CH509245A - Verfahren zur Herstellung von Acetalen der B-Halogenaldehyde - Google Patents
Verfahren zur Herstellung von Acetalen der B-HalogenaldehydeInfo
- Publication number
- CH509245A CH509245A CH1492066A CH1492066A CH509245A CH 509245 A CH509245 A CH 509245A CH 1492066 A CH1492066 A CH 1492066A CH 1492066 A CH1492066 A CH 1492066A CH 509245 A CH509245 A CH 509245A
- Authority
- CH
- Switzerland
- Prior art keywords
- alkyl
- methanol
- mol
- ether
- added
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 30
- 150000001241 acetals Chemical class 0.000 title claims description 13
- 238000004519 manufacturing process Methods 0.000 title description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 64
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 33
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 26
- 239000000292 calcium oxide Substances 0.000 claims description 22
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 claims description 22
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 claims description 21
- 125000000217 alkyl group Chemical group 0.000 claims description 13
- 239000000460 chlorine Substances 0.000 claims description 13
- 229910052801 chlorine Inorganic materials 0.000 claims description 13
- 239000002245 particle Substances 0.000 claims description 12
- CRZJPEIBPQWDGJ-UHFFFAOYSA-N 2-chloro-1,1-dimethoxyethane Chemical compound COC(CCl)OC CRZJPEIBPQWDGJ-UHFFFAOYSA-N 0.000 claims description 11
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 11
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 10
- 150000005840 aryl radicals Chemical class 0.000 claims description 10
- -1 hydrocarbon radical Chemical class 0.000 claims description 10
- 238000006243 chemical reaction Methods 0.000 claims description 9
- XJRBAMWJDBPFIM-UHFFFAOYSA-N methyl vinyl ether Chemical compound COC=C XJRBAMWJDBPFIM-UHFFFAOYSA-N 0.000 claims description 8
- 239000003795 chemical substances by application Substances 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 claims description 6
- 239000004215 Carbon black (E152) Substances 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- 150000002170 ethers Chemical class 0.000 claims description 6
- 229930195733 hydrocarbon Natural products 0.000 claims description 6
- WQYVRQLZKVEZGA-UHFFFAOYSA-N hypochlorite Chemical compound Cl[O-] WQYVRQLZKVEZGA-UHFFFAOYSA-N 0.000 claims description 6
- 150000003254 radicals Chemical class 0.000 claims description 6
- 230000035484 reaction time Effects 0.000 claims description 6
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 5
- 239000002360 explosive Substances 0.000 claims description 5
- 125000005843 halogen group Chemical group 0.000 claims description 5
- 239000000203 mixture Substances 0.000 claims description 5
- 239000001301 oxygen Substances 0.000 claims description 5
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- 239000000243 solution Substances 0.000 claims description 5
- 229910052717 sulfur Inorganic materials 0.000 claims description 5
- 239000011593 sulfur Substances 0.000 claims description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 4
- 239000012267 brine Substances 0.000 claims description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 4
- 229910052794 bromium Chemical group 0.000 claims description 4
- 238000001816 cooling Methods 0.000 claims description 4
- 230000001419 dependent effect Effects 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical class 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 claims description 4
- 238000004821 distillation Methods 0.000 claims description 3
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 2
- 239000003513 alkali Substances 0.000 claims description 2
- 150000005215 alkyl ethers Chemical class 0.000 claims description 2
- 238000005660 chlorination reaction Methods 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 238000003860 storage Methods 0.000 claims description 2
- 235000019441 ethanol Nutrition 0.000 description 11
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- 239000007858 starting material Substances 0.000 description 7
- 239000000047 product Substances 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 4
- QYKIQEUNHZKYBP-UHFFFAOYSA-N Vinyl ether Chemical compound C=COC=C QYKIQEUNHZKYBP-UHFFFAOYSA-N 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 238000004508 fractional distillation Methods 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- UCFFGYASXIPWPD-UHFFFAOYSA-N methyl hypochlorite Chemical compound COCl UCFFGYASXIPWPD-UHFFFAOYSA-N 0.000 description 2
- GLDOVTGHNKAZLK-UHFFFAOYSA-N octadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCCCO GLDOVTGHNKAZLK-UHFFFAOYSA-N 0.000 description 2
- 238000011084 recovery Methods 0.000 description 2
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- ACIAHEMYLLBZOI-ZZXKWVIFSA-N Unsaturated alcohol Chemical compound CC\C(CO)=C/C ACIAHEMYLLBZOI-ZZXKWVIFSA-N 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 239000002036 chloroform fraction Substances 0.000 description 1
- 125000000853 cresyl group Chemical group C1(=CC=C(C=C1)C)* 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 230000001066 destructive effect Effects 0.000 description 1
- MHDVGSVTJDSBDK-UHFFFAOYSA-N dibenzyl ether Chemical class C=1C=CC=CC=1COCC1=CC=CC=C1 MHDVGSVTJDSBDK-UHFFFAOYSA-N 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- LQZZUXJYWNFBMV-UHFFFAOYSA-N ethyl butylhexanol Natural products CCCCCCCCCCCCO LQZZUXJYWNFBMV-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000000555 isopropenyl group Chemical group [H]\C([H])=C(\*)C([H])([H])[H] 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C41/00—Preparation of ethers; Preparation of compounds having groups, groups or groups
- C07C41/48—Preparation of compounds having groups
- C07C41/50—Preparation of compounds having groups by reactions producing groups
- C07C41/54—Preparation of compounds having groups by reactions producing groups by addition of compounds to unsaturated carbon-to-carbon bonds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US507227A US3379772A (en) | 1965-11-10 | 1965-11-10 | Process for the production of dimethyl chloroacetal |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH509245A true CH509245A (de) | 1971-06-30 |
Family
ID=24017767
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1492066A CH509245A (de) | 1965-11-10 | 1966-10-17 | Verfahren zur Herstellung von Acetalen der B-Halogenaldehyde |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3379772A (cg-RX-API-DMAC10.html) |
| BE (1) | BE688591A (cg-RX-API-DMAC10.html) |
| CH (1) | CH509245A (cg-RX-API-DMAC10.html) |
| FR (1) | FR1498835A (cg-RX-API-DMAC10.html) |
| GB (1) | GB1158982A (cg-RX-API-DMAC10.html) |
| IL (1) | IL26717A (cg-RX-API-DMAC10.html) |
| NL (1) | NL6613778A (cg-RX-API-DMAC10.html) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3919328A (en) * | 1973-12-20 | 1975-11-11 | Lever Brothers Ltd | Process for the preparation of selectively halogenated ketones and ketals |
| DE2620498A1 (de) * | 1976-05-08 | 1977-11-24 | Basf Ag | Verfahren zur herstellung von beta-halogenacetalen oder beta-halogenketalen |
| DE3149652A1 (de) * | 1981-12-15 | 1983-06-23 | Wacker-Chemie GmbH, 8000 München | Verfahren zur herstellung von chloracetaldehyddimethylacetal |
| CN112010743A (zh) * | 2019-05-29 | 2020-12-01 | 石家庄欧特佳化工有限公司 | 一种由乙烯基醚制备氯乙醛缩二烷基醇的绿色方法 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2550637A (en) * | 1951-04-24 | O-haloaldehydes |
-
1965
- 1965-11-10 US US507227A patent/US3379772A/en not_active Expired - Lifetime
-
1966
- 1966-09-29 NL NL6613778A patent/NL6613778A/xx unknown
- 1966-10-03 GB GB44054/66A patent/GB1158982A/en not_active Expired
- 1966-10-17 CH CH1492066A patent/CH509245A/de not_active IP Right Cessation
- 1966-10-18 IL IL26717A patent/IL26717A/xx unknown
- 1966-10-20 BE BE688591D patent/BE688591A/xx unknown
- 1966-11-07 FR FR82752A patent/FR1498835A/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR1498835A (fr) | 1967-10-20 |
| US3379772A (en) | 1968-04-23 |
| IL26717A (en) | 1970-09-17 |
| NL6613778A (cg-RX-API-DMAC10.html) | 1967-05-11 |
| GB1158982A (en) | 1969-07-23 |
| BE688591A (cg-RX-API-DMAC10.html) | 1967-03-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2162859A1 (de) | Verfahren zur Herstellung von beta, beta-Bis-(3,5-dibrom-4-hydroxyphenyl> propan | |
| DE2718997A1 (de) | Verfahren zur herstellung von 4,4'- isopropylidenbis (2,6-dibrom)phenol | |
| DE3207746A1 (de) | Verfahren zur herstellung von trimethylolpropan | |
| DE68914956T2 (de) | Methode zur Herstellung von Dialkyl- und Diallyldicarbonaten. | |
| DE1919420A1 (de) | Verfahren zur Herstellung von 2-Mercaptobenzthiazol | |
| CH509245A (de) | Verfahren zur Herstellung von Acetalen der B-Halogenaldehyde | |
| DE947549C (de) | Verfahren zur Herstellung von organischen Chloriden | |
| DE3029368C2 (cg-RX-API-DMAC10.html) | ||
| DE903458C (de) | Verfahren zur Herstellung von Trialkylsilylcyclohexanolen | |
| CH562213A5 (cg-RX-API-DMAC10.html) | ||
| EP0045429B1 (de) | Verfahren zur Herstellung von 4-tert.-Butylbenzaldehyden | |
| EP0136549A1 (de) | Verfahren zur Herstellung von Alkylchloriden aus Alkohol-Ethergemischen, die bei der Celluloseveretherung entstehen | |
| DE2841913A1 (de) | Verfahren zur herstellung von 2,2,4- trimethyl-3-hydroxypentyl-isobutyrat | |
| DE857956C (de) | Verfahren zur Herstellung von fluorhaltigen Olefinen | |
| AT163637B (de) | Verfahren zur Herstellung von 2,4-Dichlorphenoxyverbindungen | |
| AT231433B (de) | Verfahren zur Herstellung von Alkylaralkylphthalaten | |
| DE934824C (de) | Verfahren zur Herstellung von Alkoxyvinylmethylketonen | |
| DE1198357B (de) | Verfahren zur Herstellung des Oxims des 16-Dehydropregnenolonacetats | |
| DE1263781B (de) | Verfahren zur Herstellung von 2-Methoxy-3, 6-dichlorbenzoesaeure | |
| DE1643890C (de) | alpha- Hy droxy-gamma-methy lmercaptobuttersäure-methylsulfonium-halogenide und Verfahren zu ihrer Herstellung | |
| DE1003204B (de) | Verfahren zur Herstellung von Trichloressigsaeure | |
| DE1593389C3 (de) | Verfahren zur Herstellung von 4,5,6,7,8,8-Heptachlor-4,7-methano-3a, 4,7,7a-tetrahydroindan | |
| DE1212056B (de) | Verfahren zur Herstellung von Glycerin durch Hydroxylierung von Allylalkohol mit Wasserstoffperoxyd | |
| DE1544581A1 (de) | Verfahren zur Herstellung von Azo-Farbstoffen | |
| DE3228868A1 (de) | Verfahren zur herstellung von o,s-dimethylthiolophosphorsaeureamid |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |