CA2607359C - Compounds and methods for the treatment or prevention of flavivirus infections - Google Patents
Compounds and methods for the treatment or prevention of flavivirus infections Download PDFInfo
- Publication number
- CA2607359C CA2607359C CA2607359A CA2607359A CA2607359C CA 2607359 C CA2607359 C CA 2607359C CA 2607359 A CA2607359 A CA 2607359A CA 2607359 A CA2607359 A CA 2607359A CA 2607359 C CA2607359 C CA 2607359C
- Authority
- CA
- Canada
- Prior art keywords
- alkyl
- trans
- methyl
- optionally substituted
- thiophene
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 150000001875 compounds Chemical class 0.000 title claims abstract description 361
- 238000000034 method Methods 0.000 title description 54
- 206010054261 Flavivirus infection Diseases 0.000 title description 6
- 238000011282 treatment Methods 0.000 title description 6
- 230000002265 prevention Effects 0.000 title description 3
- 150000003839 salts Chemical class 0.000 claims abstract description 195
- 239000012453 solvate Substances 0.000 claims abstract description 182
- 241000711549 Hepacivirus C Species 0.000 claims abstract description 34
- 208000036142 Viral infection Diseases 0.000 claims abstract description 17
- 230000009385 viral infection Effects 0.000 claims abstract description 17
- 241000700605 Viruses Species 0.000 claims abstract description 6
- 241000710777 Classical swine fever virus Species 0.000 claims abstract description 4
- 208000001490 Dengue Diseases 0.000 claims abstract description 3
- 206010012310 Dengue fever Diseases 0.000 claims abstract description 3
- 241000710842 Japanese encephalitis virus Species 0.000 claims abstract description 3
- 241000710772 Yellow fever virus Species 0.000 claims abstract description 3
- 208000025729 dengue disease Diseases 0.000 claims abstract description 3
- 229940051021 yellow-fever virus Drugs 0.000 claims abstract description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 340
- -1 substituted Chemical class 0.000 claims description 300
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 220
- 125000000623 heterocyclic group Chemical group 0.000 claims description 149
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 131
- 125000001072 heteroaryl group Chemical group 0.000 claims description 129
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical group N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 123
- 229910052736 halogen Inorganic materials 0.000 claims description 113
- 150000002367 halogens Chemical class 0.000 claims description 109
- 125000003545 alkoxy group Chemical group 0.000 claims description 102
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 97
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 94
- 125000004475 heteroaralkyl group Chemical group 0.000 claims description 93
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 92
- 125000000018 nitroso group Chemical group N(=O)* 0.000 claims description 90
- 125000000304 alkynyl group Chemical group 0.000 claims description 85
- 125000003118 aryl group Chemical group 0.000 claims description 83
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 83
- 125000003342 alkenyl group Chemical group 0.000 claims description 82
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 81
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 claims description 76
- 229910052757 nitrogen Inorganic materials 0.000 claims description 74
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims description 73
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 claims description 70
- 125000005133 alkynyloxy group Chemical group 0.000 claims description 57
- 125000004043 oxo group Chemical group O=* 0.000 claims description 53
- 125000003320 C2-C6 alkenyloxy group Chemical group 0.000 claims description 49
- 230000003612 virological effect Effects 0.000 claims description 48
- 125000000392 cycloalkenyl group Chemical group 0.000 claims description 46
- 125000004104 aryloxy group Chemical group 0.000 claims description 43
- 229910006074 SO2NH2 Inorganic materials 0.000 claims description 41
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 40
- 239000003795 chemical substances by application Substances 0.000 claims description 39
- 125000004400 (C1-C12) alkyl group Chemical group 0.000 claims description 37
- 125000005915 C6-C14 aryl group Chemical group 0.000 claims description 37
- 239000003112 inhibitor Substances 0.000 claims description 31
- 125000001424 substituent group Chemical group 0.000 claims description 31
- 125000000041 C6-C10 aryl group Chemical group 0.000 claims description 30
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 28
- 125000006652 (C3-C12) cycloalkyl group Chemical group 0.000 claims description 27
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 25
- 125000006650 (C2-C4) alkynyl group Chemical group 0.000 claims description 23
- 102000014150 Interferons Human genes 0.000 claims description 22
- 108010050904 Interferons Proteins 0.000 claims description 22
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 21
- 150000002923 oximes Chemical class 0.000 claims description 20
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 19
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 18
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 claims description 16
- 241000710781 Flaviviridae Species 0.000 claims description 15
- 239000008194 pharmaceutical composition Substances 0.000 claims description 15
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 14
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 13
- 229910052717 sulfur Inorganic materials 0.000 claims description 13
- 108020004684 Internal Ribosome Entry Sites Proteins 0.000 claims description 12
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 12
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 12
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 12
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 claims description 12
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 12
- 229910052760 oxygen Inorganic materials 0.000 claims description 12
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 11
- 229940079322 interferon Drugs 0.000 claims description 11
- 229920006395 saturated elastomer Polymers 0.000 claims description 10
- 239000003001 serine protease inhibitor Substances 0.000 claims description 10
- 125000004429 atom Chemical group 0.000 claims description 9
- 125000001162 cycloheptenyl group Chemical group C1(=CCCCCC1)* 0.000 claims description 9
- 125000000522 cyclooctenyl group Chemical group C1(=CCCCCCC1)* 0.000 claims description 9
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 claims description 9
- 239000003814 drug Substances 0.000 claims description 9
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 9
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 9
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims description 8
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 8
- 125000005842 heteroatom Chemical group 0.000 claims description 8
- 239000001301 oxygen Substances 0.000 claims description 8
- 239000011593 sulfur Chemical group 0.000 claims description 8
- 108060004795 Methyltransferase Proteins 0.000 claims description 7
- WVIIMZNLDWSIRH-UHFFFAOYSA-N cyclohexylcyclohexane Chemical group C1CCCCC1C1CCCCC1 WVIIMZNLDWSIRH-UHFFFAOYSA-N 0.000 claims description 7
- 125000005879 dioxolanyl group Chemical group 0.000 claims description 7
- 239000003937 drug carrier Substances 0.000 claims description 7
- HQUCUQJOQOFEQW-UHFFFAOYSA-N 5-(cyclohexen-1-yl)-3-[(4-methylcyclohexanecarbonyl)-(4-oxocyclohexyl)amino]thiophene-2-carboxylic acid Chemical compound C1CC(C)CCC1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCC(=O)CC1 HQUCUQJOQOFEQW-UHFFFAOYSA-N 0.000 claims description 6
- 241000710780 Bovine viral diarrhea virus 1 Species 0.000 claims description 6
- 108091005804 Peptidases Proteins 0.000 claims description 6
- 239000004365 Protease Substances 0.000 claims description 6
- IWUCXVSUMQZMFG-AFCXAGJDSA-N Ribavirin Chemical compound N1=C(C(=O)N)N=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 IWUCXVSUMQZMFG-AFCXAGJDSA-N 0.000 claims description 6
- 239000003242 anti bacterial agent Substances 0.000 claims description 6
- 230000000692 anti-sense effect Effects 0.000 claims description 6
- 239000003963 antioxidant agent Substances 0.000 claims description 6
- 230000000694 effects Effects 0.000 claims description 6
- 230000002401 inhibitory effect Effects 0.000 claims description 6
- 229960000329 ribavirin Drugs 0.000 claims description 6
- HZCAHMRRMINHDJ-DBRKOABJSA-N ribavirin Natural products O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1N=CN=C1 HZCAHMRRMINHDJ-DBRKOABJSA-N 0.000 claims description 6
- VSIYJQNFMOOGCU-UHFFFAOYSA-N 1-(cyclohexen-1-yl)cyclohexene Chemical group C1CCCC(C=2CCCCC=2)=C1 VSIYJQNFMOOGCU-UHFFFAOYSA-N 0.000 claims description 5
- MGIDOELNCIGRPO-UHFFFAOYSA-N 5-(cyclohexen-1-yl)-3-[(4-hydroxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid Chemical compound C1CC(C)CCC1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCC(O)CC1 MGIDOELNCIGRPO-UHFFFAOYSA-N 0.000 claims description 5
- NRWYAVDHRVTITK-UPRSBDKSSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCC=1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCC=1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 NRWYAVDHRVTITK-UPRSBDKSSA-N 0.000 claims description 5
- FWKQNCXZGNBPFD-UHFFFAOYSA-N Guaiazulene Chemical compound CC(C)C1=CC=C(C)C2=CC=C(C)C2=C1 FWKQNCXZGNBPFD-UHFFFAOYSA-N 0.000 claims description 5
- 125000004122 cyclic group Chemical group 0.000 claims description 5
- 125000003678 cyclohexadienyl group Chemical group C1(=CC=CCC1)* 0.000 claims description 5
- 125000000058 cyclopentadienyl group Chemical group C1(=CC=CC1)* 0.000 claims description 5
- ZSWFCLXCOIISFI-UHFFFAOYSA-N endo-cyclopentadiene Chemical group C1C=CC=C1 ZSWFCLXCOIISFI-UHFFFAOYSA-N 0.000 claims description 5
- 125000004193 piperazinyl group Chemical group 0.000 claims description 5
- 229940021747 therapeutic vaccine Drugs 0.000 claims description 5
- 125000006705 (C5-C7) cycloalkyl group Chemical group 0.000 claims description 4
- QYCGBAJADAGLLK-UHFFFAOYSA-N 1-(cyclohepten-1-yl)cycloheptene Chemical group C1CCCCC=C1C1=CCCCCC1 QYCGBAJADAGLLK-UHFFFAOYSA-N 0.000 claims description 4
- RNEQXUALSHFBCE-UHFFFAOYSA-N 3-[(4-hydroxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]-5-(4-oxocyclohexen-1-yl)thiophene-2-carboxylic acid Chemical compound C1CC(C)CCC1C(=O)N(C1=C(SC(=C1)C=1CCC(=O)CC=1)C(O)=O)C1CCC(O)CC1 RNEQXUALSHFBCE-UHFFFAOYSA-N 0.000 claims description 4
- JVSQRBKXYYHNAL-UHFFFAOYSA-N 3-[(4-hydroxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]-5-(4-phenoxycyclohexen-1-yl)thiophene-2-carboxylic acid Chemical compound C1CC(C)CCC1C(=O)N(C1=C(SC(=C1)C=1CCC(CC=1)OC=1C=CC=CC=1)C(O)=O)C1CCC(O)CC1 JVSQRBKXYYHNAL-UHFFFAOYSA-N 0.000 claims description 4
- AMOXNTAMLUCWJT-UHFFFAOYSA-N 5-(4,4-dimethylcyclohexyl)-3-[(4-methoxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid Chemical compound C1CC(OC)CCC1N(C1=C(SC(=C1)C1CCC(C)(C)CC1)C(O)=O)C(=O)C1CCC(C)CC1 AMOXNTAMLUCWJT-UHFFFAOYSA-N 0.000 claims description 4
- OFOMFFOXKMZUIW-UHFFFAOYSA-N 5-(cyclohexen-1-yl)-3-(n-(4-methylcyclohexanecarbonyl)anilino)thiophene-2-carboxylic acid Chemical compound C1CC(C)CCC1C(=O)N(C=1C=CC=CC=1)C1=C(C(O)=O)SC(C=2CCCCC=2)=C1 OFOMFFOXKMZUIW-UHFFFAOYSA-N 0.000 claims description 4
- GJNZQSSHAVNWFW-UHFFFAOYSA-N 5-(cyclohexen-1-yl)-3-[(2,4-dichlorobenzoyl)-propan-2-ylamino]thiophene-2-carboxylic acid Chemical compound C1=C(C=2CCCCC=2)SC(C(O)=O)=C1N(C(C)C)C(=O)C1=CC=C(Cl)C=C1Cl GJNZQSSHAVNWFW-UHFFFAOYSA-N 0.000 claims description 4
- OSZNFYRPACBWAD-UHFFFAOYSA-N 5-(cyclohexen-1-yl)-3-[(4-ethoxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid Chemical compound C1CC(OCC)CCC1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)C1CCC(C)CC1 OSZNFYRPACBWAD-UHFFFAOYSA-N 0.000 claims description 4
- SNHOCYVWFCETLM-UHFFFAOYSA-N 5-(cyclohexen-1-yl)-3-[[4-(methoxymethoxy)cyclohexyl]-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid Chemical compound C1CC(OCOC)CCC1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)C1CCC(C)CC1 SNHOCYVWFCETLM-UHFFFAOYSA-N 0.000 claims description 4
- VCJJWZOMFHUKMX-UHFFFAOYSA-N 5-cyclohexyl-3-[(4-hydroxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid Chemical compound C1CC(C)CCC1C(=O)N(C1=C(SC(=C1)C1CCCCC1)C(O)=O)C1CCC(O)CC1 VCJJWZOMFHUKMX-UHFFFAOYSA-N 0.000 claims description 4
- HZCUBYGLTQHCPR-JCNLHEQBSA-N C1=C(C=2CCCCC=2)SC(C(O)=O)=C1N(C(C)C)C(=O)[C@H]1CC[C@H](C)CC1 Chemical compound C1=C(C=2CCCCC=2)SC(C(O)=O)=C1N(C(C)C)C(=O)[C@H]1CC[C@H](C)CC1 HZCUBYGLTQHCPR-JCNLHEQBSA-N 0.000 claims description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 4
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 claims description 4
- 229940123066 Polymerase inhibitor Drugs 0.000 claims description 4
- DKNWSYNQZKUICI-UHFFFAOYSA-N amantadine Chemical compound C1C(C2)CC3CC2CC1(N)C3 DKNWSYNQZKUICI-UHFFFAOYSA-N 0.000 claims description 4
- 229960003805 amantadine Drugs 0.000 claims description 4
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 4
- 229910052740 iodine Inorganic materials 0.000 claims description 4
- 229910052744 lithium Inorganic materials 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 4
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 claims description 4
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 4
- 125000003386 piperidinyl group Chemical group 0.000 claims description 4
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 4
- 125000000719 pyrrolidinyl group Chemical group 0.000 claims description 4
- 239000011734 sodium Substances 0.000 claims description 4
- 229910052708 sodium Inorganic materials 0.000 claims description 4
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 4
- 150000003536 tetrazoles Chemical class 0.000 claims description 4
- 229920002554 vinyl polymer Chemical group 0.000 claims description 4
- OQJNOHVPDZQBCM-UHFFFAOYSA-N 5-(3-hydroxycyclohexen-1-yl)-3-[(4-methylcyclohexanecarbonyl)-[4-(oxan-2-yloxy)cyclohexyl]amino]thiophene-2-carboxylic acid Chemical compound C1CC(C)CCC1C(=O)N(C1=C(SC(=C1)C=1CCCC(O)C=1)C(O)=O)C1CCC(OC2OCCCC2)CC1 OQJNOHVPDZQBCM-UHFFFAOYSA-N 0.000 claims description 3
- KQXCUMQUYNMNKA-UHFFFAOYSA-N 5-(cyclohexen-1-yl)-3-[(2,4-dimethylphenyl)sulfonylamino]thiophene-2-carboxylic acid Chemical compound CC1=CC(C)=CC=C1S(=O)(=O)NC1=C(C(O)=O)SC(C=2CCCCC=2)=C1 KQXCUMQUYNMNKA-UHFFFAOYSA-N 0.000 claims description 3
- VQNVTTOMIYUAAT-UHFFFAOYSA-N 5-(cyclohexen-1-yl)-3-[(4-methylbenzoyl)-propan-2-ylamino]thiophene-2-carboxylic acid Chemical compound C1=C(C=2CCCCC=2)SC(C(O)=O)=C1N(C(C)C)C(=O)C1=CC=C(C)C=C1 VQNVTTOMIYUAAT-UHFFFAOYSA-N 0.000 claims description 3
- NHRHXDMGFVGNRU-UHFFFAOYSA-N 5-(cyclohexen-1-yl)-3-[1,3-dioxan-5-yl-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid Chemical compound C1CC(C)CCC1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1COCOC1 NHRHXDMGFVGNRU-UHFFFAOYSA-N 0.000 claims description 3
- NRWYAVDHRVTITK-UHFFFAOYSA-N 5-(cyclopenten-1-yl)-3-[(4-hydroxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid Chemical compound C1CC(C)CCC1C(=O)N(C1=C(SC(=C1)C=1CCCC=1)C(O)=O)C1CCC(O)CC1 NRWYAVDHRVTITK-UHFFFAOYSA-N 0.000 claims description 3
- YBQKQVZAEDDNAU-CTYIDZIISA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C)C1=C(C(O)=O)SC(C=2CCCCC=2)=C1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C)C1=C(C(O)=O)SC(C=2CCCCC=2)=C1 YBQKQVZAEDDNAU-CTYIDZIISA-N 0.000 claims description 3
- FPARYJXWWMDFFU-KQEUCTNFSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1C=CCCC1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1C=CCCC1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 FPARYJXWWMDFFU-KQEUCTNFSA-N 0.000 claims description 3
- YIBUSNKWAYXYIB-YSXIEMCBSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCCCCC1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCCCCC1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 YIBUSNKWAYXYIB-YSXIEMCBSA-N 0.000 claims description 3
- CMBPRRDJOSJOPZ-LBKZCYKOSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCC(CC=1)C(C)(C)C)C(O)=O)[C@@H]1CC[C@@H](O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCC(CC=1)C(C)(C)C)C(O)=O)[C@@H]1CC[C@@H](O)CC1 CMBPRRDJOSJOPZ-LBKZCYKOSA-N 0.000 claims description 3
- XMHTZCKCUJIEIC-PPFQCUIHSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CC(C)CCC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CC(C)CCC1 XMHTZCKCUJIEIC-PPFQCUIHSA-N 0.000 claims description 3
- DTJARGIYIUHGII-KOMQPUFPSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CC1 DTJARGIYIUHGII-KOMQPUFPSA-N 0.000 claims description 3
- HCTFEOYQHVJAEV-UAPYVXQJSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCN(C)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCN(C)CC1 HCTFEOYQHVJAEV-UAPYVXQJSA-N 0.000 claims description 3
- QJEOKVNLHVLDLL-SAABIXHNSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCOCC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCOCC1 QJEOKVNLHVLDLL-SAABIXHNSA-N 0.000 claims description 3
- OUUFVRBISAEUNT-YSXIEMCBSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCCC=1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCCC=1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 OUUFVRBISAEUNT-YSXIEMCBSA-N 0.000 claims description 3
- LBFROQIFJOYWFA-HDRKRICHSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(Br)=C1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(Br)=C1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 LBFROQIFJOYWFA-HDRKRICHSA-N 0.000 claims description 3
- LNYKGELUODVSNS-URYRSFGFSA-N C1C[C@@H](OC)CC[C@@H]1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)C1CCC(C)CC1 Chemical compound C1C[C@@H](OC)CC[C@@H]1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)C1CCC(C)CC1 LNYKGELUODVSNS-URYRSFGFSA-N 0.000 claims description 3
- LNYKGELUODVSNS-YSXIEMCBSA-N C1C[C@@H](OC)CC[C@@H]1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 Chemical compound C1C[C@@H](OC)CC[C@@H]1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 LNYKGELUODVSNS-YSXIEMCBSA-N 0.000 claims description 3
- 102000053642 Catalytic RNA Human genes 0.000 claims description 3
- 108090000994 Catalytic RNA Proteins 0.000 claims description 3
- PMATZTZNYRCHOR-CGLBZJNRSA-N Cyclosporin A Chemical compound CC[C@@H]1NC(=O)[C@H]([C@H](O)[C@H](C)C\C=C\C)N(C)C(=O)[C@H](C(C)C)N(C)C(=O)[C@H](CC(C)C)N(C)C(=O)[C@H](CC(C)C)N(C)C(=O)[C@@H](C)NC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)N(C)C(=O)[C@H](C(C)C)NC(=O)[C@H](CC(C)C)N(C)C(=O)CN(C)C1=O PMATZTZNYRCHOR-CGLBZJNRSA-N 0.000 claims description 3
- 229930105110 Cyclosporin A Natural products 0.000 claims description 3
- 108010036949 Cyclosporine Proteins 0.000 claims description 3
- PWKSKIMOESPYIA-BYPYZUCNSA-N L-N-acetyl-Cysteine Chemical compound CC(=O)N[C@@H](CS)C(O)=O PWKSKIMOESPYIA-BYPYZUCNSA-N 0.000 claims description 3
- 244000272459 Silybum marianum Species 0.000 claims description 3
- 235000010841 Silybum marianum Nutrition 0.000 claims description 3
- 108010046075 Thymosin Proteins 0.000 claims description 3
- 102000007501 Thymosin Human genes 0.000 claims description 3
- 229960004308 acetylcysteine Drugs 0.000 claims description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-O ammonium group Chemical group [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 3
- 125000003725 azepanyl group Chemical group 0.000 claims description 3
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 3
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- OEYIOHPDSNJKLS-UHFFFAOYSA-N choline Chemical compound C[N+](C)(C)CCO OEYIOHPDSNJKLS-UHFFFAOYSA-N 0.000 claims description 3
- 229960001265 ciclosporin Drugs 0.000 claims description 3
- 229930182912 cyclosporin Natural products 0.000 claims description 3
- STUHQDIOZQUPGP-UHFFFAOYSA-N morpholin-4-ium-4-carboxylate Chemical compound OC(=O)N1CCOCC1 STUHQDIOZQUPGP-UHFFFAOYSA-N 0.000 claims description 3
- 108091092562 ribozyme Proteins 0.000 claims description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 3
- 125000004632 tetrahydrothiopyranyl group Chemical group S1C(CCCC1)* 0.000 claims description 3
- LCJVIYPJPCBWKS-NXPQJCNCSA-N thymosin Chemical compound SC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@H](CC(O)=O)C(=O)N[C@@H](C)C(=O)N[C@@H](C)C(=O)N[C@H](C(C)C)C(=O)N[C@H](CC(O)=O)C(=O)N[C@H](C(C)C)C(=O)N[C@H](CO)C(=O)N[C@H](CO)C(=O)N[C@H](CCC(O)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@H]([C@H](C)O)C(=O)N[C@H](C(C)C)C(=O)N[C@H](CCCCN)C(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](CCCCN)C(=O)N[C@H](CCC(O)=O)C(=O)N[C@H](CCCCN)C(=O)N[C@H](CCCCN)C(=O)N[C@H](CCC(O)=O)C(=O)N[C@H](C(C)C)C(=O)N[C@H](C(C)C)C(=O)N[C@H](CCC(O)=O)C(=O)N[C@H](CCC(O)=O)C(=O)N[C@@H](C)C(=O)N[C@H](CCC(O)=O)C(O)=O LCJVIYPJPCBWKS-NXPQJCNCSA-N 0.000 claims description 3
- MERANRXZFXHYKZ-UHFFFAOYSA-N 5-(2,3-difluorocyclohexen-1-yl)-3-[(4-methoxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid Chemical compound C1CC(OC)CCC1N(C1=C(SC(=C1)C=1CCCC(F)C=1F)C(O)=O)C(=O)C1CCC(C)CC1 MERANRXZFXHYKZ-UHFFFAOYSA-N 0.000 claims description 2
- RWEPJHKNTQPJNB-UHFFFAOYSA-N 5-(2,6-difluorocyclohexen-1-yl)-3-[(4-methoxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid Chemical compound C1CC(OC)CCC1N(C1=C(SC(=C1)C=1C(CCCC=1F)F)C(O)=O)C(=O)C1CCC(C)CC1 RWEPJHKNTQPJNB-UHFFFAOYSA-N 0.000 claims description 2
- OGBAPGFURAIVAC-UHFFFAOYSA-N 5-(3-hydroxycyclohexen-1-yl)-3-[(4-hydroxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid Chemical compound C1CC(C)CCC1C(=O)N(C1=C(SC(=C1)C=1CCCC(O)C=1)C(O)=O)C1CCC(O)CC1 OGBAPGFURAIVAC-UHFFFAOYSA-N 0.000 claims description 2
- FBOBFRVOSFIYOQ-UHFFFAOYSA-N 5-(4,4-dimethylcyclohexen-1-yl)-3-[(4-methoxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid Chemical compound C1CC(OC)CCC1N(C1=C(SC(=C1)C=1CCC(C)(C)CC=1)C(O)=O)C(=O)C1CCC(C)CC1 FBOBFRVOSFIYOQ-UHFFFAOYSA-N 0.000 claims description 2
- AQBYCVVVNOZWPR-UHFFFAOYSA-N 5-(cyclohexen-1-yl)-3-[(1-formylpiperidin-4-yl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid Chemical compound C1CC(C)CCC1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCN(C=O)CC1 AQBYCVVVNOZWPR-UHFFFAOYSA-N 0.000 claims description 2
- YZBWRCKPMKZIKM-UHFFFAOYSA-N 5-(cyclohexen-1-yl)-3-[(4-methylcyclohexanecarbonyl)-[1-(2-methylpropanoyl)piperidin-4-yl]amino]thiophene-2-carboxylic acid Chemical compound C1CN(C(=O)C(C)C)CCC1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)C1CCC(C)CC1 YZBWRCKPMKZIKM-UHFFFAOYSA-N 0.000 claims description 2
- PFOHWPCBSUQTAS-UHFFFAOYSA-N 5-(cyclohexen-1-yl)-3-[[4-[(1-methoxy-3-methyl-1-oxobutan-2-yl)carbamoyloxy]cyclohexyl]-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid Chemical compound C1CC(OC(=O)NC(C(=O)OC)C(C)C)CCC1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)C1CCC(C)CC1 PFOHWPCBSUQTAS-UHFFFAOYSA-N 0.000 claims description 2
- GVYKMIALDJEPRQ-CPONINCNSA-N C1=C(C=2CCC(C)CC=2)SC(C(O)=O)=C1N(C(C)C)C(=O)[C@H]1CC[C@H](C)CC1 Chemical compound C1=C(C=2CCC(C)CC=2)SC(C(O)=O)=C1N(C(C)C)C(=O)[C@H]1CC[C@H](C)CC1 GVYKMIALDJEPRQ-CPONINCNSA-N 0.000 claims description 2
- OHWPNFAZTZGNKZ-SAABIXHNSA-N C1=C(C=2CCCCC=2)SC(C(O)=O)=C1N(C(COC)COC)C(=O)[C@H]1CC[C@H](C)CC1 Chemical compound C1=C(C=2CCCCC=2)SC(C(O)=O)=C1N(C(COC)COC)C(=O)[C@H]1CC[C@H](C)CC1 OHWPNFAZTZGNKZ-SAABIXHNSA-N 0.000 claims description 2
- TVNILQLSTHSMLT-ZCYMVKBSSA-N C1CC(=NOCC)CCC1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 Chemical compound C1CC(=NOCC)CCC1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 TVNILQLSTHSMLT-ZCYMVKBSSA-N 0.000 claims description 2
- VSBSZSMJLXBCCV-SAABIXHNSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCC(C)(C)CC1)C(O)=O)C1COCOC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCC(C)(C)CC1)C(O)=O)C1COCOC1 VSBSZSMJLXBCCV-SAABIXHNSA-N 0.000 claims description 2
- UUEBOGSQUVQIEE-YSXIEMCBSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCC(C)(C)CC1)C(O)=O)[C@@H]1CC[C@@H](F)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCC(C)(C)CC1)C(O)=O)[C@@H]1CC[C@@H](F)CC1 UUEBOGSQUVQIEE-YSXIEMCBSA-N 0.000 claims description 2
- DRTQOSFDYDDNNA-YSXIEMCBSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCC(C)(C)CC1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCC(C)(C)CC1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 DRTQOSFDYDDNNA-YSXIEMCBSA-N 0.000 claims description 2
- LMCDACUYZVUIFN-WXVWHJFISA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCC(C)(C)CC=1)C(O)=O)C1CCC2(C(N(C)C(=O)N2C)=O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCC(C)(C)CC=1)C(O)=O)C1CCC2(C(N(C)C(=O)N2C)=O)CC1 LMCDACUYZVUIFN-WXVWHJFISA-N 0.000 claims description 2
- WJGGHFVZSJUBRZ-YSXIEMCBSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCC(C)(C)CC=1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCC(C)(C)CC=1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 WJGGHFVZSJUBRZ-YSXIEMCBSA-N 0.000 claims description 2
- CRLPSZXQCTYECG-KESTWPANSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCC(C)(C)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCC(C)(C)CC1 CRLPSZXQCTYECG-KESTWPANSA-N 0.000 claims description 2
- OSJUSKYSFLVNJA-SAABIXHNSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCC(F)(F)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCC(F)(F)CC1 OSJUSKYSFLVNJA-SAABIXHNSA-N 0.000 claims description 2
- VRCATWVIEHHTHZ-UAPYVXQJSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCCCC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCCCC1 VRCATWVIEHHTHZ-UAPYVXQJSA-N 0.000 claims description 2
- CEQRAOMBFIAWLT-SAABIXHNSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCSCC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCSCC1 CEQRAOMBFIAWLT-SAABIXHNSA-N 0.000 claims description 2
- BWWCLVQZCHIZEF-BOYKGFJRSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1COC(C)OC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1COC(C)OC1 BWWCLVQZCHIZEF-BOYKGFJRSA-N 0.000 claims description 2
- AHQGMPPSKUDUDL-VJVRBHMKSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)[C@@H]1CC[C@@H](F)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)[C@@H]1CC[C@@H](F)CC1 AHQGMPPSKUDUDL-VJVRBHMKSA-N 0.000 claims description 2
- BVXHTXRVCMTCJW-XBFADQFBSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)[C@@H]1CC[C@@H](C)CC1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)[C@@H]1CC[C@@H](C)CC1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 BVXHTXRVCMTCJW-XBFADQFBSA-N 0.000 claims description 2
- BVXHTXRVCMTCJW-GONJQHFYSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)[C@H]1CC[C@@H](C)CC1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)[C@H]1CC[C@@H](C)CC1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 BVXHTXRVCMTCJW-GONJQHFYSA-N 0.000 claims description 2
- VNDXSTNPMCDMEN-SAABIXHNSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C=1C=C2OCOC2=CC=1)C1=C(C(O)=O)SC(C=2CCCCC=2)=C1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C=1C=C2OCOC2=CC=1)C1=C(C(O)=O)SC(C=2CCCCC=2)=C1 VNDXSTNPMCDMEN-SAABIXHNSA-N 0.000 claims description 2
- XLJOUVDPWPSXDM-ICNBMTIMSA-N C1C[C@@H](C)CC[C@H]1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 Chemical compound C1C[C@@H](C)CC[C@H]1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 XLJOUVDPWPSXDM-ICNBMTIMSA-N 0.000 claims description 2
- QOIHGTCVBFQWJO-DRLVJGDXSA-N C1C[C@@H](OC)CC[C@@H]1N(C1=C(SC(=C1)C1CCC(CC1)C(F)(F)F)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 Chemical compound C1C[C@@H](OC)CC[C@@H]1N(C1=C(SC(=C1)C1CCC(CC1)C(F)(F)F)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 QOIHGTCVBFQWJO-DRLVJGDXSA-N 0.000 claims description 2
- FBOBFRVOSFIYOQ-XHPGVBHPSA-N C1C[C@@H](OC)CC[C@@H]1N(C1=C(SC(=C1)C=1CCC(C)(C)CC=1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 Chemical compound C1C[C@@H](OC)CC[C@@H]1N(C1=C(SC(=C1)C=1CCC(C)(C)CC=1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 FBOBFRVOSFIYOQ-XHPGVBHPSA-N 0.000 claims description 2
- JFUHFSBVZUPBIF-IKYFGSHTSA-N C1C[C@@H](OC)CC[C@@H]1N(C1=C(SC(=C1)C=1CCC(CC=1)C(F)(F)F)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 Chemical compound C1C[C@@H](OC)CC[C@@H]1N(C1=C(SC(=C1)C=1CCC(CC=1)C(F)(F)F)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 JFUHFSBVZUPBIF-IKYFGSHTSA-N 0.000 claims description 2
- AMOXNTAMLUCWJT-ZULOPVSISA-N C1C[C@@H](OC)CC[C@H]1N(C1=C(SC(=C1)C1CCC(C)(C)CC1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 Chemical compound C1C[C@@H](OC)CC[C@H]1N(C1=C(SC(=C1)C1CCC(C)(C)CC1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 AMOXNTAMLUCWJT-ZULOPVSISA-N 0.000 claims description 2
- ARGZTWUXBRUFQC-GUJRETQESA-N C1C[C@@H](OCOCC)CC[C@@H]1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 Chemical compound C1C[C@@H](OCOCC)CC[C@@H]1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 ARGZTWUXBRUFQC-GUJRETQESA-N 0.000 claims description 2
- QVBYCKAQILQSKF-KESTWPANSA-N C[C@H](CC1)CC[C@@H]1C(N(C1CC[N+](C)(C)CC1)C1=C(C([O-])=O)SC(C2=CCCCC2)=C1)=O Chemical compound C[C@H](CC1)CC[C@@H]1C(N(C1CC[N+](C)(C)CC1)C1=C(C([O-])=O)SC(C2=CCCCC2)=C1)=O QVBYCKAQILQSKF-KESTWPANSA-N 0.000 claims description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 2
- 108090000626 DNA-directed RNA polymerases Proteins 0.000 claims description 2
- 102000004163 DNA-directed RNA polymerases Human genes 0.000 claims description 2
- 208000005176 Hepatitis C Diseases 0.000 claims description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 2
- WMQSAOFWTROXBO-AFFTWYSYSA-N [Cl-].C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(=O)OCOC(=O)C(C)(C)C)C1CC[NH+](C)CC1 Chemical compound [Cl-].C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(=O)OCOC(=O)C(C)(C)C)C1CC[NH+](C)CC1 WMQSAOFWTROXBO-AFFTWYSYSA-N 0.000 claims description 2
- 125000002393 azetidinyl group Chemical group 0.000 claims description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims description 2
- 229910052791 calcium Inorganic materials 0.000 claims description 2
- 239000011575 calcium Substances 0.000 claims description 2
- 229960001231 choline Drugs 0.000 claims description 2
- 125000004188 dichlorophenyl group Chemical group 0.000 claims description 2
- 125000000532 dioxanyl group Chemical group 0.000 claims description 2
- 229910052749 magnesium Inorganic materials 0.000 claims description 2
- 239000011777 magnesium Substances 0.000 claims description 2
- 229910052700 potassium Inorganic materials 0.000 claims description 2
- 239000011591 potassium Substances 0.000 claims description 2
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 claims description 2
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 claims description 2
- 229960000281 trometamol Drugs 0.000 claims description 2
- 125000006656 (C2-C4) alkenyl group Chemical group 0.000 claims 21
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims 7
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims 6
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical group C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 claims 4
- 125000004404 heteroalkyl group Chemical group 0.000 claims 3
- 125000003107 substituted aryl group Chemical group 0.000 claims 3
- CMBPRRDJOSJOPZ-UHFFFAOYSA-N 5-(4-tert-butylcyclohexen-1-yl)-3-[(4-hydroxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid Chemical compound C1CC(C)CCC1C(=O)N(C1=C(SC(=C1)C=1CCC(CC=1)C(C)(C)C)C(O)=O)C1CCC(O)CC1 CMBPRRDJOSJOPZ-UHFFFAOYSA-N 0.000 claims 2
- VRCATWVIEHHTHZ-UHFFFAOYSA-N 5-(cyclohexen-1-yl)-3-[cyclohexyl-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid Chemical compound C1CC(C)CCC1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCCCC1 VRCATWVIEHHTHZ-UHFFFAOYSA-N 0.000 claims 2
- CHSWOVCXLYDIIY-UHFFFAOYSA-N 5-(cyclopenten-1-yl)-3-[(2,4-dichlorobenzoyl)-propan-2-ylamino]thiophene-2-carboxylic acid Chemical compound C1=C(C=2CCCC=2)SC(C(O)=O)=C1N(C(C)C)C(=O)C1=CC=C(Cl)C=C1Cl CHSWOVCXLYDIIY-UHFFFAOYSA-N 0.000 claims 2
- AIPXYNJQICQCPP-QFLLTADKSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1C2CCC(C2)C1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1C2CCC(C2)C1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 AIPXYNJQICQCPP-QFLLTADKSA-N 0.000 claims 2
- QHSXCGCAECGORC-LWLBLJAOSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1C=CC(C)CC1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1C=CC(C)CC1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 QHSXCGCAECGORC-LWLBLJAOSA-N 0.000 claims 2
- JZZHJWYJGBDGPG-BRWVVXTDSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CC=C(C)CC1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CC=C(C)CC1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 JZZHJWYJGBDGPG-BRWVVXTDSA-N 0.000 claims 2
- JFNVYOKGZLDNAH-KQEUCTNFSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CC=CCC1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CC=CCC1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 JFNVYOKGZLDNAH-KQEUCTNFSA-N 0.000 claims 2
- IUWYBOFGGDTQOR-KHBPEBPSSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCC(CC1)OC=1C=CC=CC=1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCC(CC1)OC=1C=CC=CC=1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 IUWYBOFGGDTQOR-KHBPEBPSSA-N 0.000 claims 2
- PAMOIOVTAUVDIT-PWZZDWAZSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCC(CC=1)C=1C=CC=CC=1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCC(CC=1)C=1C=CC=CC=1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 PAMOIOVTAUVDIT-PWZZDWAZSA-N 0.000 claims 2
- OZNMZONMPKBECR-GFKXMWDQSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCC2(C(N(C)C(=O)N2C)=O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCC2(C(N(C)C(=O)N2C)=O)CC1 OZNMZONMPKBECR-GFKXMWDQSA-N 0.000 claims 2
- MGIDOELNCIGRPO-IXXJFMHHSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)[C@H]1CC[C@@H](O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)[C@H]1CC[C@@H](O)CC1 MGIDOELNCIGRPO-IXXJFMHHSA-N 0.000 claims 2
- 102100037486 Reverse transcriptase/ribonuclease H Human genes 0.000 claims 2
- QMPSPZPLWQPLNV-UHFFFAOYSA-N 5-(cyclohexen-1-yl)-3-[[1-(2,2-difluoroethyl)piperidin-4-yl]-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid Chemical compound C1CC(C)CCC1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCN(CC(F)F)CC1 QMPSPZPLWQPLNV-UHFFFAOYSA-N 0.000 claims 1
- KSKQKUXDUAQBNC-UHFFFAOYSA-N 5-(cyclohexen-1-yl)-3-[[4-[(1-methoxy-2-methylpropyl)carbamoyloxy]cyclohexyl]-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid Chemical compound C1CC(OC(=O)NC(OC)C(C)C)CCC1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)C1CCC(C)CC1 KSKQKUXDUAQBNC-UHFFFAOYSA-N 0.000 claims 1
- XSKWKTVUQVYCKD-NHZVSXMUSA-N C1C(=N/OCC)\CCC(C=2SC(=C(N([C@@H]3CC[C@@H](O)CC3)C(=O)[C@@H]3CC[C@@H](C)CC3)C=2)C(O)=O)=C1 Chemical compound C1C(=N/OCC)\CCC(C=2SC(=C(N([C@@H]3CC[C@@H](O)CC3)C(=O)[C@@H]3CC[C@@H](C)CC3)C=2)C(O)=O)=C1 XSKWKTVUQVYCKD-NHZVSXMUSA-N 0.000 claims 1
- UKRVVPIKBGFVNT-RPCDJPHFSA-N C1CC(N(C)C(=O)CC)CCC1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 Chemical compound C1CC(N(C)C(=O)CC)CCC1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 UKRVVPIKBGFVNT-RPCDJPHFSA-N 0.000 claims 1
- MMKZHFVOWJFVHI-KESTWPANSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCC(C)(C)CC1)C(O)=O)C1CCN(C)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCC(C)(C)CC1)C(O)=O)C1CCN(C)CC1 MMKZHFVOWJFVHI-KESTWPANSA-N 0.000 claims 1
- URPYXASENBMACD-GUJRETQESA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCC(C)(C)CC1)C(O)=O)[C@@H]1CC[C@@H](N2N=CN=C2)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCC(C)(C)CC1)C(O)=O)[C@@H]1CC[C@@H](N2N=CN=C2)CC1 URPYXASENBMACD-GUJRETQESA-N 0.000 claims 1
- GTZZCRIWNBVETM-GUJRETQESA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCC(C)(C)CC1)C(O)=O)[C@@H]1CC[C@@H](N2N=NC=C2)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCC(C)(C)CC1)C(O)=O)[C@@H]1CC[C@@H](N2N=NC=C2)CC1 GTZZCRIWNBVETM-GUJRETQESA-N 0.000 claims 1
- URPYXASENBMACD-FORLXOICSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCC(C)(C)CC1)C(O)=O)[C@@H]1CC[C@H](N2N=CN=C2)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCC(C)(C)CC1)C(O)=O)[C@@H]1CC[C@H](N2N=CN=C2)CC1 URPYXASENBMACD-FORLXOICSA-N 0.000 claims 1
- BVXHTXRVCMTCJW-LWLBLJAOSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCC(C)CC1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCC(C)CC1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 BVXHTXRVCMTCJW-LWLBLJAOSA-N 0.000 claims 1
- KEFGYEBMBUZYLK-QEYNBREGSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1C2CCC(C2)C=1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1C2CCC(C2)C=1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 KEFGYEBMBUZYLK-QEYNBREGSA-N 0.000 claims 1
- UFAKXAOJOPWWCD-GUJRETQESA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCC(C)(C)CC=1)C(O)=O)[C@@H]1CC[C@@H](N2N=CN=C2)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCC(C)(C)CC=1)C(O)=O)[C@@H]1CC[C@@H](N2N=CN=C2)CC1 UFAKXAOJOPWWCD-GUJRETQESA-N 0.000 claims 1
- NINQOJCMYBIHMF-KCFDPAHWSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCC(C)CC=1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCC(C)CC=1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 NINQOJCMYBIHMF-KCFDPAHWSA-N 0.000 claims 1
- USXOSXKMNUPPNO-JOSYPBKRSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCC2CCCCC2C=1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCC2CCCCC2C=1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 USXOSXKMNUPPNO-JOSYPBKRSA-N 0.000 claims 1
- QMKHTEOIBBSGKN-WHLIJDCNSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CC(C2)CCC2C1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CC(C2)CCC2C1 QMKHTEOIBBSGKN-WHLIJDCNSA-N 0.000 claims 1
- AHIZAJIZSMUYKS-KESTWPANSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCN(CCF)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCN(CCF)CC1 AHIZAJIZSMUYKS-KESTWPANSA-N 0.000 claims 1
- NTQRCGGRNOJNJD-UAPYVXQJSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCN(S(C)(=O)=O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCN(S(C)(=O)=O)CC1 NTQRCGGRNOJNJD-UAPYVXQJSA-N 0.000 claims 1
- SATLBJQBKFNRNL-VYUAXZJKSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)[C@@H]1CC[C@@H](C#N)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)[C@@H]1CC[C@@H](C#N)CC1 SATLBJQBKFNRNL-VYUAXZJKSA-N 0.000 claims 1
- KCFLNRBBFVETGB-VJVRBHMKSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)[C@@H]1CC[C@@H](C=2NN=NN=2)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)[C@@H]1CC[C@@H](C=2NN=NN=2)CC1 KCFLNRBBFVETGB-VJVRBHMKSA-N 0.000 claims 1
- QPTQPRHLMQYGHB-XHPGVBHPSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)[C@@H]1CC[C@@H](N2N=CN=C2)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)[C@@H]1CC[C@@H](N2N=CN=C2)CC1 QPTQPRHLMQYGHB-XHPGVBHPSA-N 0.000 claims 1
- BZOWKCOXOYJPPR-XHPGVBHPSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)[C@@H]1CC[C@@H](N2N=NC=C2)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)[C@@H]1CC[C@@H](N2N=NC=C2)CC1 BZOWKCOXOYJPPR-XHPGVBHPSA-N 0.000 claims 1
- QPTQPRHLMQYGHB-ZULOPVSISA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)[C@@H]1CC[C@H](N2N=CN=C2)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)[C@@H]1CC[C@H](N2N=CN=C2)CC1 QPTQPRHLMQYGHB-ZULOPVSISA-N 0.000 claims 1
- BZOWKCOXOYJPPR-ZULOPVSISA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)[C@@H]1CC[C@H](N2N=NC=C2)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)[C@@H]1CC[C@H](N2N=NC=C2)CC1 BZOWKCOXOYJPPR-ZULOPVSISA-N 0.000 claims 1
- SATLBJQBKFNRNL-ICNBMTIMSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)[C@H]1CC[C@@H](C#N)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)[C@H]1CC[C@@H](C#N)CC1 SATLBJQBKFNRNL-ICNBMTIMSA-N 0.000 claims 1
- AHQGMPPSKUDUDL-IXXJFMHHSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)[C@H]1CC[C@@H](F)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)[C@H]1CC[C@@H](F)CC1 AHQGMPPSKUDUDL-IXXJFMHHSA-N 0.000 claims 1
- XLJOUVDPWPSXDM-VYUAXZJKSA-N C1C[C@@H](C)CC[C@@H]1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 XLJOUVDPWPSXDM-VYUAXZJKSA-N 0.000 claims 1
- OVTIYPJPKHHYCK-GUJRETQESA-N C1C[C@@H](NC(=O)C(C)C)CC[C@@H]1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 Chemical compound C1C[C@@H](NC(=O)C(C)C)CC[C@@H]1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 OVTIYPJPKHHYCK-GUJRETQESA-N 0.000 claims 1
- OVTIYPJPKHHYCK-FORLXOICSA-N C1C[C@@H](NC(=O)C(C)C)CC[C@H]1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 Chemical compound C1C[C@@H](NC(=O)C(C)C)CC[C@H]1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 OVTIYPJPKHHYCK-FORLXOICSA-N 0.000 claims 1
- LNYKGELUODVSNS-HMYFDTNDSA-N C1C[C@@H](OC)CC[C@H]1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)C1CCC(C)CC1 Chemical compound C1C[C@@H](OC)CC[C@H]1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)C1CCC(C)CC1 LNYKGELUODVSNS-HMYFDTNDSA-N 0.000 claims 1
- YUIXIDHCLFDQRR-XHPGVBHPSA-N C1C[C@@H](OCSC)CC[C@@H]1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 Chemical compound C1C[C@@H](OCSC)CC[C@@H]1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 YUIXIDHCLFDQRR-XHPGVBHPSA-N 0.000 claims 1
- SNLFZVXDVWBLJR-FFPCIGOZSA-N [Cl-].C1(=CCCCC1)C1=CC(=C(S1)C(=O)OC)N(C1CC[NH+](CC1)C)C(=O)[C@@H]1CC[C@H](CC1)C Chemical compound [Cl-].C1(=CCCCC1)C1=CC(=C(S1)C(=O)OC)N(C1CC[NH+](CC1)C)C(=O)[C@@H]1CC[C@H](CC1)C SNLFZVXDVWBLJR-FFPCIGOZSA-N 0.000 claims 1
- HLLIYDVPIGSIJX-AFFTWYSYSA-N [Cl-].CC(C)OC(=O)OCOC(=O)C=1SC(C=2CCCCC=2)=CC=1N(C(=O)[C@@H]1CC[C@@H](C)CC1)C1CC[NH+](C)CC1 Chemical compound [Cl-].CC(C)OC(=O)OCOC(=O)C=1SC(C=2CCCCC=2)=CC=1N(C(=O)[C@@H]1CC[C@@H](C)CC1)C1CC[NH+](C)CC1 HLLIYDVPIGSIJX-AFFTWYSYSA-N 0.000 claims 1
- RGOXDVCFLLPALO-UHFFFAOYSA-N azanium;5-(cyclohexen-1-yl)-3-[(4-methylcyclohexanecarbonyl)-[1-(pyridin-3-ylmethyl)piperidin-4-yl]amino]thiophene-2-carboxylate Chemical compound [NH4+].C1CC(C)CCC1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C([O-])=O)C1CCN(CC=2C=NC=CC=2)CC1 RGOXDVCFLLPALO-UHFFFAOYSA-N 0.000 claims 1
- WPLOVIFNBMNBPD-ATHMIXSHSA-N subtilin Chemical compound CC1SCC(NC2=O)C(=O)NC(CC(N)=O)C(=O)NC(C(=O)NC(CCCCN)C(=O)NC(C(C)CC)C(=O)NC(=C)C(=O)NC(CCCCN)C(O)=O)CSC(C)C2NC(=O)C(CC(C)C)NC(=O)C1NC(=O)C(CCC(N)=O)NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C1NC(=O)C(=C/C)/NC(=O)C(CCC(N)=O)NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)CNC(=O)C(NC(=O)C(NC(=O)C2NC(=O)CNC(=O)C3CCCN3C(=O)C(NC(=O)C3NC(=O)C(CC(C)C)NC(=O)C(=C)NC(=O)C(CCC(O)=O)NC(=O)C(NC(=O)C(CCCCN)NC(=O)C(N)CC=4C5=CC=CC=C5NC=4)CSC3)C(C)SC2)C(C)C)C(C)SC1)CC1=CC=CC=C1 WPLOVIFNBMNBPD-ATHMIXSHSA-N 0.000 claims 1
- 206010051511 Viral diarrhoea Diseases 0.000 abstract 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 256
- 239000000203 mixture Substances 0.000 description 185
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 170
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 149
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 146
- 239000000243 solution Substances 0.000 description 133
- 235000019439 ethyl acetate Nutrition 0.000 description 109
- 229910001868 water Inorganic materials 0.000 description 80
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 71
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 69
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 61
- 239000011541 reaction mixture Substances 0.000 description 54
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 51
- 229910052938 sodium sulfate Inorganic materials 0.000 description 51
- 235000011152 sodium sulphate Nutrition 0.000 description 51
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 49
- 239000007787 solid Substances 0.000 description 49
- 239000007832 Na2SO4 Substances 0.000 description 47
- 239000012267 brine Substances 0.000 description 41
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 41
- 239000000741 silica gel Substances 0.000 description 39
- 229910002027 silica gel Inorganic materials 0.000 description 39
- 229960001866 silicon dioxide Drugs 0.000 description 39
- 239000003480 eluent Substances 0.000 description 37
- 230000002829 reductive effect Effects 0.000 description 37
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 36
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 36
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 36
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 35
- NKLCHDQGUHMCGL-UHFFFAOYSA-N cyclohexylidenemethanone Chemical group O=C=C1CCCCC1 NKLCHDQGUHMCGL-UHFFFAOYSA-N 0.000 description 33
- 238000002360 preparation method Methods 0.000 description 29
- 238000004440 column chromatography Methods 0.000 description 27
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 26
- 239000002904 solvent Substances 0.000 description 25
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 24
- 238000010898 silica gel chromatography Methods 0.000 description 24
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 21
- 238000000746 purification Methods 0.000 description 19
- 229940047124 interferons Drugs 0.000 description 18
- 239000000543 intermediate Substances 0.000 description 18
- 239000000725 suspension Substances 0.000 description 18
- 238000006243 chemical reaction Methods 0.000 description 17
- 238000004587 chromatography analysis Methods 0.000 description 15
- 238000004128 high performance liquid chromatography Methods 0.000 description 15
- 239000012044 organic layer Substances 0.000 description 15
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 15
- DTQVDTLACAAQTR-UHFFFAOYSA-N trifluoroacetic acid Substances OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 15
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 14
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 description 14
- 235000017557 sodium bicarbonate Nutrition 0.000 description 14
- 239000002253 acid Substances 0.000 description 13
- 239000004480 active ingredient Substances 0.000 description 13
- 239000010410 layer Substances 0.000 description 13
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 13
- 235000019341 magnesium sulphate Nutrition 0.000 description 13
- 125000001624 naphthyl group Chemical group 0.000 description 13
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 12
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 12
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 12
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical class [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 11
- 125000003302 alkenyloxy group Chemical group 0.000 description 11
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 11
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 11
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 11
- 229910000104 sodium hydride Inorganic materials 0.000 description 11
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 10
- 238000001914 filtration Methods 0.000 description 10
- 150000004702 methyl esters Chemical class 0.000 description 10
- 239000000047 product Substances 0.000 description 10
- 238000010992 reflux Methods 0.000 description 10
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- 239000002585 base Substances 0.000 description 9
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 8
- 239000007864 aqueous solution Substances 0.000 description 8
- 239000000706 filtrate Substances 0.000 description 8
- 239000006260 foam Substances 0.000 description 8
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 8
- 150000002576 ketones Chemical class 0.000 description 8
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 8
- 239000000843 powder Substances 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 7
- NFHFRUOZVGFOOS-UHFFFAOYSA-N Pd(PPh3)4 Substances [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 7
- PYRZPBDTPRQYKG-UHFFFAOYSA-N cyclopentene-1-carboxylic acid Chemical compound OC(=O)C1=CCCC1 PYRZPBDTPRQYKG-UHFFFAOYSA-N 0.000 description 7
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 7
- 125000004076 pyridyl group Chemical group 0.000 description 7
- ODYARUXXIJYYNA-UHFFFAOYSA-N 4-methylcyclohexane-1-carbonyl chloride Chemical compound CC1CCC(C(Cl)=O)CC1 ODYARUXXIJYYNA-UHFFFAOYSA-N 0.000 description 6
- QTDXSEZXAPHVBI-UHFFFAOYSA-N 4-methylcyclohexane-1-carboxylic acid Chemical compound CC1CCC(C(O)=O)CC1 QTDXSEZXAPHVBI-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 6
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 6
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 6
- 239000013058 crude material Substances 0.000 description 6
- RJGHQTVXGKYATR-UHFFFAOYSA-L dibutyl(dichloro)stannane Chemical compound CCCC[Sn](Cl)(Cl)CCCC RJGHQTVXGKYATR-UHFFFAOYSA-L 0.000 description 6
- 239000007788 liquid Substances 0.000 description 6
- HCPWLJURHZATCV-UHFFFAOYSA-N methyl 5-(cyclohexen-1-yl)-3-[(4-methylcyclohexanecarbonyl)-piperidin-4-ylamino]thiophene-2-carboxylate Chemical compound COC(=O)C=1SC(C=2CCCCC=2)=CC=1N(C(=O)C1CCC(C)CC1)C1CCNCC1 HCPWLJURHZATCV-UHFFFAOYSA-N 0.000 description 6
- MXZRZTHTXZXYIZ-UHFFFAOYSA-N methyl 5-bromo-3-[(4-hydroxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylate Chemical compound S1C(Br)=CC(N(C2CCC(O)CC2)C(=O)C2CCC(C)CC2)=C1C(=O)OC MXZRZTHTXZXYIZ-UHFFFAOYSA-N 0.000 description 6
- 239000012074 organic phase Substances 0.000 description 6
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 6
- 125000006239 protecting group Chemical group 0.000 description 6
- 239000006188 syrup Substances 0.000 description 6
- 235000020357 syrup Nutrition 0.000 description 6
- QERYCTSHXKAMIS-UHFFFAOYSA-N thiophene-2-carboxylic acid Chemical compound OC(=O)C1=CC=CS1 QERYCTSHXKAMIS-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N EtOH Substances CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 5
- 101710144128 Non-structural protein 2 Proteins 0.000 description 5
- 101710199667 Nuclear export protein Proteins 0.000 description 5
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 5
- 229940122055 Serine protease inhibitor Drugs 0.000 description 5
- 101710102218 Serine protease inhibitor Proteins 0.000 description 5
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 5
- 235000019270 ammonium chloride Nutrition 0.000 description 5
- 150000002148 esters Chemical class 0.000 description 5
- 125000005843 halogen group Chemical group 0.000 description 5
- 208000015181 infectious disease Diseases 0.000 description 5
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 5
- 239000000377 silicon dioxide Substances 0.000 description 5
- 235000017550 sodium carbonate Nutrition 0.000 description 5
- 229910000029 sodium carbonate Inorganic materials 0.000 description 5
- 239000012312 sodium hydride Substances 0.000 description 5
- FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 5
- 125000001544 thienyl group Chemical group 0.000 description 5
- 238000005406 washing Methods 0.000 description 5
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 4
- 229940121759 Helicase inhibitor Drugs 0.000 description 4
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical compound NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 description 4
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 4
- 102000035195 Peptidases Human genes 0.000 description 4
- WFDIJRYMOXRFFG-UHFFFAOYSA-N acetic acid anhydride Natural products CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 4
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 4
- 230000005587 bubbling Effects 0.000 description 4
- 239000000969 carrier Substances 0.000 description 4
- 229940043279 diisopropylamine Drugs 0.000 description 4
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- 238000009472 formulation Methods 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- 238000001802 infusion Methods 0.000 description 4
- SVQDIBDRCYBDIN-UHFFFAOYSA-N methyl 5-bromo-3-[(4-methylcyclohexanecarbonyl)-(4-oxocyclohexyl)amino]thiophene-2-carboxylate Chemical compound S1C(Br)=CC(N(C2CCC(=O)CC2)C(=O)C2CCC(C)CC2)=C1C(=O)OC SVQDIBDRCYBDIN-UHFFFAOYSA-N 0.000 description 4
- 125000002950 monocyclic group Chemical group 0.000 description 4
- 239000003921 oil Substances 0.000 description 4
- 239000012071 phase Substances 0.000 description 4
- 125000000168 pyrrolyl group Chemical group 0.000 description 4
- 229910052705 radium Inorganic materials 0.000 description 4
- 229910052701 rubidium Inorganic materials 0.000 description 4
- 239000012279 sodium borohydride Substances 0.000 description 4
- 229910000033 sodium borohydride Inorganic materials 0.000 description 4
- 239000007921 spray Substances 0.000 description 4
- 239000000375 suspending agent Substances 0.000 description 4
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 3
- VKRKCBWIVLSRBJ-UHFFFAOYSA-N 1,4-dioxaspiro[4.5]decan-8-one Chemical compound C1CC(=O)CCC21OCCO2 VKRKCBWIVLSRBJ-UHFFFAOYSA-N 0.000 description 3
- XSLHQJJTBVYMJX-UHFFFAOYSA-N 1,4-dioxaspiro[4.5]decan-8-yl methanesulfonate Chemical compound C1CC(OS(=O)(=O)C)CCC21OCCO2 XSLHQJJTBVYMJX-UHFFFAOYSA-N 0.000 description 3
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 3
- AHQGMPPSKUDUDL-UHFFFAOYSA-N 5-(cyclohexen-1-yl)-3-[(4-fluorocyclohexyl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid Chemical compound C1CC(C)CCC1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCC(F)CC1 AHQGMPPSKUDUDL-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 125000006374 C2-C10 alkenyl group Chemical group 0.000 description 3
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 3
- 241000764238 Isis Species 0.000 description 3
- 238000005684 Liebig rearrangement reaction Methods 0.000 description 3
- 241000124008 Mammalia Species 0.000 description 3
- 244000061176 Nicotiana tabacum Species 0.000 description 3
- 235000002637 Nicotiana tabacum Nutrition 0.000 description 3
- 102000012479 Serine Proteases Human genes 0.000 description 3
- 108010022999 Serine Proteases Proteins 0.000 description 3
- 239000012298 atmosphere Substances 0.000 description 3
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 3
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 3
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 3
- 229910000024 caesium carbonate Inorganic materials 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 239000006071 cream Substances 0.000 description 3
- XZWQKJXJNKYMAP-UHFFFAOYSA-N cyclohexen-1-ylboronic acid Chemical compound OB(O)C1=CCCCC1 XZWQKJXJNKYMAP-UHFFFAOYSA-N 0.000 description 3
- WGLUMOCWFMKWIL-UHFFFAOYSA-N dichloromethane;methanol Chemical compound OC.ClCCl WGLUMOCWFMKWIL-UHFFFAOYSA-N 0.000 description 3
- CSJLBAMHHLJAAS-UHFFFAOYSA-N diethylaminosulfur trifluoride Chemical compound CCN(CC)S(F)(F)F CSJLBAMHHLJAAS-UHFFFAOYSA-N 0.000 description 3
- 239000002270 dispersing agent Substances 0.000 description 3
- 239000002552 dosage form Substances 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 3
- 125000002541 furyl group Chemical group 0.000 description 3
- 208000006454 hepatitis Diseases 0.000 description 3
- 231100000283 hepatitis Toxicity 0.000 description 3
- 125000001041 indolyl group Chemical group 0.000 description 3
- 239000004615 ingredient Substances 0.000 description 3
- 238000001990 intravenous administration Methods 0.000 description 3
- GLXDVVHUTZTUQK-UHFFFAOYSA-M lithium;hydroxide;hydrate Chemical compound [Li+].O.[OH-] GLXDVVHUTZTUQK-UHFFFAOYSA-M 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- JGHMTFPYGOMSIB-UHFFFAOYSA-N methyl 3-[1,4-dioxaspiro[4.5]decan-8-yl-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylate Chemical compound S1C=CC(N(C2CCC3(CC2)OCCO3)C(=O)C2CCC(C)CC2)=C1C(=O)OC JGHMTFPYGOMSIB-UHFFFAOYSA-N 0.000 description 3
- XYRRRTDDQUCNQM-UHFFFAOYSA-N methyl 3-amino-5-(cyclohexen-1-yl)thiophene-2-carboxylate Chemical compound NC1=C(C(=O)OC)SC(C=2CCCCC=2)=C1 XYRRRTDDQUCNQM-UHFFFAOYSA-N 0.000 description 3
- RZYLOBBUEWSONL-UHFFFAOYSA-N methyl 3-amino-5-bromothiophene-2-carboxylate Chemical compound COC(=O)C=1SC(Br)=CC=1N RZYLOBBUEWSONL-UHFFFAOYSA-N 0.000 description 3
- GFOIAINHMGKDME-UHFFFAOYSA-N methyl 5-(cyclohexen-1-yl)-3-[(4-hydroxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylate Chemical compound COC(=O)C=1SC(C=2CCCCC=2)=CC=1N(C(=O)C1CCC(C)CC1)C1CCC(O)CC1 GFOIAINHMGKDME-UHFFFAOYSA-N 0.000 description 3
- VONOFJWOVOTLIO-UHFFFAOYSA-N methyl 5-bromo-3-[(4-fluorocyclohexyl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylate Chemical compound S1C(Br)=CC(N(C2CCC(F)CC2)C(=O)C2CCC(C)CC2)=C1C(=O)OC VONOFJWOVOTLIO-UHFFFAOYSA-N 0.000 description 3
- 230000003287 optical effect Effects 0.000 description 3
- 125000002971 oxazolyl group Chemical group 0.000 description 3
- PARWUHTVGZSQPD-UHFFFAOYSA-N phenylsilane Chemical compound [SiH3]C1=CC=CC=C1 PARWUHTVGZSQPD-UHFFFAOYSA-N 0.000 description 3
- 125000003367 polycyclic group Chemical group 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 238000002953 preparative HPLC Methods 0.000 description 3
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 3
- 229910052702 rhenium Inorganic materials 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- 239000003826 tablet Substances 0.000 description 3
- 229940086542 triethylamine Drugs 0.000 description 3
- CYPYTURSJDMMMP-WVCUSYJESA-N (1e,4e)-1,5-diphenylpenta-1,4-dien-3-one;palladium Chemical compound [Pd].[Pd].C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1 CYPYTURSJDMMMP-WVCUSYJESA-N 0.000 description 2
- PCXQRRQONBYBHO-UHFFFAOYSA-N (4-phenoxycyclohexen-1-yl) trifluoromethanesulfonate Chemical compound C1CC(OS(=O)(=O)C(F)(F)F)=CCC1OC1=CC=CC=C1 PCXQRRQONBYBHO-UHFFFAOYSA-N 0.000 description 2
- YQYGGOPUTPQHAY-KIQLFZLRSA-N (4S)-4-[[(2S)-2-[[(2S)-2-[2-[6-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S,3S)-1-[[(2S)-5-amino-1-[[(4S,7R)-7-[[(2S)-1-[(2S)-6-amino-2-[[(2R)-2-[[(2S)-5-amino-2-[[(2S,3R)-2-[[(2S)-6-amino-2-[[(2S)-4-carboxy-2-hydrazinylbutanoyl]amino]hexanoyl]amino]-3-methylpentanoyl]amino]-5-oxopentanoyl]amino]propanoyl]amino]hexanoyl]pyrrolidine-2-carbonyl]amino]-2-methyl-5,6-dioxooctan-4-yl]amino]-1,5-dioxopentan-2-yl]amino]-3-hydroxy-1-oxobutan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-5-carbamimidamido-1-oxopentan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-5-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S,3S)-2-[[(2S)-4-amino-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-4-oxobutanoyl]amino]-3-hydroxybutanoyl]amino]-3-hydroxypropanoyl]amino]-4-carboxybutanoyl]amino]-3-hydroxypropanoyl]amino]-3-phenylpropanoyl]amino]-6-oxohexyl]hydrazinyl]-3-phenylpropanoyl]amino]-3-hydroxypropanoyl]amino]-5-[[(2S)-1-[[(2S,3S)-1-[[(2S)-4-amino-1-[[(2S)-1-hydroxy-3-oxopropan-2-yl]amino]-1,4-dioxobutan-2-yl]amino]-3-hydroxy-1-oxobutan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-5-oxopentanoic acid Chemical compound CC[C@@H](C)[C@H](NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCC(O)=O)NN)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@H](C)C(=O)N[C@@H](CCCCN)C(=O)N1CCC[C@H]1C(=O)N[C@H](C)C(=O)C(=O)[C@H](CC(C)C)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](Cc1ccccc1)NC(=O)C(CCCCNN[C@@H](Cc1ccccc1)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H]([C@H](C)O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C=O)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CO)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H](N)CO)[C@H](C)O)C(C)C)[C@H](C)O YQYGGOPUTPQHAY-KIQLFZLRSA-N 0.000 description 2
- 125000000008 (C1-C10) alkyl group Chemical group 0.000 description 2
- 108091032973 (ribonucleotides)n+m Proteins 0.000 description 2
- WDXCZWJQOFPQOS-UHFFFAOYSA-N 1,4-dioxaspiro[4.5]dec-7-en-8-ylboronic acid Chemical compound C1CC(B(O)O)=CCC21OCCO2 WDXCZWJQOFPQOS-UHFFFAOYSA-N 0.000 description 2
- WZWQNWWFCHNJON-UHFFFAOYSA-N 1,4-dioxaspiro[4.5]decane-8-carbonitrile Chemical compound C1CC(C#N)CCC21OCCO2 WZWQNWWFCHNJON-UHFFFAOYSA-N 0.000 description 2
- FTXBKFXPNSRBDW-UHFFFAOYSA-N 1-(1,4-dioxaspiro[4.5]decan-8-yl)-1,2,4-triazole Chemical compound O1CCOC11CCC(N2N=CN=C2)CC1 FTXBKFXPNSRBDW-UHFFFAOYSA-N 0.000 description 2
- VDNFJEDSFOJTFV-UHFFFAOYSA-N 1-(1,4-dioxaspiro[4.5]decan-8-yl)triazole Chemical compound O1CCOC11CCC(N2N=NC=C2)CC1 VDNFJEDSFOJTFV-UHFFFAOYSA-N 0.000 description 2
- STPXIOFWKOIYHX-UHFFFAOYSA-N 1-methylcyclohexane-1-carbonyl chloride Chemical compound ClC(=O)C1(C)CCCCC1 STPXIOFWKOIYHX-UHFFFAOYSA-N 0.000 description 2
- 238000005160 1H NMR spectroscopy Methods 0.000 description 2
- QVDOCNRIQLYHGK-UHFFFAOYSA-N 2,4-dimethyl-9,12-dioxa-2,4-diazadispiro[4.2.4^{8}.2^{5}]tetradecan-3-one Chemical compound CN1C(=O)N(C)CC11CCC2(OCCO2)CC1 QVDOCNRIQLYHGK-UHFFFAOYSA-N 0.000 description 2
- DGMOBVGABMBZSB-UHFFFAOYSA-N 2-methylpropanoyl chloride Chemical compound CC(C)C(Cl)=O DGMOBVGABMBZSB-UHFFFAOYSA-N 0.000 description 2
- 229960000549 4-dimethylaminophenol Drugs 0.000 description 2
- DZZLGMLLNNTZKL-UHFFFAOYSA-N 4-phenoxycyclohexan-1-one Chemical compound C1CC(=O)CCC1OC1=CC=CC=C1 DZZLGMLLNNTZKL-UHFFFAOYSA-N 0.000 description 2
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 2
- XEQYTVWTBFZWLU-UHFFFAOYSA-N 8-azido-1,4-dioxaspiro[4.5]decane Chemical compound C1CC(N=[N+]=[N-])CCC21OCCO2 XEQYTVWTBFZWLU-UHFFFAOYSA-N 0.000 description 2
- GTHRCIGLVKMIOM-UHFFFAOYSA-N 8-phenoxy-1,4-dioxaspiro[4.5]decane Chemical compound O1CCOC11CCC(OC=2C=CC=CC=2)CC1 GTHRCIGLVKMIOM-UHFFFAOYSA-N 0.000 description 2
- AMQIRCLQGYEIQA-UHFFFAOYSA-N 9,12-dioxa-2,4-diazadispiro[4.2.4^{8}.2^{5}]tetradecan-3-one Chemical compound N1C(=O)NCC11CCC2(OCCO2)CC1 AMQIRCLQGYEIQA-UHFFFAOYSA-N 0.000 description 2
- VJZBGDJWIYJHCU-UHFFFAOYSA-N 9,12-dioxa-2,4-diazadispiro[4.2.4^{8}.2^{5}]tetradecane-1,3-dione Chemical compound N1C(=O)NC(=O)C11CCC2(OCCO2)CC1 VJZBGDJWIYJHCU-UHFFFAOYSA-N 0.000 description 2
- NUPNYQFGLIQQGM-UHFFFAOYSA-N 9,12-dioxa-3-azadispiro[4.2.4^{8}.2^{5}]tetradecan-2-one Chemical compound C1NC(=O)CC21CCC1(OCCO1)CC2 NUPNYQFGLIQQGM-UHFFFAOYSA-N 0.000 description 2
- 102100036475 Alanine aminotransferase 1 Human genes 0.000 description 2
- 108010082126 Alanine transaminase Proteins 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical class N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical compound [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 description 2
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 2
- FDVDLESUSZKVIW-YBJLBLLESA-N C1C[C@@H](OC)CC[C@@H]1N(C1=C(SC(=C1)C1CCC(=O)CC1)C(=O)OC)C(=O)[C@@H]1CC[C@@H](C)CC1 Chemical compound C1C[C@@H](OC)CC[C@@H]1N(C1=C(SC(=C1)C1CCC(=O)CC1)C(=O)OC)C(=O)[C@@H]1CC[C@@H](C)CC1 FDVDLESUSZKVIW-YBJLBLLESA-N 0.000 description 2
- GZPCNCMYPJUFCL-BIAGXBKMSA-N C1C[C@@H](OC)CC[C@@H]1N(C1=C(SC=C1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 Chemical compound C1C[C@@H](OC)CC[C@@H]1N(C1=C(SC=C1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 GZPCNCMYPJUFCL-BIAGXBKMSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 2
- 108010010803 Gelatin Proteins 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- 235000019766 L-Lysine Nutrition 0.000 description 2
- 240000007472 Leucaena leucocephala Species 0.000 description 2
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 2
- 239000004472 Lysine Substances 0.000 description 2
- 238000005481 NMR spectroscopy Methods 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- SZVJHZAAFAYPKX-GLNUWHKMSA-N O([C@H]1CC[C@@H](CC1)N(C=1C=C(SC=1C(=O)OC)C=1CCCC(O)C=1)C(=O)[C@@H]1CC[C@@H](C)CC1)C1CCCCO1 Chemical compound O([C@H]1CC[C@@H](CC1)N(C=1C=C(SC=1C(=O)OC)C=1CCCC(O)C=1)C(=O)[C@@H]1CC[C@@H](C)CC1)C1CCCCO1 SZVJHZAAFAYPKX-GLNUWHKMSA-N 0.000 description 2
- 229930040373 Paraformaldehyde Natural products 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- 238000006069 Suzuki reaction reaction Methods 0.000 description 2
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 2
- UCAVIHWWIOYPML-UHFFFAOYSA-N [1-(1,4-dioxaspiro[4.5]decan-8-yl)triazol-4-yl]-trimethylsilane Chemical compound N1=NC([Si](C)(C)C)=CN1C1CCC2(OCCO2)CC1 UCAVIHWWIOYPML-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000000443 aerosol Substances 0.000 description 2
- 125000003368 amide group Chemical group 0.000 description 2
- 235000001014 amino acid Nutrition 0.000 description 2
- 150000001413 amino acids Chemical class 0.000 description 2
- 239000001099 ammonium carbonate Substances 0.000 description 2
- 235000012501 ammonium carbonate Nutrition 0.000 description 2
- 125000004069 aziridinyl group Chemical group 0.000 description 2
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 2
- MUALRAIOVNYAIW-UHFFFAOYSA-N binap Chemical compound C1=CC=CC=C1P(C=1C(=C2C=CC=CC2=CC=1)C=1C2=CC=CC=C2C=CC=1P(C=1C=CC=CC=1)C=1C=CC=CC=1)C1=CC=CC=C1 MUALRAIOVNYAIW-UHFFFAOYSA-N 0.000 description 2
- 239000004305 biphenyl Substances 0.000 description 2
- 235000010290 biphenyl Nutrition 0.000 description 2
- 210000004369 blood Anatomy 0.000 description 2
- 239000008280 blood Substances 0.000 description 2
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 239000012230 colorless oil Substances 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- PQVSTLUFSYVLTO-UHFFFAOYSA-N ethyl n-ethoxycarbonylcarbamate Chemical compound CCOC(=O)NC(=O)OCC PQVSTLUFSYVLTO-UHFFFAOYSA-N 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- WBJINCZRORDGAQ-UHFFFAOYSA-N formic acid ethyl ester Natural products CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 description 2
- 238000004108 freeze drying Methods 0.000 description 2
- 230000006870 function Effects 0.000 description 2
- 239000008273 gelatin Substances 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 235000011852 gelatine desserts Nutrition 0.000 description 2
- 125000001188 haloalkyl group Chemical group 0.000 description 2
- 125000006038 hexenyl group Chemical group 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 230000002519 immonomodulatory effect Effects 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 230000000670 limiting effect Effects 0.000 description 2
- CDOSHBSSFJOMGT-UHFFFAOYSA-N linalool Chemical compound CC(C)=CCCC(C)(O)C=C CDOSHBSSFJOMGT-UHFFFAOYSA-N 0.000 description 2
- DLEDOFVPSDKWEF-UHFFFAOYSA-N lithium butane Chemical compound [Li+].CCC[CH2-] DLEDOFVPSDKWEF-UHFFFAOYSA-N 0.000 description 2
- 229940040692 lithium hydroxide monohydrate Drugs 0.000 description 2
- 239000006210 lotion Substances 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- ZXCYYTFNTVJHLH-UHFFFAOYSA-N methyl 2-[8-(nitromethyl)-1,4-dioxaspiro[4.5]decan-8-yl]acetate Chemical compound C1CC(CC(=O)OC)(C[N+]([O-])=O)CCC21OCCO2 ZXCYYTFNTVJHLH-UHFFFAOYSA-N 0.000 description 2
- CKHQMNWVACYRCJ-UHFFFAOYSA-N methyl 3-[(4-azidocyclohexyl)-(4-methylcyclohexanecarbonyl)amino]-5-(4,4-dimethylcyclohexyl)thiophene-2-carboxylate Chemical compound COC(=O)C=1SC(C2CCC(C)(C)CC2)=CC=1N(C(=O)C1CCC(C)CC1)C1CCC(N=[N+]=[N-])CC1 CKHQMNWVACYRCJ-UHFFFAOYSA-N 0.000 description 2
- DSQDEKDZRKDBNM-UHFFFAOYSA-N methyl 3-[(4-hydroxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]-5-(4-phenoxycyclohexen-1-yl)thiophene-2-carboxylate Chemical compound COC(=O)C=1SC(C=2CCC(CC=2)OC=2C=CC=CC=2)=CC=1N(C(=O)C1CCC(C)CC1)C1CCC(O)CC1 DSQDEKDZRKDBNM-UHFFFAOYSA-N 0.000 description 2
- GVIDKWMNFNCELI-UHFFFAOYSA-N methyl 3-[(4-hydroxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]-5-tributylstannylthiophene-2-carboxylate Chemical compound S1C([Sn](CCCC)(CCCC)CCCC)=CC(N(C2CCC(O)CC2)C(=O)C2CCC(C)CC2)=C1C(=O)OC GVIDKWMNFNCELI-UHFFFAOYSA-N 0.000 description 2
- FUFKLFUHAOZTRC-UHFFFAOYSA-N methyl 3-[(4-hydroxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylate Chemical compound S1C=CC(N(C2CCC(O)CC2)C(=O)C2CCC(C)CC2)=C1C(=O)OC FUFKLFUHAOZTRC-UHFFFAOYSA-N 0.000 description 2
- ARRVSKLKQXEQJW-UHFFFAOYSA-N methyl 3-[(4-methylcyclohexanecarbonyl)-[4-(oxan-2-yloxy)cyclohexyl]amino]thiophene-2-carboxylate Chemical compound S1C=CC(N(C2CCC(CC2)OC2OCCCC2)C(=O)C2CCC(C)CC2)=C1C(=O)OC ARRVSKLKQXEQJW-UHFFFAOYSA-N 0.000 description 2
- NSMUNRCXDBJSNW-UHFFFAOYSA-N methyl 3-[1,4-dioxaspiro[4.5]decan-8-yl-(4-methylcyclohexanecarbonyl)amino]-5-(1-hydroxy-4,4-dimethylcyclohexyl)thiophene-2-carboxylate Chemical compound COC(=O)C=1SC(C2(O)CCC(C)(C)CC2)=CC=1N(C(=O)C1CCC(C)CC1)C(CC1)CCC21OCCO2 NSMUNRCXDBJSNW-UHFFFAOYSA-N 0.000 description 2
- NKMNDFXAMGNIMF-UHFFFAOYSA-N methyl 3-bromo-5-(4,4-dimethylcyclohexen-1-yl)thiophene-2-carboxylate Chemical compound BrC1=C(C(=O)OC)SC(C=2CCC(C)(C)CC=2)=C1 NKMNDFXAMGNIMF-UHFFFAOYSA-N 0.000 description 2
- CXOZJRDPSBGTDT-UHFFFAOYSA-N methyl 5-(1-hydroxycyclohex-2-en-1-yl)-3-[(4-methylcyclohexanecarbonyl)-[4-(oxan-2-yloxy)cyclohexyl]amino]thiophene-2-carboxylate Chemical compound COC(=O)C=1SC(C2(O)C=CCCC2)=CC=1N(C(=O)C1CCC(C)CC1)C(CC1)CCC1OC1CCCCO1 CXOZJRDPSBGTDT-UHFFFAOYSA-N 0.000 description 2
- DWPUQUYRFXVZMZ-UHFFFAOYSA-N methyl 5-(2,3-difluorocyclohexen-1-yl)-3-[(4-methoxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylate Chemical compound C1CC(OC)CCC1N(C1=C(SC(=C1)C=1CCCC(F)C=1F)C(=O)OC)C(=O)C1CCC(C)CC1 DWPUQUYRFXVZMZ-UHFFFAOYSA-N 0.000 description 2
- LIXSQKKNCMTAOV-UHFFFAOYSA-N methyl 5-(2,6-difluorocyclohexen-1-yl)-3-[(4-methoxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylate Chemical compound C1CC(OC)CCC1N(C1=C(SC(=C1)C=1C(CCCC=1F)F)C(=O)OC)C(=O)C1CCC(C)CC1 LIXSQKKNCMTAOV-UHFFFAOYSA-N 0.000 description 2
- TZWZECVZNWQKPF-UHFFFAOYSA-N methyl 5-(4,4-dimethylcyclohexen-1-yl)-3-[(4-hydroxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylate Chemical compound COC(=O)C=1SC(C=2CCC(C)(C)CC=2)=CC=1N(C(=O)C1CCC(C)CC1)C1CCC(O)CC1 TZWZECVZNWQKPF-UHFFFAOYSA-N 0.000 description 2
- IKOOQCARUDZMIN-UHFFFAOYSA-N methyl 5-(4,4-dimethylcyclohexen-1-yl)-3-[(4-methylcyclohexanecarbonyl)-(4-oxocyclohexyl)amino]thiophene-2-carboxylate Chemical compound COC(=O)C=1SC(C=2CCC(C)(C)CC=2)=CC=1N(C(=O)C1CCC(C)CC1)C1CCC(=O)CC1 IKOOQCARUDZMIN-UHFFFAOYSA-N 0.000 description 2
- SDBPCUBBQPSQIX-UHFFFAOYSA-N methyl 5-(4,4-dimethylcyclohexen-1-yl)-3-[(4-methylcyclohexanecarbonyl)-[4-(1,2,4-triazol-1-yl)cyclohexyl]amino]thiophene-2-carboxylate Chemical compound COC(=O)C=1SC(C=2CCC(C)(C)CC=2)=CC=1N(C(=O)C1CCC(C)CC1)C(CC1)CCC1N1C=NC=N1 SDBPCUBBQPSQIX-UHFFFAOYSA-N 0.000 description 2
- TZUJJCSDLZTBCF-UHFFFAOYSA-N methyl 5-(4,4-dimethylcyclohexen-1-yl)-3-[[4-(1,2,4-triazol-1-yl)cyclohexyl]amino]thiophene-2-carboxylate Chemical compound COC(=O)C=1SC(C=2CCC(C)(C)CC=2)=CC=1NC(CC1)CCC1N1C=NC=N1 TZUJJCSDLZTBCF-UHFFFAOYSA-N 0.000 description 2
- WLZHXIQKYJUIQZ-UHFFFAOYSA-N methyl 5-(4,4-dimethylcyclohexyl)-3-[(4-methylcyclohexanecarbonyl)-(4-methylsulfonyloxycyclohexyl)amino]thiophene-2-carboxylate Chemical compound COC(=O)C=1SC(C2CCC(C)(C)CC2)=CC=1N(C(=O)C1CCC(C)CC1)C1CCC(OS(C)(=O)=O)CC1 WLZHXIQKYJUIQZ-UHFFFAOYSA-N 0.000 description 2
- PPNFNPIBVRLCFC-UHFFFAOYSA-N methyl 5-(4,4-dimethylcyclohexyl)-3-[(4-methylcyclohexanecarbonyl)-[4-(triazol-1-yl)cyclohexyl]amino]thiophene-2-carboxylate Chemical compound COC(=O)C=1SC(C2CCC(C)(C)CC2)=CC=1N(C(=O)C1CCC(C)CC1)C(CC1)CCC1N1C=CN=N1 PPNFNPIBVRLCFC-UHFFFAOYSA-N 0.000 description 2
- XSKJQHJBKMWKSS-UHFFFAOYSA-N methyl 5-(cyclohexen-1-yl)-3-[(3-oxo-2,5,6,7,8,8a-hexahydro-1h-indolizin-7-yl)amino]thiophene-2-carboxylate Chemical compound C=1C(NC2CC3N(C(CC3)=O)CC2)=C(C(=O)OC)SC=1C1=CCCCC1 XSKJQHJBKMWKSS-UHFFFAOYSA-N 0.000 description 2
- MELBMXRSFAPHMC-UHFFFAOYSA-N methyl 5-(cyclohexen-1-yl)-3-[(4-fluorocyclohexyl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylate Chemical compound COC(=O)C=1SC(C=2CCCCC=2)=CC=1N(C(=O)C1CCC(C)CC1)C1CCC(F)CC1 MELBMXRSFAPHMC-UHFFFAOYSA-N 0.000 description 2
- OSUVFWFEGCZXCD-UHFFFAOYSA-N methyl 5-(cyclohexen-1-yl)-3-[(4-methoxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylate Chemical compound C1CC(OC)CCC1N(C1=C(SC(=C1)C=1CCCCC=1)C(=O)OC)C(=O)C1CCC(C)CC1 OSUVFWFEGCZXCD-UHFFFAOYSA-N 0.000 description 2
- SCTGGEQFOGRINW-UHFFFAOYSA-N methyl 5-(cyclohexen-1-yl)-3-[(4-methylcyclohexanecarbonyl)-[4-(1,2,4-triazol-1-yl)cyclohexyl]amino]thiophene-2-carboxylate Chemical compound COC(=O)C=1SC(C=2CCCCC=2)=CC=1N(C(=O)C1CCC(C)CC1)C(CC1)CCC1N1C=NC=N1 SCTGGEQFOGRINW-UHFFFAOYSA-N 0.000 description 2
- QFIKJRHQBUOWDD-UHFFFAOYSA-N methyl 5-(cyclohexen-1-yl)-3-[[4-(1,2,4-triazol-1-yl)cyclohexyl]amino]thiophene-2-carboxylate Chemical compound COC(=O)C=1SC(C=2CCCCC=2)=CC=1NC(CC1)CCC1N1C=NC=N1 QFIKJRHQBUOWDD-UHFFFAOYSA-N 0.000 description 2
- CKAFQCCNBSOGEI-UHFFFAOYSA-N methyl 5-(cyclohexen-1-yl)-3-[[4-(methoxymethoxy)cyclohexyl]-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylate Chemical compound C1CC(OCOC)CCC1N(C1=C(SC(=C1)C=1CCCCC=1)C(=O)OC)C(=O)C1CCC(C)CC1 CKAFQCCNBSOGEI-UHFFFAOYSA-N 0.000 description 2
- JWGYYGHNONYRSO-UHFFFAOYSA-N methyl 5-bromo-3-(1,4-dioxaspiro[4.5]decan-8-ylamino)thiophene-2-carboxylate Chemical compound S1C(Br)=CC(NC2CCC3(CC2)OCCO3)=C1C(=O)OC JWGYYGHNONYRSO-UHFFFAOYSA-N 0.000 description 2
- PYTFYQSPFFVGMA-UHFFFAOYSA-N methyl 5-bromo-3-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]thiophene-2-carboxylate Chemical compound S1C(Br)=CC(NC2COC(C)(C)OC2)=C1C(=O)OC PYTFYQSPFFVGMA-UHFFFAOYSA-N 0.000 description 2
- AEJSNRFCXSRZNH-UHFFFAOYSA-N methyl 5-bromo-3-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-8-yl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylate Chemical compound S1C(Br)=CC(N(C2CCC3(CC2)C(NC(=O)N3)=O)C(=O)C2CCC(C)CC2)=C1C(=O)OC AEJSNRFCXSRZNH-UHFFFAOYSA-N 0.000 description 2
- IGJSQSPXSPMZLX-UHFFFAOYSA-N methyl 5-bromo-3-[1,3-dihydroxypropan-2-yl-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylate Chemical compound S1C(Br)=CC(N(C(CO)CO)C(=O)C2CCC(C)CC2)=C1C(=O)OC IGJSQSPXSPMZLX-UHFFFAOYSA-N 0.000 description 2
- JOCAMKMEAASVJQ-UHFFFAOYSA-N methyl 5-bromo-3-[1,4-dioxaspiro[4.5]decan-8-yl-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylate Chemical compound S1C(Br)=CC(N(C2CCC3(CC2)OCCO3)C(=O)C2CCC(C)CC2)=C1C(=O)OC JOCAMKMEAASVJQ-UHFFFAOYSA-N 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- 239000002777 nucleoside Substances 0.000 description 2
- 239000002674 ointment Substances 0.000 description 2
- KJIFKLIQANRMOU-UHFFFAOYSA-N oxidanium;4-methylbenzenesulfonate Chemical compound O.CC1=CC=C(S(O)(=O)=O)C=C1 KJIFKLIQANRMOU-UHFFFAOYSA-N 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 229920002866 paraformaldehyde Polymers 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 239000006072 paste Substances 0.000 description 2
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 2
- 239000003755 preservative agent Substances 0.000 description 2
- 235000018102 proteins Nutrition 0.000 description 2
- 108090000623 proteins and genes Proteins 0.000 description 2
- 102000004169 proteins and genes Human genes 0.000 description 2
- 125000006513 pyridinyl methyl group Chemical group 0.000 description 2
- 229910052703 rhodium Inorganic materials 0.000 description 2
- 238000007127 saponification reaction Methods 0.000 description 2
- 239000012047 saturated solution Substances 0.000 description 2
- 238000007493 shaping process Methods 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- 125000003003 spiro group Chemical group 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- 239000005720 sucrose Substances 0.000 description 2
- 125000004434 sulfur atom Chemical group 0.000 description 2
- 239000000829 suppository Substances 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- 125000000335 thiazolyl group Chemical group 0.000 description 2
- MGSRCZKZVOBKFT-UHFFFAOYSA-N thymol Chemical compound CC(C)C1=CC=C(C)C=C1O MGSRCZKZVOBKFT-UHFFFAOYSA-N 0.000 description 2
- 125000003944 tolyl group Chemical group 0.000 description 2
- 238000011200 topical administration Methods 0.000 description 2
- AQRLNPVMDITEJU-UHFFFAOYSA-N triethylsilane Chemical compound CC[SiH](CC)CC AQRLNPVMDITEJU-UHFFFAOYSA-N 0.000 description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 2
- DCGLONGLPGISNX-UHFFFAOYSA-N trimethyl(prop-1-ynyl)silane Chemical compound CC#C[Si](C)(C)C DCGLONGLPGISNX-UHFFFAOYSA-N 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- 239000003981 vehicle Substances 0.000 description 2
- NOOLISFMXDJSKH-UTLUCORTSA-N (+)-Neomenthol Chemical compound CC(C)[C@@H]1CC[C@@H](C)C[C@@H]1O NOOLISFMXDJSKH-UTLUCORTSA-N 0.000 description 1
- 239000001490 (3R)-3,7-dimethylocta-1,6-dien-3-ol Substances 0.000 description 1
- 125000006376 (C3-C10) cycloalkyl group Chemical group 0.000 description 1
- CDOSHBSSFJOMGT-JTQLQIEISA-N (R)-linalool Natural products CC(C)=CCC[C@@](C)(O)C=C CDOSHBSSFJOMGT-JTQLQIEISA-N 0.000 description 1
- 102000040650 (ribonucleotides)n+m Human genes 0.000 description 1
- DIOHEXPTUTVCNX-UHFFFAOYSA-N 1,1,1-trifluoro-n-phenyl-n-(trifluoromethylsulfonyl)methanesulfonamide Chemical compound FC(F)(F)S(=O)(=O)N(S(=O)(=O)C(F)(F)F)C1=CC=CC=C1 DIOHEXPTUTVCNX-UHFFFAOYSA-N 0.000 description 1
- VMFCTZUYOILUMY-UHFFFAOYSA-N 1,1-difluoro-2-iodoethane Chemical compound FC(F)CI VMFCTZUYOILUMY-UHFFFAOYSA-N 0.000 description 1
- OSQAYXCDJAOMDA-UHFFFAOYSA-N 1,2,5,6,8,8a-hexahydroindolizine-3,7-dione Chemical compound C1C(=O)CCN2C(=O)CCC21 OSQAYXCDJAOMDA-UHFFFAOYSA-N 0.000 description 1
- DDMOUSALMHHKOS-UHFFFAOYSA-N 1,2-dichloro-1,1,2,2-tetrafluoroethane Chemical compound FC(F)(Cl)C(F)(F)Cl DDMOUSALMHHKOS-UHFFFAOYSA-N 0.000 description 1
- FWDRVAWKOVFTRU-UHFFFAOYSA-N 1,3-bis[tri(propan-2-yl)silyloxy]propan-2-amine Chemical compound CC(C)[Si](C(C)C)(C(C)C)OCC(N)CO[Si](C(C)C)(C(C)C)C(C)C FWDRVAWKOVFTRU-UHFFFAOYSA-N 0.000 description 1
- SZVHDRLVQJXQBT-UHFFFAOYSA-N 1,3-dimethoxypropan-2-one Chemical compound COCC(=O)COC SZVHDRLVQJXQBT-UHFFFAOYSA-N 0.000 description 1
- XNXWFAFLFUURRI-UHFFFAOYSA-N 1,3-dimethyl-1,3-diazaspiro[4.5]decane-2,8-dione Chemical compound CN1C(=O)N(C)CC11CCC(=O)CC1 XNXWFAFLFUURRI-UHFFFAOYSA-N 0.000 description 1
- HKQTYQDNCKMNHZ-UHFFFAOYSA-N 1,4-dioxaspiro[4.5]decan-8-ol Chemical compound C1CC(O)CCC21OCCO2 HKQTYQDNCKMNHZ-UHFFFAOYSA-N 0.000 description 1
- IWUCXVSUMQZMFG-RGDLXGNYSA-N 1-[(2s,3s,4r,5s)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxamide Chemical compound N1=C(C(=O)N)N=CN1[C@@H]1[C@@H](O)[C@@H](O)[C@H](CO)O1 IWUCXVSUMQZMFG-RGDLXGNYSA-N 0.000 description 1
- WZZBNLYBHUDSHF-DHLKQENFSA-N 1-[(3s,4s)-4-[8-(2-chloro-4-pyrimidin-2-yloxyphenyl)-7-fluoro-2-methylimidazo[4,5-c]quinolin-1-yl]-3-fluoropiperidin-1-yl]-2-hydroxyethanone Chemical compound CC1=NC2=CN=C3C=C(F)C(C=4C(=CC(OC=5N=CC=CN=5)=CC=4)Cl)=CC3=C2N1[C@H]1CCN(C(=O)CO)C[C@@H]1F WZZBNLYBHUDSHF-DHLKQENFSA-N 0.000 description 1
- GWCTUYUNVJTNJR-UHFFFAOYSA-N 1-cyclohexyl-2-(4-phenylmethoxyphenyl)benzimidazole-5-carboxylic acid Chemical compound C=1C=C(OCC=2C=CC=CC=2)C=CC=1C1=NC2=CC(C(=O)O)=CC=C2N1C1CCCCC1 GWCTUYUNVJTNJR-UHFFFAOYSA-N 0.000 description 1
- DDSBNJVJUCCGNO-UHFFFAOYSA-N 1-methyl-4-oxocyclohexane-1-carbonitrile Chemical compound N#CC1(C)CCC(=O)CC1 DDSBNJVJUCCGNO-UHFFFAOYSA-N 0.000 description 1
- ABEXEQSGABRUHS-UHFFFAOYSA-N 16-methylheptadecyl 16-methylheptadecanoate Chemical compound CC(C)CCCCCCCCCCCCCCCOC(=O)CCCCCCCCCCCCCCC(C)C ABEXEQSGABRUHS-UHFFFAOYSA-N 0.000 description 1
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Natural products C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 1
- PDQRQJVPEFGVRK-UHFFFAOYSA-N 2,1,3-benzothiadiazole Chemical compound C1=CC=CC2=NSN=C21 PDQRQJVPEFGVRK-UHFFFAOYSA-N 0.000 description 1
- ASFQDNDZFGFMMP-UHFFFAOYSA-N 2,2-dimethyl-1,3-dioxan-5-one Chemical compound CC1(C)OCC(=O)CO1 ASFQDNDZFGFMMP-UHFFFAOYSA-N 0.000 description 1
- YWEUSNUNKANIKM-UHFFFAOYSA-N 2,2-dimethylpropanoyloxymethyl 5-(cyclohexen-1-yl)-3-[(4-methylcyclohexanecarbonyl)-(1-methylpiperidin-4-yl)amino]thiophene-2-carboxylate Chemical compound C1CC(C)CCC1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(=O)OCOC(=O)C(C)(C)C)C1CCN(C)CC1 YWEUSNUNKANIKM-UHFFFAOYSA-N 0.000 description 1
- ZEMZPXWZVTUONV-UHFFFAOYSA-N 2-(2-dicyclohexylphosphanylphenyl)-n,n-dimethylaniline Chemical group CN(C)C1=CC=CC=C1C1=CC=CC=C1P(C1CCCCC1)C1CCCCC1 ZEMZPXWZVTUONV-UHFFFAOYSA-N 0.000 description 1
- KJJPLEZQSCZCKE-UHFFFAOYSA-N 2-aminopropane-1,3-diol Chemical compound OCC(N)CO KJJPLEZQSCZCKE-UHFFFAOYSA-N 0.000 description 1
- VDCZRVJPEUWFMI-UHFFFAOYSA-N 2-azaspiro[4.5]decane-3,8-dione Chemical compound C1NC(=O)CC21CCC(=O)CC2 VDCZRVJPEUWFMI-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- VNDWQCSOSCCWIP-UHFFFAOYSA-N 2-tert-butyl-9-fluoro-1,6-dihydrobenzo[h]imidazo[4,5-f]isoquinolin-7-one Chemical compound C1=2C=CNC(=O)C=2C2=CC(F)=CC=C2C2=C1NC(C(C)(C)C)=N2 VNDWQCSOSCCWIP-UHFFFAOYSA-N 0.000 description 1
- MGADZUXDNSDTHW-UHFFFAOYSA-N 2H-pyran Chemical compound C1OC=CC=C1 MGADZUXDNSDTHW-UHFFFAOYSA-N 0.000 description 1
- UDXXOLLCWQZWPL-UHFFFAOYSA-N 3-(6-methylcyclohexen-1-yl)thiophene-2-carboxylic acid Chemical compound CC1CCCC=C1C1=C(SC=C1)C(=O)O UDXXOLLCWQZWPL-UHFFFAOYSA-N 0.000 description 1
- KHCXGFNZZRXOND-UHFFFAOYSA-N 3-(bromomethyl)pyridine Chemical compound BrCC1=CC=CN=C1 KHCXGFNZZRXOND-UHFFFAOYSA-N 0.000 description 1
- CCFPXCANXFKCOE-UHFFFAOYSA-N 3-[(4-hydroxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid Chemical compound C1CC(C)CCC1C(=O)N(C1=C(SC=C1)C(O)=O)C1CCC(O)CC1 CCFPXCANXFKCOE-UHFFFAOYSA-N 0.000 description 1
- BLNSUWQSBBAVMD-UHFFFAOYSA-N 3-[(4-methoxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]-5-(4-oxocyclohexyl)thiophene-2-carboxylic acid Chemical compound C1CC(OC)CCC1N(C1=C(SC(=C1)C1CCC(=O)CC1)C(O)=O)C(=O)C1CCC(C)CC1 BLNSUWQSBBAVMD-UHFFFAOYSA-N 0.000 description 1
- AJKDUJRRWLQXHM-UHFFFAOYSA-N 3-bromocyclohexene Chemical compound BrC1CCCC=C1 AJKDUJRRWLQXHM-UHFFFAOYSA-N 0.000 description 1
- 125000006201 3-phenylpropyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- PXQMSTLNSHMSJB-UHFFFAOYSA-N 4,4-dimethylcyclohexan-1-one Chemical compound CC1(C)CCC(=O)CC1 PXQMSTLNSHMSJB-UHFFFAOYSA-N 0.000 description 1
- KHTGWQYWBVTUTI-UHFFFAOYSA-N 4-(1,2,4-triazol-1-yl)cyclohexan-1-one Chemical compound C1CC(=O)CCC1N1N=CN=C1 KHTGWQYWBVTUTI-UHFFFAOYSA-N 0.000 description 1
- QODZHJFYKBFCAJ-UHFFFAOYSA-N 4-(triazol-1-yl)cyclohexan-1-one Chemical compound C1CC(=O)CCC1N1N=NC=C1 QODZHJFYKBFCAJ-UHFFFAOYSA-N 0.000 description 1
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical compound C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 description 1
- VBLAAESAMSKCOO-UHFFFAOYSA-N 5-(1,2,4-triazol-1-yl)heptan-2-one Chemical compound CC(=O)CCC(CC)N1C=NC=N1 VBLAAESAMSKCOO-UHFFFAOYSA-N 0.000 description 1
- DHZRKGZVOWHWSR-UHFFFAOYSA-N 5-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-3-[(4-hydroxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid Chemical compound C1CC(C)CCC1C(=O)N(C1=C(SC(=C1)C=1CCC2(CC=1)OCCO2)C(O)=O)C1CCC(O)CC1 DHZRKGZVOWHWSR-UHFFFAOYSA-N 0.000 description 1
- LLKFNPUXQZHIAE-UHFFFAOYSA-N 5-(3-aminopropyl)-8-bromo-3-methyl-2h-pyrazolo[4,3-c]quinolin-4-one Chemical compound O=C1N(CCCN)C2=CC=C(Br)C=C2C2=C1C(C)=NN2 LLKFNPUXQZHIAE-UHFFFAOYSA-N 0.000 description 1
- LNYKGELUODVSNS-UHFFFAOYSA-N 5-(cyclohexen-1-yl)-3-[(4-methoxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid Chemical compound C1CC(OC)CCC1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)C1CCC(C)CC1 LNYKGELUODVSNS-UHFFFAOYSA-N 0.000 description 1
- HCTFEOYQHVJAEV-UHFFFAOYSA-N 5-(cyclohexen-1-yl)-3-[(4-methylcyclohexanecarbonyl)-(1-methylpiperidin-4-yl)amino]thiophene-2-carboxylic acid Chemical compound C1CC(C)CCC1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCN(C)CC1 HCTFEOYQHVJAEV-UHFFFAOYSA-N 0.000 description 1
- UKRVVPIKBGFVNT-UHFFFAOYSA-N 5-(cyclohexen-1-yl)-3-[(4-methylcyclohexanecarbonyl)-[4-[methyl(propanoyl)amino]cyclohexyl]amino]thiophene-2-carboxylic acid Chemical compound C1CC(N(C)C(=O)CC)CCC1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)C1CCC(C)CC1 UKRVVPIKBGFVNT-UHFFFAOYSA-N 0.000 description 1
- WTDWVLJJJOTABN-UHFFFAOYSA-N 5-cyclopropyl-2-(4-fluorophenyl)-6-[(2-hydroxyethyl)(methylsulfonyl)amino]-n-methyl-1-benzofuran-3-carboxamide Chemical compound C1=C2C(C(=O)NC)=C(C=3C=CC(F)=CC=3)OC2=CC(N(CCO)S(C)(=O)=O)=C1C1CC1 WTDWVLJJJOTABN-UHFFFAOYSA-N 0.000 description 1
- JTEJPPKMYBDEMY-UHFFFAOYSA-N 5-methoxytryptamine Chemical compound COC1=CC=C2NC=C(CCN)C2=C1 JTEJPPKMYBDEMY-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- JNFOVWRVUGBVAH-UHFFFAOYSA-N 8-methyl-1,4-dioxaspiro[4.5]decane-8-carbonitrile Chemical compound C1CC(C)(C#N)CCC21OCCO2 JNFOVWRVUGBVAH-UHFFFAOYSA-N 0.000 description 1
- JRLTTZUODKEYDH-UHFFFAOYSA-N 8-methylquinoline Chemical group C1=CN=C2C(C)=CC=CC2=C1 JRLTTZUODKEYDH-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- 108700016947 Bos taurus structural-GP Proteins 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- DLPYXWRVVZCMEL-GUJRETQESA-N C(C)(C)(C)OC(=O)N[C@@H]1CC[C@H](CC1)N(C1=C(SC(=C1)C1=CCCCC1)C(=O)O)C(=O)[C@@H]1CC[C@H](CC1)C Chemical compound C(C)(C)(C)OC(=O)N[C@@H]1CC[C@H](CC1)N(C1=C(SC(=C1)C1=CCCCC1)C(=O)O)C(=O)[C@@H]1CC[C@H](CC1)C DLPYXWRVVZCMEL-GUJRETQESA-N 0.000 description 1
- ASELAGGOTSGWGU-JCNLHEQBSA-N C1(=CCCCC1)C=1C(=C(SC1)C(=O)O)N(C(=O)[C@@H]1CC[C@H](CC1)C)C1COCOC1 Chemical compound C1(=CCCCC1)C=1C(=C(SC1)C(=O)O)N(C(=O)[C@@H]1CC[C@H](CC1)C)C1COCOC1 ASELAGGOTSGWGU-JCNLHEQBSA-N 0.000 description 1
- XSKWKTVUQVYCKD-MUVNWNFZSA-N C1C(=NOCC)CCC(C=2SC(=C(N([C@@H]3CC[C@@H](O)CC3)C(=O)[C@@H]3CC[C@@H](C)CC3)C=2)C(O)=O)=C1 Chemical compound C1C(=NOCC)CCC(C=2SC(=C(N([C@@H]3CC[C@@H](O)CC3)C(=O)[C@@H]3CC[C@@H](C)CC3)C=2)C(O)=O)=C1 XSKWKTVUQVYCKD-MUVNWNFZSA-N 0.000 description 1
- KVIIFMHSHSIEHH-OSHZUIANSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCC(=O)CC1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCC(=O)CC1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 KVIIFMHSHSIEHH-OSHZUIANSA-N 0.000 description 1
- ZRBWUSPUYHLDPM-WXVWHJFISA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCC(C)(C)CC1)C(O)=O)C1CCC2(C(N(C)C(=O)N2C)=O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCC(C)(C)CC1)C(O)=O)C1CCC2(C(N(C)C(=O)N2C)=O)CC1 ZRBWUSPUYHLDPM-WXVWHJFISA-N 0.000 description 1
- BWSQKLRZLXODAO-BOIGYYLYSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCC(CC=1)=NOCC=1C=CC=CC=1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCC(CC=1)=NOCC=1C=CC=CC=1)C(O)=O)[C@@H]1CC[C@@H](O)CC1 BWSQKLRZLXODAO-BOIGYYLYSA-N 0.000 description 1
- OQJNOHVPDZQBCM-OUSQFULFSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCC(O)C=1)C(O)=O)[C@@H]1CC[C@@H](OC2OCCCC2)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCC(O)C=1)C(O)=O)[C@@H]1CC[C@@H](OC2OCCCC2)CC1 OQJNOHVPDZQBCM-OUSQFULFSA-N 0.000 description 1
- YWEUSNUNKANIKM-AFARHQOCSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(=O)OCOC(=O)C(C)(C)C)C1CCN(C)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(=O)OCOC(=O)C(C)(C)C)C1CCN(C)CC1 YWEUSNUNKANIKM-AFARHQOCSA-N 0.000 description 1
- GDLYEIAVXRHMTA-XUTJKUGGSA-N C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCN(C=2N=CC=CN=2)CC1 Chemical compound C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C1CCN(C=2N=CC=CN=2)CC1 GDLYEIAVXRHMTA-XUTJKUGGSA-N 0.000 description 1
- UFLNDZQEGXWPQV-XNVWPBTHSA-N C1C[C@@H](OC)CC[C@@H]1N(C1=C(SC(=C1)C1CC=C(F)CC1)C(=O)OC)C(=O)[C@@H]1CC[C@@H](C)CC1 Chemical compound C1C[C@@H](OC)CC[C@@H]1N(C1=C(SC(=C1)C1CC=C(F)CC1)C(=O)OC)C(=O)[C@@H]1CC[C@@H](C)CC1 UFLNDZQEGXWPQV-XNVWPBTHSA-N 0.000 description 1
- BEWQFGIHJWFTTM-YSXIEMCBSA-N C1C[C@@H](OC)CC[C@@H]1N(C1=C(SC(=C1)C1CCC(F)(F)CC1)C(=O)OC)C(=O)[C@@H]1CC[C@@H](C)CC1 Chemical compound C1C[C@@H](OC)CC[C@@H]1N(C1=C(SC(=C1)C1CCC(F)(F)CC1)C(=O)OC)C(=O)[C@@H]1CC[C@@H](C)CC1 BEWQFGIHJWFTTM-YSXIEMCBSA-N 0.000 description 1
- YARFHYQWCPLHGK-VJVRBHMKSA-N C1C[C@@H](OC)CC[C@@H]1N(C1=C(SC(=C1)C1CCC(F)(F)CC1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 Chemical compound C1C[C@@H](OC)CC[C@@H]1N(C1=C(SC(=C1)C1CCC(F)(F)CC1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 YARFHYQWCPLHGK-VJVRBHMKSA-N 0.000 description 1
- GQOLEXCMAPABGR-YSXIEMCBSA-N C1C[C@@H](OC)CC[C@@H]1N(C1=C(SC(=C1)C1CCCCC1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 Chemical compound C1C[C@@H](OC)CC[C@@H]1N(C1=C(SC(=C1)C1CCCCC1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 GQOLEXCMAPABGR-YSXIEMCBSA-N 0.000 description 1
- COSFOXLUNFUJIP-JOLHVKOESA-N C1C[C@@H](OC)CC[C@@H]1N(C1=C(SC(=C1)C=1CC(C)(C)CCC=1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 Chemical compound C1C[C@@H](OC)CC[C@@H]1N(C1=C(SC(=C1)C=1CC(C)(C)CCC=1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 COSFOXLUNFUJIP-JOLHVKOESA-N 0.000 description 1
- OSZNFYRPACBWAD-XHPGVBHPSA-N C1C[C@@H](OCC)CC[C@@H]1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 Chemical compound C1C[C@@H](OCC)CC[C@@H]1N(C1=C(SC(=C1)C=1CCCCC=1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 OSZNFYRPACBWAD-XHPGVBHPSA-N 0.000 description 1
- QRKLHFIPRBGHGR-GUJRETQESA-N C1C[C@@H](OCOC)CC[C@@H]1N(C1=C(SC(=C1)C=1CCC(C)(C)CC=1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 Chemical compound C1C[C@@H](OCOC)CC[C@@H]1N(C1=C(SC(=C1)C=1CCC(C)(C)CC=1)C(O)=O)C(=O)[C@@H]1CC[C@@H](C)CC1 QRKLHFIPRBGHGR-GUJRETQESA-N 0.000 description 1
- PUWYENWRQJAVBI-AFARHQOCSA-N CC(C)OC(OCOC(C(SC(C1=CCCCC1)=C1)=C1N(C1CCN(C)CC1)C([C@H]1CC[C@H](C)CC1)=O)=O)=O Chemical compound CC(C)OC(OCOC(C(SC(C1=CCCCC1)=C1)=C1N(C1CCN(C)CC1)C([C@H]1CC[C@H](C)CC1)=O)=O)=O PUWYENWRQJAVBI-AFARHQOCSA-N 0.000 description 1
- TZWZECVZNWQKPF-XHPGVBHPSA-N COC(=O)C=1SC(C=2CCC(C)(C)CC=2)=CC=1N(C(=O)[C@@H]1CC[C@@H](C)CC1)[C@H]1CC[C@H](O)CC1 Chemical compound COC(=O)C=1SC(C=2CCC(C)(C)CC=2)=CC=1N(C(=O)[C@@H]1CC[C@@H](C)CC1)[C@H]1CC[C@H](O)CC1 TZWZECVZNWQKPF-XHPGVBHPSA-N 0.000 description 1
- HEZJUUMFRVLDCN-AQYVVDRMSA-N COC(=O)C=1SC(C=2CCCCC=2)=CC=1N(C(=O)[C@@H]1CC[C@@H](C)CC1)C(CC1)CCN1C1=CN=CN=C1 Chemical compound COC(=O)C=1SC(C=2CCCCC=2)=CC=1N(C(=O)[C@@H]1CC[C@@H](C)CC1)C(CC1)CCN1C1=CN=CN=C1 HEZJUUMFRVLDCN-AQYVVDRMSA-N 0.000 description 1
- MRYMMWAGVKALOS-AQYVVDRMSA-N COC(=O)C=1SC(C=2CCCCC=2)=CC=1N(C(=O)[C@@H]1CC[C@@H](C)CC1)C(CC1)CCN1C1=NC=CC=N1 Chemical compound COC(=O)C=1SC(C=2CCCCC=2)=CC=1N(C(=O)[C@@H]1CC[C@@H](C)CC1)C(CC1)CCN1C1=NC=CC=N1 MRYMMWAGVKALOS-AQYVVDRMSA-N 0.000 description 1
- YGSPLQPMFYGMIS-UAPYVXQJSA-N COC(=O)C=1SC(C=2CCCCC=2)=CC=1N(C(=O)[C@@H]1CC[C@@H](C)CC1)C1CCC(=O)CC1 Chemical compound COC(=O)C=1SC(C=2CCCCC=2)=CC=1N(C(=O)[C@@H]1CC[C@@H](C)CC1)C1CCC(=O)CC1 YGSPLQPMFYGMIS-UAPYVXQJSA-N 0.000 description 1
- QHXBJHAYEHDHTO-KESTWPANSA-N COC(=O)C=1SC(C=2CCCCC=2)=CC=1N(C(=O)[C@@H]1CC[C@@H](C)CC1)C1CCN(C=O)CC1 Chemical compound COC(=O)C=1SC(C=2CCCCC=2)=CC=1N(C(=O)[C@@H]1CC[C@@H](C)CC1)C1CCN(C=O)CC1 QHXBJHAYEHDHTO-KESTWPANSA-N 0.000 description 1
- JIAZOZWJVJSOKM-KESTWPANSA-N COC(=O)C=1SC(C=2CCCCC=2)=CC=1N(C(=O)[C@@H]1CC[C@@H](C)CC1)C1CCN(CC(F)F)CC1 Chemical compound COC(=O)C=1SC(C=2CCCCC=2)=CC=1N(C(=O)[C@@H]1CC[C@@H](C)CC1)C1CCN(CC(F)F)CC1 JIAZOZWJVJSOKM-KESTWPANSA-N 0.000 description 1
- HCPWLJURHZATCV-UAPYVXQJSA-N COC(=O)C=1SC(C=2CCCCC=2)=CC=1N(C(=O)[C@@H]1CC[C@@H](C)CC1)C1CCNCC1 Chemical compound COC(=O)C=1SC(C=2CCCCC=2)=CC=1N(C(=O)[C@@H]1CC[C@@H](C)CC1)C1CCNCC1 HCPWLJURHZATCV-UAPYVXQJSA-N 0.000 description 1
- UOPBJTQBUKLXNX-JOLHVKOESA-N COC(=O)C=1SC(C=2CCCCC=2)=CC=1N(C(=O)[C@@H]1CC[C@@H](C)CC1)[C@H]1CC[C@H](C#N)CC1 Chemical compound COC(=O)C=1SC(C=2CCCCC=2)=CC=1N(C(=O)[C@@H]1CC[C@@H](C)CC1)[C@H]1CC[C@H](C#N)CC1 UOPBJTQBUKLXNX-JOLHVKOESA-N 0.000 description 1
- GFOIAINHMGKDME-YSXIEMCBSA-N COC(=O)C=1SC(C=2CCCCC=2)=CC=1N(C(=O)[C@@H]1CC[C@@H](C)CC1)[C@H]1CC[C@H](O)CC1 Chemical compound COC(=O)C=1SC(C=2CCCCC=2)=CC=1N(C(=O)[C@@H]1CC[C@@H](C)CC1)[C@H]1CC[C@H](O)CC1 GFOIAINHMGKDME-YSXIEMCBSA-N 0.000 description 1
- DKSUOVPUZAYKTD-MLRKGSHFSA-N COC(=O)c1sc(cc1N([C@H]1CC[C@@H](CC1)NC(=O)C(C)C)C(=O)[C@H]1CC[C@H](C)CC1)C1=CCCCC1 Chemical compound COC(=O)c1sc(cc1N([C@H]1CC[C@@H](CC1)NC(=O)C(C)C)C(=O)[C@H]1CC[C@H](C)CC1)C1=CCCCC1 DKSUOVPUZAYKTD-MLRKGSHFSA-N 0.000 description 1
- OUKJLNWNIDSFKB-YSXIEMCBSA-N COC(=O)c1sc(cc1N([C@H]1CC[C@H](N)CC1)C(=O)[C@H]1CC[C@H](C)CC1)C1=CCCCC1 Chemical compound COC(=O)c1sc(cc1N([C@H]1CC[C@H](N)CC1)C(=O)[C@H]1CC[C@H](C)CC1)C1=CCCCC1 OUKJLNWNIDSFKB-YSXIEMCBSA-N 0.000 description 1
- 101710132601 Capsid protein Proteins 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- XJUZRXYOEPSWMB-UHFFFAOYSA-N Chloromethyl methyl ether Chemical compound COCCl XJUZRXYOEPSWMB-UHFFFAOYSA-N 0.000 description 1
- WTEVQBCEXWBHNA-UHFFFAOYSA-N Citral Natural products CC(C)=CCCC(C)=CC=O WTEVQBCEXWBHNA-UHFFFAOYSA-N 0.000 description 1
- OWAQWJZQHJWZPO-OMWMBCDQSA-N Cl.C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCC(C)(C)CC1)C(O)=O)[C@@H]1CC[C@@H](N2N=CN=C2)CC1 Chemical compound Cl.C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCC(C)(C)CC1)C(O)=O)[C@@H]1CC[C@@H](N2N=CN=C2)CC1 OWAQWJZQHJWZPO-OMWMBCDQSA-N 0.000 description 1
- NTXTYCUOVNWTEE-OMWMBCDQSA-N Cl.C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCC(C)(C)CC1)C(O)=O)[C@@H]1CC[C@@H](N2N=NC=C2)CC1 Chemical compound Cl.C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCC(C)(C)CC1)C(O)=O)[C@@H]1CC[C@@H](N2N=NC=C2)CC1 NTXTYCUOVNWTEE-OMWMBCDQSA-N 0.000 description 1
- OWAQWJZQHJWZPO-RSUHOQBUSA-N Cl.C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCC(C)(C)CC1)C(O)=O)[C@@H]1CC[C@H](N2N=CN=C2)CC1 Chemical compound Cl.C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(=C1)C1CCC(C)(C)CC1)C(O)=O)[C@@H]1CC[C@H](N2N=CN=C2)CC1 OWAQWJZQHJWZPO-RSUHOQBUSA-N 0.000 description 1
- 229910021589 Copper(I) bromide Inorganic materials 0.000 description 1
- NOOLISFMXDJSKH-UHFFFAOYSA-N DL-menthol Natural products CC(C)C1CCC(C)CC1O NOOLISFMXDJSKH-UHFFFAOYSA-N 0.000 description 1
- 101710118188 DNA-binding protein HU-alpha Proteins 0.000 description 1
- 239000004338 Dichlorodifluoromethane Substances 0.000 description 1
- 239000004150 EU approved colour Substances 0.000 description 1
- 102000020897 Formins Human genes 0.000 description 1
- 108091022623 Formins Proteins 0.000 description 1
- 229940126656 GS-4224 Drugs 0.000 description 1
- 241001481828 Glyptocephalus cynoglossus Species 0.000 description 1
- 239000007821 HATU Substances 0.000 description 1
- 229940124683 HCV polymerase inhibitor Drugs 0.000 description 1
- 206010019799 Hepatitis viral Diseases 0.000 description 1
- 102100027612 Kallikrein-11 Human genes 0.000 description 1
- 101710115807 Kallikrein-11 Proteins 0.000 description 1
- ODKSFYDXXFIFQN-BYPYZUCNSA-N L-arginine Chemical compound OC(=O)[C@@H](N)CCCN=C(N)N ODKSFYDXXFIFQN-BYPYZUCNSA-N 0.000 description 1
- 229930064664 L-arginine Natural products 0.000 description 1
- 235000014852 L-arginine Nutrition 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- 101100030361 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) pph-3 gene Proteins 0.000 description 1
- 101710144111 Non-structural protein 3 Proteins 0.000 description 1
- 101800001020 Non-structural protein 4A Proteins 0.000 description 1
- 101800001019 Non-structural protein 4B Proteins 0.000 description 1
- 101800001014 Non-structural protein 5A Proteins 0.000 description 1
- 241000710778 Pestivirus Species 0.000 description 1
- 108010076039 Polyproteins Proteins 0.000 description 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- 101800001554 RNA-directed RNA polymerase Proteins 0.000 description 1
- 101800001838 Serine protease/helicase NS3 Proteins 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- 239000005844 Thymol Substances 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- 241000927721 Tritia Species 0.000 description 1
- 108010067390 Viral Proteins Proteins 0.000 description 1
- 108020000999 Viral RNA Proteins 0.000 description 1
- TVRCRTJYMVTEFS-ICGCPXGVSA-N [(2r,3r,4r,5r)-5-(4-amino-2-oxopyrimidin-1-yl)-4-hydroxy-2-(hydroxymethyl)-4-methyloxolan-3-yl] (2s)-2-amino-3-methylbutanoate Chemical compound C[C@@]1(O)[C@H](OC(=O)[C@@H](N)C(C)C)[C@@H](CO)O[C@H]1N1C(=O)N=C(N)C=C1 TVRCRTJYMVTEFS-ICGCPXGVSA-N 0.000 description 1
- JBPUGFODGPKTDW-SFHVURJKSA-N [(3s)-oxolan-3-yl] n-[[3-[[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]carbamoylamino]phenyl]methyl]carbamate Chemical compound C=1C=C(C=2OC=NC=2)C(OC)=CC=1NC(=O)NC(C=1)=CC=CC=1CNC(=O)O[C@H]1CCOC1 JBPUGFODGPKTDW-SFHVURJKSA-N 0.000 description 1
- FXWODRNBVUDSLE-UBRLZZGHSA-M [Li+].C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(Br)=C1)C([O-])=O)C1CCCCC1 Chemical compound [Li+].C1C[C@@H](C)CC[C@@H]1C(=O)N(C1=C(SC(Br)=C1)C([O-])=O)C1CCCCC1 FXWODRNBVUDSLE-UBRLZZGHSA-M 0.000 description 1
- QQIRAVWVGBTHMJ-UHFFFAOYSA-N [dimethyl-(trimethylsilylamino)silyl]methane;lithium Chemical compound [Li].C[Si](C)(C)N[Si](C)(C)C QQIRAVWVGBTHMJ-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- MDFFNEOEWAXZRQ-UHFFFAOYSA-N aminyl Chemical compound [NH2] MDFFNEOEWAXZRQ-UHFFFAOYSA-N 0.000 description 1
- HSMPSHPWCOOUJH-UHFFFAOYSA-N anilinyl Chemical group [NH]C1=CC=CC=C1 HSMPSHPWCOOUJH-UHFFFAOYSA-N 0.000 description 1
- 125000005428 anthryl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C3C(*)=C([H])C([H])=C([H])C3=C([H])C2=C1[H] 0.000 description 1
- 239000003443 antiviral agent Substances 0.000 description 1
- 239000012223 aqueous fraction Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000008135 aqueous vehicle Substances 0.000 description 1
- XRWSZZJLZRKHHD-WVWIJVSJSA-N asunaprevir Chemical compound O=C([C@@H]1C[C@H](CN1C(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)OC1=NC=C(C2=CC=C(Cl)C=C21)OC)N[C@]1(C(=O)NS(=O)(=O)C2CC2)C[C@H]1C=C XRWSZZJLZRKHHD-WVWIJVSJSA-N 0.000 description 1
- 125000002785 azepinyl group Chemical group 0.000 description 1
- RFRXIWQYSOIBDI-UHFFFAOYSA-N benzarone Chemical compound CCC=1OC2=CC=CC=C2C=1C(=O)C1=CC=C(O)C=C1 RFRXIWQYSOIBDI-UHFFFAOYSA-N 0.000 description 1
- 150000008107 benzenesulfonic acids Chemical class 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 125000004622 benzoxazinyl group Chemical group O1NC(=CC2=C1C=CC=C2)* 0.000 description 1
- BVCRERJDOOBZOH-UHFFFAOYSA-N bicyclo[2.2.1]heptanyl Chemical group C1C[C+]2CC[C-]1C2 BVCRERJDOOBZOH-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000036765 blood level Effects 0.000 description 1
- LHHCSNFAOIFYRV-DOVBMPENSA-N boceprevir Chemical compound O=C([C@@H]1[C@@H]2[C@@H](C2(C)C)CN1C(=O)[C@@H](NC(=O)NC(C)(C)C)C(C)(C)C)NC(C(=O)C(N)=O)CC1CCC1 LHHCSNFAOIFYRV-DOVBMPENSA-N 0.000 description 1
- 229960000517 boceprevir Drugs 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- ZADPBFCGQRWHPN-UHFFFAOYSA-N boronic acid Chemical compound OBO ZADPBFCGQRWHPN-UHFFFAOYSA-N 0.000 description 1
- 125000005620 boronic acid group Chemical class 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 229940045348 brown mixture Drugs 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000000480 butynyl group Chemical group [*]C#CC([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052792 caesium Inorganic materials 0.000 description 1
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 1
- 125000003739 carbamimidoyl group Chemical group C(N)(=N)* 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 229960004424 carbon dioxide Drugs 0.000 description 1
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 1
- RECUKUPTGUEGMW-UHFFFAOYSA-N carvacrol Chemical compound CC(C)C1=CC=C(C)C(O)=C1 RECUKUPTGUEGMW-UHFFFAOYSA-N 0.000 description 1
- HHTWOMMSBMNRKP-UHFFFAOYSA-N carvacrol Natural products CC(=C)C1=CC=C(C)C(O)=C1 HHTWOMMSBMNRKP-UHFFFAOYSA-N 0.000 description 1
- 235000007746 carvacrol Nutrition 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000004296 chiral HPLC Methods 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 125000004775 chlorodifluoromethyl group Chemical group FC(F)(Cl)* 0.000 description 1
- 125000002603 chloroethyl group Chemical group [H]C([*])([H])C([H])([H])Cl 0.000 description 1
- 125000004773 chlorofluoromethyl group Chemical group [H]C(F)(Cl)* 0.000 description 1
- GGRHYQCXXYLUTL-UHFFFAOYSA-N chloromethyl 2,2-dimethylpropanoate Chemical compound CC(C)(C)C(=O)OCCl GGRHYQCXXYLUTL-UHFFFAOYSA-N 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 229940061627 chloromethyl methyl ether Drugs 0.000 description 1
- 238000011097 chromatography purification Methods 0.000 description 1
- PJZPDFUUXKKDNB-KNINVFKUSA-N ciluprevir Chemical compound N([C@@H]1C(=O)N2[C@H](C(N[C@@]3(C[C@H]3\C=C/CCCCC1)C(O)=O)=O)C[C@H](C2)OC=1C2=CC=C(C=C2N=C(C=1)C=1N=C(NC(C)C)SC=1)OC)C(=O)OC1CCCC1 PJZPDFUUXKKDNB-KNINVFKUSA-N 0.000 description 1
- 229940043350 citral Drugs 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 238000011284 combination treatment Methods 0.000 description 1
- 230000000295 complement effect Effects 0.000 description 1
- 229940125773 compound 10 Drugs 0.000 description 1
- 229940125961 compound 24 Drugs 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 108010011222 cyclo(Arg-Pro) Proteins 0.000 description 1
- FWFSEYBSWVRWGL-UHFFFAOYSA-N cyclohex-2-enone Chemical compound O=C1CCCC=C1 FWFSEYBSWVRWGL-UHFFFAOYSA-N 0.000 description 1
- ZVTDLPBHTSMEJZ-JSZLBQEHSA-N danoprevir Chemical compound O=C([C@@]12C[C@H]1\C=C/CCCCC[C@@H](C(N1C[C@@H](C[C@H]1C(=O)N2)OC(=O)N1CC2=C(F)C=CC=C2C1)=O)NC(=O)OC(C)(C)C)NS(=O)(=O)C1CC1 ZVTDLPBHTSMEJZ-JSZLBQEHSA-N 0.000 description 1
- DEZRYPDIMOWBDS-UHFFFAOYSA-N dcm dichloromethane Chemical compound ClCCl.ClCCl DEZRYPDIMOWBDS-UHFFFAOYSA-N 0.000 description 1
- 230000002939 deleterious effect Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 125000002576 diazepinyl group Chemical group N1N=C(C=CC=C1)* 0.000 description 1
- 235000019404 dichlorodifluoromethane Nutrition 0.000 description 1
- 229940042935 dichlorodifluoromethane Drugs 0.000 description 1
- 125000006003 dichloroethyl group Chemical group 0.000 description 1
- 125000004772 dichloromethyl group Chemical group [H]C(Cl)(Cl)* 0.000 description 1
- 229940087091 dichlorotetrafluoroethane Drugs 0.000 description 1
- YSLFMGDEEXOKHF-UHFFFAOYSA-N difluoro(iodo)methane Chemical compound FC(F)I YSLFMGDEEXOKHF-UHFFFAOYSA-N 0.000 description 1
- 125000006001 difluoroethyl group Chemical group 0.000 description 1
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 description 1
- UXGNZZKBCMGWAZ-UHFFFAOYSA-N dimethylformamide dmf Chemical compound CN(C)C=O.CN(C)C=O UXGNZZKBCMGWAZ-UHFFFAOYSA-N 0.000 description 1
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical group C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 description 1
- GPAYUJZHTULNBE-UHFFFAOYSA-O diphenylphosphanium Chemical compound C=1C=CC=CC=1[PH2+]C1=CC=CC=C1 GPAYUJZHTULNBE-UHFFFAOYSA-O 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 125000005303 dithiazolyl group Chemical group S1SNC(=C1)* 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 241001493065 dsRNA viruses Species 0.000 description 1
- 239000008157 edible vegetable oil Substances 0.000 description 1
- 238000001493 electron microscopy Methods 0.000 description 1
- 239000003623 enhancer Substances 0.000 description 1
- 230000002255 enzymatic effect Effects 0.000 description 1
- 230000009088 enzymatic function Effects 0.000 description 1
- 210000002615 epidermis Anatomy 0.000 description 1
- ZKQFHRVKCYFVCN-UHFFFAOYSA-N ethoxyethane;hexane Chemical compound CCOCC.CCCCCC ZKQFHRVKCYFVCN-UHFFFAOYSA-N 0.000 description 1
- 239000002024 ethyl acetate extract Substances 0.000 description 1
- 125000005469 ethylenyl group Chemical group 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000003818 flash chromatography Methods 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 125000003784 fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 description 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- WTEVQBCEXWBHNA-JXMROGBWSA-N geranial Chemical compound CC(C)=CCC\C(C)=C\C=O WTEVQBCEXWBHNA-JXMROGBWSA-N 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 125000002795 guanidino group Chemical group C(N)(=N)N* 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 230000005802 health problem Effects 0.000 description 1
- 125000005980 hexynyl group Chemical group 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 229940042795 hydrazides for tuberculosis treatment Drugs 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000005417 image-selected in vivo spectroscopy Methods 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 125000004857 imidazopyridinyl group Chemical group N1C(=NC2=C1C=CC=N2)* 0.000 description 1
- 230000000899 immune system response Effects 0.000 description 1
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 description 1
- 238000012739 integrated shape imaging system Methods 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- 125000001977 isobenzofuranyl group Chemical group C=1(OC=C2C=CC=CC12)* 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- WYXXLXHHWYNKJF-UHFFFAOYSA-N isocarvacrol Natural products CC(C)C1=CC=C(O)C(C)=C1 WYXXLXHHWYNKJF-UHFFFAOYSA-N 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- 125000004594 isoindolinyl group Chemical group C1(NCC2=CC=CC=C12)* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- ZLVXBBHTMQJRSX-VMGNSXQWSA-N jdtic Chemical compound C1([C@]2(C)CCN(C[C@@H]2C)C[C@H](C(C)C)NC(=O)[C@@H]2NCC3=CC(O)=CC=C3C2)=CC=CC(O)=C1 ZLVXBBHTMQJRSX-VMGNSXQWSA-N 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 229930007744 linalool Natural products 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- YNESATAKKCNGOF-UHFFFAOYSA-N lithium bis(trimethylsilyl)amide Chemical compound [Li+].C[Si](C)(C)[N-][Si](C)(C)C YNESATAKKCNGOF-UHFFFAOYSA-N 0.000 description 1
- 229910003002 lithium salt Inorganic materials 0.000 description 1
- 159000000002 lithium salts Chemical group 0.000 description 1
- JTCYOTDMLABHJJ-UHFFFAOYSA-M lithium;5-bromo-3-[(4-hydroxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylate Chemical compound [Li+].C1CC(C)CCC1C(=O)N(C1=C(SC(Br)=C1)C([O-])=O)C1CCC(O)CC1 JTCYOTDMLABHJJ-UHFFFAOYSA-M 0.000 description 1
- 230000004904 long-term response Effects 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- WWOYCMCZTZTIGU-UHFFFAOYSA-L magnesium;2-carboxybenzenecarboperoxoate;hexahydrate Chemical compound O.O.O.O.O.O.[Mg+2].OOC(=O)C1=CC=CC=C1C([O-])=O.OOC(=O)C1=CC=CC=C1C([O-])=O WWOYCMCZTZTIGU-UHFFFAOYSA-L 0.000 description 1
- 210000004779 membrane envelope Anatomy 0.000 description 1
- 229940041616 menthol Drugs 0.000 description 1
- COTNUBDHGSIOTA-UHFFFAOYSA-N meoh methanol Chemical compound OC.OC COTNUBDHGSIOTA-UHFFFAOYSA-N 0.000 description 1
- 229950003168 merimepodib Drugs 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- JCVZXXSBCISMLJ-LURJTMIESA-N methyl (2s)-2-isocyanato-3-methylbutanoate Chemical compound COC(=O)[C@H](C(C)C)N=C=O JCVZXXSBCISMLJ-LURJTMIESA-N 0.000 description 1
- OGJDZVITLCFAII-UHFFFAOYSA-N methyl 2-(1,4-dioxaspiro[4.5]decan-8-ylidene)acetate Chemical compound C1CC(=CC(=O)OC)CCC21OCCO2 OGJDZVITLCFAII-UHFFFAOYSA-N 0.000 description 1
- NTNUDYROPUKXNA-UHFFFAOYSA-N methyl 2-(triphenyl-$l^{5}-phosphanylidene)acetate Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)(=CC(=O)OC)C1=CC=CC=C1 NTNUDYROPUKXNA-UHFFFAOYSA-N 0.000 description 1
- KMTPLRIOOJYJQD-UHFFFAOYSA-N methyl 3-(1,4-dioxaspiro[4.5]decan-8-ylamino)thiophene-2-carboxylate Chemical compound S1C=CC(NC2CCC3(CC2)OCCO3)=C1C(=O)OC KMTPLRIOOJYJQD-UHFFFAOYSA-N 0.000 description 1
- BQQHXIZCAPCAQE-UHFFFAOYSA-N methyl 3-amino-5-(4,4-dimethylcyclohexen-1-yl)thiophene-2-carboxylate Chemical compound NC1=C(C(=O)OC)SC(C=2CCC(C)(C)CC=2)=C1 BQQHXIZCAPCAQE-UHFFFAOYSA-N 0.000 description 1
- TWEQNZZOOFKOER-UHFFFAOYSA-N methyl 3-aminothiophene-2-carboxylate Chemical compound COC(=O)C=1SC=CC=1N TWEQNZZOOFKOER-UHFFFAOYSA-N 0.000 description 1
- UEARGZRWCIVDOO-UHFFFAOYSA-N methyl 3-anilino-5-(cyclohexen-1-yl)thiophene-2-carboxylate Chemical compound COC(=O)C=1SC(C=2CCCCC=2)=CC=1NC1=CC=CC=C1 UEARGZRWCIVDOO-UHFFFAOYSA-N 0.000 description 1
- PEGSJNCGPSIJOX-UHFFFAOYSA-N methyl 3-bromothiophene-2-carboxylate Chemical compound COC(=O)C=1SC=CC=1Br PEGSJNCGPSIJOX-UHFFFAOYSA-N 0.000 description 1
- XSKFBQUERIPAKH-UHFFFAOYSA-N methyl 5-(1,4-dioxaspiro[4.5]decan-8-yl)-3-[(4-methoxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylate Chemical compound C1CC(OC)CCC1N(C1=C(SC(=C1)C1CCC2(CC1)OCCO2)C(=O)OC)C(=O)C1CCC(C)CC1 XSKFBQUERIPAKH-UHFFFAOYSA-N 0.000 description 1
- XHDJCEAGKSIJBB-UHFFFAOYSA-N methyl 5-(4,4-dimethylcyclohexen-1-yl)-3-[[4-(methoxymethoxy)cyclohexyl]-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylate Chemical compound C1CC(OCOC)CCC1N(C1=C(SC(=C1)C=1CCC(C)(C)CC=1)C(=O)OC)C(=O)C1CCC(C)CC1 XHDJCEAGKSIJBB-UHFFFAOYSA-N 0.000 description 1
- IPICGJKKANUVMD-UHFFFAOYSA-N methyl 5-(4,4-dimethylcyclohexyl)-3-[(4-hydroxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylate Chemical compound COC(=O)C=1SC(C2CCC(C)(C)CC2)=CC=1N(C(=O)C1CCC(C)CC1)C1CCC(O)CC1 IPICGJKKANUVMD-UHFFFAOYSA-N 0.000 description 1
- NBXAFBUAJVRUIU-UHFFFAOYSA-N methyl 5-(4,4-dimethylcyclohexyl)-3-[(4-methylcyclohexanecarbonyl)-[4-(1,2,4-triazol-1-yl)cyclohexyl]amino]thiophene-2-carboxylate Chemical compound COC(=O)C=1SC(C2CCC(C)(C)CC2)=CC=1N(C(=O)C1CCC(C)CC1)C(CC1)CCC1N1C=NC=N1 NBXAFBUAJVRUIU-UHFFFAOYSA-N 0.000 description 1
- ATEZBAUSRGJRTP-UHFFFAOYSA-N methyl 5-(cyclohexen-1-yl)-3-(n-(4-methylcyclohexanecarbonyl)anilino)thiophene-2-carboxylate Chemical compound COC(=O)C=1SC(C=2CCCCC=2)=CC=1N(C=1C=CC=CC=1)C(=O)C1CCC(C)CC1 ATEZBAUSRGJRTP-UHFFFAOYSA-N 0.000 description 1
- UDFZVRTZRTUZLH-UHFFFAOYSA-N methyl 5-(cyclohexen-1-yl)-3-[(3-oxo-2-azaspiro[4.5]decan-8-yl)amino]thiophene-2-carboxylate Chemical compound COC(=O)C=1SC(C=2CCCCC=2)=CC=1NC(CC1)CCC21CNC(=O)C2 UDFZVRTZRTUZLH-UHFFFAOYSA-N 0.000 description 1
- HEZJUUMFRVLDCN-UHFFFAOYSA-N methyl 5-(cyclohexen-1-yl)-3-[(4-methylcyclohexanecarbonyl)-(1-pyrimidin-5-ylpiperidin-4-yl)amino]thiophene-2-carboxylate Chemical compound COC(=O)C=1SC(C=2CCCCC=2)=CC=1N(C(=O)C1CCC(C)CC1)C(CC1)CCN1C1=CN=CN=C1 HEZJUUMFRVLDCN-UHFFFAOYSA-N 0.000 description 1
- PYNHJVXZJFCQHI-UHFFFAOYSA-N methyl 5-(cyclohexen-1-yl)-3-[(4-methylcyclohexanecarbonyl)-(2-methyl-3-oxo-2-azaspiro[4.5]decan-8-yl)amino]thiophene-2-carboxylate Chemical compound COC(=O)C=1SC(C=2CCCCC=2)=CC=1N(C(=O)C1CCC(C)CC1)C(CC1)CCC21CN(C)C(=O)C2 PYNHJVXZJFCQHI-UHFFFAOYSA-N 0.000 description 1
- PFVAJVRMWSPGKC-UHFFFAOYSA-N methyl 5-(cyclohexen-1-yl)-3-[(4-methylcyclohexanecarbonyl)-(3-oxo-2,5,6,7,8,8a-hexahydro-1h-indolizin-7-yl)amino]thiophene-2-carboxylate Chemical compound COC(=O)C=1SC(C=2CCCCC=2)=CC=1N(C1CC2N(C(CC2)=O)CC1)C(=O)C1CCC(C)CC1 PFVAJVRMWSPGKC-UHFFFAOYSA-N 0.000 description 1
- UJPXPQITBKABOQ-UHFFFAOYSA-N methyl 5-(cyclohexen-1-yl)-3-[(4-methylcyclohexanecarbonyl)-[1-(2-methylpropanoyl)piperidin-4-yl]amino]thiophene-2-carboxylate Chemical compound COC(=O)C=1SC(C=2CCCCC=2)=CC=1N(C(=O)C1CCC(C)CC1)C1CCN(C(=O)C(C)C)CC1 UJPXPQITBKABOQ-UHFFFAOYSA-N 0.000 description 1
- WUDQZNWCZNXVSM-UHFFFAOYSA-N methyl 5-(cyclohexen-1-yl)-3-[1,3-dioxan-5-yl-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylate Chemical compound COC(=O)C=1SC(C=2CCCCC=2)=CC=1N(C(=O)C1CCC(C)CC1)C1COCOC1 WUDQZNWCZNXVSM-UHFFFAOYSA-N 0.000 description 1
- FRKRFOAZSVJFDM-UHFFFAOYSA-N methyl 5-bromo-3-[(1,3-dimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-8-yl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylate Chemical compound S1C(Br)=CC(N(C2CCC3(CC2)C(N(C)C(=O)N3C)=O)C(=O)C2CCC(C)CC2)=C1C(=O)OC FRKRFOAZSVJFDM-UHFFFAOYSA-N 0.000 description 1
- DNVFEPOGJHDYMJ-UHFFFAOYSA-N methyl 5-bromo-3-[(2,2-dimethyl-1,3-dioxan-5-yl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylate Chemical compound S1C(Br)=CC(N(C2COC(C)(C)OC2)C(=O)C2CCC(C)CC2)=C1C(=O)OC DNVFEPOGJHDYMJ-UHFFFAOYSA-N 0.000 description 1
- QRHBBGITAUTBKO-UHFFFAOYSA-N methyl 5-bromo-3-[1,3-dioxan-5-yl-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylate Chemical compound S1C(Br)=CC(N(C2COCOC2)C(=O)C2CCC(C)CC2)=C1C(=O)OC QRHBBGITAUTBKO-UHFFFAOYSA-N 0.000 description 1
- YMZBNCXRVMHBHA-UHFFFAOYSA-N methyl 5-cyclohex-2-en-1-yl-3-[(4-hydroxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylate Chemical compound COC(=O)C=1SC(C2C=CCCC2)=CC=1N(C(=O)C1CCC(C)CC1)C1CCC(O)CC1 YMZBNCXRVMHBHA-UHFFFAOYSA-N 0.000 description 1
- UODPHKFUTYRNDZ-UHFFFAOYSA-N methyl 5-cyclohex-2-en-1-yl-3-[(4-methylcyclohexanecarbonyl)-(4-oxocyclohexyl)amino]thiophene-2-carboxylate Chemical compound COC(=O)C=1SC(C2C=CCCC2)=CC=1N(C(=O)C1CCC(C)CC1)C1CCC(=O)CC1 UODPHKFUTYRNDZ-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- XMWFMEYDRNJSOO-UHFFFAOYSA-N morpholine-4-carbonyl chloride Chemical compound ClC(=O)N1CCOCC1 XMWFMEYDRNJSOO-UHFFFAOYSA-N 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- 239000002324 mouth wash Substances 0.000 description 1
- WOOWBQQQJXZGIE-UHFFFAOYSA-N n-ethyl-n-propan-2-ylpropan-2-amine Chemical compound CCN(C(C)C)C(C)C.CCN(C(C)C)C(C)C WOOWBQQQJXZGIE-UHFFFAOYSA-N 0.000 description 1
- 125000004923 naphthylmethyl group Chemical group C1(=CC=CC2=CC=CC=C12)C* 0.000 description 1
- 125000004593 naphthyridinyl group Chemical group N1=C(C=CC2=CC=CN=C12)* 0.000 description 1
- 239000006199 nebulizer Substances 0.000 description 1
- 125000005244 neohexyl group Chemical group [H]C([H])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- 239000002687 nonaqueous vehicle Substances 0.000 description 1
- 150000003833 nucleoside derivatives Chemical class 0.000 description 1
- 125000003835 nucleoside group Chemical group 0.000 description 1
- HYDZPXNVHXJHBG-UHFFFAOYSA-N o-benzylhydroxylamine;hydron;chloride Chemical compound Cl.NOCC1=CC=CC=C1 HYDZPXNVHXJHBG-UHFFFAOYSA-N 0.000 description 1
- NUXCOKIYARRTDC-UHFFFAOYSA-N o-ethylhydroxylamine;hydron;chloride Chemical compound Cl.CCON NUXCOKIYARRTDC-UHFFFAOYSA-N 0.000 description 1
- 239000012053 oil suspension Substances 0.000 description 1
- 229940006093 opthalmologic coloring agent diagnostic Drugs 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 125000001715 oxadiazolyl group Chemical group 0.000 description 1
- 125000000466 oxiranyl group Chemical group 0.000 description 1
- NXJCBFBQEVOTOW-UHFFFAOYSA-L palladium(2+);dihydroxide Chemical compound O[Pd]O NXJCBFBQEVOTOW-UHFFFAOYSA-L 0.000 description 1
- 238000010651 palladium-catalyzed cross coupling reaction Methods 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 230000036961 partial effect Effects 0.000 description 1
- 235000010603 pastilles Nutrition 0.000 description 1
- 230000037361 pathway Effects 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 125000002255 pentenyl group Chemical group C(=CCCC)* 0.000 description 1
- 125000005981 pentynyl group Chemical group 0.000 description 1
- 125000005561 phenanthryl group Chemical group 0.000 description 1
- 125000004482 piperidin-4-yl group Chemical group N1CCC(CC1)* 0.000 description 1
- 125000005936 piperidyl group Chemical group 0.000 description 1
- CHKVPAROMQMJNQ-UHFFFAOYSA-M potassium bisulfate Chemical compound [K+].OS([O-])(=O)=O CHKVPAROMQMJNQ-UHFFFAOYSA-M 0.000 description 1
- 229910000343 potassium bisulfate Inorganic materials 0.000 description 1
- LJCNRYVRMXRIQR-OLXYHTOASA-L potassium sodium L-tartrate Chemical compound [Na+].[K+].[O-]C(=O)[C@H](O)[C@@H](O)C([O-])=O LJCNRYVRMXRIQR-OLXYHTOASA-L 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 230000002335 preservative effect Effects 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- VVWRJUBEIPHGQF-UHFFFAOYSA-N propan-2-yl n-propan-2-yloxycarbonyliminocarbamate Chemical compound CC(C)OC(=O)N=NC(=O)OC(C)C VVWRJUBEIPHGQF-UHFFFAOYSA-N 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- 230000020978 protein processing Effects 0.000 description 1
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 1
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- GRJJQCWNZGRKAU-UHFFFAOYSA-N pyridin-1-ium;fluoride Chemical compound F.C1=CC=NC=C1 GRJJQCWNZGRKAU-UHFFFAOYSA-N 0.000 description 1
- ZDYVRSLAEXCVBX-UHFFFAOYSA-N pyridinium p-toluenesulfonate Chemical compound C1=CC=[NH+]C=C1.CC1=CC=C(S([O-])(=O)=O)C=C1 ZDYVRSLAEXCVBX-UHFFFAOYSA-N 0.000 description 1
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000006268 reductive amination reaction Methods 0.000 description 1
- 230000010076 replication Effects 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 102220065682 rs77311724 Human genes 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 210000002966 serum Anatomy 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 235000011006 sodium potassium tartrate Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical group 0.000 description 1
- XZPVPNZTYPUODG-UHFFFAOYSA-M sodium;chloride;dihydrate Chemical compound O.O.[Na+].[Cl-] XZPVPNZTYPUODG-UHFFFAOYSA-M 0.000 description 1
- 239000008247 solid mixture Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 238000013268 sustained release Methods 0.000 description 1
- 239000012730 sustained-release form Substances 0.000 description 1
- 238000001308 synthesis method Methods 0.000 description 1
- NHKZSTHOYNWEEZ-AFCXAGJDSA-N taribavirin Chemical compound N1=C(C(=N)N)N=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 NHKZSTHOYNWEEZ-AFCXAGJDSA-N 0.000 description 1
- 229950006081 taribavirin Drugs 0.000 description 1
- 229960002935 telaprevir Drugs 0.000 description 1
- BBAWEDCPNXPBQM-GDEBMMAJSA-N telaprevir Chemical compound N([C@H](C(=O)N[C@H](C(=O)N1C[C@@H]2CCC[C@@H]2[C@H]1C(=O)N[C@@H](CCC)C(=O)C(=O)NC1CC1)C(C)(C)C)C1CCCCC1)C(=O)C1=CN=CC=N1 BBAWEDCPNXPBQM-GDEBMMAJSA-N 0.000 description 1
- 108010017101 telaprevir Proteins 0.000 description 1
- GFNMJSGQSWLTOR-UHFFFAOYSA-N tert-butyl 4-[[5-(cyclohexen-1-yl)-2-methoxycarbonylthiophen-3-yl]-(4-methylcyclohexanecarbonyl)amino]piperidine-1-carboxylate Chemical compound COC(=O)C=1SC(C=2CCCCC=2)=CC=1N(C(=O)C1CCC(C)CC1)C1CCN(C(=O)OC(C)(C)C)CC1 GFNMJSGQSWLTOR-UHFFFAOYSA-N 0.000 description 1
- WYVFPGFWUKBXPZ-UHFFFAOYSA-N tert-butyl n-(4-oxocyclohexyl)carbamate Chemical compound CC(C)(C)OC(=O)NC1CCC(=O)CC1 WYVFPGFWUKBXPZ-UHFFFAOYSA-N 0.000 description 1
- 125000001973 tert-pentyl group Chemical group [H]C([H])([H])C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- 125000005247 tetrazinyl group Chemical group N1=NN=NC(=C1)* 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 125000001113 thiadiazolyl group Chemical group 0.000 description 1
- 125000005307 thiatriazolyl group Chemical group S1N=NN=C1* 0.000 description 1
- 125000004305 thiazinyl group Chemical group S1NC(=CC=C1)* 0.000 description 1
- 230000008719 thickening Effects 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 125000004588 thienopyridyl group Chemical group S1C(=CC2=C1C=CC=N2)* 0.000 description 1
- 150000003577 thiophenes Chemical class 0.000 description 1
- 229960000790 thymol Drugs 0.000 description 1
- DZXKSFDSPBRJPS-UHFFFAOYSA-N tin(2+);sulfide Chemical compound [S-2].[Sn+2] DZXKSFDSPBRJPS-UHFFFAOYSA-N 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- RUVINXPYWBROJD-ONEGZZNKSA-N trans-anethole Chemical compound COC1=CC=C(\C=C\C)C=C1 RUVINXPYWBROJD-ONEGZZNKSA-N 0.000 description 1
- 125000004306 triazinyl group Chemical group 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- CMHHITPYCHHOGT-UHFFFAOYSA-N tributylborane Chemical compound CCCCB(CCCC)CCCC CMHHITPYCHHOGT-UHFFFAOYSA-N 0.000 description 1
- REDSKZBUUUQMSK-UHFFFAOYSA-N tributyltin Chemical compound CCCC[Sn](CCCC)CCCC.CCCC[Sn](CCCC)CCCC REDSKZBUUUQMSK-UHFFFAOYSA-N 0.000 description 1
- 125000006000 trichloroethyl group Chemical group 0.000 description 1
- CYRMSUTZVYGINF-UHFFFAOYSA-N trichlorofluoromethane Chemical compound FC(Cl)(Cl)Cl CYRMSUTZVYGINF-UHFFFAOYSA-N 0.000 description 1
- 229940029284 trichlorofluoromethane Drugs 0.000 description 1
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 1
- 125000004205 trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 1
- CWMFRHBXRUITQE-UHFFFAOYSA-N trimethylsilylacetylene Chemical group C[Si](C)(C)C#C CWMFRHBXRUITQE-UHFFFAOYSA-N 0.000 description 1
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 229950002810 valopicitabine Drugs 0.000 description 1
- 230000029812 viral genome replication Effects 0.000 description 1
- 201000001862 viral hepatitis Diseases 0.000 description 1
- 239000003039 volatile agent Substances 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/26—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D333/38—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D333/40—Thiophene-2-carboxylic acid
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/38—Heterocyclic compounds having sulfur as a ring hetero atom
- A61K31/381—Heterocyclic compounds having sulfur as a ring hetero atom having five-membered rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P1/00—Drugs for disorders of the alimentary tract or the digestive system
- A61P1/16—Drugs for disorders of the alimentary tract or the digestive system for liver or gallbladder disorders, e.g. hepatoprotective agents, cholagogues, litholytics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/12—Antivirals
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/12—Antivirals
- A61P31/14—Antivirals for RNA viruses
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/02—Immunomodulators
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/02—Immunomodulators
- A61P37/04—Immunostimulants
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/26—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D333/38—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing three or more hetero rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Veterinary Medicine (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Immunology (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Virology (AREA)
- Oncology (AREA)
- Communicable Diseases (AREA)
- Gastroenterology & Hepatology (AREA)
- Molecular Biology (AREA)
- Epidemiology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Thiazole And Isothizaole Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US68048205P | 2005-05-13 | 2005-05-13 | |
| US60/680,482 | 2005-05-13 | ||
| PCT/CA2006/000786 WO2006119646A1 (en) | 2005-05-13 | 2006-05-15 | Compounds and methods for the treatment or prevention of flavivirus infections |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| CA2607359A1 CA2607359A1 (en) | 2006-11-16 |
| CA2607359C true CA2607359C (en) | 2011-08-09 |
Family
ID=37396165
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA2607359A Expired - Fee Related CA2607359C (en) | 2005-05-13 | 2006-05-15 | Compounds and methods for the treatment or prevention of flavivirus infections |
Country Status (16)
| Country | Link |
|---|---|
| US (3) | US7569600B2 (cg-RX-API-DMAC7.html) |
| EP (3) | EP2546246A3 (cg-RX-API-DMAC7.html) |
| JP (1) | JP5030947B2 (cg-RX-API-DMAC7.html) |
| KR (1) | KR20080016597A (cg-RX-API-DMAC7.html) |
| CN (2) | CN101218224B (cg-RX-API-DMAC7.html) |
| AP (1) | AP2007004245A0 (cg-RX-API-DMAC7.html) |
| AU (1) | AU2006246227B2 (cg-RX-API-DMAC7.html) |
| BR (1) | BRPI0610283A2 (cg-RX-API-DMAC7.html) |
| CA (1) | CA2607359C (cg-RX-API-DMAC7.html) |
| EA (1) | EA016071B1 (cg-RX-API-DMAC7.html) |
| ES (1) | ES2415742T3 (cg-RX-API-DMAC7.html) |
| MX (1) | MX2007014117A (cg-RX-API-DMAC7.html) |
| NZ (1) | NZ563909A (cg-RX-API-DMAC7.html) |
| SG (1) | SG161315A1 (cg-RX-API-DMAC7.html) |
| WO (1) | WO2006119646A1 (cg-RX-API-DMAC7.html) |
| ZA (1) | ZA200709727B (cg-RX-API-DMAC7.html) |
Families Citing this family (45)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JP4544857B2 (ja) * | 2001-06-11 | 2010-09-15 | ヴァイロケム ファーマ インコーポレイテッド | Flavivirus感染の治療または予防のための化合物および方法 |
| US8329924B2 (en) * | 2001-06-11 | 2012-12-11 | Vertex Pharmaceuticals (Canada) Incorporated | Compounds and methods for the treatment or prevention of Flavivirus infections |
| EP2546246A3 (en) * | 2005-05-13 | 2013-04-24 | Virochem Pharma Inc. | Compounds and methods for the treatment or prevention of flavivirus infections |
| AU2007321677B2 (en) | 2006-11-15 | 2013-04-11 | Vertex Pharmaceuticals (Canada) Incorporated | Thiophene analogues for the treatment or prevention of flavivirus infections |
| JP2010521457A (ja) * | 2007-03-12 | 2010-06-24 | メルク・シャープ・エンド・ドーム・コーポレイション | 単環式アニリドスピロラクタムcgrp受容体アンタゴニスト |
| DK2308514T3 (da) | 2007-03-23 | 2013-09-02 | To Bbb Holding B V | Konjugater til målrettet lægemiddeltransport gennem blod-hjerne barrieren |
| JP2010526143A (ja) | 2007-05-04 | 2010-07-29 | バーテックス ファーマシューティカルズ インコーポレイテッド | Hcv感染の処置のための併用療法 |
| PH12012502343A1 (en) | 2007-05-23 | 2013-06-17 | Siga Tech Inc | Antiviral drugs for treatment or prevention of dengue infection |
| GB0712393D0 (en) * | 2007-06-26 | 2007-08-01 | Smithkline Beecham Corp | Compounds |
| CN101903351B (zh) | 2007-12-19 | 2014-09-10 | 贝林格尔.英格海姆国际有限公司 | 病毒聚合酶抑制剂 |
| US20110212986A1 (en) * | 2008-08-21 | 2011-09-01 | Health Research, Inc. | Anti-flavivirus therapeutic |
| RU2011127080A (ru) | 2009-01-07 | 2013-02-20 | Сайнексис, Инк. | Производное циклоспорина для применения в лечении заражения вирусом гепатита с и вич |
| JP5327744B2 (ja) * | 2009-03-13 | 2013-10-30 | 国立大学法人 鹿児島大学 | ジフェニルメタン誘導体を有効成分とする抗ウイルス剤 |
| AU2010276441B2 (en) * | 2009-07-21 | 2015-07-02 | Gilead Sciences, Inc. | Inhibitors of Flaviviridae viruses |
| KR20120081123A (ko) | 2009-09-09 | 2012-07-18 | 길리애드 사이언시즈, 인코포레이티드 | 플라비비리대 바이러스의 억제제 |
| EP2477982A4 (en) * | 2009-09-16 | 2013-04-03 | Calcimedica Inc | COMPOUNDS THAT MODULATE INTRACELLULAR CALCIUM |
| JP2013512247A (ja) | 2009-11-25 | 2013-04-11 | バーテックス ファーマシューティカルズ インコーポレイテッド | フラビウイルス感染症の治療または予防のための5−アルキニル−チオフェン−2−カルボン酸誘導体およびそれらの使用 |
| SI2523950T1 (sl) | 2010-01-15 | 2017-06-30 | Gilead Sciences, Inc. | Inhibitorji flaviviridae virusov |
| WO2011088303A1 (en) * | 2010-01-15 | 2011-07-21 | Gilead Sciences , Inc. | Inhibitors of flaviviridae viruses |
| MX2012014918A (es) | 2010-06-28 | 2013-04-08 | Vertex Pharma | Compuestos y metodos para tratamiento o prevencion de infecciones por flavivirus. |
| WO2012006060A1 (en) * | 2010-06-28 | 2012-01-12 | Vertex Pharmaceuticals Incorporated | Compounds and methods for the treatment or prevention of flavivirus infections |
| WO2012024363A2 (en) | 2010-08-17 | 2012-02-23 | Vertex Pharmaceuticals Incorporated | Compounds and methods for the treatment or prevention of flaviviridae viral infections |
| WO2012083105A1 (en) | 2010-12-17 | 2012-06-21 | Cocrystal Discovery, Inc. | Inhibitors of hepatitis c virus polymerase |
| US20130203706A1 (en) * | 2011-06-28 | 2013-08-08 | Vertex Pharmaceuticals Incorporated | Compounds and methods for the treatment or prevention of flavivirus infections |
| PT2734515E (pt) * | 2011-07-13 | 2016-03-11 | Gilead Sciences Inc | Derivados de ácido tiofen-2-carboxílico úteis como inibidores de vírus flaviviridae |
| CN103059042B (zh) * | 2011-10-18 | 2015-10-07 | 银杏树药业(苏州)有限公司 | 噻吩类衍生物及其在药学中的用途 |
| US8466159B2 (en) | 2011-10-21 | 2013-06-18 | Abbvie Inc. | Methods for treating HCV |
| CN104023726A (zh) | 2011-10-21 | 2014-09-03 | 艾伯维公司 | 用于治疗hcv的一种或多种daa的联合治疗(例如,与abt-072或abt-333) |
| GB2506086A (en) | 2011-10-21 | 2014-03-19 | Abbvie Inc | Methods for treating HCV comprising at least two direct acting antiviral agent, ribavirin but not interferon |
| US8492386B2 (en) | 2011-10-21 | 2013-07-23 | Abbvie Inc. | Methods for treating HCV |
| CN103087052A (zh) * | 2011-10-31 | 2013-05-08 | 上海壹志医药科技有限公司 | 噻吩衍生物及其药物用途 |
| WO2014055142A1 (en) | 2012-06-20 | 2014-04-10 | Cocrystal Discovery, Inc. | Inhibitors of hepatitis c virus polymerase |
| US8841340B2 (en) | 2012-08-17 | 2014-09-23 | Gilead Sciences, Inc. | Solid forms of an antiviral compound |
| US8927741B2 (en) | 2012-08-17 | 2015-01-06 | Gilead Sciences, Inc. | Synthesis of an antiviral compound |
| US8759544B2 (en) | 2012-08-17 | 2014-06-24 | Gilead Sciences, Inc. | Synthesis of an antiviral compound |
| TWI731854B (zh) | 2015-03-23 | 2021-07-01 | 美商共結晶製藥公司 | C型肝炎病毒聚合酶之抑制劑 |
| US11192914B2 (en) | 2016-04-28 | 2021-12-07 | Emory University | Alkyne containing nucleotide and nucleoside therapeutic compositions and uses related thereto |
| CN106467477A (zh) * | 2016-08-26 | 2017-03-01 | 天津雅奥科技发展有限公司 | 一种合成化合物(1‑环丙基‑1‑氰基‑4‑环己酮)的新方法 |
| MX2020011912A (es) | 2018-05-09 | 2021-01-29 | Cocrystal Pharma Inc | Terapia de combinacion para el tratamiento del virus de la hepatitis c (vhc). |
| CR20200618A (es) | 2018-06-19 | 2021-01-21 | Novartis Ag | Derivados de tetrahidrotienopiridina n-sustituidos y sus usos |
| CN110592172B (zh) * | 2019-10-29 | 2021-05-28 | 华中农业大学 | 利用CRISPR/Cas9敲除文库技术筛选JEV抗性基因的方法与靶点 |
| CN111518015A (zh) * | 2020-05-20 | 2020-08-11 | 上海合全药物研发有限公司 | 一种叔丁基-8-氧亚基-2-氮杂螺[4.5]癸烷-2-甲酸基酯的制备方法 |
| CN113861176B (zh) * | 2021-09-28 | 2023-11-03 | 北京凯因格领生物技术有限公司 | 一种黄病毒抑制剂 |
| EP4282862A1 (en) * | 2022-05-25 | 2023-11-29 | Irbm S.P.A. | Flavivirus inhibitors |
| WO2024254161A2 (en) * | 2023-06-05 | 2024-12-12 | Celloram Inc. | Inhibitors of fatty acid binding proteins (fabps), methods of use and methods of making |
Family Cites Families (92)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3076817A (en) * | 1963-02-05 | New j-amino-thiophene-z | ||
| DE1055007B (de) | 1957-08-29 | 1959-04-16 | Dr Hans Fiesselmann | Verfahren zur Herstellung von 3-Aminothiophen-2-carbonsaeureestern und den entsprechenden freien Carbonsaeuren |
| US3470151A (en) | 1966-05-17 | 1969-09-30 | Beecham Group Ltd | Furyl- and thienyl-penicillins and salts thereof |
| AU518216B2 (en) * | 1977-09-06 | 1981-09-17 | Hafslund Nycomed Pharma Aktiengesellschaft | Thienothiazine derivatives |
| GB8627698D0 (en) | 1986-11-20 | 1986-12-17 | Boots Co Plc | Therapeutic agents |
| US4962101A (en) | 1989-08-21 | 1990-10-09 | Merck & Co., Inc. | 2-(Heterocyclylalkyl)phenyl carbapenem antibacterial agents |
| JPH0748360A (ja) | 1993-05-31 | 1995-02-21 | Yoshitomi Pharmaceut Ind Ltd | ビフェニルテトラゾール誘導体 |
| JP4080541B2 (ja) | 1996-10-18 | 2008-04-23 | バーテックス ファーマシューティカルズ インコーポレイテッド | セリンプロテアーゼ、特にc型肝炎ウイルスns3プロテアーゼの阻害因子 |
| JP4000608B2 (ja) * | 1996-11-07 | 2007-10-31 | トヨタ自動車株式会社 | 水素製造充填装置および電気自動車 |
| TW523506B (en) * | 1996-12-18 | 2003-03-11 | Ono Pharmaceutical Co | Sulfonamide or carbamide derivatives and drugs containing the same as active ingredients |
| WO1998046588A2 (en) * | 1997-04-11 | 1998-10-22 | Neorx Corporation | Compounds and therapies for the prevention of vascular and non-vascular pathologies |
| IL131318A (en) * | 1997-04-28 | 2004-08-31 | Encysive Pharmaceuticals Inc | Pharmaceutically acceptable salts of sulfonamides for treatment of endothelin-mediated disorders |
| US5783705A (en) * | 1997-04-28 | 1998-07-21 | Texas Biotechnology Corporation | Process of preparing alkali metal salys of hydrophobic sulfonamides |
| DE69826695T2 (de) | 1997-05-23 | 2006-02-02 | Bayer Pharmaceuticals Corp., West Haven | Arylharnstoffderivate zur behandlung von inflammatorischen oder immunomodulatorischen erkrankungen |
| DE69839639D1 (en) | 1997-05-23 | 2008-08-07 | Bayer Pharmaceuticals Corp | Raf kinase hemmer |
| US6187799B1 (en) * | 1997-05-23 | 2001-02-13 | Onyx Pharmaceuticals | Inhibition of raf kinase activity using aryl ureas |
| HUP0004853A3 (en) | 1997-08-11 | 2001-12-28 | Boehringer Ingelheim Ca Ltd | Hepatitis c inhibitor peptides, process for preparation thereof, pharmaceutical compositions comprising thereof, their use and their intermediates |
| DE69827956T2 (de) | 1997-08-11 | 2005-04-14 | Boehringer Ingelheim (Canada) Ltd., Laval | Peptidanaloga mit inhibitorischer wirkung auf hepatitis c |
| ATE228119T1 (de) * | 1998-04-15 | 2002-12-15 | Pfizer Prod Inc | Heterocyclische carboxamide |
| EP0960882A1 (en) * | 1998-05-19 | 1999-12-01 | Hoechst Marion Roussel Deutschland GmbH | Thienyl substituted acylguanidines as inhibitors of bone resorption and vitronectin receptor antagonists |
| US6858223B2 (en) * | 1998-06-23 | 2005-02-22 | Altana Pharma Ag | Compositions comprising phenylaminothiophenacetic acid derivatives for the treatment of acute or adult respiratory distress syndrome (ARDS) and infant respiratory distress syndrome (IRDS) |
| ATE253061T1 (de) * | 1998-06-29 | 2003-11-15 | Iaf Biochem Int | Zur behandlung von krebs nützliche thiophen- und furan-2,5-dicarboxamide |
| ES2244204T3 (es) | 1998-07-27 | 2005-12-01 | Istituto Di Ricerche Di Biologia Molecolare P. Angeletti S.P.A. | Derivados de dicetoacidos como inhibidores de polimerasas. |
| US6323180B1 (en) | 1998-08-10 | 2001-11-27 | Boehringer Ingelheim (Canada) Ltd | Hepatitis C inhibitor tri-peptides |
| AR022061A1 (es) | 1998-08-10 | 2002-09-04 | Boehringer Ingelheim Ca Ltd | Peptidos inhibidores de la hepatitis c, una composicion farmaceutica que los contiene, el uso de los mismos para preparar una composicion farmaceutica, el uso de un producto intermedio para la preparacion de estos peptidos y un procedimiento para la preparacion de un peptido analogo de los mismos. |
| HRP20010206A2 (en) | 1998-08-20 | 2004-02-29 | Agouron Pharma | NON-PEPTIDE GnRH AGENTS, METHODS AND INTERMEDIATES FOR THEIR PREPARATION |
| DE19903398A1 (de) | 1999-01-29 | 2000-08-10 | Hassan Jomaa | Verwendung von Thiadiazolderivaten zur prophylaktischen und therapeutischen Behandlung von Infektionen |
| WO2000055139A2 (en) * | 1999-03-12 | 2000-09-21 | Boehringer Ingelheim Pharmaceuticals, Inc. | Heterocyclic urea and related compounds useful as anti-inflammatory agents |
| UA74546C2 (en) | 1999-04-06 | 2006-01-16 | Boehringer Ingelheim Ca Ltd | Macrocyclic peptides having activity relative to hepatitis c virus, a pharmaceutical composition and use of the pharmaceutical composition |
| JP2001010957A (ja) | 1999-04-28 | 2001-01-16 | Sankyo Co Ltd | 肝障害の予防または抑制剤 |
| DE19920247A1 (de) | 1999-05-03 | 2000-11-16 | Hassan Jomaa | Arzneimittel mit einem Gehalt an Verbindungen mit einem Stickstoff-Sauerstoff-Heterocyclus als Wirkstoff und ihre Verwendung |
| HN2000000051A (es) * | 1999-05-19 | 2001-02-02 | Pfizer Prod Inc | Derivados heterociclicos utiles como agentes anticancerosos |
| CA2385972A1 (en) | 1999-10-01 | 2001-04-12 | Haruhisa Ogita | Novel diarylamide derivatives and use thereof as medicines |
| DE60008416D1 (de) * | 1999-11-29 | 2004-03-25 | Novartis Ag | Pestizide n-heteroaryl alpha-alkoximinocarbonsäureamide |
| WO2001047883A1 (fr) | 1999-12-27 | 2001-07-05 | Japan Tobacco Inc. | Composes a cycles accoles et leur utilisation comme medicaments |
| DE10002424A1 (de) * | 2000-01-20 | 2001-07-26 | Siemens Ag | Di(het)arylaminothiophen-Derivate |
| AU2001261377A1 (en) | 2000-05-10 | 2001-11-20 | Smith Kline Beecham Corporation | Novel anti-infectives |
| MY164523A (en) | 2000-05-23 | 2017-12-29 | Univ Degli Studi Cagliari | Methods and compositions for treating hepatitis c virus |
| US6414013B1 (en) * | 2000-06-19 | 2002-07-02 | Pharmacia & Upjohn S.P.A. | Thiophene compounds, process for preparing the same, and pharmaceutical compositions containing the same background of the invention |
| GB0017676D0 (en) | 2000-07-19 | 2000-09-06 | Angeletti P Ist Richerche Bio | Inhibitors of viral polymerase |
| SV2003000617A (es) | 2000-08-31 | 2003-01-13 | Lilly Co Eli | Inhibidores de la proteasa peptidomimetica ref. x-14912m |
| WO2002028353A2 (en) | 2000-10-05 | 2002-04-11 | Smithkline Beecham Corporation | Phosphate transport inhibitors |
| EG23122A (en) | 2000-11-08 | 2004-04-28 | Syngenta Participations Ag | Pyrrolcarboxamides and pyrrolcarbothioamides |
| ES2263687T3 (es) | 2000-11-20 | 2006-12-16 | Bristol-Myers Squibb Company | Inhibidores tripeptidicos de la hepatitis c. |
| US6892279B2 (en) * | 2000-11-30 | 2005-05-10 | Mosaid Technologies Incorporated | Method and apparatus for accelerating retrieval of data from a memory system with cache by reducing latency |
| DE10061876A1 (de) * | 2000-12-12 | 2002-06-20 | Aventis Pharma Gmbh | Arylierte Furan- und Thiophencarbonsäureamide, Verfahren zu ihrer Herstellung, ihre Verwendung als Medikament sowie sie enthaltende pharmazeutische Zubereitungen |
| ATE526339T1 (de) | 2001-01-22 | 2011-10-15 | Merck Sharp & Dohme | Nukleosidderivate als inhibitoren der rna- abhängigen viralen rna-polymerase |
| AU2002252183A1 (en) | 2001-03-06 | 2002-09-19 | Biocryst Pharmaceuticals, Inc. | Nucleosides, preparation thereof and use as inhibitors of rna viral polymerases |
| US6734207B2 (en) * | 2001-04-20 | 2004-05-11 | Parker Hughes Institute | Cytotoxic compounds |
| EP1256628A3 (en) | 2001-05-10 | 2003-03-19 | Agouron Pharmaceuticals, Inc. | Hepatitis c virus (hcv) ns5b rna polymerase and mutants thereof |
| US6713638B2 (en) * | 2001-05-18 | 2004-03-30 | Joel M. Linden | 2-amino-3-aroyl-4,5 alkylthiophenes: agonist allosteric enhancers at human A1 adenosine receptors |
| AR036081A1 (es) | 2001-06-07 | 2004-08-11 | Smithkline Beecham Corp | Compuesto de 1,2-dihidroquinolina, su uso para preparar una composicion farmaceutica, metodos para prepararlo y compuestos del acido 2-aminobenzoico n-alquilado de utilidad como intermediarios en dichos metodos |
| EP1395571A1 (en) | 2001-06-11 | 2004-03-10 | Shire Biochem Inc. | Compounds and methods for the treatment or prevention of flavivirus infections |
| JP4544857B2 (ja) | 2001-06-11 | 2010-09-15 | ヴァイロケム ファーマ インコーポレイテッド | Flavivirus感染の治療または予防のための化合物および方法 |
| AR035543A1 (es) | 2001-06-26 | 2004-06-16 | Japan Tobacco Inc | Agente terapeutico para la hepatitis c que comprende un compuesto de anillo condensado, compuesto de anillo condensado, composicion farmaceutica que lo comprende, compuestos de benzimidazol, tiazol y bifenilo utiles como intermediarios para producir dichos compuestos, uso del compuesto de anillo con |
| EP2335700A1 (en) | 2001-07-25 | 2011-06-22 | Boehringer Ingelheim (Canada) Ltd. | Hepatitis C virus polymerase inhibitors with a heterobicylic structure |
| SE0102617D0 (sv) * | 2001-07-25 | 2001-07-25 | Astrazeneca Ab | Novel compounds |
| WO2003026587A2 (en) | 2001-09-26 | 2003-04-03 | Bristol-Myers Squibb Company | Compounds useful for treating hepatitus c virus |
| ATE414697T1 (de) * | 2001-10-04 | 2008-12-15 | Smithkline Beecham Corp | Nf-kb-inhibitoren |
| MXPA04003825A (es) | 2001-10-24 | 2004-07-08 | Vertex Pharma | Inhibidores de serina proteasa, en particular la ns3-ns4a proteasa del virus de hepatitis c, que incorpora un sistema de anillo fusionado. |
| TWI281916B (en) * | 2001-10-25 | 2007-06-01 | Lilly Co Eli | Antitumor compounds and methods |
| AU2002352443A1 (en) * | 2001-12-21 | 2003-07-15 | Consejo Superior De Investigaciones Cientificas | Compounds and their therapeutic use related to the phosphorylating activity of the enzyme gsk-3 |
| US6835745B2 (en) * | 2002-01-15 | 2004-12-28 | Wyeth | Phenyl substituted thiophenes as estrogenic agents |
| DE10203122A1 (de) | 2002-01-25 | 2003-07-31 | Gruenenthal Gmbh | Verfahren zur Herstellung von substituierten Acrylsäureestern bzw. deren Einsatz zur Herstellung von substituierten gamma-Aminosäuren |
| MXPA04009938A (es) | 2002-04-11 | 2004-12-13 | Vertex Pharma | Inhibidores de serina proteasas, en particular la proteasa ns3-ns4a del hcv. |
| JP2005530759A (ja) | 2002-05-06 | 2005-10-13 | ジェネラブズ テクノロジーズ インコーポレーティッド | C型肝炎ウイルス感染症を治療するためのヌクレオシド誘導体 |
| JP2005538953A (ja) * | 2002-05-28 | 2005-12-22 | 3−ディメンショナル ファーマシューティカルズ, インコーポレイテッド | 新規チオフェンアミジン、それらの組成物、および補体媒介疾患および病気を治療する方法 |
| US7179836B2 (en) * | 2002-09-20 | 2007-02-20 | Smithkline Beecham Corporation | Chemical compounds |
| WO2004052879A1 (en) | 2002-12-10 | 2004-06-24 | Virochem Pharma Inc. | Thiophenederivatives for the treatment of flavivirus infections |
| PT1569929E (pt) | 2002-12-10 | 2010-06-18 | Virochem Pharma Inc | Compostos e métodos para o tratamento ou prevenção de infecções por flavivírus |
| JP4926403B2 (ja) | 2002-12-10 | 2012-05-09 | ヴァイロケム ファーマ インコーポレイテッド | フラビウイルス感染の処置もしくは予防のための化合物および方法 |
| US7098241B2 (en) * | 2002-12-16 | 2006-08-29 | Hoffmann-La Roche Inc. | Thiophene hydroxamic acid derivatives |
| US20050090450A1 (en) | 2003-04-11 | 2005-04-28 | Farmer Luc J. | Inhibitors of serine proteases, particularly HCV NS3-NS4A protease |
| EP1613620A1 (en) | 2003-04-11 | 2006-01-11 | Vertex Pharmaceuticals Incorporated | Inhibitors of serine proteases, particularly hcv ns3-ns4a protease |
| US20050113566A1 (en) | 2003-04-25 | 2005-05-26 | Player Mark R. | Inhibitors of C-FMS kinase |
| CA2523808A1 (en) | 2003-05-16 | 2004-12-23 | Ambit Biosciences Corporation | Pyrrole compounds and uses thereof |
| US7345046B2 (en) | 2003-05-30 | 2008-03-18 | Chiron Corporation | Heteroaryl-fused pyrimidinyl compounds as anticancer agents |
| US7109172B2 (en) | 2003-07-18 | 2006-09-19 | Vertex Pharmaceuticals Incorporated | Inhibitors of serine proteases, particularly HCV NS3-NS4A protease |
| TWI359147B (en) | 2003-09-05 | 2012-03-01 | Vertex Pharma | Inhibitors of serine proteases, particularly hcv n |
| US20050119189A1 (en) | 2003-09-18 | 2005-06-02 | Cottrell Kevin M. | Inhibitors of serine proteases, particularly HCV NS3-NS4A protease |
| GB0324653D0 (en) | 2003-10-22 | 2003-11-26 | Syngenta Participations Ag | Fungicides |
| DE10359791A1 (de) * | 2003-12-19 | 2005-07-21 | Bayer Healthcare Ag | Substituierte Thiophene |
| EP1711515A2 (en) | 2004-02-04 | 2006-10-18 | Vertex Pharmaceuticals Incorporated | Inhibitors of serine proteases, particularly hcv ns3-ns4a protease |
| WO2006093518A2 (en) | 2004-06-25 | 2006-09-08 | Apath, Llc | Thienyl compounds for treating virus-related conditions |
| CA2573185A1 (en) | 2004-07-14 | 2006-02-23 | Ptc Therapeutics, Inc. | Methods for treating hepatitis c |
| FR2873692B1 (fr) | 2004-07-29 | 2006-12-01 | Univ Claude Bernard Lyon | COMPOSITIONS CONTENANT, EN ASSOCIATION AVEC UN AGENT ANTIMICROBIEN, UN COMPOSE THIOPHENIQUE OU BENZOTHIOPHENIQUE DE FORMULE(I)PRESENTANT UNE ACTIVITE INHIBITRICE DE POMPE NorA |
| MX2007003812A (es) | 2004-10-01 | 2007-05-24 | Vertex Pharma | Inhibicion de proteasa ns3-ns4a del virus de la hepatitis c (vhc). |
| DE102005028077A1 (de) | 2004-12-22 | 2006-07-13 | Aicuris Gmbh & Co. Kg | Alkinyl-substituierte Thiophene |
| DE102004061746A1 (de) | 2004-12-22 | 2006-07-06 | Bayer Healthcare Ag | Alkinyl-substituierte Thiophene |
| EP2546246A3 (en) * | 2005-05-13 | 2013-04-24 | Virochem Pharma Inc. | Compounds and methods for the treatment or prevention of flavivirus infections |
| JP2006334109A (ja) | 2005-06-01 | 2006-12-14 | Matsushita Electric Works Ltd | ヘアセット装置 |
| AU2007321677B2 (en) | 2006-11-15 | 2013-04-11 | Vertex Pharmaceuticals (Canada) Incorporated | Thiophene analogues for the treatment or prevention of flavivirus infections |
-
2006
- 2006-05-15 EP EP12004718.8A patent/EP2546246A3/en not_active Withdrawn
- 2006-05-15 JP JP2008510379A patent/JP5030947B2/ja not_active Expired - Fee Related
- 2006-05-15 EA EA200702493A patent/EA016071B1/ru not_active IP Right Cessation
- 2006-05-15 AU AU2006246227A patent/AU2006246227B2/en not_active Ceased
- 2006-05-15 AP AP2007004245A patent/AP2007004245A0/xx unknown
- 2006-05-15 CA CA2607359A patent/CA2607359C/en not_active Expired - Fee Related
- 2006-05-15 BR BRPI0610283-2A patent/BRPI0610283A2/pt not_active IP Right Cessation
- 2006-05-15 EP EP06741500A patent/EP1879879B1/en active Active
- 2006-05-15 CN CN2006800248617A patent/CN101218224B/zh not_active Expired - Fee Related
- 2006-05-15 NZ NZ563909A patent/NZ563909A/en not_active IP Right Cessation
- 2006-05-15 ES ES06741500T patent/ES2415742T3/es active Active
- 2006-05-15 KR KR1020077028215A patent/KR20080016597A/ko not_active Ceased
- 2006-05-15 US US11/433,749 patent/US7569600B2/en not_active Expired - Fee Related
- 2006-05-15 SG SG201002905-6A patent/SG161315A1/en unknown
- 2006-05-15 EP EP12004696A patent/EP2543664A1/en not_active Withdrawn
- 2006-05-15 MX MX2007014117A patent/MX2007014117A/es active IP Right Grant
- 2006-05-15 CN CN2012101163717A patent/CN102718744A/zh active Pending
- 2006-05-15 WO PCT/CA2006/000786 patent/WO2006119646A1/en not_active Ceased
-
2007
- 2007-11-12 ZA ZA200709727A patent/ZA200709727B/xx unknown
-
2009
- 2009-07-24 US US12/508,893 patent/US8158675B2/en not_active Expired - Fee Related
-
2012
- 2012-03-09 US US13/416,565 patent/US8674118B2/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| AU2006246227A1 (en) | 2006-11-16 |
| JP2008540463A (ja) | 2008-11-20 |
| US20060276533A1 (en) | 2006-12-07 |
| US7569600B2 (en) | 2009-08-04 |
| EP2543664A1 (en) | 2013-01-09 |
| KR20080016597A (ko) | 2008-02-21 |
| JP5030947B2 (ja) | 2012-09-19 |
| BRPI0610283A2 (pt) | 2010-10-19 |
| CN101218224A (zh) | 2008-07-09 |
| ZA200709727B (en) | 2008-11-26 |
| US20120164103A1 (en) | 2012-06-28 |
| EA016071B1 (ru) | 2012-01-30 |
| EP1879879B1 (en) | 2013-03-27 |
| WO2006119646A1 (en) | 2006-11-16 |
| US20100093775A1 (en) | 2010-04-15 |
| CN102718744A (zh) | 2012-10-10 |
| CN101218224B (zh) | 2013-05-08 |
| MX2007014117A (es) | 2008-02-05 |
| NZ563909A (en) | 2011-10-28 |
| CA2607359A1 (en) | 2006-11-16 |
| US8158675B2 (en) | 2012-04-17 |
| EP1879879A1 (en) | 2008-01-23 |
| ES2415742T3 (es) | 2013-07-26 |
| AP2007004245A0 (en) | 2007-12-31 |
| EA200702493A1 (ru) | 2008-04-28 |
| EP2546246A3 (en) | 2013-04-24 |
| AU2006246227B2 (en) | 2011-04-28 |
| EP1879879A4 (en) | 2010-03-10 |
| HK1112910A1 (en) | 2008-09-19 |
| EP2546246A2 (en) | 2013-01-16 |
| SG161315A1 (en) | 2010-05-27 |
| US8674118B2 (en) | 2014-03-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA2607359C (en) | Compounds and methods for the treatment or prevention of flavivirus infections | |
| AU2007321677B2 (en) | Thiophene analogues for the treatment or prevention of flavivirus infections | |
| AU2002344854B2 (en) | Thiophene derivatives as antiviral agents for flavivirus infection | |
| EP1569929B9 (en) | Compounds and methods for the treatment or prevention of flavivirus infections | |
| KR101058696B1 (ko) | 후라비바이러스 감염의 치료 또는 예방을 위한 화합물과방법 | |
| AU2010326225A1 (en) | 5-alkynyl-thiophene-2-carboxylic acid derivatives and their use for the treatment or prevention of flavivirus infections | |
| AU2011205048B2 (en) | Compounds and methods for the treatment or prevention of flavivirus infections | |
| HK1112910B (en) | Compounds and methods for the treatment or prevention of flavivirus infections | |
| HK1177453A (en) | Compounds and methods for the treatment or prevention of flavivirus infections | |
| AU2013206705A1 (en) | Thiophene analogues for the treatment or prevention of flavivirus infections |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| EEER | Examination request | ||
| MKLA | Lapsed |
Effective date: 20160516 |