Substances 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- UFTFJSFQGQCHQW-UHFFFAOYSA-N triformin Chemical compound O=COCC(OC=O)COC=O UFTFJSFQGQCHQW-UHFFFAOYSA-N 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- BMLPPYPVKNUKFX-UHFFFAOYSA-N (4-heptoxyphenyl)methanol Chemical compound CCCCCCCOC1=CC=C(CO)C=C1 BMLPPYPVKNUKFX-UHFFFAOYSA-N 0.000 description 1
- FMVCFXAHHYSGKF-UHFFFAOYSA-N (4-tridecoxyphenyl)methanol Chemical compound CCCCCCCCCCCCCOC1=CC=C(CO)C=C1 FMVCFXAHHYSGKF-UHFFFAOYSA-N 0.000 description 1
- GPHCPUFIWQJZOI-UHFFFAOYSA-N 1-(2-bromoethyl)naphthalene Chemical compound C1=CC=C2C(CCBr)=CC=CC2=C1 GPHCPUFIWQJZOI-UHFFFAOYSA-N 0.000 description 1
- LPUURRVXQCVXCX-UHFFFAOYSA-N 1-(2-chloroethyl)-4-fluorobenzene Chemical compound FC1=CC=C(CCCl)C=C1 LPUURRVXQCVXCX-UHFFFAOYSA-N 0.000 description 1
- YIWGJFPJRAEKMK-UHFFFAOYSA-N 1-(2H-benzotriazol-5-yl)-3-methyl-8-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carbonyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione Chemical compound CN1C(=O)N(c2ccc3n[nH]nc3c2)C2(CCN(CC2)C(=O)c2cnc(NCc3cccc(OC(F)(F)F)c3)nc2)C1=O YIWGJFPJRAEKMK-UHFFFAOYSA-N 0.000 description 1
- OMTJHFBMYNREKV-UHFFFAOYSA-N 1-(3-bromopropyl)-2-methoxybenzene Chemical compound COC1=CC=CC=C1CCCBr OMTJHFBMYNREKV-UHFFFAOYSA-N 0.000 description 1
- MOHYOXXOKFQHDC-UHFFFAOYSA-N 1-(chloromethyl)-4-methoxybenzene Chemical compound COC1=CC=C(CCl)C=C1 MOHYOXXOKFQHDC-UHFFFAOYSA-N 0.000 description 1
- HLQZCRVEEQKNMS-UHFFFAOYSA-N 1-(chloromethyl)-4-phenylbenzene Chemical group C1=CC(CCl)=CC=C1C1=CC=CC=C1 HLQZCRVEEQKNMS-UHFFFAOYSA-N 0.000 description 1
- DZMDPHNGKBEVRE-UHFFFAOYSA-N 1-chloroheptane Chemical compound CCCCCCCCl DZMDPHNGKBEVRE-UHFFFAOYSA-N 0.000 description 1
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 1
- OBWRNKAOHPYPCJ-UHFFFAOYSA-N 10-chlorodecylbenzene Chemical compound ClCCCCCCCCCCC1=CC=CC=C1 OBWRNKAOHPYPCJ-UHFFFAOYSA-N 0.000 description 1
- GYJGXXOTJSTLFP-UHFFFAOYSA-N 11-phenylundecyl methanesulfonate Chemical compound CS(=O)(=O)OCCCCCCCCCCCC1=CC=CC=C1 GYJGXXOTJSTLFP-UHFFFAOYSA-N 0.000 description 1
- XJHGAJLIKDAOPE-UHFFFAOYSA-N 2-(4-phenylmethoxyphenyl)acetic acid Chemical compound C1=CC(CC(=O)O)=CC=C1OCC1=CC=CC=C1 XJHGAJLIKDAOPE-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- AVQLZVRSIQXOQD-UHFFFAOYSA-N 2-amino-4-[3-(4-chlorophenyl)propyl]benzoic acid Chemical compound ClC1=CC=C(C=C1)CCCC1=CC(=C(C(=O)O)C=C1)N AVQLZVRSIQXOQD-UHFFFAOYSA-N 0.000 description 1
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 1
- WMPPDTMATNBGJN-UHFFFAOYSA-N 2-phenylethylbromide Chemical compound BrCCC1=CC=CC=C1 WMPPDTMATNBGJN-UHFFFAOYSA-N 0.000 description 1
- MFFBRYVNFNFSMY-UHFFFAOYSA-N 2-phenylundecanoic acid Chemical compound CCCCCCCCCC(C(O)=O)C1=CC=CC=C1 MFFBRYVNFNFSMY-UHFFFAOYSA-N 0.000 description 1
- ZHBIWFGGIKFSHZ-UHFFFAOYSA-N 3-(4-chlorophenyl)propan-1-ol Chemical compound OCCCC1=CC=C(Cl)C=C1 ZHBIWFGGIKFSHZ-UHFFFAOYSA-N 0.000 description 1
- BBSLOKZINKEUCR-UHFFFAOYSA-N 3-(4-chlorophenyl)propanoic acid Chemical compound OC(=O)CCC1=CC=C(Cl)C=C1 BBSLOKZINKEUCR-UHFFFAOYSA-N 0.000 description 1
- FZALPKMIIYFLAP-UHFFFAOYSA-N 3-(4-phenylmethoxyphenyl)propan-1-ol Chemical compound C1=CC(CCCO)=CC=C1OCC1=CC=CC=C1 FZALPKMIIYFLAP-UHFFFAOYSA-N 0.000 description 1
- SKLMHIUCQGXZLO-UHFFFAOYSA-N 3-(4-phenylmethoxyphenyl)propyl methanesulfonate Chemical compound C1=CC(CCCOS(=O)(=O)C)=CC=C1OCC1=CC=CC=C1 SKLMHIUCQGXZLO-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- XMZQWZJMTBCUFT-UHFFFAOYSA-N 3-bromopropylbenzene Chemical compound BrCCCC1=CC=CC=C1 XMZQWZJMTBCUFT-UHFFFAOYSA-N 0.000 description 1
- GXIFBRAFSGFCRS-UHFFFAOYSA-N 4-(10-phenyldecylamino)benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1NCCCCCCCCCCC1=CC=CC=C1 GXIFBRAFSGFCRS-UHFFFAOYSA-N 0.000 description 1
- WUODSBRZZIFCDW-UHFFFAOYSA-N 4-(2-phenylethylamino)benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1NCCC1=CC=CC=C1 WUODSBRZZIFCDW-UHFFFAOYSA-N 0.000 description 1
- YRQCINPHLQENIA-UHFFFAOYSA-N 4-(2-thiophen-2-ylethylamino)benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1NCCC1=CC=CS1 YRQCINPHLQENIA-UHFFFAOYSA-N 0.000 description 1
- CUCWNEGRDFOXPR-UHFFFAOYSA-N 4-(5-phenylpentylamino)benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1NCCCCCC1=CC=CC=C1 CUCWNEGRDFOXPR-UHFFFAOYSA-N 0.000 description 1
- QWUMPYQNEHASHU-UHFFFAOYSA-N 4-(7-phenylheptylamino)benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1NCCCCCCCC1=CC=CC=C1 QWUMPYQNEHASHU-UHFFFAOYSA-N 0.000 description 1
- NKZLRBAWZWSIKR-UHFFFAOYSA-N 4-(8-phenyloctylamino)benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1NCCCCCCCCC1=CC=CC=C1 NKZLRBAWZWSIKR-UHFFFAOYSA-N 0.000 description 1
- HYSBLELZKOSEQL-UHFFFAOYSA-N 4-(9-phenylnonylamino)benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1NCCCCCCCCCC1=CC=CC=C1 HYSBLELZKOSEQL-UHFFFAOYSA-N 0.000 description 1
- OEBIVOHKFYSBPE-UHFFFAOYSA-N 4-Benzyloxybenzyl alcohol Chemical compound C1=CC(CO)=CC=C1OCC1=CC=CC=C1 OEBIVOHKFYSBPE-UHFFFAOYSA-N 0.000 description 1
- MWFLXYURAGYJTG-UHFFFAOYSA-N 4-[(4-decoxyphenyl)methylamino]benzoic acid Chemical compound C1=CC(OCCCCCCCCCC)=CC=C1CNC1=CC=C(C(O)=O)C=C1 MWFLXYURAGYJTG-UHFFFAOYSA-N 0.000 description 1
- UJDYXOGMACCBAF-UHFFFAOYSA-N 4-[(4-phenylmethoxyphenyl)methylamino]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1NCC(C=C1)=CC=C1OCC1=CC=CC=C1 UJDYXOGMACCBAF-UHFFFAOYSA-N 0.000 description 1
- RZMYOCWBBSXLBP-UHFFFAOYSA-N 4-[(4-tridecoxyphenyl)methylamino]benzoic acid Chemical compound C1=CC(OCCCCCCCCCCCCC)=CC=C1CNC1=CC=C(C(O)=O)C=C1 RZMYOCWBBSXLBP-UHFFFAOYSA-N 0.000 description 1
- TYMFNSVPBRYMTN-UHFFFAOYSA-N 4-[2-(4-fluorophenyl)ethylamino]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1NCCC1=CC=C(F)C=C1 TYMFNSVPBRYMTN-UHFFFAOYSA-N 0.000 description 1
- DHVPPWMQMNKCJK-UHFFFAOYSA-N 4-[2-(4-phenylmethoxyphenyl)ethylamino]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1NCCC(C=C1)=CC=C1OCC1=CC=CC=C1 DHVPPWMQMNKCJK-UHFFFAOYSA-N 0.000 description 1
- JCXWRKQNBURTFZ-UHFFFAOYSA-N 4-[3-(2-methoxyphenyl)propylamino]benzoic acid Chemical compound COC1=CC=CC=C1CCCNC1=CC=C(C(O)=O)C=C1 JCXWRKQNBURTFZ-UHFFFAOYSA-N 0.000 description 1
- YBAZINRZQSAIAY-UHFFFAOYSA-N 4-aminobenzonitrile Chemical compound NC1=CC=C(C#N)C=C1 YBAZINRZQSAIAY-UHFFFAOYSA-N 0.000 description 1
