CH410002A - Verfahren zur cis-/trans-Isomerisierung von tricyclischen Verbindungen - Google Patents
Verfahren zur cis-/trans-Isomerisierung von tricyclischen VerbindungenInfo
- Publication number
- CH410002A CH410002A CH7973059A CH7973059A CH410002A CH 410002 A CH410002 A CH 410002A CH 7973059 A CH7973059 A CH 7973059A CH 7973059 A CH7973059 A CH 7973059A CH 410002 A CH410002 A CH 410002A
- Authority
- CH
- Switzerland
- Prior art keywords
- isomer
- cis
- excess
- isomerization
- melt treatment
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 12
- 150000001875 compounds Chemical class 0.000 title claims description 10
- 238000006317 isomerization reaction Methods 0.000 title claims description 10
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 claims description 23
- 239000000203 mixture Substances 0.000 claims description 14
- 239000002253 acid Substances 0.000 claims description 7
- -1 amino, hydroxyl Chemical group 0.000 claims description 7
- 125000003118 aryl group Chemical group 0.000 claims description 6
- 235000006408 oxalic acid Nutrition 0.000 claims description 5
- 150000003839 salts Chemical class 0.000 claims description 5
- 239000000155 melt Substances 0.000 claims description 4
- 125000001302 tertiary amino group Chemical group 0.000 claims description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 3
- 125000002252 acyl group Chemical group 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 125000004414 alkyl thio group Chemical group 0.000 claims description 3
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 3
- 125000004659 aryl alkyl thio group Chemical group 0.000 claims description 3
- 125000005110 aryl thio group Chemical group 0.000 claims description 3
- 125000004104 aryloxy group Chemical group 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- 239000012429 reaction media Substances 0.000 claims description 3
- 229910052717 sulfur Chemical group 0.000 claims description 3
- 239000011593 sulfur Chemical group 0.000 claims description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 3
- 230000001419 dependent effect Effects 0.000 claims 1
- 230000036571 hydration Effects 0.000 claims 1
- 238000006703 hydration reaction Methods 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 13
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 4
- KJFMBFZCATUALV-UHFFFAOYSA-N phenolphthalein Chemical compound C1=CC(O)=CC=C1C1(C=2C=CC(O)=CC=2)C2=CC=CC=C2C(=O)O1 KJFMBFZCATUALV-UHFFFAOYSA-N 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 239000012452 mother liquor Substances 0.000 description 3
- 150000003891 oxalate salts Chemical class 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- DYLIWHYUXAJDOJ-OWOJBTEDSA-N (e)-4-(6-aminopurin-9-yl)but-2-en-1-ol Chemical compound NC1=NC=NC2=C1N=CN2C\C=C\CO DYLIWHYUXAJDOJ-OWOJBTEDSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 230000018044 dehydration Effects 0.000 description 2
- 238000006297 dehydration reaction Methods 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 230000008030 elimination Effects 0.000 description 2
- 238000003379 elimination reaction Methods 0.000 description 2
- 238000001640 fractional crystallisation Methods 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 150000005075 thioxanthenes Chemical class 0.000 description 2
- 150000003732 xanthenes Chemical class 0.000 description 2
- PQJUJGAVDBINPI-UHFFFAOYSA-N 9H-thioxanthene Chemical compound C1=CC=C2CC3=CC=CC=C3SC2=C1 PQJUJGAVDBINPI-UHFFFAOYSA-N 0.000 description 1
- GJCOSYZMQJWQCA-UHFFFAOYSA-N 9H-xanthene Chemical compound C1=CC=C2CC3=CC=CC=C3OC2=C1 GJCOSYZMQJWQCA-UHFFFAOYSA-N 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- WSPOMRSOLSGNFJ-UHFFFAOYSA-N chlorprothixene Chemical compound C1=C(Cl)C=C2C(=CCCN(C)C)C3=CC=CC=C3SC2=C1 WSPOMRSOLSGNFJ-UHFFFAOYSA-N 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- 150000002440 hydroxy compounds Chemical class 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000009776 industrial production Methods 0.000 description 1
- QDLAGTHXVHQKRE-UHFFFAOYSA-N lichenxanthone Natural products COC1=CC(O)=C2C(=O)C3=C(C)C=C(OC)C=C3OC2=C1 QDLAGTHXVHQKRE-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 125000005936 piperidyl group Chemical group 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D337/00—Heterocyclic compounds containing rings of more than six members having one sulfur atom as the only ring hetero atom
- C07D337/02—Seven-membered rings
- C07D337/06—Seven-membered rings condensed with carbocyclic rings or ring systems
- C07D337/10—Seven-membered rings condensed with carbocyclic rings or ring systems condensed with two six-membered rings
- C07D337/12—[b,e]-condensed
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/78—Ring systems having three or more relevant rings
- C07D311/80—Dibenzopyrans; Hydrogenated dibenzopyrans
- C07D311/82—Xanthenes
- C07D311/90—Xanthenes with hydrocarbon radicals, substituted by amino radicals, directly attached in position 9
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH7973059A CH410002A (de) | 1959-06-30 | 1959-10-22 | Verfahren zur cis-/trans-Isomerisierung von tricyclischen Verbindungen |
| BE592122A BE592122A (fr) | 1959-06-30 | 1960-06-21 | Procédé d'isomérisation de composés tricycliques |
| US37864A US3113137A (en) | 1959-06-30 | 1960-06-22 | Method for isomerizing stereoisomeric xanthene and thioxanthene compounds via the use of oxalic acid |
| FR831195A FR1268648A (fr) | 1959-06-30 | 1960-06-27 | Procédé d'isomérisation de composés tricycliques, notamment des dérivés du xanthène et du thio-xanthène |
| ES0259514A ES259514A1 (es) | 1959-06-30 | 1960-06-28 | Procedimiento para la isomerizaciën de compuestos triciclicos |
| CS418160A CS152990B2 (en:Method) | 1959-06-30 | 1960-06-29 | |
| GB22758/60A GB899898A (en) | 1959-06-30 | 1960-06-29 | Novel isomerisation process |
| OA51050A OA00955A (fr) | 1959-06-30 | 1964-12-26 | Procédé d'isomérisation de composés tricycliques. |
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH7509159A CH387655A (de) | 1959-06-30 | 1959-06-30 | Verfahren zur Isomerisierung von tricyclischen Verbindungen |
| CH7558059A CH393358A (de) | 1959-07-10 | 1959-07-10 | Verfahren zur Isomerisierung von tricyclischen Verbindungen |
| CH7973059A CH410002A (de) | 1959-06-30 | 1959-10-22 | Verfahren zur cis-/trans-Isomerisierung von tricyclischen Verbindungen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH410002A true CH410002A (de) | 1966-03-31 |
Family
ID=27178565
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH7973059A CH410002A (de) | 1959-06-30 | 1959-10-22 | Verfahren zur cis-/trans-Isomerisierung von tricyclischen Verbindungen |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3113137A (en:Method) |
| BE (1) | BE592122A (en:Method) |
| CH (1) | CH410002A (en:Method) |
| CS (1) | CS152990B2 (en:Method) |
| ES (1) | ES259514A1 (en:Method) |
| GB (1) | GB899898A (en:Method) |
| OA (1) | OA00955A (en:Method) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3192204A (en) * | 1960-03-07 | 1965-06-29 | Smith Kline French Lab | Trifluoromethylthiaxanthene and -xanthene derivatives |
| GB1013901A (en) * | 1962-01-26 | 1965-12-22 | Kefalas As | Dihydroanthracene, dibenzocycloheptadiene and dibenzocycloheptatriene derivatives |
| US3609167A (en) * | 1962-04-02 | 1971-09-28 | Smith Kline French Lab | IBENZO{8 b,e{9 {0 THIEPINES |
| US3282930A (en) * | 1962-08-17 | 1966-11-01 | Smith Kline French Lab | Hydroxyalkylenepiperazine derivatives and analogs thereof |
| US3310553A (en) * | 1962-09-25 | 1967-03-21 | Pfizer & Co C | Alkylated thioxathenesulfonamides |
| US3282936A (en) * | 1963-05-01 | 1966-11-01 | Geigy Chem Corp | Process for the conversion of cis-2-phenyl-3-methylmorpholine to trans-2-phenyl-3-methylmorpholine |
| US3248291A (en) * | 1963-08-19 | 1966-04-26 | Hoffmann La Roche | Stabilized thioxanthene derivatives and method of using the same |
| US3337407A (en) * | 1965-02-24 | 1967-08-22 | Merck & Co Inc | Uricosuric agent |
| US3681346A (en) * | 1969-06-20 | 1972-08-01 | Kefalas As | {60 -isomer of the decanoic acid ester of 10-{8 3,-(4-hydroxyethyl-1-piperazinyl)propylidene{9 -2-trifluoro-methyl thiaxanthene, acid addition salts thereof, method of use and compositions |
| GB1469108A (en) * | 1973-06-25 | 1977-03-30 | Kefalas As | Thiaxanthene derivative |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2957880A (en) * | 1953-12-23 | 1960-10-25 | Ciba Pharm Prod Inc | Process for the conversion of stereoisomers |
| US2996503A (en) * | 1955-09-23 | 1961-08-15 | Merck & Co Inc | Derivatives of heterocyclic compounds |
| DE1044103B (de) * | 1956-06-12 | 1958-11-20 | Hoffmann La Roche | Verfahren zur Herstellung von Xanthen- bzw. Thioxanthenderivaten |
| BE557002A (en:Method) * | 1956-07-09 | |||
| BE568611A (en:Method) * | 1957-07-18 |
-
1959
- 1959-10-22 CH CH7973059A patent/CH410002A/de unknown
-
1960
- 1960-06-21 BE BE592122A patent/BE592122A/fr unknown
- 1960-06-22 US US37864A patent/US3113137A/en not_active Expired - Lifetime
- 1960-06-28 ES ES0259514A patent/ES259514A1/es not_active Expired
- 1960-06-29 CS CS418160A patent/CS152990B2/cs unknown
- 1960-06-29 GB GB22758/60A patent/GB899898A/en not_active Expired
-
1964
- 1964-12-26 OA OA51050A patent/OA00955A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| US3113137A (en) | 1963-12-03 |
| OA00955A (fr) | 1968-03-22 |
| BE592122A (fr) | 1960-12-21 |
| CS152990B2 (en:Method) | 1974-02-22 |
| ES259514A1 (es) | 1961-01-16 |
| GB899898A (en) | 1962-06-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH410002A (de) | Verfahren zur cis-/trans-Isomerisierung von tricyclischen Verbindungen | |
| DE2258484C3 (de) | Verfahren zum Reinigen von rohem 2-Mercaptobenzothiazol | |
| DE2331668C2 (de) | Verfahren zur Reinigung von Sorbinsäure | |
| DE2263247C3 (de) | Verfahren zur Reinigung von Anthrachinon | |
| DE2130406B2 (en:Method) | ||
| AT224119B (de) | Verfahren zur Isomerisierung von basisch substituierten tricyclischen Verbindungen | |
| AT203485B (de) | Verfahren zur Herstellung von neuen Dinitrophenylmethacrylaten | |
| DE2115944B2 (de) | Verfahren zur herstellung von o-sulfobenzimiden | |
| DE533129C (de) | Verfahren zur Herstellung von Chloranil und Bromanil | |
| DE820296C (de) | Verfahren zur Herstellung eines Vinylacetatderivates C H O | |
| EP0119463A1 (de) | Verfahren zur Trennung von substituierten Cyclopropancarbonsäureisomeren | |
| DE1909691A1 (de) | Verfahren zum Reinigen von Terephthalsaeure | |
| AT230882B (de) | Verfahren zur Herstellung von 6-Aminochrysen | |
| AT260911B (de) | Verfahren zur Herstellung der optisch aktiven Formen des α-Methyl-β-(3,4-dihydroxyphenyl)-alanins und deren N,O,O-Triacetylderivate | |
| AT268257B (de) | Verfahren zur Herstellung von α-niedrig-Alkanoylamino-d-(subst. benzyl)-niedrig-alkanonitrilen | |
| AT225684B (de) | Verfahren zur Herstellung von Gemischen aus α, α, γ- und α, γ, γ-Trimethyladipinsäure | |
| DE955510C (de) | Verfahren zur Herstellung eines heterocyclischen Chinons | |
| AT245729B (de) | Verfahren zur Gewinnung von sedativ und spasmolytisch wirksamen Estern aus Radix valerianae | |
| AT230877B (de) | Verfahren zur Herstellung aromatischer Carbonsäuren | |
| DE1002339C2 (de) | Verfahren zur Aufarbeitung des bei der Oxydation von technischem trans-Dekahydronaphthalin gebildeten Reaktionsgemisches | |
| AT205035B (de) | Verfahren zur Gewinnung von neuen, optisch aktiven, schwefelhaltigen Phenothiazin-Derivaten aus den entsprechenden Racematen | |
| CH398541A (de) | Verfahren zur Reinigung von aromatischen Carbonsäuren | |
| DE1032261B (de) | Verfahren zur Abtrennung sekundaerer Amine aus einer primaeres und sekundaeres Amin enthaltenden Mischung | |
| CH97788A (de) | Arbeitsverfahren zur Herstellung von Anthrachinon und seinen Derivaten. | |
| CH393358A (de) | Verfahren zur Isomerisierung von tricyclischen Verbindungen |