CS197312B2 - Method of producing 3,4-dimethoxy-6-/4-/2-furoyl/-1-piperazinyl-thiocarbamido/benzonitrile - Google Patents
Method of producing 3,4-dimethoxy-6-/4-/2-furoyl/-1-piperazinyl-thiocarbamido/benzonitrile Download PDFInfo
- Publication number
- CS197312B2 CS197312B2 CS778433A CS843377A CS197312B2 CS 197312 B2 CS197312 B2 CS 197312B2 CS 778433 A CS778433 A CS 778433A CS 843377 A CS843377 A CS 843377A CS 197312 B2 CS197312 B2 CS 197312B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- dimethoxy
- furoyl
- formula
- piperazinyl
- reacted
- Prior art date
Links
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 title claims abstract description 35
- 238000000034 method Methods 0.000 title claims description 12
- SADPINFEWFPMEA-UHFFFAOYSA-N furan-2-yl(piperazin-1-yl)methanone Chemical compound C=1C=COC=1C(=O)N1CCNCC1 SADPINFEWFPMEA-UHFFFAOYSA-N 0.000 claims abstract description 9
- IENZQIKPVFGBNW-UHFFFAOYSA-N prazosin Chemical compound N=1C(N)=C2C=C(OC)C(OC)=CC2=NC=1N(CC1)CCN1C(=O)C1=CC=CO1 IENZQIKPVFGBNW-UHFFFAOYSA-N 0.000 claims abstract description 9
- 229960001289 prazosin Drugs 0.000 claims abstract description 7
- ZWZVWGITAAIFPS-UHFFFAOYSA-N thiophosgene Chemical compound ClC(Cl)=S ZWZVWGITAAIFPS-UHFFFAOYSA-N 0.000 claims abstract description 7
- BJAYMNUBIULRMF-UHFFFAOYSA-N 2-amino-4,5-dimethoxybenzonitrile Chemical compound COC1=CC(N)=C(C#N)C=C1OC BJAYMNUBIULRMF-UHFFFAOYSA-N 0.000 claims abstract description 6
- 238000002360 preparation method Methods 0.000 claims abstract description 5
- SEUMXCKRKZIQAB-UHFFFAOYSA-N 4-(furan-2-carbonyl)piperazine-1-carbothioyl chloride Chemical compound C1CN(C(=S)Cl)CCN1C(=O)C1=CC=CO1 SEUMXCKRKZIQAB-UHFFFAOYSA-N 0.000 claims abstract description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 claims description 18
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims description 12
- -1 2-furoyl Chemical group 0.000 claims description 11
- 239000002904 solvent Substances 0.000 claims description 7
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 claims description 6
- 239000012442 inert solvent Substances 0.000 claims description 6
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 claims description 4
- 150000003512 tertiary amines Chemical class 0.000 claims description 4
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 claims description 3
- 229910000019 calcium carbonate Inorganic materials 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 claims description 2
- HLCPWBZNUKCSBN-UHFFFAOYSA-N 2-aminobenzonitrile Chemical compound NC1=CC=CC=C1C#N HLCPWBZNUKCSBN-UHFFFAOYSA-N 0.000 claims 1
- AFGXCIJBGLMDKI-UHFFFAOYSA-N 2-isothiocyanato-4,5-dimethoxybenzonitrile Chemical compound COC1=CC(N=C=S)=C(C#N)C=C1OC AFGXCIJBGLMDKI-UHFFFAOYSA-N 0.000 abstract description 5
- 150000001875 compounds Chemical class 0.000 abstract description 5
- 230000003276 anti-hypertensive effect Effects 0.000 abstract 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- 239000000203 mixture Substances 0.000 description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 239000000543 intermediate Substances 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 3
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 239000002026 chloroform extract Substances 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- JWVCLYRUEFBMGU-UHFFFAOYSA-N quinazoline Chemical compound N1=CN=CC2=CC=CC=C21 JWVCLYRUEFBMGU-UHFFFAOYSA-N 0.000 description 2
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 2
- GDHYPPBFBJXNRE-UHFFFAOYSA-N 2-isothiocyanatobenzonitrile Chemical compound S=C=NC1=CC=CC=C1C#N GDHYPPBFBJXNRE-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229940030600 antihypertensive agent Drugs 0.000 description 1
- 239000002220 antihypertensive agent Substances 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/56—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D307/68—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Furan Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FI763614A FI58124C (fi) | 1976-12-15 | 1976-12-15 | Ny mellanprodukt 3,4-dimetoxi-6-(4-(2-furoyl)-1-piperazinyltiokarbamido)-bensonitril foer framstaellning av 6,7-dimetoxi-4-amino-2-(4-(2-furoyl)-1-piperazinyl)kinazolin med blodtryckssaenkande verkan |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS197312B2 true CS197312B2 (en) | 1980-04-30 |
Family
ID=8510504
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS778433A CS197312B2 (en) | 1976-12-15 | 1977-12-15 | Method of producing 3,4-dimethoxy-6-/4-/2-furoyl/-1-piperazinyl-thiocarbamido/benzonitrile |
Country Status (17)
| Country | Link |
|---|---|
| JP (1) | JPS5387375A (enExample) |
| AT (1) | AT358047B (enExample) |
| BE (1) | BE861822A (enExample) |
| CA (1) | CA1102332A (enExample) |
| CH (1) | CH630624A5 (enExample) |
| CS (1) | CS197312B2 (enExample) |
| DD (1) | DD134226A1 (enExample) |
| DE (1) | DE2755638A1 (enExample) |
| DK (1) | DK145822C (enExample) |
| FI (1) | FI58124C (enExample) |
| HU (1) | HU174048B (enExample) |
| NL (1) | NL7713703A (enExample) |
| NO (1) | NO146239C (enExample) |
| PL (1) | PL106201B1 (enExample) |
| SE (1) | SE424993B (enExample) |
| SU (1) | SU923370A3 (enExample) |
| ZA (1) | ZA777222B (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FI67699C (fi) * | 1979-01-31 | 1985-05-10 | Orion Yhtymae Oy | Foerfarande foer framstaellning av 6,7-dimetoxi-4-amino-2-(4-(2-furoyl)-1-piperazinyl)kinazolinhydroklorid med blodtryckssaenkande verkan |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3935213A (en) * | 1973-12-05 | 1976-01-27 | Pfizer Inc. | Process for hypotensive 4-amino-2-(piperazin-1-yl) quinazoline derivatives |
-
1976
- 1976-12-15 FI FI763614A patent/FI58124C/fi not_active IP Right Cessation
-
1977
- 1977-11-24 CH CH1438277A patent/CH630624A5/de not_active IP Right Cessation
- 1977-11-25 SE SE7713377A patent/SE424993B/sv not_active IP Right Cessation
- 1977-12-05 ZA ZA00777222A patent/ZA777222B/xx unknown
- 1977-12-05 AT AT867177A patent/AT358047B/de not_active IP Right Cessation
- 1977-12-11 NL NL7713703A patent/NL7713703A/xx not_active Application Discontinuation
- 1977-12-12 NO NO774263A patent/NO146239C/no unknown
- 1977-12-13 HU HU77OI217A patent/HU174048B/hu not_active IP Right Cessation
- 1977-12-13 PL PL1977202898A patent/PL106201B1/pl unknown
- 1977-12-14 CA CA293,066A patent/CA1102332A/en not_active Expired
- 1977-12-14 DE DE19772755638 patent/DE2755638A1/de not_active Ceased
- 1977-12-14 SU SU772555751A patent/SU923370A3/ru active
- 1977-12-14 BE BE183425A patent/BE861822A/xx not_active IP Right Cessation
- 1977-12-14 DK DK558377A patent/DK145822C/da not_active IP Right Cessation
- 1977-12-15 JP JP15157177A patent/JPS5387375A/ja active Granted
- 1977-12-15 DD DD77202667A patent/DD134226A1/xx unknown
- 1977-12-15 CS CS778433A patent/CS197312B2/cs unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE2755638A1 (de) | 1978-06-22 |
| ZA777222B (en) | 1978-09-27 |
| CH630624A5 (en) | 1982-06-30 |
| DD134226A1 (de) | 1979-02-14 |
| DK558377A (da) | 1978-06-16 |
| NO146239C (no) | 1982-08-25 |
| BE861822A (fr) | 1978-03-31 |
| FI58124B (fi) | 1980-08-29 |
| CA1102332A (en) | 1981-06-02 |
| NO774263L (no) | 1978-06-16 |
| NO146239B (no) | 1982-05-18 |
| SE424993B (sv) | 1982-08-23 |
| AT358047B (de) | 1980-08-11 |
| HU174048B (hu) | 1979-10-28 |
| FI763614A7 (fi) | 1978-06-16 |
| ATA867177A (de) | 1980-01-15 |
| JPS6225145B2 (enExample) | 1987-06-01 |
| DK145822B (da) | 1983-03-14 |
| PL106201B1 (pl) | 1979-12-31 |
| PL202898A1 (pl) | 1978-08-28 |
| SE7713377L (sv) | 1978-06-16 |
| NL7713703A (nl) | 1978-06-19 |
| JPS5387375A (en) | 1978-08-01 |
| SU923370A3 (ru) | 1982-04-23 |
| FI58124C (fi) | 1980-12-10 |
| DK145822C (da) | 1983-08-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| RU2094428C1 (ru) | Способ получения бензопирановых соединений, промежуточные соединения и способы их получения | |
| HU195182B (en) | Process for production of /z/-1-phenil-1-diethil-amino-carbonil-2-amino-methil-cyclopropan hcl | |
| KR100490220B1 (ko) | 4-옥소이미다졸리늄염의제조방법 | |
| FI91064C (fi) | Menetelmä terapeuttisesti vaikuttavien 3-(N-asyylietyyli-aminoalkyyli)-kromaanien ja -1,4-dioksaanien valmistamiseksi | |
| US4308206A (en) | Process for preparing derivatives of 5,11-dihydro-6h-pyrido[2,3-b][1,4]-benzodiazepin-6-one, and the final derivatives and synthesis intermediates obtained thereby | |
| CS197312B2 (en) | Method of producing 3,4-dimethoxy-6-/4-/2-furoyl/-1-piperazinyl-thiocarbamido/benzonitrile | |
| JP2001064282A (ja) | イミダゾリン化合物、その中間体、およびそれらの製造方法、並びにアゼピン化合物およびその塩の製造方法 | |
| US9359333B2 (en) | Efficient process for the preparation of Lapatinib and salts thereof by means of new intermediates | |
| US4575553A (en) | Antitumor m-AMSA analog | |
| RU1838309C (ru) | Способ получени производных хиназолина или их формацевтически приемлемых кислотно-аддитивных солей | |
| US4927970A (en) | Substituted 3-cyclobutene-1,2-dione intermediates | |
| JPS6355512B2 (enExample) | ||
| HU200996B (en) | Process for producing n-(3', 4'-dimethoxycinnamoyl)-anthranilic acid (tranilast) | |
| KR20040043176A (ko) | 5-치환 이소벤조퓨란의 제조 방법 | |
| FI88292B (fi) | Foerfarande foer framstaellning av n-(sulfonylmetyl)formamider | |
| CS195347B2 (en) | Process for preparing antihypertensive 6,7-dimethoxy4-4-amino-2-/4-/2-furoyl/-1-piperazinyl/quinazoline | |
| KR101170024B1 (ko) | 아조세미드 제조방법 | |
| RU2744470C1 (ru) | Способ получения изотиобарбамина | |
| KR20190131983A (ko) | 다이아미노피리미딘 유도체 또는 이의 산부가염의 신규의 제조방법 | |
| US5151544A (en) | Intermediates in the preparation of chiral spirofluorenehydantoins | |
| PL152958B1 (en) | Method for manufacturing piperazine derivatives | |
| SU437294A1 (ru) | Способ получени производных 2-амино-дигидро-бензодиазепинона | |
| SU416944A3 (ru) | Способ получения производных | |
| JPH0386869A (ja) | キナゾリン誘導体の製造法 | |
| JPH0227346B2 (enExample) |