- NZNICZRIRMGOFG-UHFFFAOYSA-N 4-decoxybenzoic acid Chemical compound CCCCCCCCCCOC1=CC=C(C(O)=O)C=C1 NZNICZRIRMGOFG-UHFFFAOYSA-N 0.000 description 1
- RTRTWCIWPQFYDU-UHFFFAOYSA-N 4-decylbenzoic acid Chemical compound CCCCCCCCCCC1=CC=C(C(O)=O)C=C1 RTRTWCIWPQFYDU-UHFFFAOYSA-N 0.000 description 1
- QYHMLTVCBNFGAU-UHFFFAOYSA-N 4-tridecoxybenzoic acid Chemical compound CCCCCCCCCCCCCOC1=CC=C(C(O)=O)C=C1 QYHMLTVCBNFGAU-UHFFFAOYSA-N 0.000 description 1
- UXJLBVYYDZDPBV-UHFFFAOYSA-N 5-chloropentylbenzene Chemical compound ClCCCCCC1=CC=CC=C1 UXJLBVYYDZDPBV-UHFFFAOYSA-N 0.000 description 1
- JTXZPQIXIXYMDY-UHFFFAOYSA-N 6-phenylhexanoic acid Chemical compound OC(=O)CCCCCC1=CC=CC=C1 JTXZPQIXIXYMDY-UHFFFAOYSA-N 0.000 description 1
- GVDYDOFBAKCSGC-UHFFFAOYSA-N 8-chlorooctylbenzene Chemical compound ClCCCCCCCCC1=CC=CC=C1 GVDYDOFBAKCSGC-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- 201000001320 Atherosclerosis Diseases 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 241000167854 Bourreria succulenta Species 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- XUIIKFGFIJCVMT-GFCCVEGCSA-N D-thyroxine Chemical compound IC1=CC(C[C@@H](N)C(O)=O)=CC(I)=C1OC1=CC(I)=C(O)C(I)=C1 XUIIKFGFIJCVMT-GFCCVEGCSA-N 0.000 description 1
- 235000019739 Dicalciumphosphate Nutrition 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- 240000007472 Leucaena leucocephala Species 0.000 description 1
- QSACCXVHEVWNMX-UHFFFAOYSA-M N-acetylanthranilate Chemical compound CC(=O)NC1=CC=CC=C1C([O-])=O QSACCXVHEVWNMX-UHFFFAOYSA-M 0.000 description 1
- UYOUUGIWAUBXAU-UHFFFAOYSA-N N-diaminophosphorylmethanamine hexane Chemical compound CCCCCC.CNP(N)(N)=O UYOUUGIWAUBXAU-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- 229920001800 Shellac Polymers 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- IWTYTFSSTWXZFU-QPJJXVBHSA-N [(e)-3-chloroprop-1-enyl]benzene Chemical compound ClC\C=C\C1=CC=CC=C1 IWTYTFSSTWXZFU-QPJJXVBHSA-N 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910001516 alkali metal iodide Inorganic materials 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 239000010775 animal oil Substances 0.000 description 1
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical compound NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- WVHBHPATSLQXGC-UHFFFAOYSA-N benzene;ethanol Chemical compound CCO.C1=CC=CC=C1 WVHBHPATSLQXGC-UHFFFAOYSA-N 0.000 description 1
- 229960005274 benzocaine Drugs 0.000 description 1
- 150000001559 benzoic acids Chemical class 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910000085 borane Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 238000005266 casting Methods 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000012824 chemical production Methods 0.000 description 1
- 235000019693 cherries Nutrition 0.000 description 1
- 229940112822 chewing gum Drugs 0.000 description 1
- 235000015218 chewing gum Nutrition 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- 235000012000 cholesterol Nutrition 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- KNHUKKLJHYUCFP-UHFFFAOYSA-N clofibrate Chemical compound CCOC(=O)C(C)(C)OC1=CC=C(Cl)C=C1 KNHUKKLJHYUCFP-UHFFFAOYSA-N 0.000 description 1
- 229960001214 clofibrate Drugs 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000007398 colorimetric assay Methods 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 239000010779 crude oil Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 125000006612 decyloxy group Chemical group 0.000 description 1
- 229960001767 dextrothyroxine Drugs 0.000 description 1
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 description 1
- 229940038472 dicalcium phosphate Drugs 0.000 description 1
- 229910000390 dicalcium phosphate Inorganic materials 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 239000000469 ethanolic extract Substances 0.000 description 1
- DDZAGRZCSAAWGV-UHFFFAOYSA-N ethyl 4-(2-naphthalen-1-ylethylamino)benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1NCCC1=CC=CC2=CC=CC=C12 DDZAGRZCSAAWGV-UHFFFAOYSA-N 0.000 description 1
- JCPLDCLOJGGGLY-UHFFFAOYSA-N ethyl 4-(3-phenylprop-2-enylamino)benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1NCC=CC1=CC=CC=C1 JCPLDCLOJGGGLY-UHFFFAOYSA-N 0.000 description 1
- CBYXFOBAWNXUAT-UHFFFAOYSA-N ethyl 4-(8-phenyloctylamino)benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1NCCCCCCCCC1=CC=CC=C1 CBYXFOBAWNXUAT-UHFFFAOYSA-N 0.000 description 1
- XSWRXFKFYQGOEP-UHFFFAOYSA-N ethyl 4-[(4-heptoxyphenyl)methylamino]benzoate Chemical compound C1=CC(OCCCCCCC)=CC=C1CNC1=CC=C(C(=O)OCC)C=C1 XSWRXFKFYQGOEP-UHFFFAOYSA-N 0.000 description 1
- GOBYFGLUHUGHDQ-UHFFFAOYSA-N ethyl 4-[(4-phenylmethoxyphenyl)methylamino]benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1NCC(C=C1)=CC=C1OCC1=CC=CC=C1 GOBYFGLUHUGHDQ-UHFFFAOYSA-N 0.000 description 1
- IDKFNNMVIRJOOT-UHFFFAOYSA-N ethyl 4-[2-(4-phenylmethoxyphenyl)ethylamino]benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1NCCC(C=C1)=CC=C1OCC1=CC=CC=C1 IDKFNNMVIRJOOT-UHFFFAOYSA-N 0.000 description 1
- MSNHSRBIKKGATN-UHFFFAOYSA-N ethyl 4-[3-(4-phenylmethoxyphenyl)propylamino]benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1NCCCC(C=C1)=CC=C1OCC1=CC=CC=C1 MSNHSRBIKKGATN-UHFFFAOYSA-N 0.000 description 1
- MTZQAGJQAFMTAQ-UHFFFAOYSA-N ethyl benzoate Chemical group CCOC(=O)C1=CC=CC=C1 MTZQAGJQAFMTAQ-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 238000007429 general method Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 125000001841 imino group Chemical group [H]N=* 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 235000012054 meals Nutrition 0.000 description 1
- 239000004292 methyl p-hydroxybenzoate Substances 0.000 description 1
- 235000010270 methyl p-hydroxybenzoate Nutrition 0.000 description 1
- 229960002216 methylparaben Drugs 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 229960003512 nicotinic acid Drugs 0.000 description 1
- 235000001968 nicotinic acid Nutrition 0.000 description 1
- 239000011664 nicotinic acid Substances 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- LXCFILQKKLGQFO-UHFFFAOYSA-N p-hydroxybenzoic acid methyl ester Natural products COC(=O)C1=CC=C(O)C=C1 LXCFILQKKLGQFO-UHFFFAOYSA-N 0.000 description 1
- 125000004344 phenylpropyl group Chemical group 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- RAIYODFGMLZUDF-UHFFFAOYSA-N piperidin-1-ium;acetate Chemical compound CC([O-])=O.C1CC[NH2+]CC1 RAIYODFGMLZUDF-UHFFFAOYSA-N 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 125000006308 propyl amino group Chemical group 0.000 description 1
- 239000004405 propyl p-hydroxybenzoate Substances 0.000 description 1
- 235000010232 propyl p-hydroxybenzoate Nutrition 0.000 description 1
- 229960003415 propylparaben Drugs 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 1
- 229940081974 saccharin Drugs 0.000 description 1
- 235000019204 saccharin Nutrition 0.000 description 1
- 239000000901 saccharin and its Na,K and Ca salt Substances 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 239000004208 shellac Substances 0.000 description 1
- ZLGIYFNHBLSMPS-ATJNOEHPSA-N shellac Chemical compound OCCCCCC(O)C(O)CCCCCCCC(O)=O.C1C23[C@H](C(O)=O)CCC2[C@](C)(CO)[C@@H]1C(C(O)=O)=C[C@@H]3O ZLGIYFNHBLSMPS-ATJNOEHPSA-N 0.000 description 1
- 229940113147 shellac Drugs 0.000 description 1
- 235000013874 shellac Nutrition 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000013268 sustained release Methods 0.000 description 1
- 239000012730 sustained-release form Substances 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 235000012431 wafers Nutrition 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C229/00—Compounds containing amino and carboxyl groups bound to the same carbon skeleton
- C07C229/52—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton
- C07C229/54—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton with amino and carboxyl groups bound to carbon atoms of the same non-condensed six-membered aromatic ring
- C07C229/60—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton with amino and carboxyl groups bound to carbon atoms of the same non-condensed six-membered aromatic ring with amino and carboxyl groups bound in meta- or para- positions
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/14—Radicals substituted by singly bound hetero atoms other than halogen
- C07D333/20—Radicals substituted by singly bound hetero atoms other than halogen by nitrogen atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/06—Antihyperlipidemics
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C29/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring
- C07C29/132—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group
- C07C29/136—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group of >C=O containing groups, e.g. —COOH
- C07C29/147—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group of >C=O containing groups, e.g. —COOH of carboxylic acids or derivatives thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
- C07C309/63—Esters of sulfonic acids
- C07C309/64—Esters of sulfonic acids having sulfur atoms of esterified sulfo groups bound to acyclic carbon atoms
- C07C309/65—Esters of sulfonic acids having sulfur atoms of esterified sulfo groups bound to acyclic carbon atoms of a saturated carbon skeleton
- C07C309/66—Methanesulfonates
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/14—Radicals substituted by singly bound hetero atoms other than halogen
- C07D333/16—Radicals substituted by singly bound hetero atoms other than halogen by oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Diabetes (AREA)
- Hematology (AREA)
- Obesity (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/557,550 US4185115A (en) | 1975-03-12 | 1975-03-12 | Antilipidemic para-[aryl(alkyl or alkenyl)amino]-benzoic acid derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS212758B2 true CS212758B2 (en) | 1982-03-26 |
Family
ID=24225890
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS761599A CS212758B2 (en) | 1975-03-12 | 1976-03-11 | Method of preparing p-aminobenzoic acid derivatives and salts thereof |
Country Status (24)
| Country | Link |
|---|---|
| US (1) | US4185115A (ro) |
| JP (1) | JPS51113838A (ro) |
| AR (1) | AR215241A1 (ro) |
| AU (1) | AU504690B2 (ro) |
| BE (1) | BE839382A (ro) |
| CH (1) | CH628614A5 (ro) |
| CS (1) | CS212758B2 (ro) |
| DD (1) | DD125926A5 (ro) |
| DE (1) | DE2609962A1 (ro) |
| ES (1) | ES445994A1 (ro) |
| FR (2) | FR2303534A1 (ro) |
| GB (1) | GB1535967A (ro) |
| HK (1) | HK69179A (ro) |
| HU (1) | HU173416B (ro) |
| IE (1) | IE44285B1 (ro) |
| IL (1) | IL49012A (ro) |
| MX (1) | MX3788E (ro) |
| NL (1) | NL7602332A (ro) |
| PL (1) | PL112967B1 (ro) |
| RO (1) | RO71822A (ro) |
| SE (1) | SE7602869L (ro) |
| SU (1) | SU803856A3 (ro) |
| YU (1) | YU47676A (ro) |
| ZA (1) | ZA76902B (ro) |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1576841A (en) * | 1977-01-22 | 1980-10-15 | Beecham Group Ltd | Substituted n-acyl phenylamine compounds having hypolipidaemic activity |
| US4192884A (en) | 1977-04-07 | 1980-03-11 | The Dow Chemical Company | Substituted 4-(((thienyl)methyl)-amino)benzoic acids and a method for treating hypolipidemia |
| CH629796A5 (en) * | 1977-04-07 | 1982-05-14 | Dow Chemical Co | Therapeutically active compounds of 4-(2-thienylmethylamino)benzoic acid |
| IL56517A0 (en) * | 1978-02-02 | 1979-03-12 | American Cyanamid Co | Novel 4-(cycloalkyl or cyclalkenyl substituted) amino, alkylamino or alkenylamino benzoic acids, salts and derivatives |
| US4230878A (en) | 1978-03-08 | 1980-10-28 | American Cyanamid Company | Hypolipidemic and antiatherosclerotic 4-[(cyclopropyl alkyl)amino]benzoic acids and derivatives |
| US4178385A (en) | 1978-03-03 | 1979-12-11 | The Dow Chemical Company | Method for treating hyperlipidemia in primates using 4-((4-fluorophenylmethyl)amino)benzoic acid |
| US4181737A (en) | 1978-05-18 | 1980-01-01 | The Dow Chemical Company | 4-((3-Methoxyphenyl)amino)benzoic acid, a method for treating hyperlipidemia, and compositions thereof |
| DE2964790D1 (en) * | 1978-06-23 | 1983-03-24 | Dow Chemical Co | Hypoglycemic phenylpropynylamino benzoic acids, their salts, pharmaceutical compositions containing said compounds and their application |
| US4143151A (en) * | 1978-07-03 | 1979-03-06 | The Dow Chemical Company | Method for treating hyperglycemia in mammals using arylamino benzoic acids |
| US4207330A (en) * | 1978-07-03 | 1980-06-10 | The Dow Chemical Company | Method for treating hyperglycemia in mammals using arylamino benzoic acids |
| US4206223A (en) * | 1979-01-05 | 1980-06-03 | The Dow Chemical Company | Method for treating hyperglycemia in mammals using 4-(((1,3-benzodioxol-5-yl)methyl)amino)benzoic acid or derivatives thereof |
| US4281019A (en) * | 1979-02-01 | 1981-07-28 | American Cyanamid Company | 4-[(Unsaturated or cyclopropylated alkyl)amino]phenyl compounds useful as hypolipidemic and antiatherosclerotic agents |
| US4263320A (en) * | 1979-06-04 | 1981-04-21 | The Dow Chemical Company | Hypoglycemic phenylpropynylamino benzoic acids |
| US4375478A (en) * | 1982-03-02 | 1983-03-01 | Abbott Laboratories | Aminobenzoic acid derivatives |
| US7214825B2 (en) * | 2003-10-17 | 2007-05-08 | Honeywell International Inc. | O-(3-chloropropenyl) hydroxylamine free base |
| WO2006126846A1 (en) * | 2005-05-25 | 2006-11-30 | Choongwae Pharma Corporation | Process of preparation of substituted tetrafluorobenzylaniline compound and its pharmaceutically approved salts |
| WO2008121570A1 (en) * | 2007-03-29 | 2008-10-09 | Irm Llc | Compounds and methods for modulating g protein-coupled receptors |
| CN109206333A (zh) * | 2018-10-16 | 2019-01-15 | 河南师范大学 | 一种具有抗菌活性的苯佐卡因单取代衍生物的合成方法和应用 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3868416A (en) * | 1973-10-01 | 1975-02-25 | American Cyanamid Co | Hypolipidemic 4-(monoalkylamino)benzoic acid derivatives |
| GB1576007A (en) * | 1976-02-11 | 1980-10-01 | Beecham Group Ltd | Hypolipidaemic compositions |
-
1975
- 1975-03-12 US US05/557,550 patent/US4185115A/en not_active Expired - Lifetime
-
1976
- 1976-02-11 IL IL49012A patent/IL49012A/xx unknown
- 1976-02-12 AU AU11036/76A patent/AU504690B2/en not_active Expired
- 1976-02-16 GB GB6047/76A patent/GB1535967A/en not_active Expired
- 1976-02-16 ZA ZA902A patent/ZA76902B/xx unknown
- 1976-02-24 AR AR262358A patent/AR215241A1/es active
- 1976-02-26 YU YU00476/76A patent/YU47676A/xx unknown
- 1976-02-27 SE SE7602869A patent/SE7602869L/xx not_active Application Discontinuation
- 1976-03-05 NL NL7602332A patent/NL7602332A/xx not_active Application Discontinuation
- 1976-03-09 HU HU76AE461A patent/HU173416B/hu unknown
- 1976-03-10 BE BE165004A patent/BE839382A/xx unknown
- 1976-03-10 DE DE19762609962 patent/DE2609962A1/de not_active Withdrawn
- 1976-03-10 FR FR7606862A patent/FR2303534A1/fr active Granted
- 1976-03-11 CS CS761599A patent/CS212758B2/cs unknown
- 1976-03-11 MX MX7664U patent/MX3788E/es unknown
- 1976-03-11 RO RO7685064A patent/RO71822A/ro unknown
- 1976-03-11 IE IE514/76A patent/IE44285B1/en unknown
- 1976-03-11 PL PL1976187839A patent/PL112967B1/pl unknown
- 1976-03-12 DD DD191825A patent/DD125926A5/xx unknown
- 1976-03-12 CH CH313876A patent/CH628614A5/de not_active IP Right Cessation
- 1976-03-12 ES ES445994A patent/ES445994A1/es not_active Expired
- 1976-03-12 JP JP51026980A patent/JPS51113838A/ja active Pending
- 1976-03-12 SU SU762332503A patent/SU803856A3/ru active
-
1979
- 1979-07-10 FR FR7917907A patent/FR2436132A1/fr not_active Withdrawn
- 1979-09-27 HK HK691/79A patent/HK69179A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CH628614A5 (de) | 1982-03-15 |
| AR215241A1 (es) | 1979-09-28 |
| HK69179A (en) | 1979-10-05 |
| FR2303534B1 (ro) | 1981-08-28 |
