DE2746109C2 - - Google Patents
Info
- Publication number
- DE2746109C2 DE2746109C2 DE2746109A DE2746109A DE2746109C2 DE 2746109 C2 DE2746109 C2 DE 2746109C2 DE 2746109 A DE2746109 A DE 2746109A DE 2746109 A DE2746109 A DE 2746109A DE 2746109 C2 DE2746109 C2 DE 2746109C2
- Authority
- DE
- Germany
- Prior art keywords
- acid
- soluble organic
- sulfonic acid
- amino
- organic amino
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- VMKJWLXVLHBJNK-UHFFFAOYSA-N cyanuric fluoride Chemical compound FC1=NC(F)=NC(F)=N1 VMKJWLXVLHBJNK-UHFFFAOYSA-N 0.000 claims description 21
- 238000000034 method Methods 0.000 claims description 21
- 238000006243 chemical reaction Methods 0.000 claims description 20
- 239000000975 dye Substances 0.000 claims description 15
- 239000000047 product Substances 0.000 claims description 15
- 150000004027 organic amino compounds Chemical class 0.000 claims description 14
- ZAJAQTYSTDTMCU-UHFFFAOYSA-N 3-aminobenzenesulfonic acid Chemical compound NC1=CC=CC(S(O)(=O)=O)=C1 ZAJAQTYSTDTMCU-UHFFFAOYSA-N 0.000 claims description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 11
- 239000000376 reactant Substances 0.000 claims description 6
- 125000003277 amino group Chemical group 0.000 claims description 5
- ZMCHBSMFKQYNKA-UHFFFAOYSA-N 2-aminobenzenesulfonic acid Chemical compound NC1=CC=CC=C1S(O)(=O)=O ZMCHBSMFKQYNKA-UHFFFAOYSA-N 0.000 claims description 4
- 239000007795 chemical reaction product Substances 0.000 claims description 4
- RXNKCIBVUNMMAD-UHFFFAOYSA-N 4-[9-(4-amino-3-fluorophenyl)fluoren-9-yl]-2-fluoroaniline Chemical compound C1=C(F)C(N)=CC=C1C1(C=2C=C(F)C(N)=CC=2)C2=CC=CC=C2C2=CC=CC=C21 RXNKCIBVUNMMAD-UHFFFAOYSA-N 0.000 claims description 3
- 150000002894 organic compounds Chemical class 0.000 claims description 2
- 239000002243 precursor Substances 0.000 claims description 2
- UGEHFOSBNBEWMP-UHFFFAOYSA-N 2,3-diaminobenzenesulfonic acid Chemical compound NC1=CC=CC(S(O)(=O)=O)=C1N UGEHFOSBNBEWMP-UHFFFAOYSA-N 0.000 claims 1
- GWIAAIUASRVOIA-UHFFFAOYSA-N 2-aminonaphthalene-1-sulfonic acid Chemical compound C1=CC=CC2=C(S(O)(=O)=O)C(N)=CC=C21 GWIAAIUASRVOIA-UHFFFAOYSA-N 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 38
- 239000000243 solution Substances 0.000 description 29
- 239000011541 reaction mixture Substances 0.000 description 12
- -1 2,4,6- Trifluoro-1,3,5-triazine (2,4,6-trifluoro-s-triazine) Chemical compound 0.000 description 8
- 239000007864 aqueous solution Substances 0.000 description 8
- 239000002253 acid Substances 0.000 description 6
- 238000001816 cooling Methods 0.000 description 6
- RNVCVTLRINQCPJ-UHFFFAOYSA-N o-toluidine Chemical compound CC1=CC=CC=C1N RNVCVTLRINQCPJ-UHFFFAOYSA-N 0.000 description 6
- 239000000985 reactive dye Substances 0.000 description 5
- HVBSAKJJOYLTQU-UHFFFAOYSA-N 4-aminobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1 HVBSAKJJOYLTQU-UHFFFAOYSA-N 0.000 description 4
- 229920000742 Cotton Polymers 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 238000003860 storage Methods 0.000 description 4
- XOAAWQZATWQOTB-UHFFFAOYSA-N taurine Chemical compound NCCS(O)(=O)=O XOAAWQZATWQOTB-UHFFFAOYSA-N 0.000 description 4
- JVMSQRAXNZPDHF-UHFFFAOYSA-N 2,4-diaminobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C(N)=C1 JVMSQRAXNZPDHF-UHFFFAOYSA-N 0.000 description 3
- HEAHMJLHQCESBZ-UHFFFAOYSA-N 2,5-diaminobenzenesulfonic acid Chemical compound NC1=CC=C(N)C(S(O)(=O)=O)=C1 HEAHMJLHQCESBZ-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 3
- 239000012267 brine Substances 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 230000005494 condensation Effects 0.000 description 3
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 3
- 229910052731 fluorine Inorganic materials 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 3
- 229950000244 sulfanilic acid Drugs 0.000 description 3
- JIHQDMXYYFUGFV-UHFFFAOYSA-N 1,3,5-triazine Chemical group C1=NC=NC=N1 JIHQDMXYYFUGFV-UHFFFAOYSA-N 0.000 description 2
- DGUFAFFRGZKNHB-UHFFFAOYSA-N 3-[(4,6-difluoro-1,3,5-triazin-2-yl)amino]benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC(NC=2N=C(F)N=C(F)N=2)=C1 DGUFAFFRGZKNHB-UHFFFAOYSA-N 0.000 description 2
- MTJGVAJYTOXFJH-UHFFFAOYSA-N 3-aminonaphthalene-1,5-disulfonic acid Chemical compound C1=CC=C(S(O)(=O)=O)C2=CC(N)=CC(S(O)(=O)=O)=C21 MTJGVAJYTOXFJH-UHFFFAOYSA-N 0.000 description 2
- YADSWTKOIHUSDX-UHFFFAOYSA-N 4,6-diaminobenzene-1,3-disulfonic acid Chemical compound NC1=CC(N)=C(S(O)(=O)=O)C=C1S(O)(=O)=O YADSWTKOIHUSDX-UHFFFAOYSA-N 0.000 description 2
- ZDIRCGKEOWZBIM-UHFFFAOYSA-N 4-amino-2-methylbenzenesulfonic acid Chemical compound CC1=CC(N)=CC=C1S(O)(=O)=O ZDIRCGKEOWZBIM-UHFFFAOYSA-N 0.000 description 2
- ALYNCZNDIQEVRV-PZFLKRBQSA-N 4-amino-3,5-ditritiobenzoic acid Chemical compound [3H]c1cc(cc([3H])c1N)C(O)=O ALYNCZNDIQEVRV-PZFLKRBQSA-N 0.000 description 2
- WQTCZINVPXJNEL-UHFFFAOYSA-N 4-amino-3-methylbenzenesulfonic acid Chemical compound CC1=CC(S(O)(=O)=O)=CC=C1N WQTCZINVPXJNEL-UHFFFAOYSA-N 0.000 description 2
- DQNAQOYOSRJXFZ-UHFFFAOYSA-N 5-Amino-1-naphthalenesulfonic acid Chemical compound C1=CC=C2C(N)=CC=CC2=C1S(O)(=O)=O DQNAQOYOSRJXFZ-UHFFFAOYSA-N 0.000 description 2
- JXZGTFLJFKLVAX-UHFFFAOYSA-N 5-amino-2-methoxybenzenesulfonic acid Chemical compound COC1=CC=C(N)C=C1S(O)(=O)=O JXZGTFLJFKLVAX-UHFFFAOYSA-N 0.000 description 2
- BRKFTWHPLMMNHF-UHFFFAOYSA-N 5-amino-2-methylbenzenesulfonic acid Chemical compound CC1=CC=C(N)C=C1S(O)(=O)=O BRKFTWHPLMMNHF-UHFFFAOYSA-N 0.000 description 2
- GBWNQBBVSVGAAL-UHFFFAOYSA-N 5-aminobenzene-1,3-disulfonic acid Chemical compound NC1=CC(S(O)(=O)=O)=CC(S(O)(=O)=O)=C1 GBWNQBBVSVGAAL-UHFFFAOYSA-N 0.000 description 2
- UWPJYQYRSWYIGZ-UHFFFAOYSA-N 5-aminonaphthalene-2-sulfonic acid Chemical compound OS(=O)(=O)C1=CC=C2C(N)=CC=CC2=C1 UWPJYQYRSWYIGZ-UHFFFAOYSA-N 0.000 description 2
- KZCSUEYBKAPKNH-UHFFFAOYSA-N 6-aminonaphthalene-1,3-disulfonic acid Chemical compound OS(=O)(=O)C1=CC(S(O)(=O)=O)=CC2=CC(N)=CC=C21 KZCSUEYBKAPKNH-UHFFFAOYSA-N 0.000 description 2
- YUNBHHWDQDGWHC-UHFFFAOYSA-N 6-aminonaphthalene-1-sulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC2=CC(N)=CC=C21 YUNBHHWDQDGWHC-UHFFFAOYSA-N 0.000 description 2
- OKAUOXITMZTUOJ-UHFFFAOYSA-N 7-aminonaphthalene-2-sulfonic acid Chemical compound C1=CC(S(O)(=O)=O)=CC2=CC(N)=CC=C21 OKAUOXITMZTUOJ-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000003086 colorant Substances 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 125000001153 fluoro group Chemical group F* 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- NRZRRZAVMCAKEP-UHFFFAOYSA-N naphthionic acid Chemical compound C1=CC=C2C(N)=CC=C(S(O)(=O)=O)C2=C1 NRZRRZAVMCAKEP-UHFFFAOYSA-N 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- 230000009257 reactivity Effects 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- GLXWXYTYBIBBLD-UHFFFAOYSA-M sodium;3-aminobenzenesulfonate Chemical compound [Na+].NC1=CC=CC(S([O-])(=O)=O)=C1 GLXWXYTYBIBBLD-UHFFFAOYSA-M 0.000 description 2
- 229960003080 taurine Drugs 0.000 description 2
- VOPSFYWMOIKYEM-UHFFFAOYSA-N 2,5-diaminobenzene-1,4-disulfonic acid Chemical compound NC1=CC(S(O)(=O)=O)=C(N)C=C1S(O)(=O)=O VOPSFYWMOIKYEM-UHFFFAOYSA-N 0.000 description 1
- PMWXDMJNCNZHAD-UHFFFAOYSA-N 2-[[4-fluoro-6-(2-sulfoanilino)-1,3,5-triazin-2-yl]amino]benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1NC1=NC(F)=NC(NC=2C(=CC=CC=2)S(O)(=O)=O)=N1 PMWXDMJNCNZHAD-UHFFFAOYSA-N 0.000 description 1
- OYAOIWOZDIRXPE-UHFFFAOYSA-N 2-amino-5-[(4,6-difluoro-1,3,5-triazin-2-yl)amino]benzene-1,4-disulfonic acid Chemical group C1=C(S(O)(=O)=O)C(N)=CC(S(O)(=O)=O)=C1NC1=NC(F)=NC(F)=N1 OYAOIWOZDIRXPE-UHFFFAOYSA-N 0.000 description 1
- MJNYPLCGWXFYPD-UHFFFAOYSA-N 2-amino-5-sulfobenzoic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1C(O)=O MJNYPLCGWXFYPD-UHFFFAOYSA-N 0.000 description 1
- WZDBUKVBLLXXLM-UHFFFAOYSA-N 3-[[4-fluoro-6-(3-sulfoanilino)-1,3,5-triazin-2-yl]amino]benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC(NC=2N=C(NC=3C=C(C=CC=3)S(O)(=O)=O)N=C(F)N=2)=C1 WZDBUKVBLLXXLM-UHFFFAOYSA-N 0.000 description 1
- XLQICQROCSELQN-UHFFFAOYSA-N 7-[4-(aminodiazenyl)-2-(carbamoylamino)phenyl]-8-(4,6-difluoro-1,3,5-triazin-2-yl)naphthalene-1,3,6-trisulfonic acid Chemical compound N(C(=O)N)C1=C(C=CC(=C1)N=NN)C1=C(C2=C(C=C(C=C2C=C1S(=O)(=O)O)S(=O)(=O)O)S(=O)(=O)O)C1=NC(=NC(=N1)F)F XLQICQROCSELQN-UHFFFAOYSA-N 0.000 description 1
- BPNZDKJMJRWDEN-UHFFFAOYSA-N C1=C(S(O)(=O)=O)C(N)=CC(S(O)(=O)=O)=C1NC(N1)=NC=NC1(F)NC1=CC(S(O)(=O)=O)=C(N)C=C1S(O)(=O)=O Chemical compound C1=C(S(O)(=O)=O)C(N)=CC(S(O)(=O)=O)=C1NC(N1)=NC=NC1(F)NC1=CC(S(O)(=O)=O)=C(N)C=C1S(O)(=O)=O BPNZDKJMJRWDEN-UHFFFAOYSA-N 0.000 description 1
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical compound [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- CJDWRJGIRYKYJO-UHFFFAOYSA-N NC=1C(=C(C=C(C=1)S(=O)(=O)O)NN=C(N=NC1=CC=CC=C1)C1=C(C=C(C=C1)S(=O)(=O)O)C(=O)O)O Chemical compound NC=1C(=C(C=C(C=1)S(=O)(=O)O)NN=C(N=NC1=CC=CC=C1)C1=C(C=C(C=C1)S(=O)(=O)O)C(=O)O)O CJDWRJGIRYKYJO-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 1
- 238000006887 Ullmann reaction Methods 0.000 description 1
- BIRXODCBKHUNQG-UHFFFAOYSA-M [O-]S(C1=CC=CC(NC2=NC(F)=NC(F)=N2)=C1)(=O)=O.[Na+] Chemical compound [O-]S(C1=CC=CC(NC2=NC(F)=NC(F)=N2)=C1)(=O)=O.[Na+] BIRXODCBKHUNQG-UHFFFAOYSA-M 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 150000004699 copper complex Chemical class 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 150000002222 fluorine compounds Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229910000040 hydrogen fluoride Inorganic materials 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
- C07D251/40—Nitrogen atoms
- C07D251/42—One nitrogen atom
- C07D251/44—One nitrogen atom with halogen atoms attached to the two other ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/02—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group directly attached to a heterocyclic ring
- C09B62/04—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group directly attached to a heterocyclic ring to a triazine ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Phenolic Resins Or Amino Resins (AREA)
- Treatments For Attaching Organic Compounds To Fibrous Goods (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1309276A CH617929A5 (enExample) | 1976-10-15 | 1976-10-15 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2746109A1 DE2746109A1 (de) | 1978-04-20 |
| DE2746109C2 true DE2746109C2 (enExample) | 1988-10-27 |
Family
ID=4389233
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19772746109 Granted DE2746109A1 (de) | 1976-10-15 | 1977-10-13 | Verfahren zur monoacylierung wasserloeslicher organischer aminoverbindungen |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4189576A (enExample) |
| JP (1) | JPS5350186A (enExample) |
| BE (1) | BE859725A (enExample) |
| BR (1) | BR7706894A (enExample) |
| CA (1) | CA1094054A (enExample) |
| CH (1) | CH617929A5 (enExample) |
| CS (1) | CS198271B2 (enExample) |
| DE (1) | DE2746109A1 (enExample) |
| ES (1) | ES463531A1 (enExample) |
| FR (1) | FR2367755A1 (enExample) |
| GB (1) | GB1551202A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4016159A1 (de) * | 1990-05-19 | 1991-11-21 | Bayer Ag | Verfahren zur kontinuierlichen umsetzung von cyanurfluorid mit aminen sowie reaktor zur durchfuehrung des verfahrens |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3010502C2 (de) * | 1980-03-19 | 1982-07-01 | Hoechst Ag, 6000 Frankfurt | Verfahren zur Herstellung von Dihalogentriazinyl-aminonaphthol-Verbindungen |
| EP0172790B1 (de) * | 1984-08-21 | 1992-07-29 | Ciba-Geigy Ag | Verfahren zur kontinuierlichen Umsetzung von Cyanurfluorid mit Aminonaphtholsulfonsäuren |
| DE3666700D1 (en) * | 1985-12-24 | 1989-12-07 | Ciba Geigy Ag | Process for the preparation of reactive dyes |
| DE3727253A1 (de) * | 1987-08-15 | 1989-02-23 | Bayer Ag | Verfahren zur monoacylierung wasserloeslicher organischer aminoverbindungen mit 2,4,6-trifluortriazin in waessrigem medium |
| DE4100513A1 (de) * | 1991-01-10 | 1992-07-16 | Bayer Ag | Verbessertes verfahren zur herstellung eines substituierten 1-amino-2-sulfonaphthalins |
| DE4137291A1 (de) * | 1991-11-13 | 1993-05-19 | Bayer Ag | Verfahren zur kontinuierlichen umsetzung von halogenpyrimidinen mit aminen |
| DE4137292A1 (de) * | 1991-11-13 | 1993-05-19 | Bayer Ag | Verfahren zur kontinuierlichen umsetzung von difluortriazinyl-verbindungen mit aminen |
| EP0546993A1 (de) * | 1991-12-09 | 1993-06-16 | Ciba-Geigy Ag | Wasserlöschliche Triazinderivate zur photochemischen und thermischen Stabilisierung von Polyamidfasermaterialien |
| US5637348A (en) * | 1992-08-12 | 1997-06-10 | Clariant Finance (Bvi) Limited | Method of increasing the SPF rating and compounds suitable for increasing the SPF rating of fibre or fabric |
| DE4416015A1 (de) * | 1994-05-06 | 1995-11-09 | Hoechst Ag | Verfahren zur kontinuierlichen Umsetzung von aminogruppenhaltigen organischen Farbstoffen mit Trifluortriazin |
| DE19548429A1 (de) | 1995-12-22 | 1997-06-26 | Dystar Textilfarben Gmbh & Co | Wasserlösliche Azofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung |
| DE19750701A1 (de) * | 1997-11-15 | 1999-05-20 | Dystar Textilfarben Gmbh & Co | Verfahren zur Umsetzung von fluorsubstituierten Heterocyclen mit Aminen in Gegenwart von Phasentransfer-Katalysatoren |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1644208C3 (de) | 1967-04-19 | 1978-06-01 | Bayer Ag, 5090 Leverkusen | Reaktivfarbstoffe |
| CH554403A (de) * | 1969-07-11 | 1974-09-30 | Ciba Geigy Ag | Verfahren zur herstellung von faserreaktiven azofarbstoffen. |
| US3945989A (en) * | 1969-07-11 | 1976-03-23 | Ciba-Geigy Ag | Fluoro triazine containing water insoluble azo dyestuff |
| CH626650A5 (enExample) * | 1974-12-18 | 1981-11-30 | Ciba Geigy Ag | |
| IT1061627B (it) * | 1975-03-20 | 1983-04-30 | Ciba Geigy | Coloranti reattivi per fibre e procedimento per la loro produzione ed applicazione |
-
1976
- 1976-10-15 CH CH1309276A patent/CH617929A5/de not_active IP Right Cessation
-
1977
- 1977-10-13 FR FR7730841A patent/FR2367755A1/fr active Granted
- 1977-10-13 DE DE19772746109 patent/DE2746109A1/de active Granted
- 1977-10-13 CA CA288,661A patent/CA1094054A/en not_active Expired
- 1977-10-13 US US05/841,865 patent/US4189576A/en not_active Expired - Lifetime
- 1977-10-14 BE BE181738A patent/BE859725A/xx unknown
- 1977-10-14 BR BR7706894A patent/BR7706894A/pt unknown
- 1977-10-14 ES ES463531A patent/ES463531A1/es not_active Expired
- 1977-10-14 CS CS776702A patent/CS198271B2/cs unknown
- 1977-10-14 GB GB42886/77A patent/GB1551202A/en not_active Expired
- 1977-10-15 JP JP12302077A patent/JPS5350186A/ja active Granted
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4016159A1 (de) * | 1990-05-19 | 1991-11-21 | Bayer Ag | Verfahren zur kontinuierlichen umsetzung von cyanurfluorid mit aminen sowie reaktor zur durchfuehrung des verfahrens |
Also Published As
| Publication number | Publication date |
|---|---|
| ES463531A1 (es) | 1978-12-16 |
| BR7706894A (pt) | 1978-07-18 |
| US4189576A (en) | 1980-02-19 |
| CS198271B2 (en) | 1980-05-30 |
| CH617929A5 (enExample) | 1980-06-30 |
| GB1551202A (en) | 1979-08-22 |
| FR2367755B1 (enExample) | 1980-08-08 |
| FR2367755A1 (fr) | 1978-05-12 |
| DE2746109A1 (de) | 1978-04-20 |
| BE859725A (fr) | 1978-04-14 |
| JPH0248552B2 (enExample) | 1990-10-25 |
| JPS5350186A (en) | 1978-05-08 |
| CA1094054A (en) | 1981-01-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2746109C2 (enExample) | ||
| DE2342197C2 (de) | Reaktivfarbstoffe | |
| DE2650555C2 (enExample) | ||
| EP0056975B1 (de) | Wasserlösliche Monoazoverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung als Farbstoffe | |
| US4740597A (en) | Process for the continuous reaction of cyanuric fluoride with sulfo-containing aromatic amines | |
| EP0014844B1 (de) | Fluortriazin-Derivate, Verfahren zur Herstellung von Fluortriazin-Derivaten und von Reaktivfarbstoffen und deren Verwendung | |
| EP0471702A1 (de) | Wasserlösliche faserreaktive farbstoffe, verfahren zu ihrer herstellung und ihre verwendung. | |
| DE2657341C2 (de) | Faserreaktive Azofarbstoffe, deren Herstellung und Verwendung | |
| DE4338117A1 (de) | Reaktivfarbstoffe, deren Herstellung und Verwendung | |
| EP0443165A1 (de) | Reaktivfarbstoffe | |
| EP0041922B1 (de) | Verfahren zur Herstellung von aminosubstituierten 1-Amino-8-hydroxynaphthalin-sulfonsäuren | |
| CH634061A5 (de) | Verfahren zur monoacylierung von aminohydroxynaphthalinsulfonsaeuren mit 2,4,6-trifluor-s-triazin. | |
| EP0065479A2 (de) | Reaktivfarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben und Bedrucken von hydroxylgruppen- oder stickstoffhaltigen Materialien | |
| DE3879476T2 (de) | Faserreaktiv-azofarbstoffe, verfahren zu ihrer herstellung und ihre verwendung zum faerben von hydroxy und/oder carboxamidgruppen enthaltendem fasermaterial. | |
| DE2731258A1 (de) | Faserreaktive azofarbstoffe, deren herstellung und verwendung | |
| EP0627471A1 (de) | Reaktivfarbstoffe | |
| DE10212771A1 (de) | Wasserlösliche Mono- und Disazofarbstoffe | |
| DE2839209C2 (de) | Azofarbstoffe, deren Herstellung und Verwendung | |
| EP0387579A2 (de) | Verdoppelte Reaktivfarbstoffe | |
| EP0128340A1 (de) | Disazoreaktivfarbstoffe | |
| EP0041919B1 (de) | Verfahren zur Herstellung von Amino-fluor-s-triazin-Farbstoffen | |
| EP0125650B1 (de) | Reaktivfarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben und Bedrucken von Substraten | |
| EP0063739B1 (de) | Verfahren zur Herstellung von Kupferkomplexazofarbstoffen | |
| EP0198350B1 (de) | Disazoreaktivfarbstoffe | |
| CH635858A5 (de) | Faserreaktive azofarbstoffe, sowie deren herstellung. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8128 | New person/name/address of the agent |
Representative=s name: SCHWABE, H., DIPL.-ING. SANDMAIR, K., DIPL.-CHEM. |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |