CH495377A - Verfahren zur Herstellung von Penicillinen - Google Patents
Verfahren zur Herstellung von PenicillinenInfo
- Publication number
- CH495377A CH495377A CH676267A CH676267A CH495377A CH 495377 A CH495377 A CH 495377A CH 676267 A CH676267 A CH 676267A CH 676267 A CH676267 A CH 676267A CH 495377 A CH495377 A CH 495377A
- Authority
- CH
- Switzerland
- Prior art keywords
- thienyl
- furyl
- acid
- ether
- solution
- Prior art date
Links
- 229930182555 Penicillin Natural products 0.000 title claims abstract description 21
- 239000003242 anti bacterial agent Substances 0.000 title abstract description 3
- 229940049954 penicillin Drugs 0.000 title description 11
- -1 methyl penicillin Chemical compound 0.000 title description 8
- 125000002541 furyl group Chemical group 0.000 title 2
- 229940088710 antibiotic agent Drugs 0.000 title 1
- 125000001544 thienyl group Chemical group 0.000 title 1
- 150000002960 penicillins Chemical class 0.000 claims abstract description 10
- 238000000034 method Methods 0.000 claims description 9
- 239000002253 acid Substances 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 7
- 150000008064 anhydrides Chemical class 0.000 claims description 4
- 238000009903 catalytic hydrogenation reaction Methods 0.000 claims description 2
- 230000007071 enzymatic hydrolysis Effects 0.000 claims description 2
- 238000006047 enzymatic hydrolysis reaction Methods 0.000 claims description 2
- 150000004820 halides Chemical class 0.000 claims description 2
- 150000003839 salts Chemical class 0.000 abstract description 12
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 abstract description 6
- 231100000252 nontoxic Toxicity 0.000 abstract description 6
- 230000003000 nontoxic effect Effects 0.000 abstract description 6
- 125000003710 aryl alkyl group Chemical group 0.000 abstract description 5
- 125000000217 alkyl group Chemical group 0.000 abstract description 4
- 241000894006 Bacteria Species 0.000 abstract description 3
- 241001465754 Metazoa Species 0.000 abstract description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 abstract description 2
- 241000283690 Bos taurus Species 0.000 abstract description 2
- 208000035473 Communicable disease Diseases 0.000 abstract description 2
- 150000003863 ammonium salts Chemical class 0.000 abstract description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 abstract description 2
- 239000003814 drug Substances 0.000 abstract description 2
- 208000004396 mastitis Diseases 0.000 abstract description 2
- 229910052751 metal Inorganic materials 0.000 abstract description 2
- 239000002184 metal Substances 0.000 abstract description 2
- 244000144977 poultry Species 0.000 abstract description 2
- 229940124597 therapeutic agent Drugs 0.000 abstract description 2
- 239000003674 animal food additive Substances 0.000 abstract 1
- 239000003795 chemical substances by application Substances 0.000 abstract 1
- 239000000543 intermediate Substances 0.000 abstract 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 44
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 30
- 239000000243 solution Substances 0.000 description 29
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 18
- UIIMBOGNXHQVGW-UHFFFAOYSA-M sodium bicarbonate Substances [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 17
- 239000000203 mixture Substances 0.000 description 14
- 239000000126 substance Substances 0.000 description 13
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- 239000007787 solid Substances 0.000 description 12
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 12
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- 239000000284 extract Substances 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 9
- NGHVIOIJCVXTGV-ALEPSDHESA-N 6-aminopenicillanic acid Chemical compound [O-]C(=O)[C@H]1C(C)(C)S[C@@H]2[C@H]([NH3+])C(=O)N21 NGHVIOIJCVXTGV-ALEPSDHESA-N 0.000 description 8
- NGHVIOIJCVXTGV-UHFFFAOYSA-N 6beta-amino-penicillanic acid Natural products OC(=O)C1C(C)(C)SC2C(N)C(=O)N21 NGHVIOIJCVXTGV-UHFFFAOYSA-N 0.000 description 8
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- 239000010410 layer Substances 0.000 description 7
- 235000017557 sodium bicarbonate Nutrition 0.000 description 7
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 6
- 239000011734 sodium Substances 0.000 description 6
- 229910052708 sodium Inorganic materials 0.000 description 6
- 159000000000 sodium salts Chemical class 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 5
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- DLYUQMMRRRQYAE-UHFFFAOYSA-N tetraphosphorus decaoxide Chemical compound O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 5
- GCOOGCQWQFRJEK-UHFFFAOYSA-N 2-thiophen-3-ylpropanedioic acid Chemical compound OC(=O)C(C(O)=O)C=1C=CSC=1 GCOOGCQWQFRJEK-UHFFFAOYSA-N 0.000 description 4
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- 239000006286 aqueous extract Substances 0.000 description 4
- 239000003921 oil Substances 0.000 description 4
- 238000004816 paper chromatography Methods 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- GSFNQBFZFXUTBN-UHFFFAOYSA-N 2-chlorothiophene Chemical compound ClC1=CC=CS1 GSFNQBFZFXUTBN-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 238000004458 analytical method Methods 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 235000019441 ethanol Nutrition 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 230000020477 pH reduction Effects 0.000 description 3
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 3
- 229910052717 sulfur Inorganic materials 0.000 description 3
- DGUKDSJUXHAACC-UHFFFAOYSA-N 1-O-benzyl 3-O-thiophen-2-yl propanedioate Chemical compound C(CC(=O)OC=1SC=CC1)(=O)OCC1=CC=CC=C1 DGUKDSJUXHAACC-UHFFFAOYSA-N 0.000 description 2
- XDOMMHKHICBYDF-UHFFFAOYSA-N 3-ethoxy-3-oxo-2-thiophen-3-ylpropanoic acid Chemical compound CCOC(=O)C(C1=CSC=C1)C(=O)O XDOMMHKHICBYDF-UHFFFAOYSA-N 0.000 description 2
- BCYTTWDACSKYHU-UHFFFAOYSA-N 3-oxo-3-phenylmethoxy-2-thiophen-3-ylpropanoic acid Chemical compound C1=CSC=C1C(C(=O)O)C(=O)OCC1=CC=CC=C1 BCYTTWDACSKYHU-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 241000588772 Morganella morganii Species 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- 241000589517 Pseudomonas aeruginosa Species 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 230000001580 bacterial effect Effects 0.000 description 2
- 235000019445 benzyl alcohol Nutrition 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000002329 infrared spectrum Methods 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 239000013067 intermediate product Substances 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 2
- 229910052760 oxygen Chemical group 0.000 description 2
- 239000001301 oxygen Chemical group 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 238000005303 weighing Methods 0.000 description 2
- JQIYZCAQCVWAQF-UHFFFAOYSA-N 2-(furan-2-yl)propanedioic acid Chemical compound OC(=O)C(C(O)=O)C1=CC=CO1 JQIYZCAQCVWAQF-UHFFFAOYSA-N 0.000 description 1
- WZFUQSJFWNHZHM-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)CC(=O)N1CC2=C(CC1)NN=N2 WZFUQSJFWNHZHM-UHFFFAOYSA-N 0.000 description 1
- ZFVNKBNOAUAGNX-UHFFFAOYSA-N 2-benzyl-2-thiophen-3-ylpropanedioyl dichloride Chemical compound C1=CSC=C1C(C(=O)Cl)(C(Cl)=O)CC1=CC=CC=C1 ZFVNKBNOAUAGNX-UHFFFAOYSA-N 0.000 description 1
- OIJPSMYQMUNKSB-UHFFFAOYSA-N 2-thiophen-2-ylpropanedioic acid Chemical compound OC(=O)C(C(O)=O)C1=CC=CS1 OIJPSMYQMUNKSB-UHFFFAOYSA-N 0.000 description 1
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical class [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 description 1
- MWQDSHMLLUCUIY-UHFFFAOYSA-N 3-O-(furan-2-yl) 1-O-methyl propanedioate Chemical compound C(CC(=O)OC=1OC=CC1)(=O)OC MWQDSHMLLUCUIY-UHFFFAOYSA-N 0.000 description 1
- UADXQXBOLYWJCL-UHFFFAOYSA-N 3-[(4-nitrophenyl)methoxy]-3-oxo-2-thiophen-3-ylpropanoic acid Chemical compound C1=CSC=C1C(C(=O)O)C(=O)OCC1=CC=C([N+]([O-])=O)C=C1 UADXQXBOLYWJCL-UHFFFAOYSA-N 0.000 description 1
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- JKTYGPATCNUWKN-UHFFFAOYSA-N 4-nitrobenzyl alcohol Chemical compound OCC1=CC=C([N+]([O-])=O)C=C1 JKTYGPATCNUWKN-UHFFFAOYSA-N 0.000 description 1
- RFYPCIAIEWNLBG-UHFFFAOYSA-N 8-(1-carboxyethylsulfanyl)naphthalene-1-carboxylic acid Chemical compound C1=CC(C(O)=O)=C2C(SC(C)C(O)=O)=CC=CC2=C1 RFYPCIAIEWNLBG-UHFFFAOYSA-N 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- 241000228257 Aspergillus sp. Species 0.000 description 1
- 235000014469 Bacillus subtilis Nutrition 0.000 description 1
- MYHSSWRCPPWXRQ-UHFFFAOYSA-N C(CC(=O)OC1=CSC=C1)(=O)OCC Chemical compound C(CC(=O)OC1=CSC=C1)(=O)OCC MYHSSWRCPPWXRQ-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- BWLUMTFWVZZZND-UHFFFAOYSA-N Dibenzylamine Chemical compound C=1C=CC=CC=1CNCC1=CC=CC=C1 BWLUMTFWVZZZND-UHFFFAOYSA-N 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 241000588724 Escherichia coli Species 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- ZRKWMRDKSOPRRS-UHFFFAOYSA-N N-Methyl-N-nitrosourea Chemical compound O=NN(C)C(N)=O ZRKWMRDKSOPRRS-UHFFFAOYSA-N 0.000 description 1
- 108010019160 Pancreatin Proteins 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 241000589516 Pseudomonas Species 0.000 description 1
- 241000293871 Salmonella enterica subsp. enterica serovar Typhi Species 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- JVVXZOOGOGPDRZ-SLFFLAALSA-N [(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methanamine Chemical compound NC[C@]1(C)CCC[C@]2(C)C3=CC=C(C(C)C)C=C3CC[C@H]21 JVVXZOOGOGPDRZ-SLFFLAALSA-N 0.000 description 1
- 206010000269 abscess Diseases 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 108010027597 alpha-chymotrypsin Proteins 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- JUHORIMYRDESRB-UHFFFAOYSA-N benzathine Chemical compound C=1C=CC=CC=1CNCCNCC1=CC=CC=C1 JUHORIMYRDESRB-UHFFFAOYSA-N 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000004737 colorimetric analysis Methods 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- AURROROYQPIDRG-UHFFFAOYSA-N diethyl 2-thiophen-3-ylpropanedioate Chemical compound CCOC(=O)C(C(=O)OCC)C=1C=CSC=1 AURROROYQPIDRG-UHFFFAOYSA-N 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 229940088598 enzyme Drugs 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000000295 fuel oil Substances 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000004570 mortar (masonry) Substances 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 229940055695 pancreatin Drugs 0.000 description 1
- 235000019371 penicillin G benzathine Nutrition 0.000 description 1
- 229940056360 penicillin g Drugs 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 1
- 229960004919 procaine Drugs 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB21274/66A GB1125557A (en) | 1966-05-13 | 1966-05-13 | Penicillins |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH495377A true CH495377A (de) | 1970-08-31 |
Family
ID=10160137
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH676267A CH495377A (de) | 1966-05-13 | 1967-05-12 | Verfahren zur Herstellung von Penicillinen |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3502656A (2) |
| BE (1) | BE698356A (2) |
| CH (1) | CH495377A (2) |
| DE (2) | DE1795861C2 (2) |
| DK (1) | DK132084C (2) |
| FR (1) | FR1522736A (2) |
| GB (1) | GB1125557A (2) |
| NL (1) | NL154116B (2) |
| SE (1) | SE364050B (2) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3574189A (en) * | 1968-01-05 | 1971-04-06 | Pfizer | Synthetic penicillins |
| GB1321815A (en) * | 1969-07-03 | 1973-07-04 | Beecham Group Ltd | Penicillins |
| US3679801A (en) * | 1970-05-19 | 1972-07-25 | Pfizer | Aryl esters of {60 -carboxyarylmethyl-penicillins |
| USRE29003E (en) * | 1971-01-20 | 1976-10-12 | Hoffmann-La Roche Inc. | (R)-1-(2-furoyloxy)-3-methylbutyl-penicillin |
| CH580631A5 (2) * | 1971-01-20 | 1976-10-15 | Hoffmann La Roche | |
| JPS5481262A (en) * | 1977-12-06 | 1979-06-28 | Oce Andeno Bv | Manufacture of 33thienylmaloic acid or its diester |
| CN100402520C (zh) * | 2006-07-28 | 2008-07-16 | 马启明 | 2-取代丙二酸钙盐的制备方法及钙盐的用途 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1004670A (en) * | 1963-04-23 | 1965-09-15 | Beecham Res Lab | Penicillins |
-
1966
- 1966-05-13 GB GB21274/66A patent/GB1125557A/en not_active Expired
-
1967
- 1967-05-08 US US636621A patent/US3502656A/en not_active Expired - Lifetime
- 1967-05-09 SE SE06499/67A patent/SE364050B/xx unknown
- 1967-05-09 NL NL67@@7606502A patent/NL154116B/xx not_active IP Right Cessation
- 1967-05-11 FR FR106020A patent/FR1522736A/fr not_active Expired
- 1967-05-11 BE BE698356D patent/BE698356A/xx not_active IP Right Cessation
- 1967-05-12 CH CH676267A patent/CH495377A/de not_active IP Right Cessation
- 1967-05-12 DK DK252467A patent/DK132084C/da active
- 1967-05-12 DE DE1795861A patent/DE1795861C2/de not_active Expired
- 1967-05-12 DE DE1670222A patent/DE1670222C3/de not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GB1125557A (en) | 1968-08-28 |
| DK132084C (da) | 1976-03-08 |
| US3502656A (en) | 1970-03-24 |
| DE1670222B2 (de) | 1978-08-10 |
| DE1670222A1 (de) | 1971-01-21 |
| NL6706502A (2) | 1967-11-14 |
| DK132084B (da) | 1975-10-20 |
| FR1522736A (fr) | 1968-04-26 |
| DE1795861C2 (de) | 1979-10-31 |
| NL154116B (nl) | 1977-08-15 |
| DE1795861B1 (de) | 1979-03-08 |
| BE698356A (2) | 1967-11-13 |
| SE364050B (2) | 1974-02-11 |
| DE1670222C3 (de) | 1979-04-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2228012B2 (de) | -Aminophenylacetamido] -penicülansäure und Verfahren zu seiner Herstellung | |
| CH495377A (de) | Verfahren zur Herstellung von Penicillinen | |
| DE1929997C2 (de) | Acylureidopenicilline, Verfahren zu ihrer Herstellung und antibakterielle Mittel, die diese Verbindungen enthalten | |
| DE2033090C3 (de) | deren Herstellung | |
| CH394206A (de) | Verfahren zur Herstellung von Abkömmlingen der 6-Amino-penicillansäure | |
| CH625805A5 (2) | ||
| DE1289053B (de) | ª‡-Hydroxy-2-thienylmethyl-penicilline und Verfahren zur ihrer Herstellung | |
| AT259132B (de) | Verfahren zur Herstellung von neuen Penicillinderivaten | |
| DE2251290C3 (de) | α-Sulfo-p-aminobenzylpenicillin | |
| DE2206849C2 (de) | Verfahren zur Aufspaltung von 2-(2β-Benzyloxymethyl-3α-hydroxy-4-cyclopenten-1α-yl)- essigsäure | |
| DE2021073A1 (de) | alpha-Amino-2,4,6-cycloheptatrienyl-methylcephalosporine und Verfahren zu ihrer Herstellung | |
| DE2054772A1 (de) | Ureidocyclohexadienylalkylenpenicilhne, ihre Salze, Verfahren zu ihrer Herstellung und ihre Verwendung zur Herstellung von Arzneimitteln und als Desinfektionsmittel | |
| EP0032540B1 (de) | 2-Methyl-3-(2,4,6-trijod-3-(1-morpholinoäthylidenamino)-benzamido)-propionitril, Verfahren zu dessen Herstellung und dessen Verwendung als Zwischenprodukt | |
| AT226366B (de) | Verfahren zur Herstellung von neuen Penicillinderivaten | |
| DE2215721A1 (de) | Neue Penicilline und Verfahren zu ihrer Herstellung | |
| AT232196B (de) | Verfahren zur Herstellung von Penicillinen | |
| CH624410A5 (2) | ||
| DE2302671A1 (de) | 5-acylpyrrole, verfahren zu ihrer herstellung und ihre verwendung in arzneimitteln | |
| DE830792C (de) | Verfahren zur Herstellung von Acylaminoacetessigestern | |
| CH393329A (de) | Verfahren zur Herstellung von Penicillinen bzw. nichttoxischen Salzen derselben | |
| CH417597A (de) | Verfahren zur Herstellung von Penicillinen | |
| CH505853A (de) | Verfahren zur Herstellung von Penicillinen | |
| DE1645927A1 (de) | Verfahren zur Herstellung von Penicillinen | |
| DE1670008A1 (de) | Penicilline und Verfahren zu ihrer Herstellung | |
| CH499548A (de) | Verfahren zur Herstellung von Penicillinen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |