CS198271B2 - Method of monoacylation of water insoluble organic amino compounds - Google Patents
Method of monoacylation of water insoluble organic amino compounds Download PDFInfo
- Publication number
- CS198271B2 CS198271B2 CS776702A CS670277A CS198271B2 CS 198271 B2 CS198271 B2 CS 198271B2 CS 776702 A CS776702 A CS 776702A CS 670277 A CS670277 A CS 670277A CS 198271 B2 CS198271 B2 CS 198271B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- amino
- reaction
- acid
- solution
- water
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 13
- 150000004027 organic amino compounds Chemical class 0.000 title abstract description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 title description 8
- 238000006243 chemical reaction Methods 0.000 claims abstract description 31
- 230000008569 process Effects 0.000 claims abstract description 11
- 239000000376 reactant Substances 0.000 claims abstract description 8
- 239000007795 chemical reaction product Substances 0.000 claims abstract description 5
- 239000002253 acid Substances 0.000 claims description 21
- 150000007513 acids Chemical class 0.000 claims description 3
- 150000001413 amino acids Chemical class 0.000 claims description 2
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical class NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 claims description 2
- 150000001768 cations Chemical class 0.000 claims 1
- 150000001844 chromium Chemical class 0.000 claims 1
- VMKJWLXVLHBJNK-UHFFFAOYSA-N cyanuric fluoride Chemical compound FC1=NC(F)=NC(F)=N1 VMKJWLXVLHBJNK-UHFFFAOYSA-N 0.000 abstract description 2
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 27
- 239000000243 solution Substances 0.000 description 26
- 239000000975 dye Substances 0.000 description 17
- 239000000047 product Substances 0.000 description 15
- -1 amine compounds Chemical class 0.000 description 8
- 239000007864 aqueous solution Substances 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 7
- 239000000985 reactive dye Substances 0.000 description 6
- 229920000742 Cotton Polymers 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- HVBSAKJJOYLTQU-UHFFFAOYSA-N 4-aminobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1 HVBSAKJJOYLTQU-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 3
- 125000003277 amino group Chemical group 0.000 description 3
- 230000008901 benefit Effects 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 230000005494 condensation Effects 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 239000001488 sodium phosphate Substances 0.000 description 3
- 229910000162 sodium phosphate Inorganic materials 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 3
- CRTIGUQLTBDWKN-UHFFFAOYSA-N 1-aminocyclohexa-2,4-diene-1-sulfonic acid Chemical compound OS(=O)(=O)C1(N)CC=CC=C1 CRTIGUQLTBDWKN-UHFFFAOYSA-N 0.000 description 2
- PLIKAWJENQZMHA-UHFFFAOYSA-N 4-aminophenol Chemical compound NC1=CC=C(O)C=C1 PLIKAWJENQZMHA-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000012267 brine Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 125000001153 fluoro group Chemical group F* 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- RNVCVTLRINQCPJ-UHFFFAOYSA-N o-toluidine Chemical compound CC1=CC=CC=C1N RNVCVTLRINQCPJ-UHFFFAOYSA-N 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- 230000009257 reactivity Effects 0.000 description 2
- 230000000717 retained effect Effects 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 229950000244 sulfanilic acid Drugs 0.000 description 2
- HEAHMJLHQCESBZ-UHFFFAOYSA-N 2,5-diaminobenzenesulfonic acid Chemical compound NC1=CC=C(N)C(S(O)(=O)=O)=C1 HEAHMJLHQCESBZ-UHFFFAOYSA-N 0.000 description 1
- ZMCHBSMFKQYNKA-UHFFFAOYSA-N 2-aminobenzenesulfonic acid Chemical compound NC1=CC=CC=C1S(O)(=O)=O ZMCHBSMFKQYNKA-UHFFFAOYSA-N 0.000 description 1
- ZAJAQTYSTDTMCU-UHFFFAOYSA-N 3-aminobenzenesulfonic acid Chemical compound NC1=CC=CC(S(O)(=O)=O)=C1 ZAJAQTYSTDTMCU-UHFFFAOYSA-N 0.000 description 1
- MUNOBADFTHUUFG-UHFFFAOYSA-N 3-phenylaniline Chemical compound NC1=CC=CC(C=2C=CC=CC=2)=C1 MUNOBADFTHUUFG-UHFFFAOYSA-N 0.000 description 1
- YADSWTKOIHUSDX-UHFFFAOYSA-N 4,6-diaminobenzene-1,3-disulfonic acid Chemical compound NC1=CC(N)=C(S(O)(=O)=O)C=C1S(O)(=O)=O YADSWTKOIHUSDX-UHFFFAOYSA-N 0.000 description 1
- ZDIRCGKEOWZBIM-UHFFFAOYSA-N 4-amino-2-methylbenzenesulfonic acid Chemical compound CC1=CC(N)=CC=C1S(O)(=O)=O ZDIRCGKEOWZBIM-UHFFFAOYSA-N 0.000 description 1
- UWPJYQYRSWYIGZ-UHFFFAOYSA-N 5-aminonaphthalene-2-sulfonic acid Chemical compound OS(=O)(=O)C1=CC=C2C(N)=CC=CC2=C1 UWPJYQYRSWYIGZ-UHFFFAOYSA-N 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 1
- 241000755093 Gaidropsarus vulgaris Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241000208202 Linaceae Species 0.000 description 1
- 235000004431 Linum usitatissimum Nutrition 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 1
- 238000006887 Ullmann reaction Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 125000001769 aryl amino group Chemical group 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- OATNQHYJXLHTEW-UHFFFAOYSA-N benzene-1,4-disulfonic acid Chemical compound OS(=O)(=O)C1=CC=C(S(O)(=O)=O)C=C1 OATNQHYJXLHTEW-UHFFFAOYSA-N 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 description 1
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 230000003628 erosive effect Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 229910000040 hydrogen fluoride Inorganic materials 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 150000003867 organic ammonium compounds Chemical class 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- DMCJFWXGXUEHFD-UHFFFAOYSA-N pentatriacontan-18-one Chemical group CCCCCCCCCCCCCCCCCC(=O)CCCCCCCCCCCCCCCCC DMCJFWXGXUEHFD-UHFFFAOYSA-N 0.000 description 1
- 230000002085 persistent effect Effects 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 238000005185 salting out Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- SOBHUZYZLFQYFK-UHFFFAOYSA-K trisodium;hydroxy-[[phosphonatomethyl(phosphonomethyl)amino]methyl]phosphinate Chemical group [Na+].[Na+].[Na+].OP(O)(=O)CN(CP(O)([O-])=O)CP([O-])([O-])=O SOBHUZYZLFQYFK-UHFFFAOYSA-K 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
- C07D251/40—Nitrogen atoms
- C07D251/42—One nitrogen atom
- C07D251/44—One nitrogen atom with halogen atoms attached to the two other ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/02—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group directly attached to a heterocyclic ring
- C09B62/04—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group directly attached to a heterocyclic ring to a triazine ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Phenolic Resins Or Amino Resins (AREA)
- Treatments For Attaching Organic Compounds To Fibrous Goods (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1309276A CH617929A5 (enExample) | 1976-10-15 | 1976-10-15 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS198271B2 true CS198271B2 (en) | 1980-05-30 |
Family
ID=4389233
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS776702A CS198271B2 (en) | 1976-10-15 | 1977-10-14 | Method of monoacylation of water insoluble organic amino compounds |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4189576A (enExample) |
| JP (1) | JPS5350186A (enExample) |
| BE (1) | BE859725A (enExample) |
| BR (1) | BR7706894A (enExample) |
| CA (1) | CA1094054A (enExample) |
| CH (1) | CH617929A5 (enExample) |
| CS (1) | CS198271B2 (enExample) |
| DE (1) | DE2746109A1 (enExample) |
| ES (1) | ES463531A1 (enExample) |
| FR (1) | FR2367755A1 (enExample) |
| GB (1) | GB1551202A (enExample) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3010502C2 (de) * | 1980-03-19 | 1982-07-01 | Hoechst Ag, 6000 Frankfurt | Verfahren zur Herstellung von Dihalogentriazinyl-aminonaphthol-Verbindungen |
| EP0172790B1 (de) * | 1984-08-21 | 1992-07-29 | Ciba-Geigy Ag | Verfahren zur kontinuierlichen Umsetzung von Cyanurfluorid mit Aminonaphtholsulfonsäuren |
| DE3666700D1 (en) * | 1985-12-24 | 1989-12-07 | Ciba Geigy Ag | Process for the preparation of reactive dyes |
| DE3727253A1 (de) * | 1987-08-15 | 1989-02-23 | Bayer Ag | Verfahren zur monoacylierung wasserloeslicher organischer aminoverbindungen mit 2,4,6-trifluortriazin in waessrigem medium |
| DE4016159A1 (de) * | 1990-05-19 | 1991-11-21 | Bayer Ag | Verfahren zur kontinuierlichen umsetzung von cyanurfluorid mit aminen sowie reaktor zur durchfuehrung des verfahrens |
| DE4100513A1 (de) * | 1991-01-10 | 1992-07-16 | Bayer Ag | Verbessertes verfahren zur herstellung eines substituierten 1-amino-2-sulfonaphthalins |
| DE4137291A1 (de) * | 1991-11-13 | 1993-05-19 | Bayer Ag | Verfahren zur kontinuierlichen umsetzung von halogenpyrimidinen mit aminen |
| DE4137292A1 (de) * | 1991-11-13 | 1993-05-19 | Bayer Ag | Verfahren zur kontinuierlichen umsetzung von difluortriazinyl-verbindungen mit aminen |
| EP0546993A1 (de) * | 1991-12-09 | 1993-06-16 | Ciba-Geigy Ag | Wasserlöschliche Triazinderivate zur photochemischen und thermischen Stabilisierung von Polyamidfasermaterialien |
| US5637348A (en) * | 1992-08-12 | 1997-06-10 | Clariant Finance (Bvi) Limited | Method of increasing the SPF rating and compounds suitable for increasing the SPF rating of fibre or fabric |
| DE4416015A1 (de) * | 1994-05-06 | 1995-11-09 | Hoechst Ag | Verfahren zur kontinuierlichen Umsetzung von aminogruppenhaltigen organischen Farbstoffen mit Trifluortriazin |
| DE19548429A1 (de) | 1995-12-22 | 1997-06-26 | Dystar Textilfarben Gmbh & Co | Wasserlösliche Azofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung |
| DE19750701A1 (de) * | 1997-11-15 | 1999-05-20 | Dystar Textilfarben Gmbh & Co | Verfahren zur Umsetzung von fluorsubstituierten Heterocyclen mit Aminen in Gegenwart von Phasentransfer-Katalysatoren |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1644208C3 (de) | 1967-04-19 | 1978-06-01 | Bayer Ag, 5090 Leverkusen | Reaktivfarbstoffe |
| CH554403A (de) * | 1969-07-11 | 1974-09-30 | Ciba Geigy Ag | Verfahren zur herstellung von faserreaktiven azofarbstoffen. |
| US3945989A (en) * | 1969-07-11 | 1976-03-23 | Ciba-Geigy Ag | Fluoro triazine containing water insoluble azo dyestuff |
| CH626650A5 (enExample) * | 1974-12-18 | 1981-11-30 | Ciba Geigy Ag | |
| IT1061627B (it) * | 1975-03-20 | 1983-04-30 | Ciba Geigy | Coloranti reattivi per fibre e procedimento per la loro produzione ed applicazione |
-
1976
- 1976-10-15 CH CH1309276A patent/CH617929A5/de not_active IP Right Cessation
-
1977
- 1977-10-13 FR FR7730841A patent/FR2367755A1/fr active Granted
- 1977-10-13 DE DE19772746109 patent/DE2746109A1/de active Granted
- 1977-10-13 CA CA288,661A patent/CA1094054A/en not_active Expired
- 1977-10-13 US US05/841,865 patent/US4189576A/en not_active Expired - Lifetime
- 1977-10-14 BE BE181738A patent/BE859725A/xx unknown
- 1977-10-14 BR BR7706894A patent/BR7706894A/pt unknown
- 1977-10-14 ES ES463531A patent/ES463531A1/es not_active Expired
- 1977-10-14 CS CS776702A patent/CS198271B2/cs unknown
- 1977-10-14 GB GB42886/77A patent/GB1551202A/en not_active Expired
- 1977-10-15 JP JP12302077A patent/JPS5350186A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| ES463531A1 (es) | 1978-12-16 |
| BR7706894A (pt) | 1978-07-18 |
| US4189576A (en) | 1980-02-19 |
| CH617929A5 (enExample) | 1980-06-30 |
| GB1551202A (en) | 1979-08-22 |
| FR2367755B1 (enExample) | 1980-08-08 |
| FR2367755A1 (fr) | 1978-05-12 |
| DE2746109C2 (enExample) | 1988-10-27 |
| DE2746109A1 (de) | 1978-04-20 |
| BE859725A (fr) | 1978-04-14 |
| JPH0248552B2 (enExample) | 1990-10-25 |
| JPS5350186A (en) | 1978-05-08 |
| CA1094054A (en) | 1981-01-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CS198271B2 (en) | Method of monoacylation of water insoluble organic amino compounds | |
| FI94347C (fi) | Parannettu menetelmä 4-amino-1-hydroksibutylideeni-1,1-bisfosfonihapon (ABP) tai sen suolojen valmistamiseksi | |
| US4740597A (en) | Process for the continuous reaction of cyanuric fluoride with sulfo-containing aromatic amines | |
| KR900000889B1 (ko) | 이미노디아세토니트릴의 제조방법 | |
| JPS6173771A (ja) | 繊維反応性トリアジン化合物、その製法及び使用法 | |
| JPH0338306B2 (enExample) | ||
| US4808342A (en) | Production of sulfonated amines | |
| KR19990076015A (ko) | 이반응기형 적색 반응성 염료 | |
| US4785081A (en) | Process for the production of reactive dyes by adiabatic reaction of cyanuric chloride with an amino group-containing dye at elevated temperature | |
| US3145208A (en) | Manufacture of herbicidal derivatives of 2-mercapto-4, 6-bis-amino-s-triazine | |
| KR19990083163A (ko) | 셀룰로즈 섬유의 처리 방법 | |
| CS205137B2 (en) | Process for preparing 2,4-difluor-6-amino-s-triazine | |
| US3983115A (en) | Bis-dihalogeno-s-triazinyl ureas | |
| US2375733A (en) | Preparation of dithioammelide | |
| US6133447A (en) | Process for the preparation of substituted pyridines | |
| GB2073746A (en) | Process for Producing Mono Alkali Salt of 1-Amino-8-naphthol- 3,6-disulfonic Acid | |
| CZ78394A3 (en) | 4-alkyl-3-chloro-benzenesulfonic and 4-alkyl-3-chloro-benzenesulfonylcarboxylic acids and 4-alkyl-3-chloro-alkylsulfonylbenzenes and process for preparing thereof | |
| SU373954A1 (ru) | Способ получения активных красителей | |
| KR820001967B1 (ko) | 반응성 염료의 제조 방법 | |
| CH630107A5 (en) | Process for monoacylating water-soluble organic chromophoric amino compounds | |
| US963377A (en) | Manufacture of indigo leuco bodies. | |
| JP4503731B2 (ja) | 2,4−ジクロロ−6−ヒドロキシ−s−トリアジンのアルカリ金属塩またはアルカリ土類金属塩の製造法 | |
| US1995929A (en) | Chloro- and bromo-derivatives of 2-aminonaphthalene-1-sulphonic acid and process of preparing them | |
| SU332636A1 (ru) | Способ получения активных красителей | |
| CS214084B1 (cs) | Způsob přípravy kyseliny 4,5-dichlornaftalen-l,8-dikarboxylově |