| PL112967B1 (en) | 1980-11-29 |
| HU173416B (hu) | 1979-05-28 |
| FR2436132A1 (fr) | 1980-04-11 |
| IE44285L (en) | 1976-09-12 |
| YU47676A (en) | 1983-04-30 |
| GB1535967A (en) | 1978-12-13 |
| MX3788E (es) | 1981-07-20 |
| DD125926A5 (ro) | 1977-06-01 |
| SE7602869L (sv) | 1976-12-06 |
| IL49012A (en) | 1980-12-31 |
| ZA76902B (en) | 1977-01-26 |
| IL49012A0 (en) | 1976-04-30 |
| SU803856A3 (ru) | 1981-02-07 |
| BE839382A (fr) | 1976-09-10 |
| US4185115A (en) | 1980-01-22 |
| RO71822A (ro) | 1982-02-01 |
| IE44285B1 (en) | 1981-10-07 |
| AU1103676A (en) | 1977-08-18 |
| JPS51113838A (en) | 1976-10-07 |
| AU504690B2 (en) | 1979-10-25 |
| NL7602332A (nl) | 1976-09-14 |
| DE2609962A1 (de) | 1976-09-30 |
| FR2303534A1 (fr) | 1976-10-08 |
| ES445994A1 (es) | 1977-10-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CS212758B2 (en) | Method of preparing p-aminobenzoic acid derivatives and salts thereof | |
| CA1077957A (en) | Hypolipidemic 4-(monoalkylamino) benzoic acid derivatives | |
| DE69409525T2 (de) | Acetamidderivate und ihre verwendung als modifizierungsmittel des verhaltens der verdauung | |
| US4277497A (en) | Analgesic 2-(M-benzoylphenoxy)-propionic acid derivatives | |
| US3781328A (en) | Phenoxy-alkyl-carboxylic acid compounds | |
| DE3875782T2 (de) | Leucotrien-antagonisten. | |
| CA2637884A1 (en) | Compounds for the treatment of metabolic disorders | |
| HU177559B (en) | Process for producing new n-aroyl or n-heteroaroyl-substituted-p-amino-alkylphenylalkane carboxylic acids,and esters,amides and physiologically acceptable salts thereof | |
| US4350822A (en) | Antilipidemicpara-[aryl(alkyl or alkenyl)amino]benzoic acid derivatives | |
| US3957850A (en) | Phenylacetic acid derivatives | |
| NO175714B (no) | Analogifremgangsmåte for fremstilling av terapeutisk aktive, aromatiske estere | |
| DE2537070C2 (ro) | ||
| FR2493315A1 (fr) | Derive de piperazine, procede pour sa preparation et composition analgesique en contenant | |
| DE3035086A1 (de) | Cyclohexancarbonsaeurederivate, verfahren zu ihrer herstellung und sie enthaltende mittel | |
| DE69414194T2 (de) | Aminosäurederivate und ihre Verwendung als Enkephalinase-Inhibitoren | |
| US3410891A (en) | Novel thyronine derivatives | |
| US4260816A (en) | Naphthyloxyalkylaminobenzoic acids, salts and esters thereof | |
| JPH0692385B2 (ja) | 新規なチオフェン誘導体 | |
| CA1139763A (fr) | Procede d'obtention de nouveaux aryltrifluoroethanols | |
| US5451606A (en) | Anthraquinone compounds useful to treat osteoarticular conditions, pharmaceutical compositions and method of treatment | |
| US4473583A (en) | Compositions containing certain derivatives of 4-phenyl-4-oxobuten-2-oic acid and methods of treatment using them | |
| DE2600513A1 (de) | Acylamino(alkyl)benzolderivate und verfahren zu ihrer herstellung | |
| EP0083222B1 (en) | New quinolylacetic acid compounds and pharmaceutical compositions containing them | |
| US4182776A (en) | Method of treating lipidemia with aryloxyalkylaminobenzoic acids and esters | |
| DE69713128T2 (de) | 4-(1-piperazinyl)benzosäurederivate, verfahren zu ihrer herstellung und ihre therapeutischen verwendungen |