CH358236A - Verfahren zur Herstellung von makromolekularen Polymethylenterephthalaten - Google Patents
Verfahren zur Herstellung von makromolekularen PolymethylenterephthalatenInfo
- Publication number
- CH358236A CH358236A CH358236DA CH358236A CH 358236 A CH358236 A CH 358236A CH 358236D A CH358236D A CH 358236DA CH 358236 A CH358236 A CH 358236A
- Authority
- CH
- Switzerland
- Prior art keywords
- onium compound
- macromolecular
- terephthalate
- hours
- transesterification
- Prior art date
Links
- -1 polymethylene terephthalates Polymers 0.000 title claims description 13
- 238000000034 method Methods 0.000 title claims description 11
- 238000002360 preparation method Methods 0.000 title description 3
- 239000003054 catalyst Substances 0.000 claims description 15
- 150000004010 onium ions Chemical class 0.000 claims description 8
- 238000005809 transesterification reaction Methods 0.000 claims description 8
- 238000010438 heat treatment Methods 0.000 claims description 7
- 150000003839 salts Chemical class 0.000 claims description 6
- 239000000155 melt Substances 0.000 claims description 5
- 238000006068 polycondensation reaction Methods 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 3
- 150000002334 glycols Chemical class 0.000 claims description 3
- RWSOTUBLDIXVET-UHFFFAOYSA-O sulfonium Chemical compound [SH3+] RWSOTUBLDIXVET-UHFFFAOYSA-O 0.000 claims description 3
- 150000003503 terephthalic acid derivatives Chemical class 0.000 claims description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-O oxonium Chemical compound [OH3+] XLYOFNOQVPJJNP-UHFFFAOYSA-O 0.000 claims description 2
- XYFCBTPGUUZFHI-UHFFFAOYSA-O phosphonium Chemical compound [PH4+] XYFCBTPGUUZFHI-UHFFFAOYSA-O 0.000 claims description 2
- 125000003827 glycol group Chemical group 0.000 claims 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 23
- WOZVHXUHUFLZGK-UHFFFAOYSA-N dimethyl terephthalate Chemical compound COC(=O)C1=CC=C(C(=O)OC)C=C1 WOZVHXUHUFLZGK-UHFFFAOYSA-N 0.000 description 16
- 229920000642 polymer Polymers 0.000 description 14
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 7
- 238000002844 melting Methods 0.000 description 6
- 230000008018 melting Effects 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 229920000728 polyester Polymers 0.000 description 5
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZOIORXHNWRGPMV-UHFFFAOYSA-N acetic acid;zinc Chemical compound [Zn].CC(O)=O.CC(O)=O ZOIORXHNWRGPMV-UHFFFAOYSA-N 0.000 description 3
- 229910000410 antimony oxide Inorganic materials 0.000 description 3
- 230000015556 catabolic process Effects 0.000 description 3
- 238000006731 degradation reaction Methods 0.000 description 3
- VTRUBDSFZJNXHI-UHFFFAOYSA-N oxoantimony Chemical compound [Sb]=O VTRUBDSFZJNXHI-UHFFFAOYSA-N 0.000 description 3
- VDEALLOCWQYOBY-UHFFFAOYSA-L terephthalate;tetraethylazanium Chemical compound CC[N+](CC)(CC)CC.CC[N+](CC)(CC)CC.[O-]C(=O)C1=CC=C(C([O-])=O)C=C1 VDEALLOCWQYOBY-UHFFFAOYSA-L 0.000 description 3
- 239000004246 zinc acetate Substances 0.000 description 3
- VSYFZULSKMFUJJ-UHFFFAOYSA-N 2,6-dimethylpyran-4-one Chemical compound CC1=CC(=O)C=C(C)O1 VSYFZULSKMFUJJ-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- ZCYMTKHTVJVLLI-UHFFFAOYSA-L dibutyl(ethyl)sulfanium terephthalate Chemical compound C(C1=CC=C(C(=O)[O-])C=C1)(=O)[O-].C(CCC)[S+](CC)CCCC.C(CCC)[S+](CCCC)CC ZCYMTKHTVJVLLI-UHFFFAOYSA-L 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- YMBCJWGVCUEGHA-UHFFFAOYSA-M tetraethylammonium chloride Chemical compound [Cl-].CC[N+](CC)(CC)CC YMBCJWGVCUEGHA-UHFFFAOYSA-M 0.000 description 2
- 229940073455 tetraethylammonium hydroxide Drugs 0.000 description 2
- LRGJRHZIDJQFCL-UHFFFAOYSA-M tetraethylazanium;hydroxide Chemical compound [OH-].CC[N+](CC)(CC)CC LRGJRHZIDJQFCL-UHFFFAOYSA-M 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- KAMLRHYYOMTNOY-UHFFFAOYSA-M [Br-].O1CCN(CC1)[P+](CC)(N1CCOCC1)N1CCOCC1 Chemical compound [Br-].O1CCN(CC1)[P+](CC)(N1CCOCC1)N1CCOCC1 KAMLRHYYOMTNOY-UHFFFAOYSA-M 0.000 description 1
- BDYUKCFLRFKIPY-UHFFFAOYSA-M [OH-].C(C1=CC=CC=C1)[S+](C)CC1=CC=CC=C1 Chemical compound [OH-].C(C1=CC=CC=C1)[S+](C)CC1=CC=CC=C1 BDYUKCFLRFKIPY-UHFFFAOYSA-M 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 description 1
- 239000000292 calcium oxide Substances 0.000 description 1
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- FFPQSNUAVYJZDH-UHFFFAOYSA-N diazanium;terephthalate Chemical compound [NH4+].[NH4+].[O-]C(=O)C1=CC=C(C([O-])=O)C=C1 FFPQSNUAVYJZDH-UHFFFAOYSA-N 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 229910000464 lead oxide Inorganic materials 0.000 description 1
- RLSSMJSEOOYNOY-UHFFFAOYSA-N m-cresol Chemical compound CC1=CC=CC(O)=C1 RLSSMJSEOOYNOY-UHFFFAOYSA-N 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 238000002074 melt spinning Methods 0.000 description 1
- 229940100630 metacresol Drugs 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- YEXPOXQUZXUXJW-UHFFFAOYSA-N oxolead Chemical compound [Pb]=O YEXPOXQUZXUXJW-UHFFFAOYSA-N 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- KKEYFWRCBNTPAC-UHFFFAOYSA-L terephthalate(2-) Chemical class [O-]C(=O)C1=CC=C(C([O-])=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-L 0.000 description 1
- DFQPZDGUFQJANM-UHFFFAOYSA-M tetrabutylphosphanium;hydroxide Chemical compound [OH-].CCCC[P+](CCCC)(CCCC)CCCC DFQPZDGUFQJANM-UHFFFAOYSA-M 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G63/00—Macromolecular compounds obtained by reactions forming a carboxylic ester link in the main chain of the macromolecule
- C08G63/78—Preparation processes
- C08G63/82—Preparation processes characterised by the catalyst used
- C08G63/87—Non-metals or inter-compounds thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyesters Or Polycarbonates (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL203818 | 1956-01-21 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH358236A true CH358236A (de) | 1961-11-15 |
Family
ID=38526787
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH358236D CH358236A (de) | 1956-01-21 | 1957-01-04 | Verfahren zur Herstellung von makromolekularen Polymethylenterephthalaten |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3039998A (enExample) |
| BE (1) | BE553967A (enExample) |
| CH (1) | CH358236A (enExample) |
| DE (1) | DE1179710B (enExample) |
| ES (1) | ES233041A1 (enExample) |
| FR (1) | FR1164874A (enExample) |
| GB (1) | GB816801A (enExample) |
| NL (2) | NL90066C (enExample) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3227681A (en) * | 1966-01-04 | Ar-loh | ||
| DE1159168B (de) * | 1959-09-23 | 1963-12-12 | Glanzstoff Ag | Verfahren zur Herstellung von Poly-(aethylenglykolterephthalat) |
| DE1162079B (de) * | 1960-03-16 | 1964-01-30 | Gevaert Photo Producten N V Mortsel Antwerpen (Belgien) | Verfahren zur Herstellung thermoplastischer hochmolekularer Polycarbonate. |
| DE1163544B (de) * | 1960-03-16 | 1964-02-20 | Gevaert Photo Prod Nv | Verfahren zur Herstellung thermoplastischer hochmolekularer Polycarbonate |
| DE1141789B (de) * | 1960-04-21 | 1962-12-27 | Gevaert Photo-Producten N. V., Mortsel, Antwerpen (Belgien) | Verfahren zur Herstellung hochmolekularer Polycarbonate. |
| BE588783A (nl) * | 1960-03-18 | 1960-09-19 | Gevaert Photo Prod Nv | Bereiding van Thermoplastische Kunststoffen. |
| GB1023707A (en) * | 1962-05-29 | 1966-03-23 | Toyo Rayon Co Ltd | Preparation of polyesters |
| US3418289A (en) * | 1965-10-12 | 1968-12-24 | Du Pont | Polymerization of 2,2-dialkyl-3-propiolactones using teritary sulfonium salts as initiators |
| JPS4841713B1 (enExample) * | 1969-08-05 | 1973-12-07 | ||
| US4035341A (en) * | 1971-05-24 | 1977-07-12 | Rhone-Poulenc-Textile | Polyester compositions with good dyeing affinity and a process for obtaining same |
| US3954902A (en) * | 1971-05-24 | 1976-05-04 | Rhone-Poulenc-Textile | Polyesters with good dyeing affinity and a process for obtaining same |
| US4028307A (en) * | 1975-05-30 | 1977-06-07 | Fiber Industries, Inc. | Preparation of polyesters using salts of substituted quaternary ammonium bases |
| US4038258A (en) * | 1975-09-17 | 1977-07-26 | E. I. Du Pont De Nemours And Company | Antistatic composition containing an aliphatic polyester or polyether ester and a phosphonium salt |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2465319A (en) * | 1941-07-29 | 1949-03-22 | Du Pont | Polymeric linear terephthalic esters |
| US2742494A (en) * | 1952-09-26 | 1956-04-17 | Hercules Powder Co Ltd | Mixed esters of phthalic acids and process for production thereof |
| US2727881A (en) * | 1952-10-03 | 1955-12-20 | Eastman Kodak Co | Organo-titanium catalysts for the preparation of polyesters |
| NL103236C (enExample) * | 1953-11-18 | |||
| BE536016A (enExample) * | 1954-02-26 | |||
| US2779783A (en) * | 1954-09-29 | 1957-01-29 | Firestone Tire & Rubber Co | Production of linear polyesters of alkylene dicarboxylic acids |
-
0
- BE BE553967D patent/BE553967A/xx unknown
- NL NL203818D patent/NL203818A/xx unknown
- NL NL90066D patent/NL90066C/xx active
-
1956
- 1956-12-20 US US629489A patent/US3039998A/en not_active Expired - Lifetime
-
1957
- 1957-01-04 CH CH358236D patent/CH358236A/de unknown
- 1957-01-07 GB GB633/57A patent/GB816801A/en not_active Expired
- 1957-01-07 DE DEN13164A patent/DE1179710B/de active Pending
- 1957-01-15 ES ES0233041A patent/ES233041A1/es not_active Expired
- 1957-01-19 FR FR1164874D patent/FR1164874A/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| ES233041A1 (es) | 1957-07-01 |
| DE1179710B (de) | 1964-10-15 |
| GB816801A (en) | 1959-07-22 |
| US3039998A (en) | 1962-06-19 |
| NL90066C (enExample) | |
| BE553967A (enExample) | |
| NL203818A (enExample) | 1958-03-15 |
| FR1164874A (fr) | 1958-10-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1745695C3 (de) | Verfahren zur Herstellung von linearen, thermoplastischen Mischpolyester mit Erweichungstemperaturen über 100 Grad C | |
| DE1520178A1 (de) | Verfahren zur Herstellung von Polyaethylenterephthalat | |
| CH358236A (de) | Verfahren zur Herstellung von makromolekularen Polymethylenterephthalaten | |
| DE1645494A1 (de) | Verfahren zur Herstellung von faserbildenden Polyestern | |
| DE2214775C3 (de) | Verfahren zur Herstellung von Polybutylenterephthalat | |
| DE1292398B (de) | Verfahren zur Herstellung von hochpolymeren Polyestern | |
| DE2045914A1 (de) | Verfahren zur Herstellung von Polyestern des 1,4-ButandiolS· | |
| DE1520079B2 (de) | Verfahren zur herstellung hochpolymerer polymethylenterephthalate | |
| CH495395A (de) | Verfahren zur Herstellung von synthetischen hochmolekularen Polyestern | |
| DE2336026C3 (de) | Verfahren zur Herstellung von modifizierten Polyalkylenterephthalaten | |
| DE1570627C3 (de) | Verfahren zur Herstellung linearer faserbildender Polyester | |
| EP0004343B1 (de) | Verfahren zur Herstellung von linearen hochmolekularen gesättigten Polyestern | |
| CH326566A (de) | Verfahren zur Herstellung von Polyestern | |
| DE2526749C2 (de) | Verfahren zur Herstellung von flammwidrigem Polybutylenterephthalat | |
| DE1271397B (de) | Verfahren zur Herstellung von spinnfaehigem Poly-(aethylenglykolterephthalat) | |
| AT229040B (de) | Verfahren zur Herstellung von hochmolekularen Polyestern | |
| DE1770728A1 (de) | Acetylacetonat-Umesterungskatalysatoren | |
| DE1520079C (de) | Verfahren zur Herstellung hochpolymerer Polymethylenterephthalate | |
| DE2114236A1 (de) | Modifizierte Polyterephthalsaeureester | |
| DE1811446A1 (de) | Verfahren zur Herstellung von Polyaethylenterephthalat | |
| AT208596B (de) | Verfahren zur Herstellung linearer Copolyester der Kohlensäure | |
| AT259751B (de) | Lineare Polyester oder Copolyester zur Herstellung von Fasern hoher Licht- und Thermostabilität | |
| DE2213259A1 (de) | Verfahren zur herstellung von polyestern des 1,4-butandiols | |
| DE1921247C3 (de) | Verfahren zur Herstellung von linearen Polyestern | |
| DE1720312C3 (de) | Verfahren zur Herstellung von hoch molek ularen Polymethylenterephthalaten |