CH635829A5 - Verfahren zur herstellung von indazolderivaten. - Google Patents
Verfahren zur herstellung von indazolderivaten. Download PDFInfo
- Publication number
- CH635829A5 CH635829A5 CH524077A CH524077A CH635829A5 CH 635829 A5 CH635829 A5 CH 635829A5 CH 524077 A CH524077 A CH 524077A CH 524077 A CH524077 A CH 524077A CH 635829 A5 CH635829 A5 CH 635829A5
- Authority
- CH
- Switzerland
- Prior art keywords
- group
- formula
- benzyl
- indazole
- hydrogen
- Prior art date
Links
- BAXOFTOLAUCFNW-UHFFFAOYSA-N 1H-indazole Chemical class C1=CC=C2C=NNC2=C1 BAXOFTOLAUCFNW-UHFFFAOYSA-N 0.000 title description 3
- 238000004519 manufacturing process Methods 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 24
- 238000000034 method Methods 0.000 claims description 14
- 125000002252 acyl group Chemical group 0.000 claims description 12
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 11
- 229910052739 hydrogen Inorganic materials 0.000 claims description 10
- 239000001257 hydrogen Substances 0.000 claims description 10
- 239000002253 acid Substances 0.000 claims description 7
- 238000002360 preparation method Methods 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 6
- -1 p-toluenesulfonyloxy group Chemical group 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- 150000007513 acids Chemical class 0.000 claims description 4
- GGHVECOXMJTFAC-UHFFFAOYSA-N 4-(oxiran-2-ylmethoxy)-1h-indazole Chemical class C=1C=CC=2NN=CC=2C=1OCC1CO1 GGHVECOXMJTFAC-UHFFFAOYSA-N 0.000 claims description 3
- 150000002431 hydrogen Chemical group 0.000 claims description 3
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 3
- 150000003512 tertiary amines Chemical class 0.000 claims description 3
- BVZRKVKNNBQPIC-UHFFFAOYSA-N 3-(1h-indazol-4-yloxy)propane-1,2-diol Chemical class OCC(O)COC1=CC=CC2=C1C=NN2 BVZRKVKNNBQPIC-UHFFFAOYSA-N 0.000 claims description 2
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 claims description 2
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 claims description 2
- 125000005948 methanesulfonyloxy group Chemical group 0.000 claims description 2
- 150000002473 indoazoles Chemical class 0.000 claims 4
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 2
- 238000003776 cleavage reaction Methods 0.000 claims 1
- 230000007017 scission Effects 0.000 claims 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 30
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 27
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 12
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- 239000013078 crystal Substances 0.000 description 10
- 238000006243 chemical reaction Methods 0.000 description 9
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 7
- 239000000203 mixture Substances 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 5
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 229960000583 acetic acid Drugs 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 238000004061 bleaching Methods 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- OWFXIOWLTKNBAP-UHFFFAOYSA-N isoamyl nitrite Chemical compound CC(C)CCON=O OWFXIOWLTKNBAP-UHFFFAOYSA-N 0.000 description 3
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- HQHCBVXHMXNQAN-UHFFFAOYSA-N n-(2,5-dimethyl-3-phenylmethoxyphenyl)acetamide Chemical compound CC(=O)NC1=CC(C)=CC(OCC=2C=CC=CC=2)=C1C HQHCBVXHMXNQAN-UHFFFAOYSA-N 0.000 description 3
- WDEGJQYOPQDMHW-UHFFFAOYSA-N n-(2-methyl-3-phenylmethoxyphenyl)acetamide Chemical compound CC(=O)NC1=CC=CC(OCC=2C=CC=CC=2)=C1C WDEGJQYOPQDMHW-UHFFFAOYSA-N 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- XZAOAFNAKJBVRA-UHFFFAOYSA-N 2,5-dimethyl-1-nitro-3-phenylmethoxybenzene Chemical compound [O-][N+](=O)C1=CC(C)=CC(OCC=2C=CC=CC=2)=C1C XZAOAFNAKJBVRA-UHFFFAOYSA-N 0.000 description 2
- HHBUAAXHXWSZAG-UHFFFAOYSA-N 2,5-dimethyl-3-nitrophenol Chemical compound CC1=CC(O)=C(C)C([N+]([O-])=O)=C1 HHBUAAXHXWSZAG-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 230000021736 acetylation Effects 0.000 description 2
- 238000006640 acetylation reaction Methods 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- GKIPXFAANLTWBM-UHFFFAOYSA-N epibromohydrin Chemical compound BrCC1CO1 GKIPXFAANLTWBM-UHFFFAOYSA-N 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 150000003460 sulfonic acids Chemical class 0.000 description 2
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- SGJSDGAQLYNPLF-UHFFFAOYSA-N 1-(4-hydroxy-5-methylindazol-1-yl)ethanone Chemical compound C(C)(=O)N1N=CC2=C(C(=CC=C12)C)O SGJSDGAQLYNPLF-UHFFFAOYSA-N 0.000 description 1
- QNTUJXIVMMRPEW-UHFFFAOYSA-N 1-(4-hydroxy-7-methylindazol-1-yl)ethanone Chemical compound C1=CC(C)=C2N(C(=O)C)N=CC2=C1O QNTUJXIVMMRPEW-UHFFFAOYSA-N 0.000 description 1
- TWXDGTXHMPFRLY-UHFFFAOYSA-N 1-(6-ethyl-4-hydroxyindazol-1-yl)ethanone Chemical compound CCC1=CC(O)=C2C=NN(C(C)=O)C2=C1 TWXDGTXHMPFRLY-UHFFFAOYSA-N 0.000 description 1
- SVWXZUHRSUDOAY-UHFFFAOYSA-N 1-(6-methyl-4-phenylmethoxyindazol-1-yl)ethanone Chemical compound C1=C(C)C=C2N(C(=O)C)N=CC2=C1OCC1=CC=CC=C1 SVWXZUHRSUDOAY-UHFFFAOYSA-N 0.000 description 1
- IDVYDIGMVKRDGK-UHFFFAOYSA-N 1-[5-methyl-4-(oxiran-2-ylmethoxy)indazol-1-yl]ethanone Chemical compound CC1=CC=C2N(C(=O)C)N=CC2=C1OCC1CO1 IDVYDIGMVKRDGK-UHFFFAOYSA-N 0.000 description 1
- NMCDWHSFYFNCJO-UHFFFAOYSA-N 1-[6-ethyl-4-(oxiran-2-ylmethoxy)indazol-1-yl]ethanone Chemical compound C=12C=NN(C(C)=O)C2=CC(CC)=CC=1OCC1CO1 NMCDWHSFYFNCJO-UHFFFAOYSA-N 0.000 description 1
- IVKZYPSZIUYYPC-UHFFFAOYSA-N 1-chloro-3-[(6-methyl-1h-indazol-4-yl)oxy]propan-2-ol Chemical compound CC1=CC(OCC(O)CCl)=C2C=NNC2=C1 IVKZYPSZIUYYPC-UHFFFAOYSA-N 0.000 description 1
- ZUUORJQYUSTAOL-UHFFFAOYSA-N 2,4-dimethyl-3-phenylmethoxyaniline Chemical compound CC1=CC=C(N)C(C)=C1OCC1=CC=CC=C1 ZUUORJQYUSTAOL-UHFFFAOYSA-N 0.000 description 1
- SVSPCRQUROHCPG-UHFFFAOYSA-N 2,5-dimethyl-3-phenylmethoxyaniline Chemical compound CC1=CC(N)=C(C)C(OCC=2C=CC=CC=2)=C1 SVSPCRQUROHCPG-UHFFFAOYSA-N 0.000 description 1
- KMXQUVMDZUGZIA-UHFFFAOYSA-N 2,6-dimethyl-3-phenylmethoxyaniline Chemical compound CC1=C(N)C(C)=CC=C1OCC1=CC=CC=C1 KMXQUVMDZUGZIA-UHFFFAOYSA-N 0.000 description 1
- WZFUQSJFWNHZHM-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)CC(=O)N1CC2=C(CC1)NN=N2 WZFUQSJFWNHZHM-UHFFFAOYSA-N 0.000 description 1
- PBSZHNXXFIYDBU-UHFFFAOYSA-N 2-methyl-1-nitro-3-phenylmethoxybenzene Chemical compound C1=CC=C([N+]([O-])=O)C(C)=C1OCC1=CC=CC=C1 PBSZHNXXFIYDBU-UHFFFAOYSA-N 0.000 description 1
- IHMXLABJHKKMTC-UHFFFAOYSA-N 2-methyl-3-phenylmethoxyaniline Chemical compound CC1=C(N)C=CC=C1OCC1=CC=CC=C1 IHMXLABJHKKMTC-UHFFFAOYSA-N 0.000 description 1
- JLRKNILWFUILKJ-UHFFFAOYSA-N 5-ethyl-2-methyl-1-nitro-3-phenylmethoxybenzene Chemical compound [O-][N+](=O)C1=CC(CC)=CC(OCC=2C=CC=CC=2)=C1C JLRKNILWFUILKJ-UHFFFAOYSA-N 0.000 description 1
- HRUXWGVMQORKMI-UHFFFAOYSA-N 5-methyl-4-(oxiran-2-ylmethoxy)-1h-indazole Chemical compound CC1=CC=C2NN=CC2=C1OCC1CO1 HRUXWGVMQORKMI-UHFFFAOYSA-N 0.000 description 1
- UJGNFASCJOYAHM-UHFFFAOYSA-N 5-methyl-4-phenylmethoxy-1h-indazole Chemical compound CC1=CC=C2NN=CC2=C1OCC1=CC=CC=C1 UJGNFASCJOYAHM-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- ZQUGXIKISQHCQQ-UHFFFAOYSA-N 6-ethyl-4-(oxiran-2-ylmethoxy)-1h-indazole Chemical compound C=12C=NNC2=CC(CC)=CC=1OCC1CO1 ZQUGXIKISQHCQQ-UHFFFAOYSA-N 0.000 description 1
- SYLVWBQJGYUSDI-UHFFFAOYSA-N 6-ethyl-4-phenylmethoxy-1h-indazole Chemical compound C=12C=NNC2=CC(CC)=CC=1OCC1=CC=CC=C1 SYLVWBQJGYUSDI-UHFFFAOYSA-N 0.000 description 1
- QCUPEVKVINNRGY-UHFFFAOYSA-N 6-methyl-4-(oxiran-2-ylmethoxy)-1h-indazole Chemical compound C=12C=NNC2=CC(C)=CC=1OCC1CO1 QCUPEVKVINNRGY-UHFFFAOYSA-N 0.000 description 1
- WTNCCUOYMPXXOJ-UHFFFAOYSA-N 6-methyl-4-phenylmethoxy-1h-indazole Chemical compound C=12C=NNC2=CC(C)=CC=1OCC1=CC=CC=C1 WTNCCUOYMPXXOJ-UHFFFAOYSA-N 0.000 description 1
- NXWNXIABAICVNK-UHFFFAOYSA-N 7-methyl-4-(oxiran-2-ylmethoxy)-1h-indazole Chemical compound C1=2C=NNC=2C(C)=CC=C1OCC1CO1 NXWNXIABAICVNK-UHFFFAOYSA-N 0.000 description 1
- UTAZKQRKYUPPHU-UHFFFAOYSA-N 7-methyl-4-phenylmethoxy-1h-indazole Chemical compound C1=2C=NNC=2C(C)=CC=C1OCC1=CC=CC=C1 UTAZKQRKYUPPHU-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- 241000167854 Bourreria succulenta Species 0.000 description 1
- QWOJMRHUQHTCJG-UHFFFAOYSA-N CC([CH2-])=O Chemical class CC([CH2-])=O QWOJMRHUQHTCJG-UHFFFAOYSA-N 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- 208000024172 Cardiovascular disease Diseases 0.000 description 1
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 1
- CTKINSOISVBQLD-UHFFFAOYSA-N Glycidol Chemical compound OCC1CO1 CTKINSOISVBQLD-UHFFFAOYSA-N 0.000 description 1
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- DDTSNYVELTVECR-UHFFFAOYSA-N [CH2-]C(C)=O.CC(C=C1)=CC=C1S(O)(=O)=O.OCC(CO)O Chemical compound [CH2-]C(C)=O.CC(C=C1)=CC=C1S(O)(=O)=O.OCC(CO)O DDTSNYVELTVECR-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 238000007098 aminolysis reaction Methods 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 230000003266 anti-allergic effect Effects 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- 102000012740 beta Adrenergic Receptors Human genes 0.000 description 1
- 108010079452 beta Adrenergic Receptors Proteins 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 235000019693 cherries Nutrition 0.000 description 1
- MHDVGSVTJDSBDK-UHFFFAOYSA-N dibenzyl ether Chemical compound C=1C=CC=CC=1COCC1=CC=CC=C1 MHDVGSVTJDSBDK-UHFFFAOYSA-N 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 150000002118 epoxides Chemical class 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- KXIFSSCKBFYNMX-UHFFFAOYSA-N hydrazine;nickel;hydrate Chemical compound O.[Ni].NN KXIFSSCKBFYNMX-UHFFFAOYSA-N 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- HXQDDGJWCKGECC-UHFFFAOYSA-N n-(2,4-dimethyl-3-phenylmethoxyphenyl)acetamide Chemical compound CC(=O)NC1=CC=C(C)C(OCC=2C=CC=CC=2)=C1C HXQDDGJWCKGECC-UHFFFAOYSA-N 0.000 description 1
- MVUUQAXKLJYSAG-UHFFFAOYSA-N n-(2,6-dimethyl-3-phenylmethoxyphenyl)acetamide Chemical compound CC(=O)NC1=C(C)C=CC(OCC=2C=CC=CC=2)=C1C MVUUQAXKLJYSAG-UHFFFAOYSA-N 0.000 description 1
- DCDDSUGWDNKHBU-UHFFFAOYSA-N n-(5-ethyl-2-methyl-3-phenylmethoxyphenyl)acetamide Chemical compound CCC1=CC(NC(C)=O)=C(C)C(OCC=2C=CC=CC=2)=C1 DCDDSUGWDNKHBU-UHFFFAOYSA-N 0.000 description 1
- 150000002828 nitro derivatives Chemical class 0.000 description 1
- 229910000510 noble metal Inorganic materials 0.000 description 1
- NOQXXYIGRPAZJC-UHFFFAOYSA-N oxiran-2-ylmethyl 4-methylbenzenesulfonate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)OCC1OC1 NOQXXYIGRPAZJC-UHFFFAOYSA-N 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- LEVJVKGPFAQPOI-UHFFFAOYSA-N phenylmethanone Chemical compound O=[C]C1=CC=CC=C1 LEVJVKGPFAQPOI-UHFFFAOYSA-N 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- YBRBMKDOPFTVDT-UHFFFAOYSA-N tert-butylamine Chemical compound CC(C)(C)N YBRBMKDOPFTVDT-UHFFFAOYSA-N 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 238000011282 treatment Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/54—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings condensed with carbocyclic rings or ring systems
- C07D231/56—Benzopyrazoles; Hydrogenated benzopyrazoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2619165A DE2619165C2 (de) | 1976-04-30 | 1976-04-30 | Indazolderivate und Verfahren zu ihrer Herstellung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH635829A5 true CH635829A5 (de) | 1983-04-29 |
Family
ID=5976769
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH524077A CH635829A5 (de) | 1976-04-30 | 1977-04-27 | Verfahren zur herstellung von indazolderivaten. |
Country Status (22)
| Country | Link |
|---|---|
| US (1) | US4171446A (enExample) |
| JP (1) | JPS52133983A (enExample) |
| AT (1) | AT351527B (enExample) |
| AU (1) | AU509997B2 (enExample) |
| BE (1) | BE853950A (enExample) |
| CA (1) | CA1082199A (enExample) |
| CH (1) | CH635829A5 (enExample) |
| CS (1) | CS200213B2 (enExample) |
| DD (1) | DD129785A5 (enExample) |
| DE (1) | DE2619165C2 (enExample) |
| DK (1) | DK142575C (enExample) |
| ES (1) | ES458177A1 (enExample) |
| FI (1) | FI771309A7 (enExample) |
| FR (1) | FR2349575A1 (enExample) |
| GB (1) | GB1517148A (enExample) |
| HU (1) | HU174676B (enExample) |
| IE (1) | IE44827B1 (enExample) |
| LU (1) | LU77226A1 (enExample) |
| NL (1) | NL7704531A (enExample) |
| PL (2) | PL120492B1 (enExample) |
| SE (1) | SE7704830L (enExample) |
| SU (2) | SU680643A3 (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2964147D1 (en) * | 1978-08-28 | 1983-01-05 | Fujisawa Pharmaceutical Co | New process for preparing an 1h-indazol-3-ylacetic acid derivative |
| EP0040418B1 (en) * | 1978-09-12 | 1985-07-03 | Fujisawa Pharmaceutical Co., Ltd. | Process for preparing an 1h-indazol-3-ylacetic acid derivative |
| US4537966A (en) * | 1983-12-22 | 1985-08-27 | Pennwalt Corporation | 1-(Aminobenzoyl)-1H-indazol-3-ols |
| DE69109057T2 (de) * | 1990-11-08 | 1995-09-21 | Ciba Geigy Ag | Pyrazol enthaltende Pigmentderivate. |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2645642A (en) * | 1953-07-14 | Process for the manufacture of | ||
| FR7631M (enExample) * | 1968-08-13 | 1970-01-26 |
-
1976
- 1976-04-30 DE DE2619165A patent/DE2619165C2/de not_active Expired
-
1977
- 1977-04-25 US US05/790,646 patent/US4171446A/en not_active Expired - Lifetime
- 1977-04-25 SU SU772475097A patent/SU680643A3/ru active
- 1977-04-25 DD DD7700198592A patent/DD129785A5/xx unknown
- 1977-04-25 FI FI771309A patent/FI771309A7/fi not_active Application Discontinuation
- 1977-04-26 NL NL7704531A patent/NL7704531A/xx not_active Application Discontinuation
- 1977-04-26 AU AU24592/77A patent/AU509997B2/en not_active Expired
- 1977-04-26 BE BE177011A patent/BE853950A/xx unknown
- 1977-04-26 ES ES458177A patent/ES458177A1/es not_active Expired
- 1977-04-26 JP JP4835177A patent/JPS52133983A/ja active Granted
- 1977-04-27 SE SE7704830A patent/SE7704830L/ not_active Application Discontinuation
- 1977-04-27 DK DK184477A patent/DK142575C/da active
- 1977-04-27 CH CH524077A patent/CH635829A5/de not_active IP Right Cessation
- 1977-04-28 IE IE855/77A patent/IE44827B1/en unknown
- 1977-04-28 AT AT303577A patent/AT351527B/de not_active IP Right Cessation
- 1977-04-28 PL PL1977197703A patent/PL120492B1/pl unknown
- 1977-04-28 FR FR7712886A patent/FR2349575A1/fr active Granted
- 1977-04-28 LU LU77226A patent/LU77226A1/xx unknown
- 1977-04-28 PL PL1977212690A patent/PL115906B1/pl unknown
- 1977-04-29 GB GB17994/77A patent/GB1517148A/en not_active Expired
- 1977-04-29 CA CA277,406A patent/CA1082199A/en not_active Expired
- 1977-04-29 HU HU77BO1665A patent/HU174676B/hu unknown
- 1977-04-29 CS CS772840A patent/CS200213B2/cs unknown
- 1977-12-29 SU SU772559953A patent/SU685150A3/ru active
Also Published As
| Publication number | Publication date |
|---|---|
| AU2459277A (en) | 1978-11-02 |
| LU77226A1 (enExample) | 1978-06-01 |
| JPS52133983A (en) | 1977-11-09 |
| IE44827L (en) | 1977-10-30 |
| AT351527B (de) | 1979-07-25 |
| DK142575C (da) | 1981-07-27 |
| BE853950A (fr) | 1977-10-26 |
| DE2619165A1 (de) | 1977-11-17 |
| JPS619950B2 (enExample) | 1986-03-27 |
| PL120492B1 (en) | 1982-03-31 |
| HU174676B (hu) | 1980-03-28 |
| PL197703A1 (pl) | 1979-01-29 |
| NL7704531A (nl) | 1977-11-01 |
| IE44827B1 (en) | 1982-04-07 |
| CA1082199A (en) | 1980-07-22 |
| SE7704830L (sv) | 1977-10-31 |
| SU680643A3 (ru) | 1979-08-15 |
| FR2349575B1 (enExample) | 1980-03-21 |
| FR2349575A1 (fr) | 1977-11-25 |
| DK142575B (da) | 1980-11-24 |
| US4171446A (en) | 1979-10-16 |
| ES458177A1 (es) | 1978-04-01 |
| ATA303577A (de) | 1979-01-15 |
| DE2619165C2 (de) | 1985-07-11 |
| SU685150A3 (ru) | 1979-09-05 |
| DD129785A5 (de) | 1978-02-08 |
| AU509997B2 (en) | 1980-06-05 |
| PL115906B1 (en) | 1981-05-30 |
| CS200213B2 (en) | 1980-08-29 |
| FI771309A7 (enExample) | 1977-10-31 |
| GB1517148A (en) | 1978-07-12 |
| DK184477A (da) | 1977-10-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0014951B1 (de) | Heterocyclische Oxypropanolamin-Derivate, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DD143074A5 (de) | Verfahren zur herstellung neuer n-aryl bzw.benzimidazolinone | |
| CH645100A5 (de) | Substituierte 3-aryl-pyrazole und 5-aryl-isoxazole und verfahren zu ihrer herstellung. | |
| EP0121753A2 (de) | 1-(1,3-Dioxolan-2-ylmethyl)-azole, ihre Salze, Verfahren zu ihrer Herstellung und sie enthaltende pharmazeutische Zubereitungen | |
| CH636099A5 (de) | Verfahren zur herstellung von piperidinopropanolderivaten. | |
| CH626351A5 (enExample) | ||
| EP0315009A2 (de) | Chromanderivate, Verfahren zu ihrer Herstelllung und ihre Verwendung in Arzneimitteln | |
| DE2737630C2 (enExample) | ||
| CH635829A5 (de) | Verfahren zur herstellung von indazolderivaten. | |
| EP0271099A2 (de) | Substituierte Aminopropionsäureamide, Verfahren zu ihrer Herstellung, diese enthaltende Mittel und ihre Verwendung sowie die bei der Herstellung anfallenden neuen Zwischenprodukte | |
| CH621341A5 (enExample) | ||
| DE936747C (de) | Verfahren zur Herstellung von neuen Pyrimidinderivaten und deren Salzen | |
| DD141157A1 (de) | Verfahren zur herstellung von neuen arylaminoimidazolinderivaten | |
| AT351528B (de) | Verfahren zur herstellung von neuen indazol- derivaten | |
| DE3815046A1 (de) | 3-chlor-2-methylphenethylaminoderivate | |
| AT213872B (de) | Verfahren zur Herstellung neuer basischer Phenoläther und ihrer Salze | |
| DE4208778C1 (enExample) | ||
| EP0003298A2 (de) | 4-Hydroxy-2-benzimidazolin-thion-Derivate, Verfahren zu deren Herstellung sowie diese Verbindungen enthaltende Arzneimittel | |
| EP0087656B1 (de) | Verfahren zur Herstellung von 1-(4-Chlorbenzoyl)-5-methoxy-2-methyl-3-indolacetoxyessigsäure | |
| DE2626890A1 (de) | Neue derivate des indols, verfahren zu deren herstellung sowie diese enthaltende arzneimittel | |
| AT332876B (de) | Verfahren zur herstellung von neuen benzodiazepin-derivaten | |
| AT360992B (de) | Verfahren zur herstellung neuer phenylazacyclo- alkane und von deren salzen und optisch aktiven verbindungen | |
| AT214427B (de) | Verfahren zur Herstellung neuer basischer Phenoläther | |
| AT239454B (de) | Verfahren zur Herstellung von 20-Cycloketalderivaten des 3β,5,17α-Trihydroxy-6β-methyl-16-methylen-5α-pregnan-20-ons | |
| AT225197B (de) | Verfahren zur Herstellung der neuen N-[p-3,3-disubstituierten-1-Azetidinyläthoxy)-benzyl]-3,4,5-trimethoxybenzamide |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |