CH679395A5 - - Google Patents
Download PDFInfo
- Publication number
- CH679395A5 CH679395A5 CH2999/90A CH299990A CH679395A5 CH 679395 A5 CH679395 A5 CH 679395A5 CH 2999/90 A CH2999/90 A CH 2999/90A CH 299990 A CH299990 A CH 299990A CH 679395 A5 CH679395 A5 CH 679395A5
- Authority
- CH
- Switzerland
- Prior art keywords
- trimethylammonio
- butyric acid
- acetoxybenzoyloxy
- pharmaceutically acceptable
- carnitine
- Prior art date
Links
- KWIUHFFTVRNATP-UHFFFAOYSA-N glycine betaine Chemical compound C[N+](C)(C)CC([O-])=O KWIUHFFTVRNATP-UHFFFAOYSA-N 0.000 claims description 16
- 229960003237 betaine Drugs 0.000 claims description 8
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 claims description 6
- 150000003839 salts Chemical class 0.000 claims description 6
- 238000000034 method Methods 0.000 claims description 5
- IHWNOPAHRHEFIE-UHFFFAOYSA-N CC(=O)OC1=CC=CC=C1C(=O)OC(CC([O-])=O)C[N+](C)(C)C Chemical compound CC(=O)OC1=CC=CC=C1C(=O)OC(CC([O-])=O)C[N+](C)(C)C IHWNOPAHRHEFIE-UHFFFAOYSA-N 0.000 claims description 4
- 150000001875 compounds Chemical class 0.000 claims description 4
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 claims description 3
- 239000012346 acetyl chloride Substances 0.000 claims description 3
- 239000012345 acetylating agent Substances 0.000 claims description 2
- 230000021736 acetylation Effects 0.000 claims description 2
- 238000006640 acetylation reaction Methods 0.000 claims description 2
- 230000003197 catalytic effect Effects 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- IHWNOPAHRHEFIE-GFCCVEGCSA-N (3r)-3-(2-acetyloxybenzoyl)oxy-4-(trimethylazaniumyl)butanoate Chemical compound CC(=O)OC1=CC=CC=C1C(=O)O[C@H](CC([O-])=O)C[N+](C)(C)C IHWNOPAHRHEFIE-GFCCVEGCSA-N 0.000 claims 1
- IHWNOPAHRHEFIE-LBPRGKRZSA-N CC(=O)OC1=CC=CC=C1C(=O)O[C@@H](CC(=O)[O-])C[N+](C)(C)C Chemical compound CC(=O)OC1=CC=CC=C1C(=O)O[C@@H](CC(=O)[O-])C[N+](C)(C)C IHWNOPAHRHEFIE-LBPRGKRZSA-N 0.000 claims 1
- IVKTUTOOZFCEQC-UHFFFAOYSA-N C[N+](C)(C)CC(CC([O-])=O)OC(=O)C1=CC=CC=C1O Chemical compound C[N+](C)(C)CC(CC([O-])=O)OC(=O)C1=CC=CC=C1O IVKTUTOOZFCEQC-UHFFFAOYSA-N 0.000 claims 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 6
- PHIQHXFUZVPYII-ZCFIWIBFSA-N (R)-carnitine Chemical compound C[N+](C)(C)C[C@H](O)CC([O-])=O PHIQHXFUZVPYII-ZCFIWIBFSA-N 0.000 description 4
- 229910001868 water Inorganic materials 0.000 description 4
- 230000000202 analgesic effect Effects 0.000 description 3
- 229960004203 carnitine Drugs 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 3
- 229960004889 salicylic acid Drugs 0.000 description 3
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 2
- XOXKBVCLTJWGTD-UHFFFAOYSA-N C(C)(=O)C(C(O)(CC([O-])=O)C(C=1C(O)=CC=CC=1)=O)[N+](C)(C)C Chemical compound C(C)(=O)C(C(O)(CC([O-])=O)C(C=1C(O)=CC=CC=1)=O)[N+](C)(C)C XOXKBVCLTJWGTD-UHFFFAOYSA-N 0.000 description 2
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 description 2
- 229960001138 acetylsalicylic acid Drugs 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 210000004027 cell Anatomy 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- 210000003463 organelle Anatomy 0.000 description 2
- 150000003872 salicylic acid derivatives Chemical class 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- 238000005160 1H NMR spectroscopy Methods 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 230000000397 acetylating effect Effects 0.000 description 1
- -1 acetylsalicyloyl carnitine Chemical class 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 230000002337 anti-port Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 230000001413 cellular effect Effects 0.000 description 1
- 230000001934 delay Effects 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 210000004051 gastric juice Anatomy 0.000 description 1
- 210000001156 gastric mucosa Anatomy 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- 210000003470 mitochondria Anatomy 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 231100000683 possible toxicity Toxicity 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C229/00—Compounds containing amino and carboxyl groups bound to the same carbon skeleton
- C07C229/02—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C229/04—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C229/22—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated the carbon skeleton being further substituted by oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Priority Applications (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH2222/90A CH679856A5 (enExample) | 1990-07-04 | 1990-07-04 | |
| CH2999/90A CH679395A5 (enExample) | 1990-07-04 | 1990-09-17 | |
| ES92101617T ES2070535T3 (es) | 1990-07-04 | 1992-01-31 | Acetilsaliciloil-carnitina y procedimiento para su preparacion. |
| EP92101617A EP0553384B1 (de) | 1990-07-04 | 1992-01-31 | Acetylsalicyloyl-Carnitin und Verfahren zu seiner Herstellung |
| EP92101618A EP0553385B1 (de) | 1990-07-04 | 1992-01-31 | Salicyloyl-carnitin und Verfahren zu seiner Herstellung |
| ES92101618T ES2070536T3 (es) | 1990-07-04 | 1992-01-31 | Saliciloil-carnitina y procedimiento para su preparacion. |
| US07/833,673 US5227513A (en) | 1990-07-04 | 1992-02-11 | Acetylsalicyloyl-L-carnitine and process for its production |
| US07/833,672 US5227514A (en) | 1990-07-04 | 1992-02-11 | Salicyloyl-carnitine and process for its production |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH2222/90A CH679856A5 (enExample) | 1990-07-04 | 1990-07-04 | |
| CH2999/90A CH679395A5 (enExample) | 1990-07-04 | 1990-09-17 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH679395A5 true CH679395A5 (enExample) | 1992-02-14 |
Family
ID=40316909
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH2222/90A CH679856A5 (enExample) | 1990-07-04 | 1990-07-04 | |
| CH2999/90A CH679395A5 (enExample) | 1990-07-04 | 1990-09-17 |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH2222/90A CH679856A5 (enExample) | 1990-07-04 | 1990-07-04 |
Country Status (4)
| Country | Link |
|---|---|
| US (2) | US5227513A (enExample) |
| EP (2) | EP0553385B1 (enExample) |
| CH (2) | CH679856A5 (enExample) |
| ES (2) | ES2070535T3 (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0553385A1 (de) * | 1990-07-04 | 1993-08-04 | Lonza Ag | Salicyloyl-carnitin und Verfahren zu seiner Herstellung |
| EP0628308A1 (en) * | 1993-06-02 | 1994-12-14 | AVANTGARDE S.p.A. | Use of O-esters of L-carnitine with aromatic acids for the treatment of dermatoses |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IL105244A (en) * | 1993-03-31 | 2003-07-31 | Dpharm Ltd | Prodrugs with enhanced penetration into cells |
| US6413949B1 (en) * | 1995-06-07 | 2002-07-02 | D-Pharm, Ltd. | Prodrugs with enhanced penetration into cells |
| US6313106B1 (en) | 1995-06-07 | 2001-11-06 | D-Pharm Ltd. | Phospholipid derivatives of valproic acid and mixtures thereof |
| IT1306184B1 (it) | 1999-08-05 | 2001-05-30 | Sigma Tau Ind Farmaceuti | Nitrilossi derivati della (r) e (s)-carnitina. |
| EA021588B1 (ru) * | 2009-06-25 | 2015-07-30 | Тетра Сиа | Бетаиновые соли ацетилсалициловой кислоты |
| US10723691B2 (en) * | 2016-08-30 | 2020-07-28 | Drug'on Pharma Switzerland Ag | Process for preparing salicyloyl-L-carnitine hydrochloride |
| EP3326999B1 (de) | 2016-11-24 | 2019-08-07 | Drug'On Pharma Switzerland AG | Salicyloylcarnitin sulfonate |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH389641A (de) * | 1961-01-20 | 1965-03-31 | Mundipharma Ag | Verfahren zur Herstellung von Betainsalicylat |
| US4336400A (en) * | 1969-04-01 | 1982-06-22 | Sterling Drug Inc. | 3-(Hydroxy or hydroxymethyl)-4-hydroxy-alpha(aminomethyl)benzyl alcohols and methods of use |
| DE2914721A1 (de) * | 1978-04-17 | 1979-10-18 | Kyowa Hakko Kogyo Kk | Verfahren zur bestimmung der cholinesterase-aktivitaet sowie fuer dieses verfahren verwendbare cholin-derivate |
| IT1156840B (it) * | 1978-06-27 | 1987-02-04 | Sigma Tau Ind Farmaceuti | Acil derivati della carnitina |
| US4402974A (en) * | 1981-06-23 | 1983-09-06 | American Hospital Supply Corporation | Method for treating glaucoma by the topical administration of selectively metabolized beta-blocking agents |
| EP0150688B1 (en) * | 1983-12-28 | 1987-04-22 | Sigma-Tau Industrie Farmaceutiche Riunite S.p.A. | Salts of l-carnitine and alkanoyl l-carnitines and process for preparing same |
| CH679856A5 (enExample) * | 1990-07-04 | 1992-04-30 | Lonza Ag | |
| JPH0721352A (ja) * | 1993-07-05 | 1995-01-24 | Hitachi Ltd | 分散オーサリング・システム |
-
1990
- 1990-07-04 CH CH2222/90A patent/CH679856A5/de not_active IP Right Cessation
- 1990-09-17 CH CH2999/90A patent/CH679395A5/de not_active IP Right Cessation
-
1992
- 1992-01-31 ES ES92101617T patent/ES2070535T3/es not_active Expired - Lifetime
- 1992-01-31 EP EP92101618A patent/EP0553385B1/de not_active Expired - Lifetime
- 1992-01-31 ES ES92101618T patent/ES2070536T3/es not_active Expired - Lifetime
- 1992-01-31 EP EP92101617A patent/EP0553384B1/de not_active Expired - Lifetime
- 1992-02-11 US US07/833,673 patent/US5227513A/en not_active Expired - Lifetime
- 1992-02-11 US US07/833,672 patent/US5227514A/en not_active Expired - Lifetime
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0553385A1 (de) * | 1990-07-04 | 1993-08-04 | Lonza Ag | Salicyloyl-carnitin und Verfahren zu seiner Herstellung |
| EP0553384A1 (de) * | 1990-07-04 | 1993-08-04 | Lonza Ag | Acetylsalicyloyl-Carnitin und Verfahren zu seiner Herstellung |
| EP0628308A1 (en) * | 1993-06-02 | 1994-12-14 | AVANTGARDE S.p.A. | Use of O-esters of L-carnitine with aromatic acids for the treatment of dermatoses |
Also Published As
| Publication number | Publication date |
|---|---|
| EP0553385A1 (de) | 1993-08-04 |
| ES2070535T3 (es) | 1995-06-01 |
| EP0553384A1 (de) | 1993-08-04 |
| ES2070536T3 (es) | 1995-06-01 |
| EP0553385B1 (de) | 1995-03-29 |
| US5227513A (en) | 1993-07-13 |
| EP0553384B1 (de) | 1995-03-29 |
| US5227514A (en) | 1993-07-13 |
| CH679856A5 (enExample) | 1992-04-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2925945C2 (enExample) | ||
| EP0553384B1 (de) | Acetylsalicyloyl-Carnitin und Verfahren zu seiner Herstellung | |
| DE2945497C2 (enExample) | ||
| DE3116067A1 (de) | Therapeutische zusammensetzungen mit schmerzstillenden und entzuendungshemmenden eigenschaften, die als wirkstoffe adenosinderivate enthalten | |
| DE2501957A1 (de) | Verfahren zur herstellung von optisch aktivem p-hydroxyphenylglycin | |
| DE3873696T2 (de) | Derivate des cysteins, verfahren zur herstellung und verwendung davon. | |
| DE2410201C3 (de) | 6-Substituierte 3-Carbäthoxyhydrazinopyridazine beziehungsweise ihre Salze sowie solche enthaltende Arzneimittel und Verfahren zur Herstellung derselben | |
| DE1961947A1 (de) | 6,7-Diacyloxy-tetrahydroisochinolinverbindungen und Verfahren zu ihrer Herstellung | |
| DE1958383C3 (de) | Leupeptine, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel | |
| DE1620479C3 (de) | Xylitpentanicotinat und dessen Säureadditionssalze | |
| DE1770351C2 (de) | 2-0-Acyl-clindamycine, Verfahren zu deren Herstellung und diese Verbindungen enthaltende antibiotische Zubereitungen | |
| DE2410307C2 (de) | 2-(2-Thioäthyl)-4-carboxy-thiazolidin-Derivate | |
| DE2921324A1 (de) | Penicillansaeurederivate und ihre salze sowie verfahren zu ihrer herstellung | |
| DE2610679C2 (de) | Sulfinylgruppenhaltige Oximätherderivate, Verfahren zu deren Herstellung und diese enthaltende pharmazeutische Mittel | |
| DE2638423C2 (de) | Verfahren zur Herstellung von in Wasser leicht löslichen Salzen der Äthylendiamintetraacetatoeisen(III)-säure | |
| DD292908A5 (de) | Verfahren zur herstellung von thienylessigsaeurederivaten | |
| DE2357069C3 (de) | D-GIu caro-1,5-lactam-alkylester | |
| DE1111187B (de) | Verfahren zur Herstellung von Phosphorsaeureestern, -amiden oder -carbonsaeureanhydriden | |
| DE1221239B (de) | Verfahren zur Herstellung wasserloeslicher Glycinester des 1-(p-Methylsulfonyl-phenyl)-2-(dichloracetamido)-1, 3-propandiols | |
| CA2061196C (en) | Acetylsalicyloyl l-carnitine and process for its preparation | |
| AT367029B (de) | Verfahren zur herstellung von neuen racemischen oder optisch aktiven phenylessigsaeureamiden | |
| AT299239B (de) | Verfahren zur Herstellung von neuen 4-(9-Adenyl)-2,3-dihydroxy-buttersäure und ihrer Salze | |
| CH373759A (de) | Verfahren zur Herstellung eines neuen herzwirksamen Salzes | |
| DE1931199C3 (de) | Verfahren zur Herstellung von Alkylmercaptolysinen | |
| DE2657376A1 (de) | Daunosaminnucleoside, verfahren zu ihrer herstellung und arzneimittel |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased | ||
| AEN | Modification of the scope of the patent |
Free format text: DAS PATENT WAR IRRTUEMLICH GELOESCHT WORDEN.ES WURDE REAKTIVIERT. |
|
| PFA | Name/firm changed |
Owner name: LONZA AG, GAMPEL/WALLIS. GESCHAEFTSLEITUNG,,4002 B |
|
| PL | Patent ceased |