CH616742A5 - - Google Patents
Download PDFInfo
- Publication number
- CH616742A5 CH616742A5 CH1381675A CH1381675A CH616742A5 CH 616742 A5 CH616742 A5 CH 616742A5 CH 1381675 A CH1381675 A CH 1381675A CH 1381675 A CH1381675 A CH 1381675A CH 616742 A5 CH616742 A5 CH 616742A5
- Authority
- CH
- Switzerland
- Prior art keywords
- explosive
- electrically conductive
- electron conductor
- detonator
- conductive layer
- Prior art date
Links
- 239000002360 explosive Substances 0.000 claims description 58
- 239000004020 conductor Substances 0.000 claims description 39
- 239000003380 propellant Substances 0.000 claims description 9
- 239000000020 Nitrocellulose Substances 0.000 claims description 8
- 229910052751 metal Inorganic materials 0.000 claims description 8
- 239000002184 metal Substances 0.000 claims description 8
- 229920001220 nitrocellulos Polymers 0.000 claims description 8
- 239000011230 binding agent Substances 0.000 claims description 7
- 239000002904 solvent Substances 0.000 claims description 5
- 229910052787 antimony Inorganic materials 0.000 claims description 4
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 3
- YADSGOSSYOOKMP-UHFFFAOYSA-N dioxolead Chemical compound O=[Pb]=O YADSGOSSYOOKMP-UHFFFAOYSA-N 0.000 claims 2
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 claims 1
- 239000013078 crystal Substances 0.000 description 8
- 239000002923 metal particle Substances 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- 239000002245 particle Substances 0.000 description 4
- 239000000654 additive Substances 0.000 description 3
- 239000000470 constituent Substances 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- HVAASIXVWLHFJF-UHFFFAOYSA-L barium(2+);2,4,6-trinitrophenolate Chemical compound [Ba+2].[O-]C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O.[O-]C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O HVAASIXVWLHFJF-UHFFFAOYSA-L 0.000 description 2
- 230000005611 electricity Effects 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- OXNIZHLAWKMVMX-UHFFFAOYSA-N picric acid Chemical class OC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-N 0.000 description 2
- RBGOCSKFMWMTRZ-UHFFFAOYSA-M potassium picrate Chemical compound [K+].[O-]C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O RBGOCSKFMWMTRZ-UHFFFAOYSA-M 0.000 description 2
- -1 pyrite or FeS Chemical class 0.000 description 2
- 230000003068 static effect Effects 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000001311 chemical methods and process Methods 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 238000002485 combustion reaction Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000006252 electrolytic conductor Substances 0.000 description 1
- 239000003292 glue Substances 0.000 description 1
- 229910002804 graphite Inorganic materials 0.000 description 1
- 239000010439 graphite Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 150000001247 metal acetylides Chemical class 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 239000013081 microcrystal Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 238000009527 percussion Methods 0.000 description 1
- NIFIFKQPDTWWGU-UHFFFAOYSA-N pyrite Chemical compound [Fe+2].[S-][S-] NIFIFKQPDTWWGU-UHFFFAOYSA-N 0.000 description 1
- 229910052683 pyrite Inorganic materials 0.000 description 1
- 239000011028 pyrite Substances 0.000 description 1
- 239000004065 semiconductor Substances 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 238000004904 shortening Methods 0.000 description 1
- 229910021332 silicide Inorganic materials 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- IXHMHWIBCIYOAZ-UHFFFAOYSA-N styphnic acid Chemical compound OC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C(O)=C1[N+]([O-])=O IXHMHWIBCIYOAZ-UHFFFAOYSA-N 0.000 description 1
- 150000004763 sulfides Chemical class 0.000 description 1
Classifications
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F42—AMMUNITION; BLASTING
- F42C—AMMUNITION FUZES; ARMING OR SAFETY MEANS THEREFOR
- F42C19/00—Details of fuzes
- F42C19/08—Primers; Detonators
- F42C19/085—Primers for caseless ammunition
Landscapes
- Engineering & Computer Science (AREA)
- General Engineering & Computer Science (AREA)
- Conductive Materials (AREA)
- Air Bags (AREA)
- Insulated Conductors (AREA)
- Adhesives Or Adhesive Processes (AREA)
- Insulating Bodies (AREA)
- Connections Effected By Soldering, Adhesion, Or Permanent Deformation (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2451370A DE2451370C2 (de) | 1974-10-29 | 1974-10-29 | Elektrischer Zünder für hülsenlose Treibsätze und Verfahren zur Herstellung solcher Zünder |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH616742A5 true CH616742A5 (cs) | 1980-04-15 |
Family
ID=5929494
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1381675A CH616742A5 (cs) | 1974-10-29 | 1975-10-24 |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4402268A (cs) |
| JP (1) | JPS605879B2 (cs) |
| AT (1) | AT350948B (cs) |
| AU (1) | AU498512B2 (cs) |
| CH (1) | CH616742A5 (cs) |
| DD (1) | DD121175A5 (cs) |
| DE (1) | DE2451370C2 (cs) |
| FR (1) | FR2289876A1 (cs) |
| GB (1) | GB1529467A (cs) |
| IT (1) | IT1048351B (cs) |
| MX (1) | MX3290E (cs) |
| SE (1) | SE432419B (cs) |
| ZA (1) | ZA756819B (cs) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3707694A1 (de) * | 1987-03-11 | 1988-09-29 | Dynamit Nobel Ag | Elektrisch anzuendbare anzuendsaetze fuer huelsenlose munition und treibkartuschen |
| US5027707A (en) * | 1989-05-08 | 1991-07-02 | Olin Corporation | Electric primer with reduced RF and ESD hazard |
| US4994125A (en) * | 1989-05-08 | 1991-02-19 | Olin Corporation | Electric primer with intrinsic conductive mix |
| SE509310C2 (sv) * | 1994-06-17 | 1999-01-11 | Foersvarets Forskningsanstalt | Sätt att elektriskt initiera och styra förbränningen av en kompakt drivladdning samt drivladdning |
| RU2110505C1 (ru) * | 1997-03-18 | 1998-05-10 | Акционерное общество закрытого типа "Би-Вест Импорт - Русское отделение" | Пиротехнический ударный состав для капсюлей-воспламенителей центрального боя к патронам стрелкового оружия |
| US20020190426A1 (en) * | 2001-02-09 | 2002-12-19 | Seidner Nathan M. | Static dissipative mold release agent and use in casting and molding processes |
| DE10144618A1 (de) * | 2001-09-11 | 2003-03-27 | Hilti Ag | Treibmittelmagazin für Setzgeräte |
| US20060011276A1 (en) * | 2002-04-24 | 2006-01-19 | Charles Grix | Electrically controlled solid propellant |
| RU2315027C1 (ru) * | 2006-08-22 | 2008-01-20 | Закрытое Акционерное общество "БИ-ВЕСТ" | Термостойкий электродетонатор |
| CN103387475B (zh) * | 2013-07-31 | 2016-04-06 | 雅化集团绵阳实业有限公司 | 一种地震勘探电雷管引火药 |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| LU35542A1 (cs) * | 1957-10-29 | |||
| US3198117A (en) * | 1961-10-02 | 1965-08-03 | Bendix Corp | Electrically triggered squib with semiconductive dissipater for stray currents |
| BE630909A (cs) | 1962-04-12 | |||
| DE1269555B (de) * | 1964-02-28 | 1968-05-30 | Dynamit Nobel Ag | Verfahren zur Herstellung leitfaehiger Zuendsaetze |
| US3522320A (en) * | 1964-04-17 | 1970-07-28 | Atlas Chem Ind | Method of making barium styphnate |
| DE1578234A1 (de) | 1965-05-05 | 1971-01-07 | Smith And Wesson Inc | Elektrisches Gewehr und dafuer geeignete Munition |
| US3284255A (en) * | 1965-07-01 | 1966-11-08 | Northrop Carolina Inc | Explosive initiator comprising barium styphnate and lead azide |
| GB1098606A (en) * | 1965-08-09 | 1968-01-10 | Ici Ltd | Explosive compositions |
| US3608492A (en) * | 1969-10-02 | 1971-09-28 | Gen Electric | Ammunition high-voltage electrical ignition system |
| US3602283A (en) * | 1969-11-24 | 1971-08-31 | Us Navy | Priming mixture for ammunition |
| BE794600A (fr) * | 1972-01-28 | 1973-05-16 | Usel Hubert | Cartouche sans etui pour mise a feu electrique |
-
1974
- 1974-10-29 DE DE2451370A patent/DE2451370C2/de not_active Expired
-
1975
- 1975-10-24 CH CH1381675A patent/CH616742A5/de not_active IP Right Cessation
- 1975-10-27 AT AT816475A patent/AT350948B/de not_active IP Right Cessation
- 1975-10-27 DD DD189069A patent/DD121175A5/xx unknown
- 1975-10-27 IT IT51939/75A patent/IT1048351B/it active
- 1975-10-28 MX MX100278U patent/MX3290E/es unknown
- 1975-10-28 JP JP50129766A patent/JPS605879B2/ja not_active Expired
- 1975-10-28 SE SE7512051A patent/SE432419B/xx not_active IP Right Cessation
- 1975-10-28 GB GB44468/75A patent/GB1529467A/en not_active Expired
- 1975-10-28 FR FR7532949A patent/FR2289876A1/fr active Granted
- 1975-10-29 AU AU86110/75A patent/AU498512B2/en not_active Expired
- 1975-10-29 ZA ZA00756819A patent/ZA756819B/xx unknown
-
1980
- 1980-04-30 US US06/145,571 patent/US4402268A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| ATA816475A (de) | 1978-11-15 |
| FR2289876A1 (fr) | 1976-05-28 |
| JPS5167712A (cs) | 1976-06-11 |
| DD121175A5 (cs) | 1976-07-12 |
| AU8611075A (en) | 1977-05-05 |
| SE432419B (sv) | 1984-04-02 |
| GB1529467A (en) | 1978-10-18 |
| ZA756819B (en) | 1976-10-27 |
| DE2451370A1 (de) | 1976-05-06 |
| SE7512051L (sv) | 1976-04-30 |
| JPS605879B2 (ja) | 1985-02-14 |
| IT1048351B (it) | 1980-11-20 |
| FR2289876B1 (cs) | 1980-05-09 |
| AU498512B2 (en) | 1979-03-15 |
| AT350948B (de) | 1979-06-25 |
| DE2451370C2 (de) | 1986-05-15 |
| US4402268A (en) | 1983-09-06 |
| MX3290E (es) | 1980-08-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3707694C2 (cs) | ||
| DE3141980C2 (cs) | ||
| DE2451370C2 (de) | Elektrischer Zünder für hülsenlose Treibsätze und Verfahren zur Herstellung solcher Zünder | |
| DE60006322T2 (de) | Zweistufiger, optischer Detonator mit Schlagwirkung | |
| DE2206468C2 (de) | Elektrische Zündung | |
| DE2754855C2 (de) | Verfahren zur Verbesserung der Druckabhängigkeit des Abbrandverhaltens von Festtreiboder Rohrwaffentreibmittel und Verwendung der nach dem Verfahren hergestellten Treibmittel | |
| DE1174235B (de) | Elektrisch leitfaehiger Zuendsatz fuer Niederspannungs-Funkenzuender | |
| DE1132475B (de) | Elektrischer Funkenzuender | |
| WO2001086684A1 (de) | Schmelzleiter und verfahren zu seiner herstellung sowie sicherungsleiter und sicherung | |
| DE1571238A1 (de) | Sprengstoffmischung | |
| CH663089A5 (de) | Polkoerper fuer eine elektrische zuendvorrichtung, verfahren zu seiner herstellung und dessen verwendung. | |
| EP1110928A1 (de) | Anzündelement und fein abstufbare Zündsätze | |
| EP1064241B1 (de) | Durch elektrische auslösung anzündbare initialexplosivstoffe und anzündsätze | |
| DE1272790B (de) | Sicherheitsbrueckenzuender | |
| DE1590215C3 (de) | Verfahren zur Herstellung einer elektrisch leitenden Oberflache auf einem im wesentlichen aus Aluminiumoxyd bestehenden Isolator | |
| DE1036138B (de) | Funkenzuender | |
| DE1948034A1 (de) | Halbleiterkontakt und Verfahren zu seiner Herstellung | |
| DE2152011C3 (de) | Verfahren zum Metallisieren von Oberflächen keramischer Körper | |
| DE2633168C3 (de) | Verzögerungsdetonator | |
| DE2116353A1 (de) | Pulverförmiger Ammoniumnitratsprengstoff hoher Wasserfestigkeit und Dichte | |
| DE1012854B (de) | Verfahren zur Herstellung eines leitfaehigen Initialsprengstoffes | |
| DE19742034A1 (de) | Verfahren zur Herstellung eines Zündmittels | |
| DE945805C (de) | Zuendsatz fuer elektrische Blitzlichtlampen | |
| DE1293068B (de) | Gegen Fremdspannung gesicherter elektrischer Zuenderkopf | |
| DE69728912T2 (de) | Leitfähige zündmittelmischung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |