CH509359A - Verfahren zur Herstellung von faserbildendem Polyester - Google Patents
Verfahren zur Herstellung von faserbildendem PolyesterInfo
- Publication number
- CH509359A CH509359A CH1047066A CH1047066A CH509359A CH 509359 A CH509359 A CH 509359A CH 1047066 A CH1047066 A CH 1047066A CH 1047066 A CH1047066 A CH 1047066A CH 509359 A CH509359 A CH 509359A
- Authority
- CH
- Switzerland
- Prior art keywords
- sep
- glycol
- reaction
- oligomer
- stage
- Prior art date
Links
- 229920000728 polyester Polymers 0.000 title claims abstract description 30
- 125000003118 aryl group Chemical group 0.000 title description 7
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims abstract description 218
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 claims abstract description 112
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 claims abstract description 80
- 238000000034 method Methods 0.000 claims abstract description 43
- 239000002253 acid Substances 0.000 claims abstract description 19
- 238000006068 polycondensation reaction Methods 0.000 claims abstract description 13
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 12
- 239000000203 mixture Substances 0.000 claims abstract description 11
- 150000007513 acids Chemical class 0.000 claims abstract description 4
- 238000006243 chemical reaction Methods 0.000 claims description 68
- 150000002148 esters Chemical class 0.000 claims description 35
- 238000006116 polymerization reaction Methods 0.000 claims description 33
- 239000007795 chemical reaction product Substances 0.000 claims description 18
- -1 polyethylene terephthalate Polymers 0.000 claims description 15
- 125000004185 ester group Chemical group 0.000 claims description 7
- 238000004519 manufacturing process Methods 0.000 claims description 6
- 150000001991 dicarboxylic acids Chemical class 0.000 claims description 5
- 150000002334 glycols Chemical class 0.000 claims description 3
- 229920000139 polyethylene terephthalate Polymers 0.000 claims description 3
- 239000005020 polyethylene terephthalate Substances 0.000 claims description 3
- 230000001476 alcoholic effect Effects 0.000 claims description 2
- 230000001419 dependent effect Effects 0.000 claims 2
- 238000010438 heat treatment Methods 0.000 abstract description 11
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Natural products OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 abstract 1
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 59
- 238000005886 esterification reaction Methods 0.000 description 38
- 230000032050 esterification Effects 0.000 description 25
- QPKOBORKPHRBPS-UHFFFAOYSA-N bis(2-hydroxyethyl) terephthalate Chemical compound OCCOC(=O)C1=CC=C(C(=O)OCCO)C=C1 QPKOBORKPHRBPS-UHFFFAOYSA-N 0.000 description 15
- ADCOVFLJGNWWNZ-UHFFFAOYSA-N antimony trioxide Chemical compound O=[Sb]O[Sb]=O ADCOVFLJGNWWNZ-UHFFFAOYSA-N 0.000 description 14
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 12
- 239000000047 product Substances 0.000 description 12
- 229920000642 polymer Polymers 0.000 description 11
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 10
- 230000015572 biosynthetic process Effects 0.000 description 9
- 238000005755 formation reaction Methods 0.000 description 9
- 238000004821 distillation Methods 0.000 description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N diethyl ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 7
- 238000006266 etherification reaction Methods 0.000 description 7
- 239000003054 catalyst Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 239000000835 fiber Substances 0.000 description 4
- 230000035484 reaction time Effects 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 238000012691 depolymerization reaction Methods 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 238000007086 side reaction Methods 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 2
- 230000015556 catabolic process Effects 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000006731 degradation reaction Methods 0.000 description 2
- WOZVHXUHUFLZGK-UHFFFAOYSA-N dimethyl terephthalate Chemical compound COC(=O)C1=CC=C(C(=O)OC)C=C1 WOZVHXUHUFLZGK-UHFFFAOYSA-N 0.000 description 2
- 239000012456 homogeneous solution Substances 0.000 description 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- ONJNHSZRRFHSPJ-UHFFFAOYSA-N 2,2,4,4-tetramethylcyclobutane-1,1-diol Chemical compound CC1(C)CC(C)(C)C1(O)O ONJNHSZRRFHSPJ-UHFFFAOYSA-N 0.000 description 1
- ISPYQTSUDJAMAB-UHFFFAOYSA-N 2-chlorophenol Chemical compound OC1=CC=CC=C1Cl ISPYQTSUDJAMAB-UHFFFAOYSA-N 0.000 description 1
- BTVWZWFKMIUSGS-UHFFFAOYSA-N 2-methylpropane-1,2-diol Chemical compound CC(C)(O)CO BTVWZWFKMIUSGS-UHFFFAOYSA-N 0.000 description 1
- VAXBLYWAVAIJJJ-UHFFFAOYSA-N 4-[2-(4-carboxyphenoxy)ethoxy]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1OCCOC1=CC=C(C(O)=O)C=C1 VAXBLYWAVAIJJJ-UHFFFAOYSA-N 0.000 description 1
- HCUNREWMFYCWAQ-UHFFFAOYSA-N 4-[2-(4-carboxyphenyl)ethyl]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1CCC1=CC=C(C(O)=O)C=C1 HCUNREWMFYCWAQ-UHFFFAOYSA-N 0.000 description 1
- YIMQCDZDWXUDCA-UHFFFAOYSA-N [4-(hydroxymethyl)cyclohexyl]methanol Chemical compound OCC1CCC(CO)CC1 YIMQCDZDWXUDCA-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000006229 carbon black Substances 0.000 description 1
- PMMYEEVYMWASQN-IMJSIDKUSA-N cis-4-Hydroxy-L-proline Chemical compound O[C@@H]1CN[C@H](C(O)=O)C1 PMMYEEVYMWASQN-IMJSIDKUSA-N 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000011437 continuous method Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 239000000539 dimer Substances 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 150000002484 inorganic compounds Chemical class 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 235000021184 main course Nutrition 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 229940071125 manganese acetate Drugs 0.000 description 1
- UOGMEBQRZBEZQT-UHFFFAOYSA-L manganese(2+);diacetate Chemical compound [Mn+2].CC([O-])=O.CC([O-])=O UOGMEBQRZBEZQT-UHFFFAOYSA-L 0.000 description 1
- 239000006224 matting agent Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- KYTZHLUVELPASH-UHFFFAOYSA-N naphthalene-1,2-dicarboxylic acid Chemical compound C1=CC=CC2=C(C(O)=O)C(C(=O)O)=CC=C21 KYTZHLUVELPASH-UHFFFAOYSA-N 0.000 description 1
- MNZMMCVIXORAQL-UHFFFAOYSA-N naphthalene-2,6-diol Chemical compound C1=C(O)C=CC2=CC(O)=CC=C21 MNZMMCVIXORAQL-UHFFFAOYSA-N 0.000 description 1
- SLCVBVWXLSEKPL-UHFFFAOYSA-N neopentyl glycol Chemical compound OCC(C)(C)CO SLCVBVWXLSEKPL-UHFFFAOYSA-N 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 238000005192 partition Methods 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- KKEYFWRCBNTPAC-UHFFFAOYSA-L terephthalate(2-) Chemical compound [O-]C(=O)C1=CC=C(C([O-])=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-L 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G63/00—Macromolecular compounds obtained by reactions forming a carboxylic ester link in the main chain of the macromolecule
- C08G63/78—Preparation processes
- C08G63/785—Preparation processes characterised by the apparatus used
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyesters Or Polycarbonates (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP4382865 | 1965-07-20 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH509359A true CH509359A (de) | 1971-06-30 |
Family
ID=12674601
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1047066A CH509359A (de) | 1965-07-20 | 1966-07-20 | Verfahren zur Herstellung von faserbildendem Polyester |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3442868A (enExample) |
| CH (1) | CH509359A (enExample) |
| DE (1) | DE1645494A1 (enExample) |
| GB (1) | GB1152726A (enExample) |
| NL (1) | NL6610149A (enExample) |
Families Citing this family (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1720424A1 (de) * | 1967-12-08 | 1971-09-23 | Albert Ag Chem Werke | Verfahren zur mehrstufigen Herstellung haertbarer Fettsaeure-modifizierter Polykondensate auf Basis von Telomerisaten |
| US3673139A (en) * | 1970-04-06 | 1972-06-27 | Sandoz Ltd | Process for the production of injection moulded and extrusion moulded polyester products |
| JPS5343200B2 (enExample) * | 1974-08-26 | 1978-11-17 | ||
| US4166896A (en) * | 1976-02-23 | 1979-09-04 | Owens-Corning Fiberglas Corporation | Polyester production |
| DK378479A (da) * | 1978-10-02 | 1980-04-03 | Henkel & Cie Gmbh | Fremgangsmaade til fremstilling af modoficerede alkydharpikser og harpiksernes anvendelse som lakbindemiddel |
| US6528579B2 (en) | 2000-02-17 | 2003-03-04 | Shell Oil Company | Zero-heel polyester process |
| EP1453883B1 (en) * | 2000-12-07 | 2012-11-21 | Grupo Petrotemex, S.A. de C.V. | Low cost polyester process using a pipe reactor |
| US6906164B2 (en) * | 2000-12-07 | 2005-06-14 | Eastman Chemical Company | Polyester process using a pipe reactor |
| US7135541B2 (en) | 2003-06-06 | 2006-11-14 | Eastman Chemical Company | Polyester process using a pipe reactor |
| US7074879B2 (en) * | 2003-06-06 | 2006-07-11 | Eastman Chemical Company | Polyester process using a pipe reactor |
| US7332548B2 (en) * | 2004-03-04 | 2008-02-19 | Eastman Chemical Company | Process for production of a polyester product from alkylene oxide and carboxylic acid |
| US7943094B2 (en) | 2006-12-07 | 2011-05-17 | Grupo Petrotemex, S.A. De C.V. | Polyester production system employing horizontally elongated esterification vessel |
| US20080139780A1 (en) * | 2006-12-07 | 2008-06-12 | Debruin Bruce Roger | Polyester production system employing short residence time esterification |
| US7649109B2 (en) * | 2006-12-07 | 2010-01-19 | Eastman Chemical Company | Polyester production system employing recirculation of hot alcohol to esterification zone |
| US7863477B2 (en) * | 2007-03-08 | 2011-01-04 | Eastman Chemical Company | Polyester production system employing hot paste to esterification zone |
| US7842777B2 (en) * | 2007-07-12 | 2010-11-30 | Eastman Chemical Company | Sloped tubular reactor with divided flow |
| US7868129B2 (en) * | 2007-07-12 | 2011-01-11 | Eastman Chemical Company | Sloped tubular reactor with spaced sequential trays |
| US7829653B2 (en) * | 2007-07-12 | 2010-11-09 | Eastman Chemical Company | Horizontal trayed reactor |
| US7872089B2 (en) | 2007-07-12 | 2011-01-18 | Eastman Chemical Company | Multi-level tubular reactor with internal tray |
| US7858730B2 (en) * | 2007-07-12 | 2010-12-28 | Eastman Chemical Company | Multi-level tubular reactor with dual headers |
| US7872090B2 (en) * | 2007-07-12 | 2011-01-18 | Eastman Chemical Company | Reactor system with optimized heating and phase separation |
| US7847053B2 (en) | 2007-07-12 | 2010-12-07 | Eastman Chemical Company | Multi-level tubular reactor with oppositely extending segments |
| US7868130B2 (en) * | 2007-07-12 | 2011-01-11 | Eastman Chemical Company | Multi-level tubular reactor with vertically spaced segments |
| KR20170112161A (ko) * | 2016-03-31 | 2017-10-12 | 코오롱인더스트리 주식회사 | 폴리에스테르 필름 |
| CN112679715B (zh) * | 2020-12-23 | 2023-03-21 | 中国纺织科学研究院有限公司 | 一种功能聚酯生产系统、生产方法及功能聚酯纤维 |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB676372A (en) * | 1949-07-15 | 1952-07-23 | Owen Burchell Edgar | Improvements in or relating to copolyesters and their use for electrical insulation |
| NL195941A (enExample) * | 1951-08-20 | |||
| NL97591C (enExample) * | 1954-08-18 | |||
| DE956040C (de) * | 1955-03-05 | 1957-01-10 | Rottweiler Kunstseidefabrik Ag | Verfahren zur Herstellung von fuer die Polykondensation gut geeigneten Terephthalsaeureglykolestern |
| NL107408C (enExample) * | 1957-03-23 | |||
| US3070575A (en) * | 1958-01-27 | 1962-12-25 | Du Pont | Process for the preparation of polyesters from dicarboxylic acids and bis (hydroxy-alkyl) esters |
| DE1128657B (de) * | 1960-02-20 | 1962-04-26 | Glanzstoff Ag | Vorrichtung zur kontinuierlichen Polykondensation von Diolestern der Terephthalsaeure |
| BE632776A (enExample) * | 1962-05-23 | |||
| LU44479A1 (enExample) * | 1962-09-24 | 1963-11-21 | ||
| FR1368576A (fr) * | 1962-09-24 | 1964-07-31 | Onderzoekings Inst Res | Procédé pour préparer du polytéréphtalate d'éthylène |
-
1966
- 1966-07-15 US US565571A patent/US3442868A/en not_active Expired - Lifetime
- 1966-07-19 NL NL6610149A patent/NL6610149A/xx unknown
- 1966-07-20 DE DE19661645494 patent/DE1645494A1/de active Pending
- 1966-07-20 CH CH1047066A patent/CH509359A/de not_active IP Right Cessation
- 1966-07-20 GB GB32603/66A patent/GB1152726A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| US3442868A (en) | 1969-05-06 |
| GB1152726A (en) | 1969-05-21 |
| NL6610149A (enExample) | 1967-01-23 |
| DE1645494A1 (de) | 1970-09-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH509359A (de) | Verfahren zur Herstellung von faserbildendem Polyester | |
| DE69737259T2 (de) | Verfahren zur herstellung von copolyestern aus terephthalsaure, ethylenglycol und 1,4-cyclohexanedimethanol mit neutralen farbton, hoher klarheit und erhöhter helligkeit | |
| DE69905856T2 (de) | Verfahren zur Herstellung von Polytrimethylenterephthalat (PTT) | |
| DE69830415T2 (de) | Späte zugabe von zusätzlichem ethylenglykol bei der herstellung von copolyestern | |
| DE1495876B2 (de) | Verfahren zur Herstellung von niedermolekularen Polyestern | |
| EP0815158B1 (de) | Verfahren zur kontinuierlichen herstellung von thermoplastischen polyestern | |
| DE69333139T2 (de) | Verfahren zur Darstellung von Milchsäurepolyestern | |
| DE2003579A1 (de) | Verfahren zur Herstellung von Polyester-Diacrylaten | |
| DE1495955A1 (de) | Verfahren zur Harzherstellung | |
| DE4137842A1 (de) | Verfahren zur kontinuierlichen polykondensation von terephthalsaeure und 1,4-bis-(hydroxymethyl)-cyclohexan | |
| DE2214775A1 (de) | Verfahren zur herstellung von polybutylenterephthalaten | |
| DE2126863A1 (enExample) | ||
| EP1799746B1 (de) | Verfahren zur herstellung von polyestern | |
| DE4137841C2 (de) | Diskontinuierliches Verfahren zur Polykondensation von Terephthalsäure und 1,4-Bis-(hydroxymethyl)-cyclohexan | |
| DE1966884C3 (de) | Verfahren zur Herstellung von faserbildenden aromatischen Polyestern | |
| DE2245703A1 (de) | Verfahren zur herstellung von estern aromatischer dicarbonsaeuren | |
| DE2544069A1 (de) | Verfahren zur herstellung von polyestern | |
| DE2229843C3 (de) | Verfahren zur Herstellung von Polyestern | |
| DE1921247C3 (de) | Verfahren zur Herstellung von linearen Polyestern | |
| DE2260956C3 (de) | Verfahren zur kontinuierlichen Herstellung von Polyestern | |
| DE2504156A1 (de) | Niedermolekulare terephthalsaeure- aethylenglykolester, ihre herstellung und verwendung | |
| AT272654B (de) | Verfahren zur Herstellung von Polyalkylenterephthalaten | |
| AT225418B (de) | Verfahren zur Herstellung hochmolekularen Polyäthylenterephthalates | |
| DE1593080B2 (de) | Verfahren zur Veresterung von Terephthalsäure mit Alkylenglykol | |
| AT259751B (de) | Lineare Polyester oder Copolyester zur Herstellung von Fasern hoher Licht- und Thermostabilität |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |