CH625593A5 - - Google Patents
Download PDFInfo
- Publication number
- CH625593A5 CH625593A5 CH1430377A CH1430377A CH625593A5 CH 625593 A5 CH625593 A5 CH 625593A5 CH 1430377 A CH1430377 A CH 1430377A CH 1430377 A CH1430377 A CH 1430377A CH 625593 A5 CH625593 A5 CH 625593A5
- Authority
- CH
- Switzerland
- Prior art keywords
- frame
- door
- door according
- cover
- band
- Prior art date
Links
- 239000006260 foam Substances 0.000 claims description 14
- 239000000463 material Substances 0.000 claims description 6
- 239000010425 asbestos Substances 0.000 claims description 5
- 229910052895 riebeckite Inorganic materials 0.000 claims description 5
- 229910052751 metal Inorganic materials 0.000 claims description 4
- 239000002184 metal Substances 0.000 claims description 4
- 239000004744 fabric Substances 0.000 claims 3
- 238000007373 indentation Methods 0.000 claims 2
- 229910052782 aluminium Inorganic materials 0.000 description 5
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 5
- 238000007789 sealing Methods 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 3
- 239000011093 chipboard Substances 0.000 description 3
- 238000005187 foaming Methods 0.000 description 2
- 239000004115 Sodium Silicate Substances 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- 239000002969 artificial stone Substances 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000004020 conductor Substances 0.000 description 1
- 239000006261 foam material Substances 0.000 description 1
- 239000004088 foaming agent Substances 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 230000000873 masking effect Effects 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 239000011490 mineral wool Substances 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 1
- 229910052911 sodium silicate Inorganic materials 0.000 description 1
- SQMCFUSVGSBKFK-UHFFFAOYSA-M sodium;5-(cyclohexen-1-yl)-1,5-dimethylpyrimidin-3-ide-2,4,6-trione Chemical compound [Na+].O=C1N(C)C(=O)[N-]C(=O)C1(C)C1=CCCCC1 SQMCFUSVGSBKFK-UHFFFAOYSA-M 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Classifications
-
- E—FIXED CONSTRUCTIONS
- E06—DOORS, WINDOWS, SHUTTERS, OR ROLLER BLINDS IN GENERAL; LADDERS
- E06B—FIXED OR MOVABLE CLOSURES FOR OPENINGS IN BUILDINGS, VEHICLES, FENCES OR LIKE ENCLOSURES IN GENERAL, e.g. DOORS, WINDOWS, BLINDS, GATES
- E06B5/00—Doors, windows, or like closures for special purposes; Border constructions therefor
- E06B5/10—Doors, windows, or like closures for special purposes; Border constructions therefor for protection against air-raid or other war-like action; for other protective purposes
- E06B5/16—Fireproof doors or similar closures; Adaptations of fixed constructions therefor
- E06B5/164—Sealing arrangements between the door or window and its frame, e.g. intumescent seals specially adapted therefor
Landscapes
- Engineering & Computer Science (AREA)
- Civil Engineering (AREA)
- Structural Engineering (AREA)
- Special Wing (AREA)
- Glass Compositions (AREA)
- Curing Cements, Concrete, And Artificial Stone (AREA)
- Specific Sealing Or Ventilating Devices For Doors And Windows (AREA)
Priority Applications (14)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1430377A CH625593A5 (cg-RX-API-DMAC7.html) | 1977-11-22 | 1977-11-22 | |
| NO783809A NO783809L (no) | 1977-11-22 | 1978-11-13 | Doer. |
| DK504178A DK144980C (da) | 1977-11-22 | 1978-11-13 | Doer med foroeget brandbestandighed |
| FI783474A FI783474A7 (fi) | 1977-11-22 | 1978-11-14 | Doerr |
| SE7811739A SE7811739L (sv) | 1977-11-22 | 1978-11-14 | Dorr |
| AT0816478A AT373356B (de) | 1977-11-22 | 1978-11-15 | Tuer |
| DE19782850125 DE2850125A1 (de) | 1977-11-22 | 1978-11-18 | Tuer |
| GB7845306A GB2008178A (en) | 1977-11-22 | 1978-11-20 | Doors |
| LU80550A LU80550A1 (de) | 1977-11-22 | 1978-11-20 | Tuer |
| FR7832799A FR2409369A1 (fr) | 1977-11-22 | 1978-11-21 | Porte a chassis metallique |
| JP14489578A JPS54109231A (en) | 1977-11-22 | 1978-11-22 | Door |
| NL7811500A NL7811500A (nl) | 1977-11-22 | 1978-11-22 | Deur. |
| BE191888A BE872216A (fr) | 1977-11-22 | 1978-11-22 | Porte a chassis metallique |
| US06/075,936 US4307543A (en) | 1977-11-22 | 1979-09-17 | Door |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1430377A CH625593A5 (cg-RX-API-DMAC7.html) | 1977-11-22 | 1977-11-22 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH625593A5 true CH625593A5 (cg-RX-API-DMAC7.html) | 1981-09-30 |
Family
ID=4399688
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1430377A CH625593A5 (cg-RX-API-DMAC7.html) | 1977-11-22 | 1977-11-22 |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4307543A (cg-RX-API-DMAC7.html) |
| JP (1) | JPS54109231A (cg-RX-API-DMAC7.html) |
| AT (1) | AT373356B (cg-RX-API-DMAC7.html) |
| BE (1) | BE872216A (cg-RX-API-DMAC7.html) |
| CH (1) | CH625593A5 (cg-RX-API-DMAC7.html) |
| DE (1) | DE2850125A1 (cg-RX-API-DMAC7.html) |
| DK (1) | DK144980C (cg-RX-API-DMAC7.html) |
| FI (1) | FI783474A7 (cg-RX-API-DMAC7.html) |
| FR (1) | FR2409369A1 (cg-RX-API-DMAC7.html) |
| GB (1) | GB2008178A (cg-RX-API-DMAC7.html) |
| LU (1) | LU80550A1 (cg-RX-API-DMAC7.html) |
| NL (1) | NL7811500A (cg-RX-API-DMAC7.html) |
| NO (1) | NO783809L (cg-RX-API-DMAC7.html) |
| SE (1) | SE7811739L (cg-RX-API-DMAC7.html) |
Families Citing this family (43)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ATE11587T1 (de) * | 1981-03-06 | 1985-02-15 | Keller & Co., Aktiengesellschaft | Zarge einer tuer, deren tuerfutter miteinander verleimte teile aufweist. |
| JPS58501282A (ja) * | 1981-08-14 | 1983-08-04 | ヘイステイングス,オ−テイス エイチ. | 遮断装置および該装置に使用される複合積層体 |
| USD279409S (en) | 1982-11-23 | 1985-06-25 | Allen Jr George A | Combined smoke gasket and intumescent expanding seal device for sliding elevator doors and the like |
| DE3325630C2 (de) * | 1983-07-15 | 1986-08-14 | Hörmann KG Freisen, 6699 Freisen | Feuerschutztür oder dergleichen feuerhemmender Abschluß von Gebäudeöffnungen |
| GB8400990D0 (en) * | 1984-01-14 | 1984-02-15 | Chubb & Sons Lock & Safe Co | Fireresistant enclosures |
| JPS60174790U (ja) * | 1984-04-26 | 1985-11-19 | 株式会社 熊平製作所 | 防災、防湿扉 |
| AT380292B (de) * | 1984-05-17 | 1986-05-12 | Atlas Blech Center Gmbh | Dichtung fuer gebaeudeteile |
| USD293935S (en) | 1985-02-11 | 1988-01-26 | Allen Jr George A | Combined smoke gasket and intumescent expanding seal device for swinging doors |
| US4631866A (en) * | 1985-06-17 | 1986-12-30 | Garland Manufacturing Co. | Composite non-handed door jamb construction |
| US4676025A (en) * | 1986-01-02 | 1987-06-30 | Schlegel Corporation | Remotely activatable seal |
| USD299171S (en) | 1986-03-26 | 1988-12-27 | Allen Jr George A | Combined smoke gasket and intumescent expanding seal device for sliding doors |
| DE3621619A1 (de) * | 1986-06-27 | 1988-01-21 | Mueller Wilhelm K | Tuer oder fenster |
| FR2610311B1 (fr) * | 1987-02-04 | 1989-03-31 | Otis Elevator Co | Porte d'ascenseur coupe-feu |
| DE3717206A1 (de) * | 1987-05-22 | 1988-12-08 | Theo Schroeders | Profilkombination zum abdichten eines spaltes |
| JPH0637195Y2 (ja) * | 1987-07-30 | 1994-09-28 | 三井木材工業株式会社 | 建築用開口部の防火枠構造 |
| DE3839673C1 (cg-RX-API-DMAC7.html) * | 1988-11-24 | 1990-04-12 | Guenter Dipl.-Ing. 4772 Bad Sassendorf De Langenhorst | |
| CA2004357C (en) * | 1989-12-01 | 1994-12-13 | Salvatore Tizzoni | Thermally insulated aluminum door frame |
| US5152231A (en) * | 1991-01-30 | 1992-10-06 | John D. Brush & Co., Inc. | Fire-resistant safe |
| DE4129851A1 (de) * | 1991-09-07 | 1993-03-18 | Theo Schroeders | Tuerzarge mit einer brandschutzleiste |
| DE9210421U1 (de) * | 1992-08-04 | 1992-10-01 | Schröders, Theo, 5140 Erkelenz | Türzargenprofil |
| US5816017A (en) * | 1996-02-02 | 1998-10-06 | Yale Security Inc. | Fire retardant door and exit device for same |
| US5916077A (en) * | 1997-02-20 | 1999-06-29 | Chuan Mau Products, Ltd. | Composite fire-proof, heat-barrier door |
| AT500861B1 (de) * | 1998-07-10 | 2007-06-15 | Dana Tuerenindustrie | Mehrlagiger brandschutzbauteil |
| DE19933408B4 (de) * | 1999-07-21 | 2005-10-13 | Dorma Gmbh + Co. Kg | Brandschutztür oder -fenster |
| US6393779B1 (en) | 2000-07-19 | 2002-05-28 | Ex Cell Cellular Pvc Building Components, Inc. | Door frame assembly and method of mounting the same |
| GB2368364B (en) | 2000-10-12 | 2004-06-02 | Mdf Inc | Fire door and method of assembly |
| AU2003217720A1 (en) * | 2002-02-26 | 2003-09-09 | Washington Hardwoods Co., Llc | Fire-resistant wood assemblies for building |
| US6625933B1 (en) * | 2002-06-03 | 2003-09-30 | Chris R. Moeller | Attic cover |
| RU2249652C2 (ru) * | 2002-09-16 | 2005-04-10 | Общество с ограниченной ответственностью "Благовест" | Дверь |
| DE10318975B3 (de) * | 2003-04-26 | 2004-12-16 | Airbus Deutschland Gmbh | Verfahren zur Bekämpfung eines in einem geschlossenen Raum eines Flugzeuges auftretenden Feuers |
| US20050268559A1 (en) * | 2004-05-21 | 2005-12-08 | Ellingson Robert T | Rollable door seal with integral intumescent strips |
| DE102008031364A1 (de) * | 2008-07-04 | 2010-01-07 | Stöbich Brandschutz GmbH | Zarge |
| US8327778B2 (en) * | 2009-10-28 | 2012-12-11 | Dellorusso Jr Anthony J | Light weight portable fire resistant containment system |
| US8474386B2 (en) | 2009-10-28 | 2013-07-02 | Anthony J. DelloRusso, JR. | Fire resistant containment system having a light weight portable removable enclosure |
| TWM430523U (en) * | 2012-01-06 | 2012-06-01 | Kwangfu Tech Co Ltd | Lock-free metal fire door |
| US10378273B2 (en) | 2015-07-24 | 2019-08-13 | Nan Ya Plastics Corporation | Soundproof door for use in reduction of sound transmitted from one side of the door to the other side |
| US10113355B2 (en) * | 2015-07-24 | 2018-10-30 | Nan Ya Plastics Corporation | Soundproof door for use in reduction of sound transmitted from one side of the door to the other side |
| US9725946B1 (en) * | 2016-09-08 | 2017-08-08 | Gregory A Header | Cladding system for glazed doors and windows |
| GB2558635A (en) * | 2017-01-12 | 2018-07-18 | Andoras Ltd | Lapped closure system |
| DE102017128873A1 (de) * | 2017-12-05 | 2019-06-06 | Novoferm Riexinger Türenwerke GmbH | Hinterfüllung mit intumeszierendem Material |
| GB2581202B (en) * | 2019-02-11 | 2023-08-23 | Solidcor Ltd | Improvements in or relating to fire-related door sets |
| NL1043636B1 (nl) * | 2020-04-23 | 2021-11-01 | Comforthome B V | Smeltzekering |
| US20240229548A9 (en) * | 2021-02-03 | 2024-07-11 | Walter Andre | Fire door, frame, and method for producing the fire door |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH569181A5 (en) * | 1974-05-02 | 1975-11-14 | Keller & Co Ag | Fire retarding smoke proof protection door - has sealing strip which expands on heating and seals door gaps |
| DE2607248A1 (de) * | 1975-02-26 | 1976-09-09 | Horst Peter Dipl Ing Seiffarth | Anordnung bei einer feuerhemmenden tuere o.dgl. durchgangsoeffnung |
| US3964214A (en) * | 1975-06-25 | 1976-06-22 | United States Gypsum Company | Smoke stop |
-
1977
- 1977-11-22 CH CH1430377A patent/CH625593A5/de not_active IP Right Cessation
-
1978
- 1978-11-13 NO NO783809A patent/NO783809L/no unknown
- 1978-11-13 DK DK504178A patent/DK144980C/da active
- 1978-11-14 FI FI783474A patent/FI783474A7/fi unknown
- 1978-11-14 SE SE7811739A patent/SE7811739L/xx unknown
- 1978-11-15 AT AT0816478A patent/AT373356B/de not_active IP Right Cessation
- 1978-11-18 DE DE19782850125 patent/DE2850125A1/de not_active Ceased
- 1978-11-20 LU LU80550A patent/LU80550A1/de unknown
- 1978-11-20 GB GB7845306A patent/GB2008178A/en not_active Withdrawn
- 1978-11-21 FR FR7832799A patent/FR2409369A1/fr active Granted
- 1978-11-22 JP JP14489578A patent/JPS54109231A/ja active Pending
- 1978-11-22 NL NL7811500A patent/NL7811500A/xx not_active Application Discontinuation
- 1978-11-22 BE BE191888A patent/BE872216A/xx not_active IP Right Cessation
-
1979
- 1979-09-17 US US06/075,936 patent/US4307543A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| FR2409369B1 (cg-RX-API-DMAC7.html) | 1983-11-10 |
| NO783809L (no) | 1979-05-23 |
| JPS54109231A (en) | 1979-08-27 |
| SE7811739L (sv) | 1979-05-23 |
| BE872216A (fr) | 1979-03-16 |
| DK504178A (da) | 1979-05-23 |
| ATA816478A (de) | 1983-05-15 |
| FI783474A7 (fi) | 1979-05-23 |
| DE2850125A1 (de) | 1979-05-23 |
| GB2008178A (en) | 1979-05-31 |
| DK144980B (da) | 1982-07-19 |
| NL7811500A (nl) | 1979-05-25 |
| LU80550A1 (de) | 1979-03-22 |
| AT373356B (de) | 1984-01-10 |
| DK144980C (da) | 1982-12-13 |
| FR2409369A1 (fr) | 1979-06-15 |
| US4307543A (en) | 1981-12-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH625593A5 (cg-RX-API-DMAC7.html) | ||
| DE3009729A1 (de) | Bauteil (bauelement) | |
| DE3705401C2 (cg-RX-API-DMAC7.html) | ||
| DE2742665A1 (de) | Feuerhemmende schwing- oder pendeltuer | |
| DE3541442C2 (cg-RX-API-DMAC7.html) | ||
| DE2543685C2 (de) | Dichtung für Türen, Fenster oder dgl. sowie Verfahren zu deren Herstellung | |
| DE8715428U1 (de) | Dichtungsstreifen aus imprägniertem, offenzelligem Kunststoffschaum | |
| DE3502032A1 (de) | Tuer oder tor mit wenigstens einem isolierten fluegel, insbesondere brandschutztor | |
| DE2525309A1 (de) | Feuerbestaendige tuer | |
| DE7148693U (de) | Feuerhemmende Tür, Klappe od. dgl | |
| EP2535473A2 (de) | Brandschutzsystem sowie Brandschutztür, Brandschutz-Wandelement und Brandschutzplatte hierfür | |
| DE2607248A1 (de) | Anordnung bei einer feuerhemmenden tuere o.dgl. durchgangsoeffnung | |
| EP1533462B1 (de) | Feuerabschlusselement und Verfahren zur Herstellung | |
| DE19937835A1 (de) | Feuerschutzsystem | |
| DE2738625A1 (de) | Tuer- und tuerrahmenanordnung | |
| DE69415634T2 (de) | Feuerbeständige Trennwand und Rahmen dafür | |
| EP0115554B1 (de) | Einrichtung zur Verkleidung eines Türstockes | |
| EP1020608B1 (de) | Verbundprofil für Rahmen von Wandelementen, Türen und Fenstern | |
| DE2600420A1 (de) | Druckausgleichselement | |
| EP1387020A2 (de) | Revisionsklappe | |
| EP0124881B1 (de) | Feuerschutztür mit einem wenigstens im Rahmenbereich aus Holz bestehenden Türblatt | |
| DE2511331A1 (de) | Druckausgleichselement | |
| DE29917162U1 (de) | Kombiniertes Dichtungs- und Brandschutzprofil | |
| EP0333982A1 (de) | Durchführung für Leitungen, wie Kabel Rohre oder dergl. durch eine Wandöffnung | |
| DE3727163C1 (en) | Means for fastening a frame in a wall opening |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |