CH417215A - Schädlingsbekämpfungsmittel - Google Patents
SchädlingsbekämpfungsmittelInfo
- Publication number
- CH417215A CH417215A CH84662A CH84662A CH417215A CH 417215 A CH417215 A CH 417215A CH 84662 A CH84662 A CH 84662A CH 84662 A CH84662 A CH 84662A CH 417215 A CH417215 A CH 417215A
- Authority
- CH
- Switzerland
- Prior art keywords
- animals
- farnesyl
- compounds
- acid
- ether
- Prior art date
Links
- 239000000575 pesticide Substances 0.000 title claims description 4
- 150000001875 compounds Chemical class 0.000 claims description 12
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 4
- 230000029052 metamorphosis Effects 0.000 claims description 4
- 241000238421 Arthropoda Species 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 claims description 2
- 150000001241 acetals Chemical class 0.000 claims description 2
- 150000008065 acid anhydrides Chemical class 0.000 claims description 2
- 150000001408 amides Chemical class 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 2
- 150000002148 esters Chemical class 0.000 claims description 2
- 150000002373 hemiacetals Chemical class 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 241001465754 Metazoa Species 0.000 description 13
- -1 isoprenoid compounds Chemical class 0.000 description 8
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 5
- 230000018109 developmental process Effects 0.000 description 5
- CRDAMVZIKSXKFV-FBXUGWQNSA-N (2-cis,6-cis)-farnesol Chemical compound CC(C)=CCC\C(C)=C/CC\C(C)=C/CO CRDAMVZIKSXKFV-FBXUGWQNSA-N 0.000 description 3
- 239000000260 (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-ol Substances 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 241000238631 Hexapoda Species 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 229940043259 farnesol Drugs 0.000 description 3
- 229930002886 farnesol Natural products 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- CRDAMVZIKSXKFV-UHFFFAOYSA-N trans-Farnesol Natural products CC(C)=CCCC(C)=CCCC(C)=CCO CRDAMVZIKSXKFV-UHFFFAOYSA-N 0.000 description 3
- YHRUHBBTQZKMEX-YFVJMOTDSA-N (2-trans,6-trans)-farnesal Chemical compound CC(C)=CCC\C(C)=C\CC\C(C)=C\C=O YHRUHBBTQZKMEX-YFVJMOTDSA-N 0.000 description 2
- YHRUHBBTQZKMEX-UHFFFAOYSA-N (2E,6E)-3,7,11-trimethyl-2,6,10-dodecatrien-1-al Natural products CC(C)=CCCC(C)=CCCC(C)=CC=O YHRUHBBTQZKMEX-UHFFFAOYSA-N 0.000 description 2
- CJWPDADGDASKGI-YFVJMOTDSA-N (2e,6e)-3,7,11-trimethyldodeca-2,6,10-triene-1-thiol Chemical compound CC(C)=CCC\C(C)=C\CC\C(C)=C\CS CJWPDADGDASKGI-YFVJMOTDSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- 241000238557 Decapoda Species 0.000 description 2
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 2
- YHRUHBBTQZKMEX-FBXUGWQNSA-N E,E-Farnesal Natural products CC(C)=CCC\C(C)=C/CC\C(C)=C/C=O YHRUHBBTQZKMEX-FBXUGWQNSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 241000254109 Tenebrio molitor Species 0.000 description 2
- 241000607479 Yersinia pestis Species 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 230000001476 alcoholic effect Effects 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 150000001649 bromium compounds Chemical class 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 230000003111 delayed effect Effects 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- 231100000614 poison Toxicity 0.000 description 2
- MLNZDKSOEQLQOL-UHFFFAOYSA-N (2E,6E)-10,11-dihydrofarnesol Natural products CC(C)CCCC(C)=CCCC(C)=CCO MLNZDKSOEQLQOL-UHFFFAOYSA-N 0.000 description 1
- ALEWCKXBHSDCCT-YFVJMOTDSA-N (2E,6E)-farnesyl monophosphate Chemical compound CC(C)=CCC\C(C)=C\CC\C(C)=C\COP(O)(O)=O ALEWCKXBHSDCCT-YFVJMOTDSA-N 0.000 description 1
- HZDZRGKULMGCJE-NCZFFCEISA-N (2e,6e)-1-methoxy-3,7,11-trimethyldodeca-2,6,10-triene Chemical group COC\C=C(/C)CC\C=C(/C)CCC=C(C)C HZDZRGKULMGCJE-NCZFFCEISA-N 0.000 description 1
- MLNZDKSOEQLQOL-YFVJMOTDSA-N (2e,6e)-3,7,11-trimethyldodeca-2,6-dien-1-ol Chemical compound CC(C)CCC\C(C)=C\CC\C(C)=C\CO MLNZDKSOEQLQOL-YFVJMOTDSA-N 0.000 description 1
- SHOKIRAUFQBXSP-UHFFFAOYSA-N 1-ethoxy-3,7,11-trimethyldodeca-2,6,10-triene Chemical compound CCOCC=C(C)CCC=C(C)CCC=C(C)C SHOKIRAUFQBXSP-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- ZGIGZINMAOQWLX-NCZFFCEISA-N 3,7,11-Trimethyl-2,6,10-dodecatrienyl acetate Chemical compound CC(C)=CCC\C(C)=C\CC\C(C)=C\COC(C)=O ZGIGZINMAOQWLX-NCZFFCEISA-N 0.000 description 1
- BDKQVCHNTAJNJR-UHFFFAOYSA-N 3,7,11-trimethyldodeca-2,6,10-trien-1-amine Chemical compound CC(C)=CCCC(C)=CCCC(C)=CCN BDKQVCHNTAJNJR-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 241000255789 Bombyx mori Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- 241000257163 Calliphora vicina Species 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- ZGIGZINMAOQWLX-UHFFFAOYSA-N Farnesyl acetate Natural products CC(C)=CCCC(C)=CCCC(C)=CCOC(C)=O ZGIGZINMAOQWLX-UHFFFAOYSA-N 0.000 description 1
- 241000255896 Galleria mellonella Species 0.000 description 1
- 241000382353 Pupa Species 0.000 description 1
- 241000251539 Vertebrata <Metazoa> Species 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000027326 copulation Effects 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- HRKQOINLCJTGBK-UHFFFAOYSA-N dihydroxidosulfur Chemical compound OSO HRKQOINLCJTGBK-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 229940007703 farnesyl acetate Drugs 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- HNZUNIKWNYHEJJ-FMIVXFBMSA-N geranyl acetone Chemical class CC(C)=CCC\C(C)=C\CCC(C)=O HNZUNIKWNYHEJJ-FMIVXFBMSA-N 0.000 description 1
- HNZUNIKWNYHEJJ-UHFFFAOYSA-N geranyl acetone Natural products CC(C)=CCCC(C)=CCCC(C)=O HNZUNIKWNYHEJJ-UHFFFAOYSA-N 0.000 description 1
- 235000020993 ground meat Nutrition 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 230000012447 hatching Effects 0.000 description 1
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 230000001418 larval effect Effects 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- BAVYZALUXZFZLV-UHFFFAOYSA-N mono-methylamine Natural products NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 231100000956 nontoxicity Toxicity 0.000 description 1
- 239000002574 poison Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 230000019617 pupation Effects 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 230000001850 reproductive effect Effects 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 235000015099 wheat brans Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C33/00—Unsaturated compounds having hydroxy or O-metal groups bound to acyclic carbon atoms
- C07C33/02—Acyclic alcohols with carbon-to-carbon double bonds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C57/00—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms
- C07C57/02—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms with only carbon-to-carbon double bonds as unsaturation
- C07C57/03—Monocarboxylic acids
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DESCH29159A DE1140394B (de) | 1961-02-02 | 1961-02-02 | Schaedlingsbekaempfungsmittel |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH417215A true CH417215A (de) | 1966-07-15 |
Family
ID=7431339
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH84662A CH417215A (de) | 1961-02-02 | 1962-01-24 | Schädlingsbekämpfungsmittel |
Country Status (6)
| Country | Link |
|---|---|
| BE (1) | BE613361A (enFirst) |
| BR (1) | BR6236106D0 (enFirst) |
| CH (1) | CH417215A (enFirst) |
| DE (1) | DE1140394B (enFirst) |
| GB (1) | GB989554A (enFirst) |
| NL (1) | NL274168A (enFirst) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3453362A (en) * | 1966-05-10 | 1969-07-01 | Fmc Corp | Insect control methods and compositions |
| ZA712023B (en) * | 1970-03-31 | 1971-12-29 | Hoffmann La Roche | Pest control agent |
| JPS5126354B1 (enFirst) * | 1971-03-31 | 1976-08-05 | ||
| JPS52144614A (en) * | 1976-05-27 | 1977-12-02 | Eisai Co Ltd | Polyprenyl carboxylic acid compounds and hypo-tensor containing same |
| US4147800A (en) * | 1977-01-17 | 1979-04-03 | Block Drug Company, Inc. | Pediculicidal toxicants |
| DE3120805A1 (de) * | 1981-05-25 | 1982-12-16 | Basf Ag, 6700 Ludwigshafen | Mittel und verfahren zur bekaempfung von blaualgen |
| GB8603621D0 (en) * | 1986-02-14 | 1986-03-19 | Habib N | Modifying lipid structure of cell membranes |
| WO2007003346A2 (en) * | 2005-07-06 | 2007-01-11 | MAX-PLANCK-Gesellschaft zur Förderung der Wissenschaften e.V. | Fungicidal agents |
| EP4341381A4 (en) * | 2021-05-17 | 2025-06-25 | P2 Science, Inc. | Terpenol ethers |
-
0
- BE BE613361D patent/BE613361A/xx unknown
- NL NL274168D patent/NL274168A/xx unknown
-
1961
- 1961-02-02 DE DESCH29159A patent/DE1140394B/de active Pending
-
1962
- 1962-01-24 CH CH84662A patent/CH417215A/de unknown
- 1962-01-31 GB GB363762A patent/GB989554A/en not_active Expired
- 1962-01-31 BR BR13610662A patent/BR6236106D0/pt unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE1140394B (de) | 1962-11-29 |
| NL274168A (enFirst) | |
| BE613361A (enFirst) | |
| GB989554A (en) | 1965-04-22 |
| BR6236106D0 (pt) | 1973-05-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2449546A1 (de) | Insektizide mittel | |
| CH417215A (de) | Schädlingsbekämpfungsmittel | |
| DE3717467A1 (de) | Biologisches insektizidspray | |
| DE2530070A1 (de) | Insekten-abwehrmittel | |
| EP0090288A1 (de) | Insektenvertreibungsmittel | |
| AT326949B (de) | Insektizide mischung | |
| DE2019504C3 (de) | Oxim-N-acylcarbamate, Verfahren zu ihrer Herstellung und ihre Verwendung zur Schädlingsbekämpfung | |
| DE2714671C2 (de) | Mandelsäure-N-dialkylamide sowie diese als Wirkstoff enthaltendes insektenabweisendes Mittel | |
| DE1966957B2 (de) | Epoxide von geranylhalogeniden sowie verfahren zu deren herstellung | |
| AT236700B (de) | Schädlingsbekämpfungsmittel | |
| DE3420230A1 (de) | Steroid, dessen gewinnung und verwendung als pharmazeutikum | |
| DE948653C (de) | Schaedlingsbekaempfungsmittel | |
| EP0097812A1 (de) | Insektenvertreibungsmittel | |
| DE1695763B2 (de) | Cyclopropancarbonsäureester | |
| EP0053756B1 (de) | 2,6-Diethyl-3,5-dimethyl-2,3-dihydro-4H-pyran, Verfahren zu seiner Herstellung und seine Verwendung zur Früherkennung, Lokalisierung und Bekämpfung von Lasioderma serricorne F | |
| EP0090287B1 (de) | Insektenvertreibungsmittel | |
| DE1901917A1 (de) | 2,2,3,3-Tetramethylcyclopropan-1-carbonsaeure-5-alkinylfurylmethylester,Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE69007209T2 (de) | Pestizide Verwendungen des Bialaphos. | |
| DE2512940C2 (de) | N-Benzoyl-N-halogenphenyl-2-aminopropionsäure-ester, Verfahren zu deren Herstellung und deren Verwendung | |
| DE672110C (de) | Insektenbekaempfung | |
| DE495049C (de) | Insektenvertilgungsmittel | |
| DE2166232C3 (de) | Phenyläthyläther, Verfahren zu ihrer Herstellung und ihre Verwendung als Synergisten für Insektizide und in Insektiziden Mitteln | |
| DD212640A5 (de) | Lockstoffpraeparat zum selektiven anlocken von maennlichen gammaeulen | |
| DE1054777B (de) | Akarizide Mittel | |
| AT261987B (de) | Saatgutbehandlungsmittel |