CA2485012A1 - 1h-imidazo[4,5-c] quinoline derivatives in the treatment of protein kinase dependent diseases - Google Patents
1h-imidazo[4,5-c] quinoline derivatives in the treatment of protein kinase dependent diseases Download PDFInfo
- Publication number
- CA2485012A1 CA2485012A1 CA002485012A CA2485012A CA2485012A1 CA 2485012 A1 CA2485012 A1 CA 2485012A1 CA 002485012 A CA002485012 A CA 002485012A CA 2485012 A CA2485012 A CA 2485012A CA 2485012 A1 CA2485012 A1 CA 2485012A1
- Authority
- CA
- Canada
- Prior art keywords
- phenyl
- chloro
- imidazo
- quinolin
- quinoline
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- 238000011282 treatment Methods 0.000 title claims abstract description 67
- 201000010099 disease Diseases 0.000 title claims abstract description 64
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 title claims abstract description 64
- 102000001253 Protein Kinase Human genes 0.000 title claims abstract description 51
- 108060006633 protein kinase Proteins 0.000 title claims abstract description 51
- 230000001419 dependent effect Effects 0.000 title claims abstract description 32
- ITIRVXDSMXFTPW-UHFFFAOYSA-N 1H-imidazo[4,5-c]quinoline Chemical class C1=CC=CC2=C(NC=N3)C3=CN=C21 ITIRVXDSMXFTPW-UHFFFAOYSA-N 0.000 title description 11
- 150000003839 salts Chemical class 0.000 claims abstract description 79
- 238000000034 method Methods 0.000 claims abstract description 51
- 241001465754 Metazoa Species 0.000 claims abstract description 20
- 238000004519 manufacturing process Methods 0.000 claims abstract description 19
- 230000008569 process Effects 0.000 claims abstract description 18
- 238000002360 preparation method Methods 0.000 claims abstract description 15
- 239000000825 pharmaceutical preparation Substances 0.000 claims abstract description 14
- 150000001875 compounds Chemical class 0.000 claims description 424
- -1 amidino, N-hydroxy-amidino Chemical group 0.000 claims description 156
- 125000000217 alkyl group Chemical group 0.000 claims description 139
- 239000001257 hydrogen Substances 0.000 claims description 73
- 229910052739 hydrogen Inorganic materials 0.000 claims description 73
- 238000006243 chemical reaction Methods 0.000 claims description 61
- 239000000203 mixture Substances 0.000 claims description 57
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 42
- 125000003545 alkoxy group Chemical group 0.000 claims description 38
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 33
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 32
- 125000005843 halogen group Chemical group 0.000 claims description 32
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 26
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 26
- 206010028980 Neoplasm Diseases 0.000 claims description 25
- 229910052757 nitrogen Inorganic materials 0.000 claims description 25
- 239000007858 starting material Substances 0.000 claims description 25
- 150000002431 hydrogen Chemical group 0.000 claims description 22
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 22
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 22
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 21
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 21
- 125000001424 substituent group Chemical group 0.000 claims description 21
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 20
- 125000001246 bromo group Chemical group Br* 0.000 claims description 19
- 125000003282 alkyl amino group Chemical group 0.000 claims description 18
- 229910052736 halogen Inorganic materials 0.000 claims description 17
- 150000002367 halogens Chemical class 0.000 claims description 17
- 229910052799 carbon Inorganic materials 0.000 claims description 16
- 125000001153 fluoro group Chemical group F* 0.000 claims description 16
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 claims description 15
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 15
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 15
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims description 13
- 201000011510 cancer Diseases 0.000 claims description 12
- 229910052760 oxygen Inorganic materials 0.000 claims description 12
- 239000008194 pharmaceutical composition Substances 0.000 claims description 12
- 230000002062 proliferating effect Effects 0.000 claims description 12
- 239000000463 material Substances 0.000 claims description 11
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 10
- 125000006239 protecting group Chemical group 0.000 claims description 10
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 claims description 9
- 150000003254 radicals Chemical class 0.000 claims description 9
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 claims description 8
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 claims description 8
- 125000005236 alkanoylamino group Chemical group 0.000 claims description 8
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 8
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 8
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 8
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 8
- 230000001225 therapeutic effect Effects 0.000 claims description 8
- 125000004464 hydroxyphenyl group Chemical group 0.000 claims description 7
- 125000002346 iodo group Chemical group I* 0.000 claims description 7
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 claims description 7
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 7
- 210000002307 prostate Anatomy 0.000 claims description 7
- 206010009944 Colon cancer Diseases 0.000 claims description 6
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 6
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 claims description 6
- 125000003707 hexyloxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 claims description 6
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims description 6
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 6
- 208000032839 leukemia Diseases 0.000 claims description 6
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 claims description 6
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 claims description 6
- 125000002004 n-butylamino group Chemical group [H]N(*)C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 6
- 201000004681 Psoriasis Diseases 0.000 claims description 5
- 201000008275 breast carcinoma Diseases 0.000 claims description 5
- 210000004185 liver Anatomy 0.000 claims description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 5
- UNEFEGQGMBXINE-UHFFFAOYSA-N 2-(8-phenylimidazo[4,5-c]quinolin-1-yl)benzonitrile Chemical compound N#CC1=CC=CC=C1N1C2=C3C=C(C=4C=CC=CC=4)C=CC3=NC=C2N=C1 UNEFEGQGMBXINE-UHFFFAOYSA-N 0.000 claims description 4
- HFYDAZHTIXGXLX-UHFFFAOYSA-N 8-bromo-1-(2-chlorophenyl)-3h-imidazo[4,5-c]quinolin-2-one Chemical compound ClC1=CC=CC=C1N1C(=O)NC2=C1C1=CC(Br)=CC=C1N=C2 HFYDAZHTIXGXLX-UHFFFAOYSA-N 0.000 claims description 4
- AKUYBJNMQGMOGO-UHFFFAOYSA-N 8-chloro-1-(2-chlorophenyl)-5-oxidoimidazo[4,5-c]quinolin-5-ium Chemical compound C1=2C3=CC(Cl)=CC=C3[N+]([O-])=CC=2N=CN1C1=CC=CC=C1Cl AKUYBJNMQGMOGO-UHFFFAOYSA-N 0.000 claims description 4
- CBLDOFQFGVTFDE-UHFFFAOYSA-N 8-chloro-1-(2-chlorophenyl)imidazo[4,5-c]quinoline-2-carbonitrile Chemical compound C1=2C3=CC(Cl)=CC=C3N=CC=2N=C(C#N)N1C1=CC=CC=C1Cl CBLDOFQFGVTFDE-UHFFFAOYSA-N 0.000 claims description 4
- 201000009030 Carcinoma Diseases 0.000 claims description 4
- 239000003937 drug carrier Substances 0.000 claims description 4
- 206010020718 hyperplasia Diseases 0.000 claims description 4
- IITKPEYOYIOLLN-UHFFFAOYSA-N n'-hydroxy-2-[2-(8-phenylimidazo[4,5-c]quinolin-1-yl)phenyl]ethanimidamide Chemical compound ONC(=N)CC1=CC=CC=C1N1C2=C3C=C(C=4C=CC=CC=4)C=CC3=NC=C2N=C1 IITKPEYOYIOLLN-UHFFFAOYSA-N 0.000 claims description 4
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 4
- 230000009826 neoplastic cell growth Effects 0.000 claims description 4
- 210000001685 thyroid gland Anatomy 0.000 claims description 4
- 210000003932 urinary bladder Anatomy 0.000 claims description 4
- UFKSFNKNOCMZHF-UHFFFAOYSA-N 1-(2-chlorophenyl)-8-methyl-3h-imidazo[4,5-c]quinolin-2-one Chemical compound C1=2C3=CC(C)=CC=C3N=CC=2NC(=O)N1C1=CC=CC=C1Cl UFKSFNKNOCMZHF-UHFFFAOYSA-N 0.000 claims description 3
- AICXPROILZDBEB-UHFFFAOYSA-N 2-(4-imidazo[4,5-c]quinolin-1-ylphenyl)acetonitrile Chemical compound C1=CC(CC#N)=CC=C1N1C2=C3C=CC=CC3=NC=C2N=C1 AICXPROILZDBEB-UHFFFAOYSA-N 0.000 claims description 3
- JLSDIJBOOUHDKW-UHFFFAOYSA-N 2-[2-(8-phenylimidazo[4,5-c]quinolin-1-yl)phenyl]acetonitrile Chemical compound N#CCC1=CC=CC=C1N1C2=C3C=C(C=4C=CC=CC=4)C=CC3=NC=C2N=C1 JLSDIJBOOUHDKW-UHFFFAOYSA-N 0.000 claims description 3
- QASHQZJYQGDZOF-UHFFFAOYSA-N 8-bromo-1-(2-chlorophenyl)-3-methylimidazo[4,5-c]quinolin-2-one Chemical compound O=C1N(C)C2=CN=C3C=CC(Br)=CC3=C2N1C1=CC=CC=C1Cl QASHQZJYQGDZOF-UHFFFAOYSA-N 0.000 claims description 3
- IONOGCVKZSKRGF-UHFFFAOYSA-N 8-bromo-1-(2-chlorophenyl)-3-phenylimidazo[4,5-c]quinolin-2-one Chemical compound ClC1=CC=CC=C1N1C(=O)N(C=2C=CC=CC=2)C2=C1C1=CC(Br)=CC=C1N=C2 IONOGCVKZSKRGF-UHFFFAOYSA-N 0.000 claims description 3
- MEASAAQFFXPMHM-UHFFFAOYSA-N 8-chloro-1-(2-chlorophenyl)-3-(furan-3-ylmethyl)imidazo[4,5-c]quinolin-2-one Chemical compound O=C1N(C=2C(=CC=CC=2)Cl)C=2C3=CC(Cl)=CC=C3N=CC=2N1CC=1C=COC=1 MEASAAQFFXPMHM-UHFFFAOYSA-N 0.000 claims description 3
- KTIXTQUHMCPKJM-UHFFFAOYSA-N 8-chloro-1-(2-chlorophenyl)imidazo[4,5-c]quinoline Chemical compound C1=2C3=CC(Cl)=CC=C3N=CC=2N=CN1C1=CC=CC=C1Cl KTIXTQUHMCPKJM-UHFFFAOYSA-N 0.000 claims description 3
- 208000003200 Adenoma Diseases 0.000 claims description 3
- 206010001233 Adenoma benign Diseases 0.000 claims description 3
- 206010061968 Gastric neoplasm Diseases 0.000 claims description 3
- 206010017993 Gastrointestinal neoplasms Diseases 0.000 claims description 3
- 208000034578 Multiple myelomas Diseases 0.000 claims description 3
- 206010035226 Plasma cell myeloma Diseases 0.000 claims description 3
- 206010039491 Sarcoma Diseases 0.000 claims description 3
- 210000004100 adrenal gland Anatomy 0.000 claims description 3
- 210000004556 brain Anatomy 0.000 claims description 3
- 210000000481 breast Anatomy 0.000 claims description 3
- 210000001072 colon Anatomy 0.000 claims description 3
- 125000000524 functional group Chemical group 0.000 claims description 3
- 208000005017 glioblastoma Diseases 0.000 claims description 3
- 210000003734 kidney Anatomy 0.000 claims description 3
- 210000004072 lung Anatomy 0.000 claims description 3
- 210000001672 ovary Anatomy 0.000 claims description 3
- 210000000496 pancreas Anatomy 0.000 claims description 3
- 210000000664 rectum Anatomy 0.000 claims description 3
- 210000002784 stomach Anatomy 0.000 claims description 3
- 210000001215 vagina Anatomy 0.000 claims description 3
- ZNBSRKVMSNKUOS-UHFFFAOYSA-N 1-(2-chlorophenyl)-3-(3-chlorophenyl)-8-methylimidazo[4,5-c]quinolin-2-one Chemical compound O=C1N(C=2C(=CC=CC=2)Cl)C=2C3=CC(C)=CC=C3N=CC=2N1C1=CC=CC(Cl)=C1 ZNBSRKVMSNKUOS-UHFFFAOYSA-N 0.000 claims description 2
- XKPHJSIJSWEHQY-UHFFFAOYSA-N 1-(2-chlorophenyl)-8-methoxyimidazo[4,5-c]quinoline Chemical compound C1=2C3=CC(OC)=CC=C3N=CC=2N=CN1C1=CC=CC=C1Cl XKPHJSIJSWEHQY-UHFFFAOYSA-N 0.000 claims description 2
- KXTRZVLPEHDUCK-UHFFFAOYSA-N 1-(2-chlorophenyl)-8-methyl-3-phenylimidazo[4,5-c]quinolin-2-one Chemical compound O=C1N(C=2C(=CC=CC=2)Cl)C=2C3=CC(C)=CC=C3N=CC=2N1C1=CC=CC=C1 KXTRZVLPEHDUCK-UHFFFAOYSA-N 0.000 claims description 2
- KUGCFLKQWVVXAM-UHFFFAOYSA-N 1-(2-fluorophenyl)-8-methyl-3h-imidazo[4,5-c]quinolin-2-one Chemical compound C1=2C3=CC(C)=CC=C3N=CC=2NC(=O)N1C1=CC=CC=C1F KUGCFLKQWVVXAM-UHFFFAOYSA-N 0.000 claims description 2
- RQKXMQUVRUAVGV-UHFFFAOYSA-N 1-butylimidazo[4,5-c]quinoline Chemical compound C1=CC=CC2=C3N(CCCC)C=NC3=CN=C21 RQKXMQUVRUAVGV-UHFFFAOYSA-N 0.000 claims description 2
- GTPFUTFIMDNOMP-UHFFFAOYSA-N 1-cyclohexyl-6-hexoxy-8-methyl-3-propan-2-ylimidazo[4,5-c]quinolin-2-one Chemical compound O=C1N(C(C)C)C2=CN=C3C(OCCCCCC)=CC(C)=CC3=C2N1C1CCCCC1 GTPFUTFIMDNOMP-UHFFFAOYSA-N 0.000 claims description 2
- CLHDZZQTVYWSAN-UHFFFAOYSA-N 1-cyclohexyl-6-hexoxy-8-methyl-3-propylimidazo[4,5-c]quinolin-2-one Chemical compound O=C1N(CCC)C2=CN=C3C(OCCCCCC)=CC(C)=CC3=C2N1C1CCCCC1 CLHDZZQTVYWSAN-UHFFFAOYSA-N 0.000 claims description 2
- XMIIPNJYAGHQHO-UHFFFAOYSA-N 2-[4-(8-chloroimidazo[4,5-c]quinolin-1-yl)phenyl]acetonitrile Chemical compound C1=2C3=CC(Cl)=CC=C3N=CC=2N=CN1C1=CC=C(CC#N)C=C1 XMIIPNJYAGHQHO-UHFFFAOYSA-N 0.000 claims description 2
- MJAQWNXJTWLFPG-UHFFFAOYSA-N 2-[8-chloro-1-(2-chlorophenyl)imidazo[4,5-c]quinolin-2-yl]acetonitrile Chemical compound C1=2C3=CC(Cl)=CC=C3N=CC=2N=C(CC#N)N1C1=CC=CC=C1Cl MJAQWNXJTWLFPG-UHFFFAOYSA-N 0.000 claims description 2
- MVBDRSJRMTWGDN-UHFFFAOYSA-N 3-(2-aminophenyl)-8-bromo-1-(2-chlorophenyl)imidazo[4,5-c]quinolin-2-one Chemical compound NC1=CC=CC=C1N1C(=O)N(C=2C(=CC=CC=2)Cl)C2=C3C=C(Br)C=CC3=NC=C21 MVBDRSJRMTWGDN-UHFFFAOYSA-N 0.000 claims description 2
- CCMQAMMXZMDLIA-UHFFFAOYSA-N 3-(3-aminophenyl)-1-(2-chlorophenyl)-8-methylimidazo[4,5-c]quinolin-2-one Chemical compound O=C1N(C=2C(=CC=CC=2)Cl)C=2C3=CC(C)=CC=C3N=CC=2N1C1=CC=CC(N)=C1 CCMQAMMXZMDLIA-UHFFFAOYSA-N 0.000 claims description 2
- YQXJXFWXKVRRIW-UHFFFAOYSA-N 3-(3-aminophenyl)-8-chloro-1-(2-chlorophenyl)imidazo[4,5-c]quinolin-2-one Chemical compound NC1=CC=CC(N2C(N(C=3C(=CC=CC=3)Cl)C3=C4C=C(Cl)C=CC4=NC=C32)=O)=C1 YQXJXFWXKVRRIW-UHFFFAOYSA-N 0.000 claims description 2
- LJUJCKNPAXSCQN-UHFFFAOYSA-N 3-(8-chloroimidazo[4,5-c]quinolin-1-yl)benzonitrile Chemical compound C1=2C3=CC(Cl)=CC=C3N=CC=2N=CN1C1=CC=CC(C#N)=C1 LJUJCKNPAXSCQN-UHFFFAOYSA-N 0.000 claims description 2
- PZXUCLAXPKZSEH-UHFFFAOYSA-N 4,8-dichloro-1-(2-chlorophenyl)imidazo[4,5-c]quinoline Chemical compound C1=2C3=CC(Cl)=CC=C3N=C(Cl)C=2N=CN1C1=CC=CC=C1Cl PZXUCLAXPKZSEH-UHFFFAOYSA-N 0.000 claims description 2
- NAZJWZFPCSAOHR-UHFFFAOYSA-N 8-bromo-1-(2-chlorophenyl)-3-(3-chlorophenyl)imidazo[4,5-c]quinolin-2-one Chemical compound ClC1=CC=CC(N2C(N(C=3C(=CC=CC=3)Cl)C3=C4C=C(Br)C=CC4=NC=C32)=O)=C1 NAZJWZFPCSAOHR-UHFFFAOYSA-N 0.000 claims description 2
- JXSPPLWZSQAOGD-UHFFFAOYSA-N 8-chloro-1-(2-chlorophenyl)-3-(2,3-dihydroxypropyl)imidazo[4,5-c]quinolin-2-one Chemical compound O=C1N(CC(O)CO)C2=CN=C3C=CC(Cl)=CC3=C2N1C1=CC=CC=C1Cl JXSPPLWZSQAOGD-UHFFFAOYSA-N 0.000 claims description 2
- LANHQWYOGQDTCD-UHFFFAOYSA-N 8-chloro-1-(2-chlorophenyl)-3-(3-chlorophenyl)imidazo[4,5-c]quinolin-2-one Chemical compound ClC1=CC=CC(N2C(N(C=3C(=CC=CC=3)Cl)C3=C4C=C(Cl)C=CC4=NC=C32)=O)=C1 LANHQWYOGQDTCD-UHFFFAOYSA-N 0.000 claims description 2
- ZWXQULFXEOEXCH-UHFFFAOYSA-N 8-chloro-1-(2-chlorophenyl)-3-(3-methoxyphenyl)imidazo[4,5-c]quinolin-2-one Chemical compound COC1=CC=CC(N2C(N(C=3C(=CC=CC=3)Cl)C3=C4C=C(Cl)C=CC4=NC=C32)=O)=C1 ZWXQULFXEOEXCH-UHFFFAOYSA-N 0.000 claims description 2
- ICCYUHZUVRQZAM-UHFFFAOYSA-N 8-chloro-1-(2-chlorophenyl)-3-(cyclohexylmethyl)imidazo[4,5-c]quinolin-2-one Chemical compound O=C1N(C=2C(=CC=CC=2)Cl)C=2C3=CC(Cl)=CC=C3N=CC=2N1CC1CCCCC1 ICCYUHZUVRQZAM-UHFFFAOYSA-N 0.000 claims description 2
- RCXLUPVATKGDNS-UHFFFAOYSA-N 8-chloro-1-(2-chlorophenyl)-3-(cyclopropylmethyl)imidazo[4,5-c]quinolin-2-one Chemical compound O=C1N(C=2C(=CC=CC=2)Cl)C=2C3=CC(Cl)=CC=C3N=CC=2N1CC1CC1 RCXLUPVATKGDNS-UHFFFAOYSA-N 0.000 claims description 2
- MJAHEPKISOLZNP-UHFFFAOYSA-N 8-chloro-1-(2-chlorophenyl)-3-heptylimidazo[4,5-c]quinolin-2-one Chemical compound O=C1N(CCCCCCC)C2=CN=C3C=CC(Cl)=CC3=C2N1C1=CC=CC=C1Cl MJAHEPKISOLZNP-UHFFFAOYSA-N 0.000 claims description 2
- STBRITKMWPCULD-UHFFFAOYSA-N 8-chloro-1-(2-chlorophenyl)-3-phenylimidazo[4,5-c]quinolin-2-one Chemical compound O=C1N(C=2C(=CC=CC=2)Cl)C=2C3=CC(Cl)=CC=C3N=CC=2N1C1=CC=CC=C1 STBRITKMWPCULD-UHFFFAOYSA-N 0.000 claims description 2
- HBRBYVCDBVLLDY-UHFFFAOYSA-N 8-chloro-1-(2-fluorophenyl)-3h-imidazo[4,5-c]quinolin-2-one Chemical compound FC1=CC=CC=C1N1C(=O)NC2=C1C1=CC(Cl)=CC=C1N=C2 HBRBYVCDBVLLDY-UHFFFAOYSA-N 0.000 claims description 2
- XVCXWGYYXZTLHK-UHFFFAOYSA-N n'-hydroxy-2-(8-phenylimidazo[4,5-c]quinolin-1-yl)benzenecarboximidamide Chemical compound ONC(=N)C1=CC=CC=C1N1C2=C3C=C(C=4C=CC=CC=4)C=CC3=NC=C2N=C1 XVCXWGYYXZTLHK-UHFFFAOYSA-N 0.000 claims description 2
- GINXKRGXHUMJRS-UHFFFAOYSA-N n-[3-[1-(2-chlorophenyl)-8-methyl-2-oxoimidazo[4,5-c]quinolin-3-yl]phenyl]acetamide Chemical compound CC(=O)NC1=CC=CC(N2C(N(C=3C(=CC=CC=3)Cl)C3=C4C=C(C)C=CC4=NC=C32)=O)=C1 GINXKRGXHUMJRS-UHFFFAOYSA-N 0.000 claims description 2
- LGWLXYWKCWPTBU-UHFFFAOYSA-N n-[3-[8-bromo-1-(2-chlorophenyl)-2-oxoimidazo[4,5-c]quinolin-3-yl]phenyl]acetamide Chemical compound CC(=O)NC1=CC=CC(N2C(N(C=3C(=CC=CC=3)Cl)C3=C4C=C(Br)C=CC4=NC=C32)=O)=C1 LGWLXYWKCWPTBU-UHFFFAOYSA-N 0.000 claims description 2
- 125000005915 C6-C14 aryl group Chemical group 0.000 claims 10
- FACHGEIJZYLXGG-UHFFFAOYSA-N 1,8-diphenylimidazo[4,5-c]quinoline Chemical compound C1=NC2=CN=C3C=CC(C=4C=CC=CC=4)=CC3=C2N1C1=CC=CC=C1 FACHGEIJZYLXGG-UHFFFAOYSA-N 0.000 claims 1
- GTJYESJSGQKMTR-UHFFFAOYSA-N 1-(2-bromophenyl)-8-chloroimidazo[4,5-c]quinoline Chemical compound C1=2C3=CC(Cl)=CC=C3N=CC=2N=CN1C1=CC=CC=C1Br GTJYESJSGQKMTR-UHFFFAOYSA-N 0.000 claims 1
- QTCIUOKGMTZGMU-UHFFFAOYSA-N 1-(2-bromophenyl)-8-phenylimidazo[4,5-c]quinoline Chemical compound BrC1=CC=CC=C1N1C2=C3C=C(C=4C=CC=CC=4)C=CC3=NC=C2N=C1 QTCIUOKGMTZGMU-UHFFFAOYSA-N 0.000 claims 1
- VWOIIYHSXIFYKW-UHFFFAOYSA-N 1-(2-chloro-4-methylphenyl)-8-phenylimidazo[4,5-c]quinoline Chemical compound ClC1=CC(C)=CC=C1N1C2=C3C=C(C=4C=CC=CC=4)C=CC3=NC=C2N=C1 VWOIIYHSXIFYKW-UHFFFAOYSA-N 0.000 claims 1
- VHBPTPVXBMZADO-UHFFFAOYSA-N 1-(2-chlorophenyl)-8-ethylimidazo[4,5-c]quinoline Chemical compound C1=2C3=CC(CC)=CC=C3N=CC=2N=CN1C1=CC=CC=C1Cl VHBPTPVXBMZADO-UHFFFAOYSA-N 0.000 claims 1
- QMSLOVLAZFXARA-UHFFFAOYSA-N 1-(2-chlorophenyl)-8-fluoroimidazo[4,5-c]quinoline Chemical compound C1=2C3=CC(F)=CC=C3N=CC=2N=CN1C1=CC=CC=C1Cl QMSLOVLAZFXARA-UHFFFAOYSA-N 0.000 claims 1
- HZEDDSMFFYIWCL-UHFFFAOYSA-N 1-(2-ethylphenyl)-8-phenylimidazo[4,5-c]quinoline Chemical compound CCC1=CC=CC=C1N1C2=C3C=C(C=4C=CC=CC=4)C=CC3=NC=C2N=C1 HZEDDSMFFYIWCL-UHFFFAOYSA-N 0.000 claims 1
- ZZYJDIMGGFXWEY-UHFFFAOYSA-N 1-(2-fluorophenyl)-8-methoxyimidazo[4,5-c]quinoline Chemical compound C1=2C3=CC(OC)=CC=C3N=CC=2N=CN1C1=CC=CC=C1F ZZYJDIMGGFXWEY-UHFFFAOYSA-N 0.000 claims 1
- IUXOWFQINUCSAG-UHFFFAOYSA-N 1-(2-fluorophenyl)-8-phenylimidazo[4,5-c]quinoline Chemical compound FC1=CC=CC=C1N1C2=C3C=C(C=4C=CC=CC=4)C=CC3=NC=C2N=C1 IUXOWFQINUCSAG-UHFFFAOYSA-N 0.000 claims 1
- HCYPHSMJUQLWHY-UHFFFAOYSA-N 1-(2-methoxyphenyl)-8-phenylimidazo[4,5-c]quinoline Chemical compound COC1=CC=CC=C1N1C2=C3C=C(C=4C=CC=CC=4)C=CC3=NC=C2N=C1 HCYPHSMJUQLWHY-UHFFFAOYSA-N 0.000 claims 1
- PHSWRUKIRJSGAG-UHFFFAOYSA-N 1-(2-methylphenyl)-8-phenylimidazo[4,5-c]quinoline Chemical compound CC1=CC=CC=C1N1C2=C3C=C(C=4C=CC=CC=4)C=CC3=NC=C2N=C1 PHSWRUKIRJSGAG-UHFFFAOYSA-N 0.000 claims 1
- IQQAXVWMYGKCQJ-UHFFFAOYSA-N 2-(4-imidazo[4,5-c]quinolin-1-ylphenyl)ethanamine Chemical compound C1=CC(CCN)=CC=C1N1C2=C3C=CC=CC3=NC=C2N=C1 IQQAXVWMYGKCQJ-UHFFFAOYSA-N 0.000 claims 1
- GFKPTKZMVKUMKC-UHFFFAOYSA-N 2-(4-imidazo[4,5-c]quinolin-1-ylphenyl)ethanol Chemical compound C1=CC(CCO)=CC=C1N1C2=C3C=CC=CC3=NC=C2N=C1 GFKPTKZMVKUMKC-UHFFFAOYSA-N 0.000 claims 1
- ZDEXHPIDGCRZCA-UHFFFAOYSA-N 2-(8-chloroimidazo[4,5-c]quinolin-1-yl)benzonitrile Chemical compound C1=2C3=CC(Cl)=CC=C3N=CC=2N=CN1C1=CC=CC=C1C#N ZDEXHPIDGCRZCA-UHFFFAOYSA-N 0.000 claims 1
- LXLKOGAJGSYHPY-UHFFFAOYSA-N 2-(8-phenylimidazo[4,5-c]quinolin-1-yl)benzenecarboximidamide Chemical compound NC(=N)C1=CC=CC=C1N1C2=C3C=C(C=4C=CC=CC=4)C=CC3=NC=C2N=C1 LXLKOGAJGSYHPY-UHFFFAOYSA-N 0.000 claims 1
- VYNPWKMWTYXZNN-UHFFFAOYSA-N 2-[2-(8-chloroimidazo[4,5-c]quinolin-1-yl)phenyl]acetonitrile Chemical compound C1=2C3=CC(Cl)=CC=C3N=CC=2N=CN1C1=CC=CC=C1CC#N VYNPWKMWTYXZNN-UHFFFAOYSA-N 0.000 claims 1
- ZRHZITZVKDMJIB-UHFFFAOYSA-N 2-[2-(8-fluoroimidazo[4,5-c]quinolin-1-yl)phenyl]acetonitrile Chemical compound C1=2C3=CC(F)=CC=C3N=CC=2N=CN1C1=CC=CC=C1CC#N ZRHZITZVKDMJIB-UHFFFAOYSA-N 0.000 claims 1
- DEYJJUXJSJBNJW-UHFFFAOYSA-N 2-[2-(8-phenylimidazo[4,5-c]quinolin-1-yl)phenyl]ethanamine Chemical compound NCCC1=CC=CC=C1N1C2=C3C=C(C=4C=CC=CC=4)C=CC3=NC=C2N=C1 DEYJJUXJSJBNJW-UHFFFAOYSA-N 0.000 claims 1
- YLXDENSFDNJMEI-UHFFFAOYSA-N 2-[2-(8-phenylimidazo[4,5-c]quinolin-1-yl)phenyl]ethanimidamide Chemical compound NC(=N)CC1=CC=CC=C1N1C2=C3C=C(C=4C=CC=CC=4)C=CC3=NC=C2N=C1 YLXDENSFDNJMEI-UHFFFAOYSA-N 0.000 claims 1
- SSMYLDHHHJRBSH-UHFFFAOYSA-N 2-[4-(8-chloroimidazo[4,5-c]quinolin-1-yl)phenyl]ethanamine Chemical compound C1=CC(CCN)=CC=C1N1C2=C3C=C(Cl)C=CC3=NC=C2N=C1 SSMYLDHHHJRBSH-UHFFFAOYSA-N 0.000 claims 1
- BXEJWZZKZGHVQK-UHFFFAOYSA-N 2-[4-(8-chloroimidazo[4,5-c]quinolin-1-yl)phenyl]ethanol Chemical compound C1=CC(CCO)=CC=C1N1C2=C3C=C(Cl)C=CC3=NC=C2N=C1 BXEJWZZKZGHVQK-UHFFFAOYSA-N 0.000 claims 1
- LXXOXXLOXMTUKU-UHFFFAOYSA-N 2-[8-chloro-1-(2-chlorophenyl)imidazo[4,5-c]quinolin-2-yl]-n'-hydroxyethanimidamide Chemical compound ONC(=N)CC1=NC2=CN=C3C=CC(Cl)=CC3=C2N1C1=CC=CC=C1Cl LXXOXXLOXMTUKU-UHFFFAOYSA-N 0.000 claims 1
- IDXPKPNCJAUSKZ-UHFFFAOYSA-N 2-[8-chloro-1-(2-chlorophenyl)imidazo[4,5-c]quinolin-2-yl]ethanimidamide Chemical compound NC(=N)CC1=NC2=CN=C3C=CC(Cl)=CC3=C2N1C1=CC=CC=C1Cl IDXPKPNCJAUSKZ-UHFFFAOYSA-N 0.000 claims 1
- GNWAOWZYLNRRHX-UHFFFAOYSA-N 2-[[8-chloro-1-(2-chlorophenyl)imidazo[4,5-c]quinolin-4-yl]amino]ethanethiol Chemical compound C1=NC=2C(NCCS)=NC3=CC=C(Cl)C=C3C=2N1C1=CC=CC=C1Cl GNWAOWZYLNRRHX-UHFFFAOYSA-N 0.000 claims 1
- WCMKBFXHZFCKKK-UHFFFAOYSA-N 2-[[8-chloro-1-(2-chlorophenyl)imidazo[4,5-c]quinolin-4-yl]amino]ethanol Chemical compound C1=NC=2C(NCCO)=NC3=CC=C(Cl)C=C3C=2N1C1=CC=CC=C1Cl WCMKBFXHZFCKKK-UHFFFAOYSA-N 0.000 claims 1
- KTCISRVMSVFEGA-UHFFFAOYSA-N 2-bromo-8-chloro-1-(2-chlorophenyl)imidazo[4,5-c]quinoline Chemical compound C1=2C3=CC(Cl)=CC=C3N=CC=2N=C(Br)N1C1=CC=CC=C1Cl KTCISRVMSVFEGA-UHFFFAOYSA-N 0.000 claims 1
- HKIWBOKRKRFJNV-UHFFFAOYSA-N 2-imidazo[4,5-c]quinolin-1-ylethanol Chemical compound C1=CC=CC2=C3N(CCO)C=NC3=CN=C21 HKIWBOKRKRFJNV-UHFFFAOYSA-N 0.000 claims 1
- JVZKWMSZGIKUEQ-UHFFFAOYSA-N 3-(8-chloroimidazo[4,5-c]quinolin-1-yl)aniline Chemical compound NC1=CC=CC(N2C3=C4C=C(Cl)C=CC4=NC=C3N=C2)=C1 JVZKWMSZGIKUEQ-UHFFFAOYSA-N 0.000 claims 1
- RPXSDLUMIDERLV-UHFFFAOYSA-N 3-(8-ethylimidazo[4,5-c]quinolin-1-yl)aniline Chemical compound C1=2C3=CC(CC)=CC=C3N=CC=2N=CN1C1=CC=CC(N)=C1 RPXSDLUMIDERLV-UHFFFAOYSA-N 0.000 claims 1
- XTMWVUSYYNAORC-UHFFFAOYSA-N 3-(8-methoxyimidazo[4,5-c]quinolin-1-yl)aniline Chemical compound C1=2C3=CC(OC)=CC=C3N=CC=2N=CN1C1=CC=CC(N)=C1 XTMWVUSYYNAORC-UHFFFAOYSA-N 0.000 claims 1
- VQPFNRYCEUUPSU-UHFFFAOYSA-N 3-(8-phenylimidazo[4,5-c]quinolin-1-yl)aniline Chemical compound NC1=CC=CC(N2C3=C4C=C(C=CC4=NC=C3N=C2)C=2C=CC=CC=2)=C1 VQPFNRYCEUUPSU-UHFFFAOYSA-N 0.000 claims 1
- OTTYQQLGSJZWSB-UHFFFAOYSA-N 4-(7-chloroimidazo[4,5-c]quinolin-1-yl)phenol Chemical compound C1=CC(O)=CC=C1N1C2=C3C=CC(Cl)=CC3=NC=C2N=C1 OTTYQQLGSJZWSB-UHFFFAOYSA-N 0.000 claims 1
- DNVDUMFPOMHTEG-UHFFFAOYSA-N 4-imidazo[4,5-c]quinolin-1-ylaniline Chemical compound C1=CC(N)=CC=C1N1C2=C3C=CC=CC3=NC=C2N=C1 DNVDUMFPOMHTEG-UHFFFAOYSA-N 0.000 claims 1
- RDQMECUPVGWHQN-UHFFFAOYSA-N 4-imidazo[4,5-c]quinolin-1-ylcyclohexan-1-ol Chemical compound C1CC(O)CCC1N1C2=C3C=CC=CC3=NC=C2N=C1 RDQMECUPVGWHQN-UHFFFAOYSA-N 0.000 claims 1
- ZUDIXYCFBXSWEF-UHFFFAOYSA-N 7-chloro-1-(3,4-dimethoxyphenyl)imidazo[4,5-c]quinoline Chemical compound C1=C(OC)C(OC)=CC=C1N1C2=C3C=CC(Cl)=CC3=NC=C2N=C1 ZUDIXYCFBXSWEF-UHFFFAOYSA-N 0.000 claims 1
- HCIMPYLFNICPJW-UHFFFAOYSA-N 7-chloro-1-(4-fluorophenyl)imidazo[4,5-c]quinoline Chemical compound C1=CC(F)=CC=C1N1C2=C3C=CC(Cl)=CC3=NC=C2N=C1 HCIMPYLFNICPJW-UHFFFAOYSA-N 0.000 claims 1
- UGBDRYQPPOEOBA-UHFFFAOYSA-N 7-chloro-1-[3-(trifluoromethyl)phenyl]imidazo[4,5-c]quinoline Chemical compound FC(F)(F)C1=CC=CC(N2C3=C4C=CC(Cl)=CC4=NC=C3N=C2)=C1 UGBDRYQPPOEOBA-UHFFFAOYSA-N 0.000 claims 1
- BAKNXAKSYZFFBF-UHFFFAOYSA-N 8-chloro-1-(2-chlorophenyl)-N'-hydroxyimidazo[4,5-c]quinoline-2-carboximidamide Chemical compound ONC(=N)C1=NC2=CN=C3C=CC(Cl)=CC3=C2N1C1=CC=CC=C1Cl BAKNXAKSYZFFBF-UHFFFAOYSA-N 0.000 claims 1
- NXCNRCUPSYQQCI-UHFFFAOYSA-N 8-chloro-1-(2-chlorophenyl)-n-cyclopropylimidazo[4,5-c]quinolin-4-amine Chemical compound C1=2N=CN(C=3C(=CC=CC=3)Cl)C=2C2=CC(Cl)=CC=C2N=C1NC1CC1 NXCNRCUPSYQQCI-UHFFFAOYSA-N 0.000 claims 1
- OVWLTLDPZSIQNC-UHFFFAOYSA-N 8-chloro-1-(2-chlorophenyl)-n-methylimidazo[4,5-c]quinolin-4-amine Chemical compound C1=NC=2C(NC)=NC3=CC=C(Cl)C=C3C=2N1C1=CC=CC=C1Cl OVWLTLDPZSIQNC-UHFFFAOYSA-N 0.000 claims 1
- IDMVOASANRNOBR-UHFFFAOYSA-N 8-chloro-1-(2-chlorophenyl)-n-phenylimidazo[4,5-c]quinolin-4-amine Chemical compound C1=2N=CN(C=3C(=CC=CC=3)Cl)C=2C2=CC(Cl)=CC=C2N=C1NC1=CC=CC=C1 IDMVOASANRNOBR-UHFFFAOYSA-N 0.000 claims 1
- UDLTXZPHFJGTPH-UHFFFAOYSA-N 8-chloro-1-(2-chlorophenyl)imidazo[4,5-c]quinolin-4-amine Chemical compound C1=NC=2C(N)=NC3=CC=C(Cl)C=C3C=2N1C1=CC=CC=C1Cl UDLTXZPHFJGTPH-UHFFFAOYSA-N 0.000 claims 1
- JHGRGVAPIOXQAZ-UHFFFAOYSA-N 8-chloro-1-(2-chlorophenyl)imidazo[4,5-c]quinoline-2-carboxamide Chemical compound NC(=O)C1=NC2=CN=C3C=CC(Cl)=CC3=C2N1C1=CC=CC=C1Cl JHGRGVAPIOXQAZ-UHFFFAOYSA-N 0.000 claims 1
- DSPDLGSSJPXKIS-UHFFFAOYSA-N 8-chloro-1-(2-chlorophenyl)imidazo[4,5-c]quinoline-4-carbonitrile Chemical compound C1=2C3=CC(Cl)=CC=C3N=C(C#N)C=2N=CN1C1=CC=CC=C1Cl DSPDLGSSJPXKIS-UHFFFAOYSA-N 0.000 claims 1
- HKJSNZKISWAHCD-UHFFFAOYSA-N 8-chloro-1-(2-ethylphenyl)imidazo[4,5-c]quinoline Chemical compound CCC1=CC=CC=C1N1C2=C3C=C(Cl)C=CC3=NC=C2N=C1 HKJSNZKISWAHCD-UHFFFAOYSA-N 0.000 claims 1
- WBPPQBLGCVKNAB-UHFFFAOYSA-N 8-chloro-1-(2-fluorophenyl)imidazo[4,5-c]quinoline Chemical compound FC1=CC=CC=C1N1C2=C3C=C(Cl)C=CC3=NC=C2N=C1 WBPPQBLGCVKNAB-UHFFFAOYSA-N 0.000 claims 1
- SMXHKIYNNKYEON-UHFFFAOYSA-N 8-chloro-1-(2-iodophenyl)imidazo[4,5-c]quinoline Chemical compound C1=2C3=CC(Cl)=CC=C3N=CC=2N=CN1C1=CC=CC=C1I SMXHKIYNNKYEON-UHFFFAOYSA-N 0.000 claims 1
- DIQHPTGXNAYXEK-UHFFFAOYSA-N 8-chloro-1-(2-methoxyphenyl)imidazo[4,5-c]quinoline Chemical compound COC1=CC=CC=C1N1C2=C3C=C(Cl)C=CC3=NC=C2N=C1 DIQHPTGXNAYXEK-UHFFFAOYSA-N 0.000 claims 1
- UQICCXIYWJRBNJ-UHFFFAOYSA-N 8-chloro-1-(2-methylphenyl)imidazo[4,5-c]quinoline Chemical compound CC1=CC=CC=C1N1C2=C3C=C(Cl)C=CC3=NC=C2N=C1 UQICCXIYWJRBNJ-UHFFFAOYSA-N 0.000 claims 1
- NRHVEQKLBQPXNE-GFCCVEGCSA-N 8-chloro-1-[(1r)-1-phenylethyl]imidazo[4,5-c]quinoline Chemical compound C1([C@@H](C)N2C3=C4C=C(Cl)C=CC4=NC=C3N=C2)=CC=CC=C1 NRHVEQKLBQPXNE-GFCCVEGCSA-N 0.000 claims 1
- NRHVEQKLBQPXNE-LBPRGKRZSA-N 8-chloro-1-[(1s)-1-phenylethyl]imidazo[4,5-c]quinoline Chemical compound C1([C@H](C)N2C3=C4C=C(Cl)C=CC4=NC=C3N=C2)=CC=CC=C1 NRHVEQKLBQPXNE-LBPRGKRZSA-N 0.000 claims 1
- PADWRLXIMSPJJS-UHFFFAOYSA-N 8-chloro-1-phenylimidazo[4,5-c]quinoline Chemical compound C1=2C3=CC(Cl)=CC=C3N=CC=2N=CN1C1=CC=CC=C1 PADWRLXIMSPJJS-UHFFFAOYSA-N 0.000 claims 1
- ZEWMQIRNNYPGEE-UHFFFAOYSA-N 8-ethyl-1-(2-fluorophenyl)imidazo[4,5-c]quinoline Chemical compound C1=2C3=CC(CC)=CC=C3N=CC=2N=CN1C1=CC=CC=C1F ZEWMQIRNNYPGEE-UHFFFAOYSA-N 0.000 claims 1
- VTSUOXLTNDURNR-UHFFFAOYSA-N 8-ethyl-1-(2-methylphenyl)imidazo[4,5-c]quinoline Chemical compound C1=2C3=CC(CC)=CC=C3N=CC=2N=CN1C1=CC=CC=C1C VTSUOXLTNDURNR-UHFFFAOYSA-N 0.000 claims 1
- AAHKIYQVUPHGDC-UHFFFAOYSA-N 8-fluoro-1-(2-fluorophenyl)imidazo[4,5-c]quinoline Chemical compound C1=2C3=CC(F)=CC=C3N=CC=2N=CN1C1=CC=CC=C1F AAHKIYQVUPHGDC-UHFFFAOYSA-N 0.000 claims 1
- HJMMOTNRILFWHE-UHFFFAOYSA-N 8-fluoro-1-(2-iodophenyl)imidazo[4,5-c]quinoline Chemical compound C1=2C3=CC(F)=CC=C3N=CC=2N=CN1C1=CC=CC=C1I HJMMOTNRILFWHE-UHFFFAOYSA-N 0.000 claims 1
- MZQIINKUJAOLKU-UHFFFAOYSA-N 8-methoxy-1-(2-methylphenyl)imidazo[4,5-c]quinoline Chemical compound C1=2C3=CC(OC)=CC=C3N=CC=2N=CN1C1=CC=CC=C1C MZQIINKUJAOLKU-UHFFFAOYSA-N 0.000 claims 1
- KFQFUAKCMSUPHS-UHFFFAOYSA-N 8-methoxy-1-phenylimidazo[4,5-c]quinoline Chemical compound C1=2C3=CC(OC)=CC=C3N=CC=2N=CN1C1=CC=CC=C1 KFQFUAKCMSUPHS-UHFFFAOYSA-N 0.000 claims 1
- YYWMIIPPMCQBKY-UHFFFAOYSA-N 8-phenyl-1-[3-(trifluoromethyl)phenyl]imidazo[4,5-c]quinoline Chemical compound FC(F)(F)C1=CC=CC(N2C3=C4C=C(C=CC4=NC=C3N=C2)C=2C=CC=CC=2)=C1 YYWMIIPPMCQBKY-UHFFFAOYSA-N 0.000 claims 1
- HZAQJHROEHANBE-UHFFFAOYSA-N [2-(8-phenylimidazo[4,5-c]quinolin-1-yl)phenyl]methanamine Chemical compound NCC1=CC=CC=C1N1C2=C3C=C(C=4C=CC=CC=4)C=CC3=NC=C2N=C1 HZAQJHROEHANBE-UHFFFAOYSA-N 0.000 claims 1
- QAVHRWWMJNWYQD-UHFFFAOYSA-N [3-(8-chloroimidazo[4,5-c]quinolin-1-yl)-2-methylphenyl]methanol Chemical compound CC1=C(CO)C=CC=C1N1C2=C3C=C(Cl)C=CC3=NC=C2N=C1 QAVHRWWMJNWYQD-UHFFFAOYSA-N 0.000 claims 1
- ZPJGJSBWETXWME-UHFFFAOYSA-N [3-(8-chloroimidazo[4,5-c]quinolin-1-yl)phenyl]methanamine Chemical compound NCC1=CC=CC(N2C3=C4C=C(Cl)C=CC4=NC=C3N=C2)=C1 ZPJGJSBWETXWME-UHFFFAOYSA-N 0.000 claims 1
- PJUWBINWPASQAO-UHFFFAOYSA-N [3-(8-chloroimidazo[4,5-c]quinolin-1-yl)phenyl]methanol Chemical compound OCC1=CC=CC(N2C3=C4C=C(Cl)C=CC4=NC=C3N=C2)=C1 PJUWBINWPASQAO-UHFFFAOYSA-N 0.000 claims 1
- AVOTVHJAAUHXNZ-UHFFFAOYSA-N [3-(8-phenylimidazo[4,5-c]quinolin-1-yl)phenyl]methanol Chemical compound OCC1=CC=CC(N2C3=C4C=C(C=CC4=NC=C3N=C2)C=2C=CC=CC=2)=C1 AVOTVHJAAUHXNZ-UHFFFAOYSA-N 0.000 claims 1
- ZREIVSSLEQVQQY-UHFFFAOYSA-N [4-(8-chloroimidazo[4,5-c]quinolin-1-yl)phenyl]methanol Chemical compound C1=CC(CO)=CC=C1N1C2=C3C=C(Cl)C=CC3=NC=C2N=C1 ZREIVSSLEQVQQY-UHFFFAOYSA-N 0.000 claims 1
- JBKVOAHYDJJIQX-UHFFFAOYSA-N n-[8-chloro-1-(2-chlorophenyl)imidazo[4,5-c]quinolin-4-yl]benzamide Chemical compound C1=2N=CN(C=3C(=CC=CC=3)Cl)C=2C2=CC(Cl)=CC=C2N=C1NC(=O)C1=CC=CC=C1 JBKVOAHYDJJIQX-UHFFFAOYSA-N 0.000 claims 1
- KJQHRWVHCYYRFA-UHFFFAOYSA-N n-butyl-8-chloro-1-(2-chlorophenyl)imidazo[4,5-c]quinolin-4-amine Chemical compound C1=NC=2C(NCCCC)=NC3=CC=C(Cl)C=C3C=2N1C1=CC=CC=C1Cl KJQHRWVHCYYRFA-UHFFFAOYSA-N 0.000 claims 1
- RHKWIGHJGOEUSM-UHFFFAOYSA-N 3h-imidazo[4,5-h]quinoline Chemical class C1=CN=C2C(N=CN3)=C3C=CC2=C1 RHKWIGHJGOEUSM-UHFFFAOYSA-N 0.000 abstract description 15
- SQQXRXKYTKFFSM-UHFFFAOYSA-N chembl1992147 Chemical compound OC1=C(OC)C(OC)=CC=C1C1=C(C)C(C(O)=O)=NC(C=2N=C3C4=NC(C)(C)N=C4C(OC)=C(O)C3=CC=2)=C1N SQQXRXKYTKFFSM-UHFFFAOYSA-N 0.000 abstract description 3
- 229940124669 imidazoquinoline Drugs 0.000 abstract description 2
- 235000013350 formula milk Nutrition 0.000 description 193
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 104
- 238000004128 high performance liquid chromatography Methods 0.000 description 89
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 84
- 239000000243 solution Substances 0.000 description 74
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 64
- 235000002639 sodium chloride Nutrition 0.000 description 64
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 59
- 239000002904 solvent Substances 0.000 description 58
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 57
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 48
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 47
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 42
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 42
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 41
- 210000004027 cell Anatomy 0.000 description 31
- 230000000875 corresponding effect Effects 0.000 description 31
- 230000000694 effects Effects 0.000 description 31
- 230000005764 inhibitory process Effects 0.000 description 31
- 239000011541 reaction mixture Substances 0.000 description 31
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 27
- 108091000080 Phosphotransferase Proteins 0.000 description 26
- 235000019441 ethanol Nutrition 0.000 description 26
- 102000020233 phosphotransferase Human genes 0.000 description 26
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 24
- 239000002244 precipitate Substances 0.000 description 23
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 22
- 238000010992 reflux Methods 0.000 description 22
- 239000013078 crystal Substances 0.000 description 21
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 20
- 238000012360 testing method Methods 0.000 description 20
- 239000007787 solid Substances 0.000 description 19
- 241000208199 Buxus sempervirens Species 0.000 description 18
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 18
- 239000002253 acid Substances 0.000 description 18
- 230000015572 biosynthetic process Effects 0.000 description 18
- 239000004480 active ingredient Substances 0.000 description 17
- 238000002330 electrospray ionisation mass spectrometry Methods 0.000 description 17
- 229960004756 ethanol Drugs 0.000 description 17
- 108090000623 proteins and genes Proteins 0.000 description 17
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 16
- 239000002585 base Substances 0.000 description 16
- 239000003054 catalyst Substances 0.000 description 16
- 238000004587 chromatography analysis Methods 0.000 description 16
- 238000001035 drying Methods 0.000 description 16
- 229940093499 ethyl acetate Drugs 0.000 description 16
- 235000019439 ethyl acetate Nutrition 0.000 description 16
- 239000005457 ice water Substances 0.000 description 16
- 102000004169 proteins and genes Human genes 0.000 description 16
- 238000000746 purification Methods 0.000 description 16
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 15
- 102000004022 Protein-Tyrosine Kinases Human genes 0.000 description 15
- 108090000412 Protein-Tyrosine Kinases Proteins 0.000 description 15
- 239000000543 intermediate Substances 0.000 description 15
- 238000003756 stirring Methods 0.000 description 15
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 14
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 14
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 14
- 125000004432 carbon atom Chemical group C* 0.000 description 14
- 238000001816 cooling Methods 0.000 description 14
- 239000012074 organic phase Substances 0.000 description 14
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 14
- 108010073929 Vascular Endothelial Growth Factor A Proteins 0.000 description 13
- 102000005789 Vascular Endothelial Growth Factors Human genes 0.000 description 13
- 108010019530 Vascular Endothelial Growth Factors Proteins 0.000 description 13
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 13
- 238000003786 synthesis reaction Methods 0.000 description 13
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 12
- 238000002425 crystallisation Methods 0.000 description 12
- 230000008025 crystallization Effects 0.000 description 12
- 238000005984 hydrogenation reaction Methods 0.000 description 12
- 239000012071 phase Substances 0.000 description 12
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 11
- 238000003556 assay Methods 0.000 description 11
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Substances [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 11
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 11
- 239000000741 silica gel Substances 0.000 description 11
- 229910002027 silica gel Inorganic materials 0.000 description 11
- 229960001866 silicon dioxide Drugs 0.000 description 11
- 239000000725 suspension Substances 0.000 description 11
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 10
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 10
- 230000001028 anti-proliverative effect Effects 0.000 description 10
- 239000002775 capsule Substances 0.000 description 10
- 238000000338 in vitro Methods 0.000 description 10
- 239000005711 Benzoic acid Substances 0.000 description 9
- 102000004190 Enzymes Human genes 0.000 description 9
- 108090000790 Enzymes Proteins 0.000 description 9
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 125000003118 aryl group Chemical group 0.000 description 9
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 9
- 239000012528 membrane Substances 0.000 description 9
- 210000004379 membrane Anatomy 0.000 description 9
- 229940086542 triethylamine Drugs 0.000 description 9
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 8
- 230000002401 inhibitory effect Effects 0.000 description 8
- HXITXNWTGFUOAU-UHFFFAOYSA-N phenylboronic acid Chemical compound OB(O)C1=CC=CC=C1 HXITXNWTGFUOAU-UHFFFAOYSA-N 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 8
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 7
- 229920002472 Starch Polymers 0.000 description 7
- 229910052783 alkali metal Inorganic materials 0.000 description 7
- 239000003795 chemical substances by application Substances 0.000 description 7
- 125000000623 heterocyclic group Chemical group 0.000 description 7
- 235000011056 potassium acetate Nutrition 0.000 description 7
- 239000002994 raw material Substances 0.000 description 7
- 235000017550 sodium carbonate Nutrition 0.000 description 7
- 229910000029 sodium carbonate Inorganic materials 0.000 description 7
- 229940001593 sodium carbonate Drugs 0.000 description 7
- 125000003107 substituted aryl group Chemical group 0.000 description 7
- 239000000758 substrate Substances 0.000 description 7
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 6
- AOJJSUZBOXZQNB-TZSSRYMLSA-N Doxorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 AOJJSUZBOXZQNB-TZSSRYMLSA-N 0.000 description 6
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 6
- 108010031794 IGF Type 1 Receptor Proteins 0.000 description 6
- 102100039688 Insulin-like growth factor 1 receptor Human genes 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- 102100033177 Vascular endothelial growth factor receptor 2 Human genes 0.000 description 6
- 239000012267 brine Substances 0.000 description 6
- 239000000872 buffer Substances 0.000 description 6
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical compound [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 description 6
- 230000007423 decrease Effects 0.000 description 6
- 229960004132 diethyl ether Drugs 0.000 description 6
- 238000002474 experimental method Methods 0.000 description 6
- 238000001914 filtration Methods 0.000 description 6
- 238000005755 formation reaction Methods 0.000 description 6
- 239000003112 inhibitor Substances 0.000 description 6
- 235000019359 magnesium stearate Nutrition 0.000 description 6
- 239000003921 oil Substances 0.000 description 6
- 235000019198 oils Nutrition 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- 239000000843 powder Substances 0.000 description 6
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 6
- VBEQCZHXXJYVRD-GACYYNSASA-N uroanthelone Chemical compound C([C@@H](C(=O)N[C@H](C(=O)N[C@@H](CS)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CS)C(=O)N[C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)NCC(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(=O)N[C@@H](CO)C(=O)NCC(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CS)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(N)=N)C(O)=O)C(C)C)[C@@H](C)O)NC(=O)[C@H](CO)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@@H](NC(=O)[C@H](CC=1NC=NC=1)NC(=O)[C@H](CCSC)NC(=O)[C@H](CS)NC(=O)[C@@H](NC(=O)CNC(=O)CNC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CS)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)CNC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CO)NC(=O)[C@H](CO)NC(=O)[C@H]1N(CCC1)C(=O)[C@H](CS)NC(=O)CNC(=O)[C@H]1N(CCC1)C(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CO)NC(=O)[C@@H](N)CC(N)=O)C(C)C)[C@@H](C)CC)C1=CC=C(O)C=C1 VBEQCZHXXJYVRD-GACYYNSASA-N 0.000 description 6
- ZRFUZDDJSQVQBY-UHFFFAOYSA-N 4-chloro-3-nitroquinoline Chemical compound C1=CC=CC2=C(Cl)C([N+](=O)[O-])=CN=C21 ZRFUZDDJSQVQBY-UHFFFAOYSA-N 0.000 description 5
- WERDZOLNNVLAMQ-UHFFFAOYSA-N 6-chloro-4-n-(2-chlorophenyl)quinoline-3,4-diamine Chemical compound NC1=CN=C2C=CC(Cl)=CC2=C1NC1=CC=CC=C1Cl WERDZOLNNVLAMQ-UHFFFAOYSA-N 0.000 description 5
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 5
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 5
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 5
- 102100032857 Cyclin-dependent kinase 1 Human genes 0.000 description 5
- 101710106279 Cyclin-dependent kinase 1 Proteins 0.000 description 5
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 5
- 108090000315 Protein Kinase C Proteins 0.000 description 5
- 102000003923 Protein Kinase C Human genes 0.000 description 5
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 5
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 5
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 5
- 150000008041 alkali metal carbonates Chemical class 0.000 description 5
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 5
- 125000006193 alkinyl group Chemical group 0.000 description 5
- 150000001413 amino acids Chemical class 0.000 description 5
- 125000003277 amino group Chemical group 0.000 description 5
- 125000000753 cycloalkyl group Chemical group 0.000 description 5
- 229920000159 gelatin Polymers 0.000 description 5
- 235000019322 gelatine Nutrition 0.000 description 5
- 150000008282 halocarbons Chemical class 0.000 description 5
- KTUFNOKKBVMGRW-UHFFFAOYSA-N imatinib Chemical compound C1CN(C)CCN1CC1=CC=C(C(=O)NC=2C=C(NC=3N=C(C=CN=3)C=3C=NC=CC=3)C(C)=CC=2)C=C1 KTUFNOKKBVMGRW-UHFFFAOYSA-N 0.000 description 5
- 238000011534 incubation Methods 0.000 description 5
- 239000008101 lactose Substances 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 229910052751 metal Inorganic materials 0.000 description 5
- 239000002184 metal Substances 0.000 description 5
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 5
- 102000005962 receptors Human genes 0.000 description 5
- 108020003175 receptors Proteins 0.000 description 5
- 229910052938 sodium sulfate Inorganic materials 0.000 description 5
- 235000011152 sodium sulphate Nutrition 0.000 description 5
- 239000011343 solid material Substances 0.000 description 5
- 239000000454 talc Substances 0.000 description 5
- 235000012222 talc Nutrition 0.000 description 5
- 229910052623 talc Inorganic materials 0.000 description 5
- 230000009466 transformation Effects 0.000 description 5
- 241000701447 unidentified baculovirus Species 0.000 description 5
- CUKXRHLWPSBCTI-UHFFFAOYSA-N 2-amino-5-bromobenzoic acid Chemical compound NC1=CC=C(Br)C=C1C(O)=O CUKXRHLWPSBCTI-UHFFFAOYSA-N 0.000 description 4
- IGDCBHSYVIAATO-UHFFFAOYSA-N 2-amino-5-ethylbenzoic acid Chemical compound CCC1=CC=C(N)C(C(O)=O)=C1 IGDCBHSYVIAATO-UHFFFAOYSA-N 0.000 description 4
- KWFWJUMXKUINAY-UHFFFAOYSA-N 4-chloro-6-ethyl-3-nitroquinoline Chemical compound N1=CC([N+]([O-])=O)=C(Cl)C2=CC(CC)=CC=C21 KWFWJUMXKUINAY-UHFFFAOYSA-N 0.000 description 4
- XDGNFZUIJHZHHP-UHFFFAOYSA-N 5-ethyl-1h-indole-2,3-dione Chemical compound CCC1=CC=C2NC(=O)C(=O)C2=C1 XDGNFZUIJHZHHP-UHFFFAOYSA-N 0.000 description 4
- LOLYSJJSHSFQHO-UHFFFAOYSA-N 8-chloro-1-(2-chlorophenyl)-3h-imidazo[4,5-c]quinolin-2-one Chemical compound C1=2C3=CC(Cl)=CC=C3N=CC=2NC(=O)N1C1=CC=CC=C1Cl LOLYSJJSHSFQHO-UHFFFAOYSA-N 0.000 description 4
- 102000002427 Cyclin B Human genes 0.000 description 4
- 108010068150 Cyclin B Proteins 0.000 description 4
- 102400001368 Epidermal growth factor Human genes 0.000 description 4
- 101800003838 Epidermal growth factor Proteins 0.000 description 4
- 108010010803 Gelatin Proteins 0.000 description 4
- 239000005909 Kieselgur Substances 0.000 description 4
- 239000005517 L01XE01 - Imatinib Substances 0.000 description 4
- 206010027476 Metastases Diseases 0.000 description 4
- 102000029749 Microtubule Human genes 0.000 description 4
- 108091022875 Microtubule Proteins 0.000 description 4
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 4
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 4
- 102000001332 SRC Human genes 0.000 description 4
- 108060006706 SRC Proteins 0.000 description 4
- NKANXQFJJICGDU-QPLCGJKRSA-N Tamoxifen Chemical compound C=1C=CC=CC=1C(/CC)=C(C=1C=CC(OCCN(C)C)=CC=1)/C1=CC=CC=C1 NKANXQFJJICGDU-QPLCGJKRSA-N 0.000 description 4
- 229910021529 ammonia Inorganic materials 0.000 description 4
- 230000001772 anti-angiogenic effect Effects 0.000 description 4
- 125000004658 aryl carbonyl amino group Chemical group 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 125000001589 carboacyl group Chemical group 0.000 description 4
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 4
- RZEKVGVHFLEQIL-UHFFFAOYSA-N celecoxib Chemical compound C1=CC(C)=CC=C1C1=CC(C(F)(F)F)=NN1C1=CC=C(S(N)(=O)=O)C=C1 RZEKVGVHFLEQIL-UHFFFAOYSA-N 0.000 description 4
- 239000007795 chemical reaction product Substances 0.000 description 4
- 125000000392 cycloalkenyl group Chemical group 0.000 description 4
- 230000003247 decreasing effect Effects 0.000 description 4
- 235000014113 dietary fatty acids Nutrition 0.000 description 4
- 229940079593 drug Drugs 0.000 description 4
- 239000003814 drug Substances 0.000 description 4
- 229940116977 epidermal growth factor Drugs 0.000 description 4
- 239000000194 fatty acid Substances 0.000 description 4
- 229930195729 fatty acid Natural products 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 238000003818 flash chromatography Methods 0.000 description 4
- 239000008273 gelatin Substances 0.000 description 4
- 229940014259 gelatin Drugs 0.000 description 4
- 235000011852 gelatine desserts Nutrition 0.000 description 4
- 230000012010 growth Effects 0.000 description 4
- 238000000021 kinase assay Methods 0.000 description 4
- 229910001629 magnesium chloride Inorganic materials 0.000 description 4
- 210000004688 microtubule Anatomy 0.000 description 4
- 150000007522 mineralic acids Chemical class 0.000 description 4
- BDERNNFJNOPAEC-UHFFFAOYSA-N n-propyl alcohol Natural products CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 4
- 229910017604 nitric acid Inorganic materials 0.000 description 4
- 239000000546 pharmaceutical excipient Substances 0.000 description 4
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 4
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 4
- 239000011877 solvent mixture Substances 0.000 description 4
- 235000019698 starch Nutrition 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 125000000547 substituted alkyl group Chemical group 0.000 description 4
- KZNICNPSHKQLFF-UHFFFAOYSA-N succinimide Chemical compound O=C1CCC(=O)N1 KZNICNPSHKQLFF-UHFFFAOYSA-N 0.000 description 4
- 229940100445 wheat starch Drugs 0.000 description 4
- KZPYGQFFRCFCPP-UHFFFAOYSA-N 1,1'-bis(diphenylphosphino)ferrocene Chemical compound [Fe+2].C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1 KZPYGQFFRCFCPP-UHFFFAOYSA-N 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- AKCRQHGQIJBRMN-UHFFFAOYSA-N 2-chloroaniline Chemical compound NC1=CC=CC=C1Cl AKCRQHGQIJBRMN-UHFFFAOYSA-N 0.000 description 3
- BYHQTRFJOGIQAO-GOSISDBHSA-N 3-(4-bromophenyl)-8-[(2R)-2-hydroxypropyl]-1-[(3-methoxyphenyl)methyl]-1,3,8-triazaspiro[4.5]decan-2-one Chemical compound C[C@H](CN1CCC2(CC1)CN(C(=O)N2CC3=CC(=CC=C3)OC)C4=CC=C(C=C4)Br)O BYHQTRFJOGIQAO-GOSISDBHSA-N 0.000 description 3
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 3
- QNEKIBGFMYLELZ-AATRIKPKSA-N 5-ethyl-2-[[(e)-2-nitroethenyl]amino]benzoic acid Chemical compound CCC1=CC=C(N\C=C\[N+]([O-])=O)C(C(O)=O)=C1 QNEKIBGFMYLELZ-AATRIKPKSA-N 0.000 description 3
- 208000031261 Acute myeloid leukaemia Diseases 0.000 description 3
- 229910002012 Aerosil® Inorganic materials 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 108091007914 CDKs Proteins 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- 102000003903 Cyclin-dependent kinases Human genes 0.000 description 3
- 108090000266 Cyclin-dependent kinases Proteins 0.000 description 3
- 102100030011 Endoribonuclease Human genes 0.000 description 3
- 101710199605 Endoribonuclease Proteins 0.000 description 3
- 108010069236 Goserelin Proteins 0.000 description 3
- 101001012157 Homo sapiens Receptor tyrosine-protein kinase erbB-2 Proteins 0.000 description 3
- XDXDZDZNSLXDNA-TZNDIEGXSA-N Idarubicin Chemical compound C1[C@H](N)[C@H](O)[C@H](C)O[C@H]1O[C@@H]1C2=C(O)C(C(=O)C3=CC=CC=C3C3=O)=C3C(O)=C2C[C@@](O)(C(C)=O)C1 XDXDZDZNSLXDNA-TZNDIEGXSA-N 0.000 description 3
- XDXDZDZNSLXDNA-UHFFFAOYSA-N Idarubicin Natural products C1C(N)C(O)C(C)OC1OC1C2=C(O)C(C(=O)C3=CC=CC=C3C3=O)=C3C(O)=C2CC(O)(C(C)=O)C1 XDXDZDZNSLXDNA-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- 229910021380 Manganese Chloride Inorganic materials 0.000 description 3
- GLFNIEUTAYBVOC-UHFFFAOYSA-L Manganese chloride Chemical compound Cl[Mn]Cl GLFNIEUTAYBVOC-UHFFFAOYSA-L 0.000 description 3
- 108700020796 Oncogene Proteins 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 108091005682 Receptor kinases Proteins 0.000 description 3
- 102100030086 Receptor tyrosine-protein kinase erbB-2 Human genes 0.000 description 3
- 101710113029 Serine/threonine-protein kinase Proteins 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- 239000007983 Tris buffer Substances 0.000 description 3
- JXLYSJRDGCGARV-WWYNWVTFSA-N Vinblastine Natural products O=C(O[C@H]1[C@](O)(C(=O)OC)[C@@H]2N(C)c3c(cc(c(OC)c3)[C@]3(C(=O)OC)c4[nH]c5c(c4CCN4C[C@](O)(CC)C[C@H](C3)C4)cccc5)[C@@]32[C@H]2[C@@]1(CC)C=CCN2CC3)C JXLYSJRDGCGARV-WWYNWVTFSA-N 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 239000013543 active substance Substances 0.000 description 3
- 125000004423 acyloxy group Chemical group 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 3
- 125000003342 alkenyl group Chemical group 0.000 description 3
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 3
- 150000003973 alkyl amines Chemical class 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 150000003863 ammonium salts Chemical class 0.000 description 3
- 239000000010 aprotic solvent Substances 0.000 description 3
- 229910052786 argon Inorganic materials 0.000 description 3
- 239000003886 aromatase inhibitor Substances 0.000 description 3
- VSRXQHXAPYXROS-UHFFFAOYSA-N azanide;cyclobutane-1,1-dicarboxylic acid;platinum(2+) Chemical compound [NH2-].[NH2-].[Pt+2].OC(=O)C1(C(O)=O)CCC1 VSRXQHXAPYXROS-UHFFFAOYSA-N 0.000 description 3
- 230000008901 benefit Effects 0.000 description 3
- 229930195545 bengamide Natural products 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Substances N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- 150000001721 carbon Chemical group 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000000576 coating method Methods 0.000 description 3
- 229940076286 cupric acetate Drugs 0.000 description 3
- 150000004292 cyclic ethers Chemical class 0.000 description 3
- 238000010790 dilution Methods 0.000 description 3
- 239000012895 dilution Substances 0.000 description 3
- LOKCTEFSRHRXRJ-UHFFFAOYSA-I dipotassium trisodium dihydrogen phosphate hydrogen phosphate dichloride Chemical compound P(=O)(O)(O)[O-].[K+].P(=O)(O)([O-])[O-].[Na+].[Na+].[Cl-].[K+].[Cl-].[Na+] LOKCTEFSRHRXRJ-UHFFFAOYSA-I 0.000 description 3
- VJJPUSNTGOMMGY-MRVIYFEKSA-N etoposide Chemical compound COC1=C(O)C(OC)=CC([C@@H]2C3=CC=4OCOC=4C=C3[C@@H](O[C@H]3[C@@H]([C@@H](O)[C@@H]4O[C@H](C)OC[C@H]4O3)O)[C@@H]3[C@@H]2C(OC3)=O)=C1 VJJPUSNTGOMMGY-MRVIYFEKSA-N 0.000 description 3
- 229960005420 etoposide Drugs 0.000 description 3
- 238000000605 extraction Methods 0.000 description 3
- 230000014509 gene expression Effects 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 229960000908 idarubicin Drugs 0.000 description 3
- 238000001727 in vivo Methods 0.000 description 3
- QWTDNUCVQCZILF-UHFFFAOYSA-N isopentane Chemical compound CCC(C)C QWTDNUCVQCZILF-UHFFFAOYSA-N 0.000 description 3
- 239000011565 manganese chloride Substances 0.000 description 3
- 235000002867 manganese chloride Nutrition 0.000 description 3
- 229940073584 methylene chloride Drugs 0.000 description 3
- KKZJGLLVHKMTCM-UHFFFAOYSA-N mitoxantrone Chemical compound O=C1C2=C(O)C=CC(O)=C2C(=O)C2=C1C(NCCNCCO)=CC=C2NCCNCCO KKZJGLLVHKMTCM-UHFFFAOYSA-N 0.000 description 3
- 229960001156 mitoxantrone Drugs 0.000 description 3
- HVLIVVXDLANSAV-UHFFFAOYSA-N n-(2-bromophenyl)-3-nitro-6-phenylquinolin-4-amine Chemical compound [O-][N+](=O)C1=CN=C2C=CC(C=3C=CC=CC=3)=CC2=C1NC1=CC=CC=C1Br HVLIVVXDLANSAV-UHFFFAOYSA-N 0.000 description 3
- WWCBKELKCXVVGN-UHFFFAOYSA-N n-(4-fluorophenyl)-3-nitroquinolin-4-amine Chemical compound [O-][N+](=O)C1=CN=C2C=CC=CC2=C1NC1=CC=C(F)C=C1 WWCBKELKCXVVGN-UHFFFAOYSA-N 0.000 description 3
- 125000001624 naphthyl group Chemical group 0.000 description 3
- WQEPLUUGTLDZJY-UHFFFAOYSA-N pentadecanoic acid Chemical compound CCCCCCCCCCCCCCC(O)=O WQEPLUUGTLDZJY-UHFFFAOYSA-N 0.000 description 3
- 239000002953 phosphate buffered saline Substances 0.000 description 3
- 230000026731 phosphorylation Effects 0.000 description 3
- 238000006366 phosphorylation reaction Methods 0.000 description 3
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 239000003528 protein farnesyltransferase inhibitor Substances 0.000 description 3
- 125000004549 quinolin-4-yl group Chemical group N1=CC=C(C2=CC=CC=C12)* 0.000 description 3
- 125000006413 ring segment Chemical group 0.000 description 3
- 230000008054 signal transmission Effects 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 238000002415 sodium dodecyl sulfate polyacrylamide gel electrophoresis Methods 0.000 description 3
- 239000003381 stabilizer Substances 0.000 description 3
- HKSZLNNOFSGOKW-FYTWVXJKSA-N staurosporine Chemical compound C12=C3N4C5=CC=CC=C5C3=C3CNC(=O)C3=C2C2=CC=CC=C2N1[C@H]1C[C@@H](NC)[C@@H](OC)[C@]4(C)O1 HKSZLNNOFSGOKW-FYTWVXJKSA-N 0.000 description 3
- 125000005346 substituted cycloalkyl group Chemical group 0.000 description 3
- NRUKOCRGYNPUPR-QBPJDGROSA-N teniposide Chemical compound COC1=C(O)C(OC)=CC([C@@H]2C3=CC=4OCOC=4C=C3[C@@H](O[C@H]3[C@@H]([C@@H](O)[C@@H]4O[C@@H](OC[C@H]4O3)C=3SC=CC=3)O)[C@@H]3[C@@H]2C(OC3)=O)=C1 NRUKOCRGYNPUPR-QBPJDGROSA-N 0.000 description 3
- 229960001278 teniposide Drugs 0.000 description 3
- 150000003512 tertiary amines Chemical class 0.000 description 3
- 238000002560 therapeutic procedure Methods 0.000 description 3
- 230000001131 transforming effect Effects 0.000 description 3
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 3
- AADVCYNFEREWOS-UHFFFAOYSA-N (+)-DDM Natural products C=CC=CC(C)C(OC(N)=O)C(C)C(O)C(C)CC(C)=CC(C)C(O)C(C)C=CC(O)CC1OC(=O)C(C)C(O)C1C AADVCYNFEREWOS-UHFFFAOYSA-N 0.000 description 2
- GVJHHUAWPYXKBD-UHFFFAOYSA-N (±)-α-Tocopherol Chemical compound OC1=C(C)C(C)=C2OC(CCCC(C)CCCC(C)CCCC(C)C)(C)CCC2=C1C GVJHHUAWPYXKBD-UHFFFAOYSA-N 0.000 description 2
- OJWYDRGMQWQCBO-UHFFFAOYSA-N 1-(2-fluorophenyl)-3h-imidazo[4,5-c]quinolin-2-one Chemical compound FC1=CC=CC=C1N1C(=O)NC2=C1C1=CC=CC=C1N=C2 OJWYDRGMQWQCBO-UHFFFAOYSA-N 0.000 description 2
- AZUYLZMQTIKGSC-UHFFFAOYSA-N 1-[6-[4-(5-chloro-6-methyl-1H-indazol-4-yl)-5-methyl-3-(1-methylindazol-5-yl)pyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one Chemical compound ClC=1C(=C2C=NNC2=CC=1C)C=1C(=NN(C=1C)C1CC2(CN(C2)C(C=C)=O)C1)C=1C=C2C=NN(C2=CC=1)C AZUYLZMQTIKGSC-UHFFFAOYSA-N 0.000 description 2
- HPZMWTNATZPBIH-UHFFFAOYSA-N 1-methyladenine Chemical compound CN1C=NC2=NC=NC2=C1N HPZMWTNATZPBIH-UHFFFAOYSA-N 0.000 description 2
- UEJJHQNACJXSKW-UHFFFAOYSA-N 2-(2,6-dioxopiperidin-3-yl)-1H-isoindole-1,3(2H)-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1C1CCC(=O)NC1=O UEJJHQNACJXSKW-UHFFFAOYSA-N 0.000 description 2
- UMKSAURFQFUULT-UHFFFAOYSA-N 2-Amino-5-methoxybenzoic acid Chemical compound COC1=CC=C(N)C(C(O)=O)=C1 UMKSAURFQFUULT-UHFFFAOYSA-N 0.000 description 2
- IFXKXCLVKQVVDI-UHFFFAOYSA-N 2-amino-5-chlorobenzoic acid Chemical compound NC1=CC=C(Cl)C=C1C(O)=O IFXKXCLVKQVVDI-UHFFFAOYSA-N 0.000 description 2
- MUJQJJYAAYPRHQ-UHFFFAOYSA-N 2-amino-5-phenylbenzoic acid Chemical compound C1=C(C(O)=O)C(N)=CC=C1C1=CC=CC=C1 MUJQJJYAAYPRHQ-UHFFFAOYSA-N 0.000 description 2
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 2
- 229940093475 2-ethoxyethanol Drugs 0.000 description 2
- AOJJSUZBOXZQNB-VTZDEGQISA-N 4'-epidoxorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)[C@@H](O)[C@H](C)O1 AOJJSUZBOXZQNB-VTZDEGQISA-N 0.000 description 2
- CLPFFLWZZBQMAO-UHFFFAOYSA-N 4-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-5-yl)benzonitrile Chemical compound C1=CC(C#N)=CC=C1C1N2C=NC=C2CCC1 CLPFFLWZZBQMAO-UHFFFAOYSA-N 0.000 description 2
- HRXZRAXKKNUKRF-UHFFFAOYSA-N 4-ethylaniline Chemical compound CCC1=CC=C(N)C=C1 HRXZRAXKKNUKRF-UHFFFAOYSA-N 0.000 description 2
- KRZCOLNOCZKSDF-UHFFFAOYSA-N 4-fluoroaniline Chemical compound NC1=CC=C(F)C=C1 KRZCOLNOCZKSDF-UHFFFAOYSA-N 0.000 description 2
- HCXJFMDOHDNDCC-UHFFFAOYSA-N 5-$l^{1}-oxidanyl-3,4-dihydropyrrol-2-one Chemical group O=C1CCC(=O)[N]1 HCXJFMDOHDNDCC-UHFFFAOYSA-N 0.000 description 2
- POQBVOBQCWRDNF-UHFFFAOYSA-N 5-chloro-2-(2-nitroethylideneamino)benzoic acid Chemical compound OC(=O)C1=CC(Cl)=CC=C1N=CC[N+]([O-])=O POQBVOBQCWRDNF-UHFFFAOYSA-N 0.000 description 2
- VBJPDMKEAUJCLL-UHFFFAOYSA-N 5-fluoro-2-(2-nitroethylideneamino)benzoic acid Chemical compound OC(=O)C1=CC(F)=CC=C1N=CC[N+]([O-])=O VBJPDMKEAUJCLL-UHFFFAOYSA-N 0.000 description 2
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 2
- PGKNBGGQQHNSRR-UHFFFAOYSA-N 8-bromo-1-(2-chlorophenyl)-3-ethylimidazo[4,5-c]quinolin-2-one Chemical compound O=C1N(CC)C2=CN=C3C=CC(Br)=CC3=C2N1C1=CC=CC=C1Cl PGKNBGGQQHNSRR-UHFFFAOYSA-N 0.000 description 2
- SIQZFWRLJUKKCD-UHFFFAOYSA-N 8-bromo-1-(2-chlorophenyl)-3-propan-2-ylimidazo[4,5-c]quinolin-2-one Chemical compound O=C1N(C(C)C)C2=CN=C3C=CC(Br)=CC3=C2N1C1=CC=CC=C1Cl SIQZFWRLJUKKCD-UHFFFAOYSA-N 0.000 description 2
- QDQQGZWEVKSMRQ-UHFFFAOYSA-N 8-chloro-1-(2-chlorophenyl)-3-ethylimidazo[4,5-c]quinolin-2-one Chemical compound O=C1N(CC)C2=CN=C3C=CC(Cl)=CC3=C2N1C1=CC=CC=C1Cl QDQQGZWEVKSMRQ-UHFFFAOYSA-N 0.000 description 2
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 2
- 229920000936 Agarose Polymers 0.000 description 2
- OGSPWJRAVKPPFI-UHFFFAOYSA-N Alendronic Acid Chemical compound NCCCC(O)(P(O)(O)=O)P(O)(O)=O OGSPWJRAVKPPFI-UHFFFAOYSA-N 0.000 description 2
- 101100515517 Arabidopsis thaliana XI-I gene Proteins 0.000 description 2
- BFYIZQONLCFLEV-DAELLWKTSA-N Aromasine Chemical compound O=C1C=C[C@]2(C)[C@H]3CC[C@](C)(C(CC4)=O)[C@@H]4[C@@H]3CC(=C)C2=C1 BFYIZQONLCFLEV-DAELLWKTSA-N 0.000 description 2
- 229940122361 Bisphosphonate Drugs 0.000 description 2
- 108091003079 Bovine Serum Albumin Proteins 0.000 description 2
- 206010006187 Breast cancer Diseases 0.000 description 2
- 208000026310 Breast neoplasm Diseases 0.000 description 2
- 102000029330 CSK Tyrosine-Protein Kinase Human genes 0.000 description 2
- 108010069682 CSK Tyrosine-Protein Kinase Proteins 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- 208000001333 Colorectal Neoplasms Diseases 0.000 description 2
- CMSMOCZEIVJLDB-UHFFFAOYSA-N Cyclophosphamide Chemical compound ClCCN(CCCl)P1(=O)NCCCO1 CMSMOCZEIVJLDB-UHFFFAOYSA-N 0.000 description 2
- UHDGCWIWMRVCDJ-CCXZUQQUSA-N Cytarabine Chemical compound O=C1N=C(N)C=CN1[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O1 UHDGCWIWMRVCDJ-CCXZUQQUSA-N 0.000 description 2
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 2
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 2
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 2
- 229940123780 DNA topoisomerase I inhibitor Drugs 0.000 description 2
- 229940124087 DNA topoisomerase II inhibitor Drugs 0.000 description 2
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 2
- AADVCYNFEREWOS-OBRABYBLSA-N Discodermolide Chemical compound C=C\C=C/[C@H](C)[C@H](OC(N)=O)[C@@H](C)[C@H](O)[C@@H](C)C\C(C)=C/[C@H](C)[C@@H](O)[C@@H](C)\C=C/[C@@H](O)C[C@@H]1OC(=O)[C@H](C)[C@@H](O)[C@H]1C AADVCYNFEREWOS-OBRABYBLSA-N 0.000 description 2
- 102000001301 EGF receptor Human genes 0.000 description 2
- 108060006698 EGF receptor Proteins 0.000 description 2
- HTIJFSOGRVMCQR-UHFFFAOYSA-N Epirubicin Natural products COc1cccc2C(=O)c3c(O)c4CC(O)(CC(OC5CC(N)C(=O)C(C)O5)c4c(O)c3C(=O)c12)C(=O)CO HTIJFSOGRVMCQR-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- 102000018233 Fibroblast Growth Factor Human genes 0.000 description 2
- 108050007372 Fibroblast Growth Factor Proteins 0.000 description 2
- VWUXBMIQPBEWFH-WCCTWKNTSA-N Fulvestrant Chemical compound OC1=CC=C2[C@H]3CC[C@](C)([C@H](CC4)O)[C@@H]4[C@@H]3[C@H](CCCCCCCCCS(=O)CCCC(F)(F)C(F)(F)F)CC2=C1 VWUXBMIQPBEWFH-WCCTWKNTSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- 102400000932 Gonadoliberin-1 Human genes 0.000 description 2
- BLCLNMBMMGCOAS-URPVMXJPSA-N Goserelin Chemical compound C([C@@H](C(=O)N[C@H](COC(C)(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N1[C@@H](CCC1)C(=O)NNC(N)=O)NC(=O)[C@H](CO)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@H](CC=1NC=NC=1)NC(=O)[C@H]1NC(=O)CC1)C1=CC=C(O)C=C1 BLCLNMBMMGCOAS-URPVMXJPSA-N 0.000 description 2
- 101500026183 Homo sapiens Gonadoliberin-1 Proteins 0.000 description 2
- 101001059454 Homo sapiens Serine/threonine-protein kinase MARK2 Proteins 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- MPBVHIBUJCELCL-UHFFFAOYSA-N Ibandronate Chemical compound CCCCCN(C)CCC(O)(P(O)(O)=O)P(O)(O)=O MPBVHIBUJCELCL-UHFFFAOYSA-N 0.000 description 2
- 229910021576 Iron(III) bromide Inorganic materials 0.000 description 2
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical compound NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 description 2
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 2
- 229940124761 MMP inhibitor Drugs 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- 229930195725 Mannitol Natural products 0.000 description 2
- 102000002274 Matrix Metalloproteinases Human genes 0.000 description 2
- 108010000684 Matrix Metalloproteinases Proteins 0.000 description 2
- 241000699670 Mus sp. Species 0.000 description 2
- 208000033776 Myeloid Acute Leukemia Diseases 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 2
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 2
- ZDZOTLJHXYCWBA-VCVYQWHSSA-N N-debenzoyl-N-(tert-butoxycarbonyl)-10-deacetyltaxol Chemical compound O([C@H]1[C@H]2[C@@](C([C@H](O)C3=C(C)[C@@H](OC(=O)[C@H](O)[C@@H](NC(=O)OC(C)(C)C)C=4C=CC=CC=4)C[C@]1(O)C3(C)C)=O)(C)[C@@H](O)C[C@H]1OC[C@]12OC(=O)C)C(=O)C1=CC=CC=C1 ZDZOTLJHXYCWBA-VCVYQWHSSA-N 0.000 description 2
- 150000001204 N-oxides Chemical class 0.000 description 2
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 2
- ZQPPMHVWECSIRJ-UHFFFAOYSA-N Oleic acid Natural products CCCCCCCCC=CCCCCCCCC(O)=O ZQPPMHVWECSIRJ-UHFFFAOYSA-N 0.000 description 2
- 108091008606 PDGF receptors Proteins 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 102000011653 Platelet-Derived Growth Factor Receptors Human genes 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- 206010060862 Prostate cancer Diseases 0.000 description 2
- 108010014608 Proto-Oncogene Proteins c-kit Proteins 0.000 description 2
- 102000016971 Proto-Oncogene Proteins c-kit Human genes 0.000 description 2
- 108010089836 Proto-Oncogene Proteins c-met Proteins 0.000 description 2
- 102000008022 Proto-Oncogene Proteins c-met Human genes 0.000 description 2
- IIDJRNMFWXDHID-UHFFFAOYSA-N Risedronic acid Chemical compound OP(=O)(O)C(P(O)(O)=O)(O)CC1=CC=CN=C1 IIDJRNMFWXDHID-UHFFFAOYSA-N 0.000 description 2
- 229920002684 Sepharose Polymers 0.000 description 2
- 102100028904 Serine/threonine-protein kinase MARK2 Human genes 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 235000021355 Stearic acid Nutrition 0.000 description 2
- 229940100514 Syk tyrosine kinase inhibitor Drugs 0.000 description 2
- 108010065917 TOR Serine-Threonine Kinases Proteins 0.000 description 2
- 102000013530 TOR Serine-Threonine Kinases Human genes 0.000 description 2
- BPEGJWRSRHCHSN-UHFFFAOYSA-N Temozolomide Chemical compound O=C1N(C)N=NC2=C(C(N)=O)N=CN21 BPEGJWRSRHCHSN-UHFFFAOYSA-N 0.000 description 2
- MUMGGOZAMZWBJJ-DYKIIFRCSA-N Testostosterone Chemical compound O=C1CC[C@]2(C)[C@H]3CC[C@](C)([C@H](CC4)O)[C@@H]4[C@@H]3CCC2=C1 MUMGGOZAMZWBJJ-DYKIIFRCSA-N 0.000 description 2
- DKJJVAGXPKPDRL-UHFFFAOYSA-N Tiludronic acid Chemical compound OP(O)(=O)C(P(O)(O)=O)SC1=CC=C(Cl)C=C1 DKJJVAGXPKPDRL-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 239000000365 Topoisomerase I Inhibitor Substances 0.000 description 2
- 239000000317 Topoisomerase II Inhibitor Substances 0.000 description 2
- 108091008605 VEGF receptors Proteins 0.000 description 2
- 102000009484 Vascular Endothelial Growth Factor Receptors Human genes 0.000 description 2
- AIWRTTMUVOZGPW-HSPKUQOVSA-N abarelix Chemical compound C([C@@H](C(=O)N[C@H](CC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCCNC(C)C)C(=O)N1[C@@H](CCC1)C(=O)N[C@H](C)C(N)=O)N(C)C(=O)[C@H](CO)NC(=O)[C@@H](CC=1C=NC=CC=1)NC(=O)[C@@H](CC=1C=CC(Cl)=CC=1)NC(=O)[C@@H](CC=1C=C2C=CC=CC2=CC=1)NC(C)=O)C1=CC=C(O)C=C1 AIWRTTMUVOZGPW-HSPKUQOVSA-N 0.000 description 2
- 229960002184 abarelix Drugs 0.000 description 2
- 108010023617 abarelix Proteins 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 230000004913 activation Effects 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 238000001042 affinity chromatography Methods 0.000 description 2
- 239000000556 agonist Substances 0.000 description 2
- 229960004343 alendronic acid Drugs 0.000 description 2
- 150000001351 alkyl iodides Chemical class 0.000 description 2
- 229940100198 alkylating agent Drugs 0.000 description 2
- 239000002168 alkylating agent Substances 0.000 description 2
- 229960003437 aminoglutethimide Drugs 0.000 description 2
- ROBVIMPUHSLWNV-UHFFFAOYSA-N aminoglutethimide Chemical compound C=1C=C(N)C=CC=1C1(CC)CCC(=O)NC1=O ROBVIMPUHSLWNV-UHFFFAOYSA-N 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 229960002932 anastrozole Drugs 0.000 description 2
- YBBLVLTVTVSKRW-UHFFFAOYSA-N anastrozole Chemical compound N#CC(C)(C)C1=CC(C(C)(C#N)C)=CC(CN2N=CN=C2)=C1 YBBLVLTVTVSKRW-UHFFFAOYSA-N 0.000 description 2
- 230000002280 anti-androgenic effect Effects 0.000 description 2
- 229940046836 anti-estrogen Drugs 0.000 description 2
- 230000001833 anti-estrogenic effect Effects 0.000 description 2
- 230000000259 anti-tumor effect Effects 0.000 description 2
- 239000000051 antiandrogen Substances 0.000 description 2
- 229940030495 antiandrogen sex hormone and modulator of the genital system Drugs 0.000 description 2
- 239000002814 antineoplastic antimetabolite Substances 0.000 description 2
- 239000012736 aqueous medium Substances 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 229940046844 aromatase inhibitors Drugs 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 2
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- LURYMYITPCOQAU-UHFFFAOYSA-N benzoyl isocyanate Chemical compound O=C=NC(=O)C1=CC=CC=C1 LURYMYITPCOQAU-UHFFFAOYSA-N 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 150000004663 bisphosphonates Chemical class 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- 239000001506 calcium phosphate Substances 0.000 description 2
- 229960004562 carboplatin Drugs 0.000 description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 239000012876 carrier material Substances 0.000 description 2
- 229940047495 celebrex Drugs 0.000 description 2
- 229960000590 celecoxib Drugs 0.000 description 2
- 230000010261 cell growth Effects 0.000 description 2
- 235000010980 cellulose Nutrition 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 235000013339 cereals Nutrition 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- RNFNDJAIBTYOQL-UHFFFAOYSA-N chloral hydrate Chemical compound OC(O)C(Cl)(Cl)Cl RNFNDJAIBTYOQL-UHFFFAOYSA-N 0.000 description 2
- 229960002327 chloral hydrate Drugs 0.000 description 2
- LNAMMBFJMYMQTO-FNEBRGMMSA-N chloroform;(1e,4e)-1,5-diphenylpenta-1,4-dien-3-one;palladium Chemical compound [Pd].[Pd].ClC(Cl)Cl.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1 LNAMMBFJMYMQTO-FNEBRGMMSA-N 0.000 description 2
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 2
- 125000004230 chromenyl group Chemical group O1C(C=CC2=CC=CC=C12)* 0.000 description 2
- 230000001684 chronic effect Effects 0.000 description 2
- 229960002286 clodronic acid Drugs 0.000 description 2
- 239000008119 colloidal silica Substances 0.000 description 2
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 2
- 229940111134 coxibs Drugs 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 2
- 239000003255 cyclooxygenase 2 inhibitor Substances 0.000 description 2
- 229960004397 cyclophosphamide Drugs 0.000 description 2
- 230000001086 cytosolic effect Effects 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- HCUYBXPSSCRKRF-UHFFFAOYSA-N diphosgene Chemical compound ClC(=O)OC(Cl)(Cl)Cl HCUYBXPSSCRKRF-UHFFFAOYSA-N 0.000 description 2
- 229960003668 docetaxel Drugs 0.000 description 2
- UKMSUNONTOPOIO-UHFFFAOYSA-N docosanoic acid Chemical compound CCCCCCCCCCCCCCCCCCCCCC(O)=O UKMSUNONTOPOIO-UHFFFAOYSA-N 0.000 description 2
- POULHZVOKOAJMA-UHFFFAOYSA-N dodecanoic acid Chemical compound CCCCCCCCCCCC(O)=O POULHZVOKOAJMA-UHFFFAOYSA-N 0.000 description 2
- 229960004679 doxorubicin Drugs 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- ZQPPMHVWECSIRJ-MDZDMXLPSA-N elaidic acid Chemical compound CCCCCCCC\C=C\CCCCCCCC(O)=O ZQPPMHVWECSIRJ-MDZDMXLPSA-N 0.000 description 2
- 229960001904 epirubicin Drugs 0.000 description 2
- 229940011871 estrogen Drugs 0.000 description 2
- 239000000262 estrogen Substances 0.000 description 2
- 239000000328 estrogen antagonist Substances 0.000 description 2
- 229940052303 ethers for general anesthesia Drugs 0.000 description 2
- ZIUSEGSNTOUIPT-UHFFFAOYSA-N ethyl 2-cyanoacetate Chemical compound CCOC(=O)CC#N ZIUSEGSNTOUIPT-UHFFFAOYSA-N 0.000 description 2
- 229960000255 exemestane Drugs 0.000 description 2
- 229950011548 fadrozole Drugs 0.000 description 2
- 150000004665 fatty acids Chemical class 0.000 description 2
- 229940126864 fibroblast growth factor Drugs 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 229960004421 formestane Drugs 0.000 description 2
- OSVMTWJCGUFAOD-KZQROQTASA-N formestane Chemical compound O=C1CC[C@]2(C)[C@H]3CC[C@](C)(C(CC4)=O)[C@@H]4[C@@H]3CCC2=C1O OSVMTWJCGUFAOD-KZQROQTASA-N 0.000 description 2
- 229960002258 fulvestrant Drugs 0.000 description 2
- 125000002541 furyl group Chemical group 0.000 description 2
- 229940080856 gleevec Drugs 0.000 description 2
- XLXSAKCOAKORKW-AQJXLSMYSA-N gonadorelin Chemical compound C([C@@H](C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N1[C@@H](CCC1)C(=O)NCC(N)=O)NC(=O)[C@H](CO)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@H](CC=1N=CNC=1)NC(=O)[C@H]1NC(=O)CC1)C1=CC=C(O)C=C1 XLXSAKCOAKORKW-AQJXLSMYSA-N 0.000 description 2
- 229960001442 gonadorelin Drugs 0.000 description 2
- 229960002913 goserelin Drugs 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 239000001963 growth medium Substances 0.000 description 2
- KEMQGTRYUADPNZ-UHFFFAOYSA-N heptadecanoic acid Chemical compound CCCCCCCCCCCCCCCCC(O)=O KEMQGTRYUADPNZ-UHFFFAOYSA-N 0.000 description 2
- 125000001072 heteroaryl group Chemical group 0.000 description 2
- 125000005842 heteroatom Chemical group 0.000 description 2
- IPCSVZSSVZVIGE-UHFFFAOYSA-N hexadecanoic acid Chemical compound CCCCCCCCCCCCCCCC(O)=O IPCSVZSSVZVIGE-UHFFFAOYSA-N 0.000 description 2
- 229940121372 histone deacetylase inhibitor Drugs 0.000 description 2
- 239000003276 histone deacetylase inhibitor Substances 0.000 description 2
- 210000005260 human cell Anatomy 0.000 description 2
- 150000002443 hydroxylamines Chemical class 0.000 description 2
- 229960005236 ibandronic acid Drugs 0.000 description 2
- VKOBVWXKNCXXDE-UHFFFAOYSA-N icosanoic acid Chemical compound CCCCCCCCCCCCCCCCCCCC(O)=O VKOBVWXKNCXXDE-UHFFFAOYSA-N 0.000 description 2
- HOMGKSMUEGBAAB-UHFFFAOYSA-N ifosfamide Chemical compound ClCCNP1(=O)OCCCN1CCCl HOMGKSMUEGBAAB-UHFFFAOYSA-N 0.000 description 2
- 229960001101 ifosfamide Drugs 0.000 description 2
- 229960002411 imatinib Drugs 0.000 description 2
- 125000002883 imidazolyl group Chemical group 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 230000003993 interaction Effects 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- UWKQSNNFCGGAFS-XIFFEERXSA-N irinotecan Chemical compound C1=C2C(CC)=C3CN(C(C4=C([C@@](C(=O)OC4)(O)CC)C=4)=O)C=4C3=NC2=CC=C1OC(=O)N(CC1)CCC1N1CCCCC1 UWKQSNNFCGGAFS-XIFFEERXSA-N 0.000 description 2
- 229960004768 irinotecan Drugs 0.000 description 2
- SUMDYPCJJOFFON-UHFFFAOYSA-N isethionic acid Chemical compound OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 2
- TWBYWOBDOCUKOW-UHFFFAOYSA-N isonicotinic acid Chemical compound OC(=O)C1=CC=NC=C1 TWBYWOBDOCUKOW-UHFFFAOYSA-N 0.000 description 2
- QXJSBBXBKPUZAA-UHFFFAOYSA-N isooleic acid Natural products CCCCCCCC=CCCCCCCCCC(O)=O QXJSBBXBKPUZAA-UHFFFAOYSA-N 0.000 description 2
- 229960003881 letrozole Drugs 0.000 description 2
- HPJKCIUCZWXJDR-UHFFFAOYSA-N letrozole Chemical compound C1=CC(C#N)=CC=C1C(N1N=CN=C1)C1=CC=C(C#N)C=C1 HPJKCIUCZWXJDR-UHFFFAOYSA-N 0.000 description 2
- 238000012417 linear regression Methods 0.000 description 2
- 239000006166 lysate Substances 0.000 description 2
- 229940124302 mTOR inhibitor Drugs 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 239000003628 mammalian target of rapamycin inhibitor Substances 0.000 description 2
- 239000000594 mannitol Substances 0.000 description 2
- 235000010355 mannitol Nutrition 0.000 description 2
- 230000010534 mechanism of action Effects 0.000 description 2
- 230000001404 mediated effect Effects 0.000 description 2
- GLVAUDGFNGKCSF-UHFFFAOYSA-N mercaptopurine Chemical compound S=C1NC=NC2=C1NC=N2 GLVAUDGFNGKCSF-UHFFFAOYSA-N 0.000 description 2
- GRWIABMEEKERFV-UHFFFAOYSA-N methanol;oxolane Chemical compound OC.C1CCOC1 GRWIABMEEKERFV-UHFFFAOYSA-N 0.000 description 2
- BMGQWWVMWDBQGC-IIFHNQTCSA-N midostaurin Chemical compound CN([C@H]1[C@H]([C@]2(C)O[C@@H](N3C4=CC=CC=C4C4=C5C(=O)NCC5=C5C6=CC=CC=C6N2C5=C43)C1)OC)C(=O)C1=CC=CC=C1 BMGQWWVMWDBQGC-IIFHNQTCSA-N 0.000 description 2
- 229950010895 midostaurin Drugs 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 2
- 208000002154 non-small cell lung carcinoma Diseases 0.000 description 2
- 238000010606 normalization Methods 0.000 description 2
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 2
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 2
- 210000000287 oocyte Anatomy 0.000 description 2
- 230000002018 overexpression Effects 0.000 description 2
- DWAFYCQODLXJNR-BNTLRKBRSA-L oxaliplatin Chemical compound O1C(=O)C(=O)O[Pt]11N[C@@H]2CCCC[C@H]2N1 DWAFYCQODLXJNR-BNTLRKBRSA-L 0.000 description 2
- 229960001756 oxaliplatin Drugs 0.000 description 2
- SOWBFZRMHSNYGE-UHFFFAOYSA-N oxamic acid Chemical compound NC(=O)C(O)=O SOWBFZRMHSNYGE-UHFFFAOYSA-N 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- WRUUGTRCQOWXEG-UHFFFAOYSA-N pamidronate Chemical compound NCCC(O)(P(O)(O)=O)P(O)(O)=O WRUUGTRCQOWXEG-UHFFFAOYSA-N 0.000 description 2
- 229960003978 pamidronic acid Drugs 0.000 description 2
- 208000008443 pancreatic carcinoma Diseases 0.000 description 2
- 150000002978 peroxides Chemical class 0.000 description 2
- YBYRMVIVWMBXKQ-UHFFFAOYSA-N phenylmethanesulfonyl fluoride Chemical compound FS(=O)(=O)CC1=CC=CC=C1 YBYRMVIVWMBXKQ-UHFFFAOYSA-N 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 239000002798 polar solvent Substances 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- 229920000137 polyphosphoric acid Polymers 0.000 description 2
- 239000013641 positive control Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 2
- 108090000765 processed proteins & peptides Proteins 0.000 description 2
- 229940002612 prodrug Drugs 0.000 description 2
- 239000000651 prodrug Substances 0.000 description 2
- 201000001514 prostate carcinoma Diseases 0.000 description 2
- 125000003373 pyrazinyl group Chemical group 0.000 description 2
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 2
- BKXVVCILCIUCLG-UHFFFAOYSA-N raloxifene hydrochloride Chemical compound [H+].[Cl-].C1=CC(O)=CC=C1C1=C(C(=O)C=2C=CC(OCCN3CCCCC3)=CC=2)C2=CC=C(O)C=C2S1 BKXVVCILCIUCLG-UHFFFAOYSA-N 0.000 description 2
- 229960002119 raloxifene hydrochloride Drugs 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 238000006722 reduction reaction Methods 0.000 description 2
- 230000002829 reductive effect Effects 0.000 description 2
- 230000026267 regulation of growth Effects 0.000 description 2
- 229960000759 risedronic acid Drugs 0.000 description 2
- 229960004641 rituximab Drugs 0.000 description 2
- RZJQGNCSTQAWON-UHFFFAOYSA-N rofecoxib Chemical compound C1=CC(S(=O)(=O)C)=CC=C1C1=C(C=2C=CC=CC=2)C(=O)OC1 RZJQGNCSTQAWON-UHFFFAOYSA-N 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 238000007086 side reaction Methods 0.000 description 2
- QFJCIRLUMZQUOT-HPLJOQBZSA-N sirolimus Chemical compound C1C[C@@H](O)[C@H](OC)C[C@@H]1C[C@@H](C)[C@H]1OC(=O)[C@@H]2CCCCN2C(=O)C(=O)[C@](O)(O2)[C@H](C)CC[C@H]2C[C@H](OC)/C(C)=C/C=C/C=C/[C@@H](C)C[C@@H](C)C(=O)[C@H](OC)[C@H](O)/C(C)=C/[C@@H](C)C(=O)C1 QFJCIRLUMZQUOT-HPLJOQBZSA-N 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 238000000638 solvent extraction Methods 0.000 description 2
- 239000000600 sorbitol Substances 0.000 description 2
- 235000010356 sorbitol Nutrition 0.000 description 2
- 238000010561 standard procedure Methods 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 239000008117 stearic acid Substances 0.000 description 2
- 150000003431 steroids Chemical class 0.000 description 2
- 239000011550 stock solution Substances 0.000 description 2
- 125000005017 substituted alkenyl group Chemical group 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- 229960002317 succinimide Drugs 0.000 description 2
- 235000000346 sugar Nutrition 0.000 description 2
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 239000006228 supernatant Substances 0.000 description 2
- 229960001603 tamoxifen Drugs 0.000 description 2
- 229960004964 temozolomide Drugs 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 229960003433 thalidomide Drugs 0.000 description 2
- 229960005324 tiludronic acid Drugs 0.000 description 2
- UCFGDBYHRUNTLO-QHCPKHFHSA-N topotecan Chemical compound C1=C(O)C(CN(C)C)=C2C=C(CN3C4=CC5=C(C3=O)COC(=O)[C@]5(O)CC)C4=NC2=C1 UCFGDBYHRUNTLO-QHCPKHFHSA-N 0.000 description 2
- 229960000303 topotecan Drugs 0.000 description 2
- 238000000844 transformation Methods 0.000 description 2
- FEONEKOZSGPOFN-UHFFFAOYSA-K tribromoiron Chemical compound Br[Fe](Br)Br FEONEKOZSGPOFN-UHFFFAOYSA-K 0.000 description 2
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical class [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 2
- SZHOJFHSIKHZHA-UHFFFAOYSA-N tridecanoic acid Chemical compound CCCCCCCCCCCCC(O)=O SZHOJFHSIKHZHA-UHFFFAOYSA-N 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- 230000001228 trophic effect Effects 0.000 description 2
- 229960003048 vinblastine Drugs 0.000 description 2
- KDQAABAKXDWYSZ-PNYVAJAMSA-N vinblastine sulfate Chemical compound OS(O)(=O)=O.C([C@H](C[C@]1(C(=O)OC)C=2C(=CC3=C([C@]45[C@H]([C@@]([C@H](OC(C)=O)[C@]6(CC)C=CCN([C@H]56)CC4)(O)C(=O)OC)N3C)C=2)OC)C[C@@](C2)(O)CC)N2CCC2=C1NC1=CC=CC=C21 KDQAABAKXDWYSZ-PNYVAJAMSA-N 0.000 description 2
- 229960004982 vinblastine sulfate Drugs 0.000 description 2
- AQTQHPDCURKLKT-JKDPCDLQSA-N vincristine sulfate Chemical compound OS(O)(=O)=O.C([C@@H](C[C@]1(C(=O)OC)C=2C(=CC3=C([C@]45[C@H]([C@@]([C@H](OC(C)=O)[C@]6(CC)C=CCN([C@H]56)CC4)(O)C(=O)OC)N3C=O)C=2)OC)C[C@@](C2)(O)CC)N2CCC2=C1NC1=CC=CC=C21 AQTQHPDCURKLKT-JKDPCDLQSA-N 0.000 description 2
- 229960002110 vincristine sulfate Drugs 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 229960004276 zoledronic acid Drugs 0.000 description 2
- XRASPMIURGNCCH-UHFFFAOYSA-N zoledronic acid Chemical compound OP(=O)(O)C(P(O)(O)=O)(O)CN1C=CN=C1 XRASPMIURGNCCH-UHFFFAOYSA-N 0.000 description 2
- DNXHEGUUPJUMQT-UHFFFAOYSA-N (+)-estrone Natural products OC1=CC=C2C3CCC(C)(C(CC4)=O)C4C3CCC2=C1 DNXHEGUUPJUMQT-UHFFFAOYSA-N 0.000 description 1
- ROEQGIFOWRQYHD-UHFFFAOYSA-N (2-methoxyphenyl)boronic acid Chemical compound COC1=CC=CC=C1B(O)O ROEQGIFOWRQYHD-UHFFFAOYSA-N 0.000 description 1
- QBYIENPQHBMVBV-HFEGYEGKSA-N (2R)-2-hydroxy-2-phenylacetic acid Chemical compound O[C@@H](C(O)=O)c1ccccc1.O[C@@H](C(O)=O)c1ccccc1 QBYIENPQHBMVBV-HFEGYEGKSA-N 0.000 description 1
- OBETXYAYXDNJHR-SSDOTTSWSA-M (2r)-2-ethylhexanoate Chemical compound CCCC[C@@H](CC)C([O-])=O OBETXYAYXDNJHR-SSDOTTSWSA-M 0.000 description 1
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 1
- NLLGFYPSWCMUIV-UHFFFAOYSA-N (3-methoxyphenyl)boronic acid Chemical compound COC1=CC=CC(B(O)O)=C1 NLLGFYPSWCMUIV-UHFFFAOYSA-N 0.000 description 1
- COIQUVGFTILYGA-UHFFFAOYSA-N (4-hydroxyphenyl)boronic acid Chemical compound OB(O)C1=CC=C(O)C=C1 COIQUVGFTILYGA-UHFFFAOYSA-N 0.000 description 1
- VOAAEKKFGLPLLU-UHFFFAOYSA-N (4-methoxyphenyl)boronic acid Chemical compound COC1=CC=C(B(O)O)C=C1 VOAAEKKFGLPLLU-UHFFFAOYSA-N 0.000 description 1
- OYHQOLUKZRVURQ-NTGFUMLPSA-N (9Z,12Z)-9,10,12,13-tetratritiooctadeca-9,12-dienoic acid Chemical compound C(CCCCCCC\C(=C(/C\C(=C(/CCCCC)\[3H])\[3H])\[3H])\[3H])(=O)O OYHQOLUKZRVURQ-NTGFUMLPSA-N 0.000 description 1
- WRIDQFICGBMAFQ-UHFFFAOYSA-N (E)-8-Octadecenoic acid Natural products CCCCCCCCCC=CCCCCCCC(O)=O WRIDQFICGBMAFQ-UHFFFAOYSA-N 0.000 description 1
- LKJPYSCBVHEWIU-KRWDZBQOSA-N (R)-bicalutamide Chemical compound C([C@@](O)(C)C(=O)NC=1C=C(C(C#N)=CC=1)C(F)(F)F)S(=O)(=O)C1=CC=C(F)C=C1 LKJPYSCBVHEWIU-KRWDZBQOSA-N 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- UWYVPFMHMJIBHE-OWOJBTEDSA-N (e)-2-hydroxybut-2-enedioic acid Chemical compound OC(=O)\C=C(\O)C(O)=O UWYVPFMHMJIBHE-OWOJBTEDSA-N 0.000 description 1
- MOWXJLUYGFNTAL-DEOSSOPVSA-N (s)-[2-chloro-4-fluoro-5-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-(6-methoxypyridazin-3-yl)methanol Chemical compound N1=NC(OC)=CC=C1[C@@H](O)C1=CC(C=2C3=CC=C(C=C3N=CN=2)N2CCOCC2)=C(F)C=C1Cl MOWXJLUYGFNTAL-DEOSSOPVSA-N 0.000 description 1
- WBYWAXJHAXSJNI-VOTSOKGWSA-M .beta-Phenylacrylic acid Natural products [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 description 1
- RXYPXQSKLGGKOL-UHFFFAOYSA-N 1,4-dimethylpiperazine Chemical compound CN1CCN(C)CC1 RXYPXQSKLGGKOL-UHFFFAOYSA-N 0.000 description 1
- MWAYMFYZOJXJMU-UHFFFAOYSA-N 1-(2-chlorophenyl)-3-(3-methoxyphenyl)-8-methylimidazo[4,5-c]quinolin-2-one Chemical compound COC1=CC=CC(N2C(N(C=3C(=CC=CC=3)Cl)C3=C4C=C(C)C=CC4=NC=C32)=O)=C1 MWAYMFYZOJXJMU-UHFFFAOYSA-N 0.000 description 1
- YZRRSEDFOUEEHB-UHFFFAOYSA-N 1-(2-chlorophenyl)-8-methyl-3-[3-(trifluoromethyl)phenyl]imidazo[4,5-c]quinolin-2-one Chemical compound O=C1N(C=2C(=CC=CC=2)Cl)C=2C3=CC(C)=CC=C3N=CC=2N1C1=CC=CC(C(F)(F)F)=C1 YZRRSEDFOUEEHB-UHFFFAOYSA-N 0.000 description 1
- NGCYSPSIXIORIW-UHFFFAOYSA-N 1-(2-chlorophenyl)-8-phenylimidazo[4,5-c]quinoline Chemical compound ClC1=CC=CC=C1N1C2=C3C=C(C=4C=CC=CC=4)C=CC3=NC=C2N=C1 NGCYSPSIXIORIW-UHFFFAOYSA-N 0.000 description 1
- VPBYZLCHOKSGRX-UHFFFAOYSA-N 1-[2-chloro-4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-3-propylurea Chemical compound C1=C(Cl)C(NC(=O)NCCC)=CC=C1OC1=NC=NC2=CC(OC)=C(OC)C=C12 VPBYZLCHOKSGRX-UHFFFAOYSA-N 0.000 description 1
- PKKCVYOXEOJQJV-UHFFFAOYSA-N 1-cyclohexyl-6-hexoxy-8-methyl-3h-imidazo[4,5-c]quinolin-2-one Chemical compound O=C1NC2=CN=C3C(OCCCCCC)=CC(C)=CC3=C2N1C1CCCCC1 PKKCVYOXEOJQJV-UHFFFAOYSA-N 0.000 description 1
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 1
- SATCOUWSAZBIJO-UHFFFAOYSA-N 1-methyladenine Natural products N=C1N(C)C=NC2=C1NC=N2 SATCOUWSAZBIJO-UHFFFAOYSA-N 0.000 description 1
- VSNHCAURESNICA-NJFSPNSNSA-N 1-oxidanylurea Chemical compound N[14C](=O)NO VSNHCAURESNICA-NJFSPNSNSA-N 0.000 description 1
- 125000004343 1-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C([H])([H])[H] 0.000 description 1
- GJYOPPSKPPTEMK-UHFFFAOYSA-N 1-phenylimidazo[4,5-c]quinoline Chemical compound C1=NC2=CN=C3C=CC=CC3=C2N1C1=CC=CC=C1 GJYOPPSKPPTEMK-UHFFFAOYSA-N 0.000 description 1
- VOXZDWNPVJITMN-ZBRFXRBCSA-N 17β-estradiol Chemical compound OC1=CC=C2[C@H]3CC[C@](C)([C@H](CC4)O)[C@@H]4[C@@H]3CCC2=C1 VOXZDWNPVJITMN-ZBRFXRBCSA-N 0.000 description 1
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Natural products C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 1
- OIQOAYVCKAHSEJ-UHFFFAOYSA-N 2-[2,3-bis(2-hydroxyethoxy)propoxy]ethanol;hexadecanoic acid;octadecanoic acid Chemical compound OCCOCC(OCCO)COCCO.CCCCCCCCCCCCCCCC(O)=O.CCCCCCCCCCCCCCCCCC(O)=O OIQOAYVCKAHSEJ-UHFFFAOYSA-N 0.000 description 1
- WJCNWFPRVRWFCU-UHFFFAOYSA-N 2-[3-chloro-2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)phenyl]acetonitrile Chemical compound ClC=1C(=C(C=CC=1)CC#N)C1=CC2=C(NC(N2)=O)C=C1 WJCNWFPRVRWFCU-UHFFFAOYSA-N 0.000 description 1
- JKMHFZQWWAIEOD-UHFFFAOYSA-N 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid Chemical compound OCC[NH+]1CCN(CCS([O-])(=O)=O)CC1 JKMHFZQWWAIEOD-UHFFFAOYSA-N 0.000 description 1
- LYPLLHAZFMALOH-CMDGGOBGSA-N 2-[[(e)-2-nitroethenyl]amino]-5-phenylbenzoic acid Chemical compound C1=C(N\C=C\[N+]([O-])=O)C(C(=O)O)=CC(C=2C=CC=CC=2)=C1 LYPLLHAZFMALOH-CMDGGOBGSA-N 0.000 description 1
- NBUUUJWWOARGNW-UHFFFAOYSA-N 2-amino-5-methylbenzoic acid Chemical compound CC1=CC=C(N)C(C(O)=O)=C1 NBUUUJWWOARGNW-UHFFFAOYSA-N 0.000 description 1
- AOPBDRUWRLBSDB-UHFFFAOYSA-N 2-bromoaniline Chemical compound NC1=CC=CC=C1Br AOPBDRUWRLBSDB-UHFFFAOYSA-N 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 description 1
- FTZQXOJYPFINKJ-UHFFFAOYSA-N 2-fluoroaniline Chemical compound NC1=CC=CC=C1F FTZQXOJYPFINKJ-UHFFFAOYSA-N 0.000 description 1
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 description 1
- PKRSYEPBQPFNRB-UHFFFAOYSA-N 2-phenoxybenzoic acid Chemical compound OC(=O)C1=CC=CC=C1OC1=CC=CC=C1 PKRSYEPBQPFNRB-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- LQJBNNIYVWPHFW-UHFFFAOYSA-N 20:1omega9c fatty acid Natural products CCCCCCCCCCC=CCCCCCCCC(O)=O LQJBNNIYVWPHFW-UHFFFAOYSA-N 0.000 description 1
- HXHAJRMTJXHJJZ-UHFFFAOYSA-N 3-[(4-bromo-2,6-difluorophenyl)methoxy]-5-(4-pyrrolidin-1-ylbutylcarbamoylamino)-1,2-thiazole-4-carboxamide Chemical compound S1N=C(OCC=2C(=CC(Br)=CC=2F)F)C(C(=O)N)=C1NC(=O)NCCCCN1CCCC1 HXHAJRMTJXHJJZ-UHFFFAOYSA-N 0.000 description 1
- CGWOEOXQHIMZEQ-UHFFFAOYSA-N 3-[1-[[4-(2-phenylquinolin-3-yl)phenyl]methyl]piperidin-4-yl]-1h-benzimidazol-2-one Chemical compound OC1=NC2=CC=CC=C2N1C(CC1)CCN1CC(C=C1)=CC=C1C1=CC2=CC=CC=C2N=C1C1=CC=CC=C1 CGWOEOXQHIMZEQ-UHFFFAOYSA-N 0.000 description 1
- WEVYNIUIFUYDGI-UHFFFAOYSA-N 3-[6-[4-(trifluoromethoxy)anilino]-4-pyrimidinyl]benzamide Chemical compound NC(=O)C1=CC=CC(C=2N=CN=C(NC=3C=CC(OC(F)(F)F)=CC=3)C=2)=C1 WEVYNIUIFUYDGI-UHFFFAOYSA-N 0.000 description 1
- FCQGDVVXCCLVCM-UHFFFAOYSA-N 3-butyl-8-chloro-1-(2-chlorophenyl)imidazo[4,5-c]quinolin-2-one Chemical compound O=C1N(CCCC)C2=CN=C3C=CC(Cl)=CC3=C2N1C1=CC=CC=C1Cl FCQGDVVXCCLVCM-UHFFFAOYSA-N 0.000 description 1
- AZVSIHIBYRHSLB-UHFFFAOYSA-N 3-furaldehyde Chemical compound O=CC=1C=COC=1 AZVSIHIBYRHSLB-UHFFFAOYSA-N 0.000 description 1
- RXXCIBALSKQCAE-UHFFFAOYSA-N 3-methylbutoxymethylbenzene Chemical compound CC(C)CCOCC1=CC=CC=C1 RXXCIBALSKQCAE-UHFFFAOYSA-N 0.000 description 1
- XJCVRTZCHMZPBD-UHFFFAOYSA-N 3-nitroaniline Chemical compound NC1=CC=CC([N+]([O-])=O)=C1 XJCVRTZCHMZPBD-UHFFFAOYSA-N 0.000 description 1
- 102100037263 3-phosphoinositide-dependent protein kinase 1 Human genes 0.000 description 1
- XRYJULCDUUATMC-CYBMUJFWSA-N 4-[4-[[(1r)-1-phenylethyl]amino]-7h-pyrrolo[2,3-d]pyrimidin-6-yl]phenol Chemical compound N([C@H](C)C=1C=CC=CC=1)C(C=1C=2)=NC=NC=1NC=2C1=CC=C(O)C=C1 XRYJULCDUUATMC-CYBMUJFWSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- WUBBRNOQWQTFEX-UHFFFAOYSA-N 4-aminosalicylic acid Chemical compound NC1=CC=C(C(O)=O)C(O)=C1 WUBBRNOQWQTFEX-UHFFFAOYSA-N 0.000 description 1
- HIQIXEFWDLTDED-UHFFFAOYSA-N 4-hydroxy-1-piperidin-4-ylpyrrolidin-2-one Chemical compound O=C1CC(O)CN1C1CCNCC1 HIQIXEFWDLTDED-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- NCOHVAYBZYKKDD-UHFFFAOYSA-N 4-n-(2-bromophenyl)-6-phenylquinoline-3,4-diamine Chemical compound NC1=CN=C2C=CC(C=3C=CC=CC=3)=CC2=C1NC1=CC=CC=C1Br NCOHVAYBZYKKDD-UHFFFAOYSA-N 0.000 description 1
- IEBLZKGNWVVCIZ-UHFFFAOYSA-N 4-n-(2-chlorophenyl)-6-methoxyquinoline-3,4-diamine Chemical compound C12=CC(OC)=CC=C2N=CC(N)=C1NC1=CC=CC=C1Cl IEBLZKGNWVVCIZ-UHFFFAOYSA-N 0.000 description 1
- UJTDGUOZUSPKJH-UHFFFAOYSA-N 4-n-(2-chlorophenyl)-6-methylquinoline-3,4-diamine Chemical compound C12=CC(C)=CC=C2N=CC(N)=C1NC1=CC=CC=C1Cl UJTDGUOZUSPKJH-UHFFFAOYSA-N 0.000 description 1
- 125000002471 4H-quinolizinyl group Chemical group C=1(C=CCN2C=CC=CC12)* 0.000 description 1
- FPQMGQZTBWIHDN-UHFFFAOYSA-N 5-fluoroanthranilic acid Chemical compound NC1=CC=C(F)C=C1C(O)=O FPQMGQZTBWIHDN-UHFFFAOYSA-N 0.000 description 1
- FHIDNBAQOFJWCA-UAKXSSHOSA-N 5-fluorouridine Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C(F)=C1 FHIDNBAQOFJWCA-UAKXSSHOSA-N 0.000 description 1
- BUHKQTKKZAXSMH-UHFFFAOYSA-N 5-hydroxy-2-nitrobenzoic acid Chemical compound OC(=O)C1=CC(O)=CC=C1[N+]([O-])=O BUHKQTKKZAXSMH-UHFFFAOYSA-N 0.000 description 1
- URADKXVAIGMTEG-UHFFFAOYSA-N 5-methoxy-2-nitrobenzoic acid Chemical compound COC1=CC=C([N+]([O-])=O)C(C(O)=O)=C1 URADKXVAIGMTEG-UHFFFAOYSA-N 0.000 description 1
- KCBWAFJCKVKYHO-UHFFFAOYSA-N 6-(4-cyclopropyl-6-methoxypyrimidin-5-yl)-1-[[4-[1-propan-2-yl-4-(trifluoromethyl)imidazol-2-yl]phenyl]methyl]pyrazolo[3,4-d]pyrimidine Chemical compound C1(CC1)C1=NC=NC(=C1C1=NC=C2C(=N1)N(N=C2)CC1=CC=C(C=C1)C=1N(C=C(N=1)C(F)(F)F)C(C)C)OC KCBWAFJCKVKYHO-UHFFFAOYSA-N 0.000 description 1
- CAVJPYBVHUTBOE-UHFFFAOYSA-N 6-bromo-4-n-(2-fluorophenyl)quinoline-3,4-diamine Chemical compound NC1=CN=C2C=CC(Br)=CC2=C1NC1=CC=CC=C1F CAVJPYBVHUTBOE-UHFFFAOYSA-N 0.000 description 1
- BUAODDSTEWSEMK-UHFFFAOYSA-N 6-chloro-3-nitro-n-phenylquinolin-4-amine Chemical compound [O-][N+](=O)C1=CN=C2C=CC(Cl)=CC2=C1NC1=CC=CC=C1 BUAODDSTEWSEMK-UHFFFAOYSA-N 0.000 description 1
- RDKQXBPQDURIHF-UHFFFAOYSA-N 6-chloro-4-n-phenylquinoline-3,4-diamine Chemical compound NC1=CN=C2C=CC(Cl)=CC2=C1NC1=CC=CC=C1 RDKQXBPQDURIHF-UHFFFAOYSA-N 0.000 description 1
- CSSZKGFNMIFWKQ-UHFFFAOYSA-N 6-fluoro-4-n-(2-fluorophenyl)quinoline-3,4-diamine Chemical compound NC1=CN=C2C=CC(F)=CC2=C1NC1=CC=CC=C1F CSSZKGFNMIFWKQ-UHFFFAOYSA-N 0.000 description 1
- KWJQBFQQUXIWCS-UHFFFAOYSA-N 6-fluoro-n-(2-fluorophenyl)-3-nitroquinolin-4-amine Chemical compound [O-][N+](=O)C1=CN=C2C=CC(F)=CC2=C1NC1=CC=CC=C1F KWJQBFQQUXIWCS-UHFFFAOYSA-N 0.000 description 1
- STQGQHZAVUOBTE-UHFFFAOYSA-N 7-Cyan-hept-2t-en-4,6-diinsaeure Natural products C1=2C(O)=C3C(=O)C=4C(OC)=CC=CC=4C(=O)C3=C(O)C=2CC(O)(C(C)=O)CC1OC1CC(N)C(O)C(C)O1 STQGQHZAVUOBTE-UHFFFAOYSA-N 0.000 description 1
- HTINDOQFEYXGFM-UHFFFAOYSA-N 7-chloro-3h-imidazo[4,5-h]quinoline Chemical class C1=CC2=CC(Cl)=CN=C2C2=C1N=CN2 HTINDOQFEYXGFM-UHFFFAOYSA-N 0.000 description 1
- HVPHUJZCYZVLPJ-UHFFFAOYSA-N 7-chloro-4-n-(4-fluorophenyl)quinoline-3,4-diamine Chemical compound NC1=CN=C2C=C(Cl)C=CC2=C1NC1=CC=C(F)C=C1 HVPHUJZCYZVLPJ-UHFFFAOYSA-N 0.000 description 1
- XXVXFJLNTOEEKR-UHFFFAOYSA-N 8-bromo-1-(2-chlorophenyl)-3-(3-methoxyphenyl)imidazo[4,5-c]quinolin-2-one Chemical compound COC1=CC=CC(N2C(N(C=3C(=CC=CC=3)Cl)C3=C4C=C(Br)C=CC4=NC=C32)=O)=C1 XXVXFJLNTOEEKR-UHFFFAOYSA-N 0.000 description 1
- ZROZVGYZVPABDO-UHFFFAOYSA-N 8-bromo-1-(2-chlorophenyl)-3-(3-nitrophenyl)imidazo[4,5-c]quinolin-2-one Chemical compound [O-][N+](=O)C1=CC=CC(N2C(N(C=3C(=CC=CC=3)Cl)C3=C4C=C(Br)C=CC4=NC=C32)=O)=C1 ZROZVGYZVPABDO-UHFFFAOYSA-N 0.000 description 1
- ICJRYLZOAZRYHV-UHFFFAOYSA-N 8-bromo-1-(2-chlorophenyl)-3-[3-(trifluoromethyl)phenyl]imidazo[4,5-c]quinolin-2-one Chemical compound FC(F)(F)C1=CC=CC(N2C(N(C=3C(=CC=CC=3)Cl)C3=C4C=C(Br)C=CC4=NC=C32)=O)=C1 ICJRYLZOAZRYHV-UHFFFAOYSA-N 0.000 description 1
- FREQBDBZTXFXFU-UHFFFAOYSA-N 8-bromo-1-(2-chlorophenyl)imidazo[4,5-c]quinoline Chemical compound ClC1=CC=CC=C1N1C2=C3C=C(Br)C=CC3=NC=C2N=C1 FREQBDBZTXFXFU-UHFFFAOYSA-N 0.000 description 1
- DPERJEFFYWQKRO-UHFFFAOYSA-N 8-chloro-1-(2-chlorophenyl)-3-(2,2-dimethylpropyl)imidazo[4,5-c]quinolin-2-one Chemical compound O=C1N(CC(C)(C)C)C2=CN=C3C=CC(Cl)=CC3=C2N1C1=CC=CC=C1Cl DPERJEFFYWQKRO-UHFFFAOYSA-N 0.000 description 1
- IPCMFDPJMZDJEJ-UHFFFAOYSA-N 8-chloro-1-(2-chlorophenyl)-3-(2-methylpropyl)imidazo[4,5-c]quinolin-2-one Chemical compound O=C1N(CC(C)C)C2=CN=C3C=CC(Cl)=CC3=C2N1C1=CC=CC=C1Cl IPCMFDPJMZDJEJ-UHFFFAOYSA-N 0.000 description 1
- BGPKBMKIUFZTME-UHFFFAOYSA-N 8-chloro-1-(2-chlorophenyl)-3-(3-nitrophenyl)imidazo[4,5-c]quinolin-2-one Chemical compound [O-][N+](=O)C1=CC=CC(N2C(N(C=3C(=CC=CC=3)Cl)C3=C4C=C(Cl)C=CC4=NC=C32)=O)=C1 BGPKBMKIUFZTME-UHFFFAOYSA-N 0.000 description 1
- MSEKIAPUFVTREV-UHFFFAOYSA-N 8-chloro-1-(2-chlorophenyl)-3-[3-(trifluoromethyl)phenyl]imidazo[4,5-c]quinolin-2-one Chemical compound FC(F)(F)C1=CC=CC(N2C(N(C=3C(=CC=CC=3)Cl)C3=C4C=C(Cl)C=CC4=NC=C32)=O)=C1 MSEKIAPUFVTREV-UHFFFAOYSA-N 0.000 description 1
- VPBLZCNTOYVMEG-UHFFFAOYSA-N 8-chloro-3h-imidazo[4,5-h]quinoline Chemical class C12=NC(Cl)=CC=C2C=CC2=C1NC=N2 VPBLZCNTOYVMEG-UHFFFAOYSA-N 0.000 description 1
- GKGQLOIQKJCTTP-UHFFFAOYSA-N 8-fluoro-3h-imidazo[4,5-h]quinoline Chemical class C12=NC(F)=CC=C2C=CC2=C1NC=N2 GKGQLOIQKJCTTP-UHFFFAOYSA-N 0.000 description 1
- QSBYPNXLFMSGKH-UHFFFAOYSA-N 9-Heptadecensaeure Natural products CCCCCCCC=CCCCCCCCC(O)=O QSBYPNXLFMSGKH-UHFFFAOYSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- 208000010507 Adenocarcinoma of Lung Diseases 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- 102000002260 Alkaline Phosphatase Human genes 0.000 description 1
- 108020004774 Alkaline Phosphatase Proteins 0.000 description 1
- 235000019489 Almond oil Nutrition 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 108010039627 Aprotinin Proteins 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- 229940122815 Aromatase inhibitor Drugs 0.000 description 1
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 1
- 241000258957 Asteroidea Species 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- 101150049556 Bcr gene Proteins 0.000 description 1
- 235000021357 Behenic acid Nutrition 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 206010005003 Bladder cancer Diseases 0.000 description 1
- DPUOLQHDNGRHBS-UHFFFAOYSA-N Brassidinsaeure Natural products CCCCCCCCC=CCCCCCCCCCCCC(O)=O DPUOLQHDNGRHBS-UHFFFAOYSA-N 0.000 description 1
- NLZUEZXRPGMBCV-UHFFFAOYSA-N Butylhydroxytoluene Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NLZUEZXRPGMBCV-UHFFFAOYSA-N 0.000 description 1
- JGLMVXWAHNTPRF-CMDGGOBGSA-N CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O Chemical compound CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O JGLMVXWAHNTPRF-CMDGGOBGSA-N 0.000 description 1
- 101150012716 CDK1 gene Proteins 0.000 description 1
- 101100381481 Caenorhabditis elegans baz-2 gene Proteins 0.000 description 1
- KLWPJMFMVPTNCC-UHFFFAOYSA-N Camptothecin Natural products CCC1(O)C(=O)OCC2=C1C=C3C4Nc5ccccc5C=C4CN3C2=O KLWPJMFMVPTNCC-UHFFFAOYSA-N 0.000 description 1
- GAGWJHPBXLXJQN-UORFTKCHSA-N Capecitabine Chemical compound C1=C(F)C(NC(=O)OCCCCC)=NC(=O)N1[C@H]1[C@H](O)[C@H](O)[C@@H](C)O1 GAGWJHPBXLXJQN-UORFTKCHSA-N 0.000 description 1
- GAGWJHPBXLXJQN-UHFFFAOYSA-N Capecitabine Natural products C1=C(F)C(NC(=O)OCCCCC)=NC(=O)N1C1C(O)C(O)C(C)O1 GAGWJHPBXLXJQN-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- WBYWAXJHAXSJNI-SREVYHEPSA-N Cinnamic acid Chemical compound OC(=O)\C=C/C1=CC=CC=C1 WBYWAXJHAXSJNI-SREVYHEPSA-N 0.000 description 1
- PTOAARAWEBMLNO-KVQBGUIXSA-N Cladribine Chemical compound C1=NC=2C(N)=NC(Cl)=NC=2N1[C@H]1C[C@H](O)[C@@H](CO)O1 PTOAARAWEBMLNO-KVQBGUIXSA-N 0.000 description 1
- 238000011537 Coomassie blue staining Methods 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 229920002307 Dextran Polymers 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 238000002965 ELISA Methods 0.000 description 1
- 239000006145 Eagle's minimal essential medium Substances 0.000 description 1
- LVGKNOAMLMIIKO-UHFFFAOYSA-N Elaidinsaeure-aethylester Natural products CCCCCCCCC=CCCCCCCCC(=O)OCC LVGKNOAMLMIIKO-UHFFFAOYSA-N 0.000 description 1
- QXRSDHAAWVKZLJ-OXZHEXMSSA-N Epothilone B Natural products O=C1[C@H](C)[C@H](O)[C@@H](C)CCC[C@@]2(C)O[C@H]2C[C@@H](/C(=C\c2nc(C)sc2)/C)OC(=O)C[C@H](O)C1(C)C QXRSDHAAWVKZLJ-OXZHEXMSSA-N 0.000 description 1
- XOZIUKBZLSUILX-SDMHVBBESA-N Epothilone D Natural products O=C1[C@H](C)[C@@H](O)[C@@H](C)CCC/C(/C)=C/C[C@@H](/C(=C\c2nc(C)sc2)/C)OC(=O)C[C@H](O)C1(C)C XOZIUKBZLSUILX-SDMHVBBESA-N 0.000 description 1
- URXZXNYJPAJJOQ-UHFFFAOYSA-N Erucic acid Natural products CCCCCCC=CCCCCCCCCCCCC(O)=O URXZXNYJPAJJOQ-UHFFFAOYSA-N 0.000 description 1
- 102100038595 Estrogen receptor Human genes 0.000 description 1
- DNXHEGUUPJUMQT-CBZIJGRNSA-N Estrone Chemical compound OC1=CC=C2[C@H]3CC[C@](C)(C(CC4)=O)[C@@H]4[C@@H]3CCC2=C1 DNXHEGUUPJUMQT-CBZIJGRNSA-N 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 1
- HKVAMNSJSFKALM-GKUWKFKPSA-N Everolimus Chemical compound C1C[C@@H](OCCO)[C@H](OC)C[C@@H]1C[C@@H](C)[C@H]1OC(=O)[C@@H]2CCCCN2C(=O)C(=O)[C@](O)(O2)[C@H](C)CC[C@H]2C[C@H](OC)/C(C)=C/C=C/C=C/[C@@H](C)C[C@@H](C)C(=O)[C@H](OC)[C@H](O)/C(C)=C/[C@@H](C)C(=O)C1 HKVAMNSJSFKALM-GKUWKFKPSA-N 0.000 description 1
- 102000007317 Farnesyltranstransferase Human genes 0.000 description 1
- 108010007508 Farnesyltranstransferase Proteins 0.000 description 1
- GHASVSINZRGABV-UHFFFAOYSA-N Fluorouracil Chemical compound FC1=CNC(=O)NC1=O GHASVSINZRGABV-UHFFFAOYSA-N 0.000 description 1
- 239000001828 Gelatine Substances 0.000 description 1
- SXRSQZLOMIGNAQ-UHFFFAOYSA-N Glutaraldehyde Chemical compound O=CCCCC=O SXRSQZLOMIGNAQ-UHFFFAOYSA-N 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 102100022623 Hepatocyte growth factor receptor Human genes 0.000 description 1
- 206010067943 Hereditary papillary renal carcinoma Diseases 0.000 description 1
- 208000027927 Hereditary papillary renal cell carcinoma Diseases 0.000 description 1
- 102000003964 Histone deacetylase Human genes 0.000 description 1
- 108090000353 Histone deacetylase Proteins 0.000 description 1
- 108010033040 Histones Proteins 0.000 description 1
- 102000006947 Histones Human genes 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- 101000600756 Homo sapiens 3-phosphoinositide-dependent protein kinase 1 Proteins 0.000 description 1
- 101000972946 Homo sapiens Hepatocyte growth factor receptor Proteins 0.000 description 1
- 101000808011 Homo sapiens Vascular endothelial growth factor A Proteins 0.000 description 1
- 101001117146 Homo sapiens [Pyruvate dehydrogenase (acetyl-transferring)] kinase isozyme 1, mitochondrial Proteins 0.000 description 1
- 108090000144 Human Proteins Proteins 0.000 description 1
- 102000003839 Human Proteins Human genes 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- 238000012404 In vitro experiment Methods 0.000 description 1
- PIWKPBJCKXDKJR-UHFFFAOYSA-N Isoflurane Chemical compound FC(F)OC(Cl)C(F)(F)F PIWKPBJCKXDKJR-UHFFFAOYSA-N 0.000 description 1
- ODKSFYDXXFIFQN-BYPYZUCNSA-P L-argininium(2+) Chemical compound NC(=[NH2+])NCCC[C@H]([NH3+])C(O)=O ODKSFYDXXFIFQN-BYPYZUCNSA-P 0.000 description 1
- FBOZXECLQNJBKD-ZDUSSCGKSA-N L-methotrexate Chemical compound C=1N=C2N=C(N)N=C(N)C2=NC=1CN(C)C1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 FBOZXECLQNJBKD-ZDUSSCGKSA-N 0.000 description 1
- 239000005551 L01XE03 - Erlotinib Substances 0.000 description 1
- 239000005639 Lauric acid Substances 0.000 description 1
- GDBQQVLCIARPGH-UHFFFAOYSA-N Leupeptin Natural products CC(C)CC(NC(C)=O)C(=O)NC(CC(C)C)C(=O)NC(C=O)CCCN=C(N)N GDBQQVLCIARPGH-UHFFFAOYSA-N 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- 101150105382 MET gene Proteins 0.000 description 1
- 239000007993 MOPS buffer Substances 0.000 description 1
- 108010046938 Macrophage Colony-Stimulating Factor Proteins 0.000 description 1
- 102100028123 Macrophage colony-stimulating factor 1 Human genes 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 238000003820 Medium-pressure liquid chromatography Methods 0.000 description 1
- 206010027457 Metastases to liver Diseases 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- 101100335081 Mus musculus Flt3 gene Proteins 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- AYCPARAPKDAOEN-LJQANCHMSA-N N-[(1S)-2-(dimethylamino)-1-phenylethyl]-6,6-dimethyl-3-[(2-methyl-4-thieno[3,2-d]pyrimidinyl)amino]-1,4-dihydropyrrolo[3,4-c]pyrazole-5-carboxamide Chemical compound C1([C@H](NC(=O)N2C(C=3NN=C(NC=4C=5SC=CC=5N=C(C)N=4)C=3C2)(C)C)CN(C)C)=CC=CC=C1 AYCPARAPKDAOEN-LJQANCHMSA-N 0.000 description 1
- HTLZVHNRZJPSMI-UHFFFAOYSA-N N-ethylpiperidine Chemical compound CCN1CCCCC1 HTLZVHNRZJPSMI-UHFFFAOYSA-N 0.000 description 1
- 101100030361 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) pph-3 gene Proteins 0.000 description 1
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 1
- MBJMCOJMDMARNB-UHFFFAOYSA-N O.O.O.O.[Na].[Na].OP(O)(=O)C(Cl)(Cl)P(O)(O)=O Chemical compound O.O.O.O.[Na].[Na].OP(O)(=O)C(Cl)(Cl)P(O)(O)=O MBJMCOJMDMARNB-UHFFFAOYSA-N 0.000 description 1
- 239000005642 Oleic acid Substances 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 239000002033 PVDF binder Substances 0.000 description 1
- 229930012538 Paclitaxel Natural products 0.000 description 1
- 235000021314 Palmitic acid Nutrition 0.000 description 1
- 206010061902 Pancreatic neoplasm Diseases 0.000 description 1
- 239000005662 Paraffin oil Substances 0.000 description 1
- 229910002666 PdCl2 Inorganic materials 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- 108010038512 Platelet-Derived Growth Factor Proteins 0.000 description 1
- 102000010780 Platelet-Derived Growth Factor Human genes 0.000 description 1
- 102000004005 Prostaglandin-endoperoxide synthases Human genes 0.000 description 1
- 108090000459 Prostaglandin-endoperoxide synthases Proteins 0.000 description 1
- 229940123924 Protein kinase C inhibitor Drugs 0.000 description 1
- 108700020978 Proto-Oncogene Proteins 0.000 description 1
- 102000052575 Proto-Oncogene Human genes 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-N R-2-phenyl-2-hydroxyacetic acid Natural products OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 101100372762 Rattus norvegicus Flt1 gene Proteins 0.000 description 1
- 102000004278 Receptor Protein-Tyrosine Kinases Human genes 0.000 description 1
- 108090000873 Receptor Protein-Tyrosine Kinases Proteins 0.000 description 1
- 102000038012 SFKs Human genes 0.000 description 1
- 108091008118 SFKs Proteins 0.000 description 1
- JXVIIQLNUPXOII-UHFFFAOYSA-N Siduron Chemical compound CC1CCCCC1NC(=O)NC1=CC=CC=C1 JXVIIQLNUPXOII-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 1
- 208000010513 Stupor Diseases 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 229940123237 Taxane Drugs 0.000 description 1
- CBPNZQVSJQDFBE-FUXHJELOSA-N Temsirolimus Chemical compound C1C[C@@H](OC(=O)C(C)(CO)CO)[C@H](OC)C[C@@H]1C[C@@H](C)[C@H]1OC(=O)[C@@H]2CCCCN2C(=O)C(=O)[C@](O)(O2)[C@H](C)CC[C@H]2C[C@H](OC)/C(C)=C/C=C/C=C/[C@@H](C)C[C@@H](C)C(=O)[C@H](OC)[C@H](O)/C(C)=C/[C@@H](C)C(=O)C1 CBPNZQVSJQDFBE-FUXHJELOSA-N 0.000 description 1
- 208000024770 Thyroid neoplasm Diseases 0.000 description 1
- IVTVGDXNLFLDRM-HNNXBMFYSA-N Tomudex Chemical compound C=1C=C2NC(C)=NC(=O)C2=CC=1CN(C)C1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)S1 IVTVGDXNLFLDRM-HNNXBMFYSA-N 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 241000209140 Triticum Species 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- 229940122803 Vinca alkaloid Drugs 0.000 description 1
- 229930003427 Vitamin E Natural products 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- LXRZVMYMQHNYJB-UNXOBOICSA-N [(1R,2S,4R)-4-[[5-[4-[(1R)-7-chloro-1,2,3,4-tetrahydroisoquinolin-1-yl]-5-methylthiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate Chemical compound CC1=C(C=C(S1)C(=O)C1=C(N[C@H]2C[C@H](O)[C@@H](COS(N)(=O)=O)C2)N=CN=C1)[C@@H]1NCCC2=C1C=C(Cl)C=C2 LXRZVMYMQHNYJB-UNXOBOICSA-N 0.000 description 1
- YSVZGWAJIHWNQK-UHFFFAOYSA-N [3-(hydroxymethyl)-2-bicyclo[2.2.1]heptanyl]methanol Chemical compound C1CC2C(CO)C(CO)C1C2 YSVZGWAJIHWNQK-UHFFFAOYSA-N 0.000 description 1
- XQAXGZLFSSPBMK-UHFFFAOYSA-M [7-(dimethylamino)phenothiazin-3-ylidene]-dimethylazanium;chloride;trihydrate Chemical compound O.O.O.[Cl-].C1=CC(=[N+](C)C)C=C2SC3=CC(N(C)C)=CC=C3N=C21 XQAXGZLFSSPBMK-UHFFFAOYSA-M 0.000 description 1
- 108700025690 abl Genes Proteins 0.000 description 1
- QPMSXSBEVQLBIL-CZRHPSIPSA-N ac1mix0p Chemical compound C1=CC=C2N(C[C@H](C)CN(C)C)C3=CC(OC)=CC=C3SC2=C1.O([C@H]1[C@]2(OC)C=CC34C[C@@H]2[C@](C)(O)CCC)C2=C5[C@]41CCN(C)[C@@H]3CC5=CC=C2O QPMSXSBEVQLBIL-CZRHPSIPSA-N 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 125000000641 acridinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3C=C12)* 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000002730 additional effect Effects 0.000 description 1
- 229940009456 adriamycin Drugs 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 235000010419 agar Nutrition 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 1
- 150000008046 alkali metal hydrides Chemical class 0.000 description 1
- 229910052936 alkali metal sulfate Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001341 alkaline earth metal compounds Chemical class 0.000 description 1
- 125000004471 alkyl aminosulfonyl group Chemical group 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 125000005115 alkyl carbamoyl group Chemical group 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 239000008168 almond oil Substances 0.000 description 1
- OBETXYAYXDNJHR-UHFFFAOYSA-N alpha-ethylcaproic acid Natural products CCCCC(CC)C(O)=O OBETXYAYXDNJHR-UHFFFAOYSA-N 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 235000001014 amino acid Nutrition 0.000 description 1
- 229960004909 aminosalicylic acid Drugs 0.000 description 1
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- AEMFNILZOJDQLW-QAGGRKNESA-N androst-4-ene-3,17-dione Chemical compound O=C1CC[C@]2(C)[C@H]3CC[C@](C)(C(CC4)=O)[C@@H]4[C@@H]3CCC2=C1 AEMFNILZOJDQLW-QAGGRKNESA-N 0.000 description 1
- 229960005471 androstenedione Drugs 0.000 description 1
- AEMFNILZOJDQLW-UHFFFAOYSA-N androstenedione Natural products O=C1CCC2(C)C3CCC(C)(C(CC4)=O)C4C3CCC2=C1 AEMFNILZOJDQLW-UHFFFAOYSA-N 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 238000005349 anion exchange Methods 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 150000004056 anthraquinones Chemical class 0.000 description 1
- 125000005428 anthryl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C3C(*)=C([H])C([H])=C([H])C3=C([H])C2=C1[H] 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 230000001093 anti-cancer Effects 0.000 description 1
- 229940034982 antineoplastic agent Drugs 0.000 description 1
- 239000002246 antineoplastic agent Substances 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 235000006708 antioxidants Nutrition 0.000 description 1
- 230000006907 apoptotic process Effects 0.000 description 1
- 229960004405 aprotinin Drugs 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 239000012300 argon atmosphere Substances 0.000 description 1
- 150000001543 aryl boronic acids Chemical class 0.000 description 1
- 125000004391 aryl sulfonyl group Chemical group 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000003305 autocrine Effects 0.000 description 1
- 230000035578 autophosphorylation Effects 0.000 description 1
- 229940120638 avastin Drugs 0.000 description 1
- 125000004045 azirinyl group Chemical group 0.000 description 1
- 125000003828 azulenyl group Chemical group 0.000 description 1
- 229940116226 behenic acid Drugs 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- 229960000397 bevacizumab Drugs 0.000 description 1
- 229960000997 bicalutamide Drugs 0.000 description 1
- 125000002619 bicyclic group Chemical group 0.000 description 1
- 201000001531 bladder carcinoma Diseases 0.000 description 1
- 229940098773 bovine serum albumin Drugs 0.000 description 1
- 201000008274 breast adenocarcinoma Diseases 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 235000010354 butylated hydroxytoluene Nutrition 0.000 description 1
- 210000004899 c-terminal region Anatomy 0.000 description 1
- 229940043430 calcium compound Drugs 0.000 description 1
- 150000001674 calcium compounds Chemical class 0.000 description 1
- FUFJGUQYACFECW-UHFFFAOYSA-L calcium hydrogenphosphate Chemical compound [Ca+2].OP([O-])([O-])=O FUFJGUQYACFECW-UHFFFAOYSA-L 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 1
- 235000013539 calcium stearate Nutrition 0.000 description 1
- 239000008116 calcium stearate Substances 0.000 description 1
- 238000004364 calculation method Methods 0.000 description 1
- 244000309466 calf Species 0.000 description 1
- 229940127093 camptothecin Drugs 0.000 description 1
- VSJKWCGYPAHWDS-FQEVSTJZSA-N camptothecin Chemical compound C1=CC=C2C=C(CN3C4=CC5=C(C3=O)COC(=O)[C@]5(O)CC)C4=NC2=C1 VSJKWCGYPAHWDS-FQEVSTJZSA-N 0.000 description 1
- 229960004117 capecitabine Drugs 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 239000004359 castor oil Substances 0.000 description 1
- 235000019438 castor oil Nutrition 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 238000004113 cell culture Methods 0.000 description 1
- 230000032823 cell division Effects 0.000 description 1
- 210000003855 cell nucleus Anatomy 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- MLIFNJABMANKEU-UHFFFAOYSA-N cep-5214 Chemical compound C1=CC=C2C3=C(C(=O)NC4)C4=C(C=4C(=CC=C(C=4)COC(C)C)N4CCCO)C4=C3CC2=C1 MLIFNJABMANKEU-UHFFFAOYSA-N 0.000 description 1
- 239000013522 chelant Substances 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 210000004978 chinese hamster ovary cell Anatomy 0.000 description 1
- 125000003016 chromanyl group Chemical group O1C(CCC2=CC=CC=C12)* 0.000 description 1
- 238000013375 chromatographic separation Methods 0.000 description 1
- 230000008711 chromosomal rearrangement Effects 0.000 description 1
- 229930016911 cinnamic acid Natural products 0.000 description 1
- 235000013985 cinnamic acid Nutrition 0.000 description 1
- 125000000259 cinnolinyl group Chemical group N1=NC(=CC2=CC=CC=C12)* 0.000 description 1
- DQLATGHUWYMOKM-UHFFFAOYSA-L cisplatin Chemical compound N[Pt](N)(Cl)Cl DQLATGHUWYMOKM-UHFFFAOYSA-L 0.000 description 1
- 229960004316 cisplatin Drugs 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 229960002436 cladribine Drugs 0.000 description 1
- ACSIXWWBWUQEHA-UHFFFAOYSA-N clodronic acid Chemical compound OP(O)(=O)C(Cl)(Cl)P(O)(O)=O ACSIXWWBWUQEHA-UHFFFAOYSA-N 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 208000029742 colonic neoplasm Diseases 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 230000006552 constitutive activation Effects 0.000 description 1
- 230000037011 constitutive activity Effects 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 235000012343 cottonseed oil Nutrition 0.000 description 1
- 239000002385 cottonseed oil Substances 0.000 description 1
- 239000013058 crude material Substances 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001162 cycloheptenyl group Chemical group C1(=CCCCCC1)* 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- JMYVMOUINOAAPA-UHFFFAOYSA-N cyclopropanecarbaldehyde Chemical compound O=CC1CC1 JMYVMOUINOAAPA-UHFFFAOYSA-N 0.000 description 1
- 229960000684 cytarabine Drugs 0.000 description 1
- STQGQHZAVUOBTE-VGBVRHCVSA-N daunorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(C)=O)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 STQGQHZAVUOBTE-VGBVRHCVSA-N 0.000 description 1
- 229960000975 daunorubicin Drugs 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- XOZIUKBZLSUILX-UHFFFAOYSA-N desoxyepothilone B Natural products O1C(=O)CC(O)C(C)(C)C(=O)C(C)C(O)C(C)CCCC(C)=CCC1C(C)=CC1=CSC(C)=N1 XOZIUKBZLSUILX-UHFFFAOYSA-N 0.000 description 1
- 230000000368 destabilizing effect Effects 0.000 description 1
- 238000001514 detection method Methods 0.000 description 1
- 125000005509 dibenzothiophenyl group Chemical group 0.000 description 1
- 235000019700 dicalcium phosphate Nutrition 0.000 description 1
- PFBUKDPBVNJDEW-UHFFFAOYSA-N dichlorocarbene Chemical group Cl[C]Cl PFBUKDPBVNJDEW-UHFFFAOYSA-N 0.000 description 1
- 235000013681 dietary sucrose Nutrition 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000004069 differentiation Effects 0.000 description 1
- AFABGHUZZDYHJO-UHFFFAOYSA-N dimethyl butane Natural products CCCC(C)C AFABGHUZZDYHJO-UHFFFAOYSA-N 0.000 description 1
- 229940113088 dimethylacetamide Drugs 0.000 description 1
- UXGNZZKBCMGWAZ-UHFFFAOYSA-N dimethylformamide dmf Chemical compound CN(C)C=O.CN(C)C=O UXGNZZKBCMGWAZ-UHFFFAOYSA-N 0.000 description 1
- UKWLRLAKGMZXJC-QIECWBMSSA-L disodium;[4-chloro-3-[(3r,5s)-1-chloro-3'-methoxyspiro[adamantane-4,4'-dioxetane]-3'-yl]phenyl] phosphate Chemical compound [Na+].[Na+].O1OC2([C@@H]3CC4C[C@H]2CC(Cl)(C4)C3)C1(OC)C1=CC(OP([O-])([O-])=O)=CC=C1Cl UKWLRLAKGMZXJC-QIECWBMSSA-L 0.000 description 1
- 238000010494 dissociation reaction Methods 0.000 description 1
- 230000005593 dissociations Effects 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 125000005303 dithiazolyl group Chemical group S1SNC(=C1)* 0.000 description 1
- VSJKWCGYPAHWDS-UHFFFAOYSA-N dl-camptothecin Natural products C1=CC=C2C=C(CN3C4=CC5=C(C3=O)COC(=O)C5(O)CC)C4=NC2=C1 VSJKWCGYPAHWDS-UHFFFAOYSA-N 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- FSIRXIHZBIXHKT-MHTVFEQDSA-N edatrexate Chemical compound C=1N=C2N=C(N)N=C(N)C2=NC=1CC(CC)C1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 FSIRXIHZBIXHKT-MHTVFEQDSA-N 0.000 description 1
- 229950006700 edatrexate Drugs 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002081 enamines Chemical class 0.000 description 1
- 150000002084 enol ethers Chemical class 0.000 description 1
- HKSZLNNOFSGOKW-UHFFFAOYSA-N ent-staurosporine Natural products C12=C3N4C5=CC=CC=C5C3=C3CNC(=O)C3=C2C2=CC=CC=C2N1C1CC(NC)C(OC)C4(C)O1 HKSZLNNOFSGOKW-UHFFFAOYSA-N 0.000 description 1
- 239000002702 enteric coating Substances 0.000 description 1
- 238000009505 enteric coating Methods 0.000 description 1
- 238000001952 enzyme assay Methods 0.000 description 1
- 229930013356 epothilone Natural products 0.000 description 1
- HESCAJZNRMSMJG-KKQRBIROSA-N epothilone A Chemical class C/C([C@@H]1C[C@@H]2O[C@@H]2CCC[C@@H]([C@@H]([C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O1)O)C)=C\C1=CSC(C)=N1 HESCAJZNRMSMJG-KKQRBIROSA-N 0.000 description 1
- HESCAJZNRMSMJG-HGYUPSKWSA-N epothilone A Natural products O=C1[C@H](C)[C@H](O)[C@H](C)CCC[C@H]2O[C@H]2C[C@@H](/C(=C\c2nc(C)sc2)/C)OC(=O)C[C@H](O)C1(C)C HESCAJZNRMSMJG-HGYUPSKWSA-N 0.000 description 1
- QXRSDHAAWVKZLJ-PVYNADRNSA-N epothilone B Chemical compound C/C([C@@H]1C[C@@H]2O[C@]2(C)CCC[C@@H]([C@@H]([C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O1)O)C)=C\C1=CSC(C)=N1 QXRSDHAAWVKZLJ-PVYNADRNSA-N 0.000 description 1
- XOZIUKBZLSUILX-GIQCAXHBSA-N epothilone D Chemical compound O1C(=O)C[C@H](O)C(C)(C)C(=O)[C@H](C)[C@@H](O)[C@@H](C)CCC\C(C)=C/C[C@H]1C(\C)=C\C1=CSC(C)=N1 XOZIUKBZLSUILX-GIQCAXHBSA-N 0.000 description 1
- 229960001433 erlotinib Drugs 0.000 description 1
- AAKJLRGGTJKAMG-UHFFFAOYSA-N erlotinib Chemical compound C=12C=C(OCCOC)C(OCCOC)=CC2=NC=NC=1NC1=CC=CC(C#C)=C1 AAKJLRGGTJKAMG-UHFFFAOYSA-N 0.000 description 1
- DPUOLQHDNGRHBS-KTKRTIGZSA-N erucic acid Chemical compound CCCCCCCC\C=C/CCCCCCCCCCCC(O)=O DPUOLQHDNGRHBS-KTKRTIGZSA-N 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 229960005309 estradiol Drugs 0.000 description 1
- 229930182833 estradiol Natural products 0.000 description 1
- 108010038795 estrogen receptors Proteins 0.000 description 1
- 229960003399 estrone Drugs 0.000 description 1
- OKOHFSWRKRCHAD-UHFFFAOYSA-N ethane ethanesulfonic acid Chemical compound CC.CCS(O)(=O)=O OKOHFSWRKRCHAD-UHFFFAOYSA-N 0.000 description 1
- PSLIMVZEAPALCD-UHFFFAOYSA-N ethanol;ethoxyethane Chemical compound CCO.CCOCC PSLIMVZEAPALCD-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- SRCZQMGIVIYBBJ-UHFFFAOYSA-N ethoxyethane;ethyl acetate Chemical compound CCOCC.CCOC(C)=O SRCZQMGIVIYBBJ-UHFFFAOYSA-N 0.000 description 1
- ZKQFHRVKCYFVCN-UHFFFAOYSA-N ethoxyethane;hexane Chemical compound CCOCC.CCCCCC ZKQFHRVKCYFVCN-UHFFFAOYSA-N 0.000 description 1
- DQYBDCGIPTYXML-UHFFFAOYSA-N ethoxyethane;hydrate Chemical compound O.CCOCC DQYBDCGIPTYXML-UHFFFAOYSA-N 0.000 description 1
- WHQLQYRFIHPMNA-UHFFFAOYSA-N ethyl acetate;oxolane Chemical compound C1CCOC1.CCOC(C)=O WHQLQYRFIHPMNA-UHFFFAOYSA-N 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- LVGKNOAMLMIIKO-QXMHVHEDSA-N ethyl oleate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OCC LVGKNOAMLMIIKO-QXMHVHEDSA-N 0.000 description 1
- 229940093471 ethyl oleate Drugs 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 229960005167 everolimus Drugs 0.000 description 1
- 208000021045 exocrine pancreatic carcinoma Diseases 0.000 description 1
- 210000002744 extracellular matrix Anatomy 0.000 description 1
- 201000005306 familial renal papillary carcinoma Diseases 0.000 description 1
- 239000010685 fatty oil Substances 0.000 description 1
- 239000012894 fetal calf serum Substances 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- GIUYCYHIANZCFB-FJFJXFQQSA-N fludarabine phosphate Chemical compound C1=NC=2C(N)=NC(F)=NC=2N1[C@@H]1O[C@H](COP(O)(O)=O)[C@@H](O)[C@@H]1O GIUYCYHIANZCFB-FJFJXFQQSA-N 0.000 description 1
- 229960005304 fludarabine phosphate Drugs 0.000 description 1
- 229960002949 fluorouracil Drugs 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 239000012634 fragment Substances 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 125000003838 furazanyl group Chemical group 0.000 description 1
- 230000004927 fusion Effects 0.000 description 1
- 108020001507 fusion proteins Proteins 0.000 description 1
- 102000037865 fusion proteins Human genes 0.000 description 1
- WIGCFUFOHFEKBI-UHFFFAOYSA-N gamma-tocopherol Natural products CC(C)CCCC(C)CCCC(C)CCCC1CCC2C(C)C(O)C(C)C(C)C2O1 WIGCFUFOHFEKBI-UHFFFAOYSA-N 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- XGALLCVXEZPNRQ-UHFFFAOYSA-N gefitinib Chemical compound C=12C=C(OCCCN3CCOCC3)C(OC)=CC2=NC=NC=1NC1=CC=C(F)C(Cl)=C1 XGALLCVXEZPNRQ-UHFFFAOYSA-N 0.000 description 1
- SDUQYLNIPVEERB-QPPQHZFASA-N gemcitabine Chemical compound O=C1N=C(N)C=CN1[C@H]1C(F)(F)[C@H](O)[C@@H](CO)O1 SDUQYLNIPVEERB-QPPQHZFASA-N 0.000 description 1
- 229960005277 gemcitabine Drugs 0.000 description 1
- 229940052308 general anesthetics halogenated hydrocarbons Drugs 0.000 description 1
- 230000008570 general process Effects 0.000 description 1
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 1
- 229960003690 goserelin acetate Drugs 0.000 description 1
- MOTRZVVGCFFABN-UHFFFAOYSA-N hexane;2-propan-2-yloxypropane Chemical compound CCCCCC.CC(C)OC(C)C MOTRZVVGCFFABN-UHFFFAOYSA-N 0.000 description 1
- QKGYJVXSKCDGOK-UHFFFAOYSA-N hexane;propan-2-ol Chemical compound CC(C)O.CCCCCC QKGYJVXSKCDGOK-UHFFFAOYSA-N 0.000 description 1
- 229940088597 hormone Drugs 0.000 description 1
- 239000005556 hormone Substances 0.000 description 1
- 108091008039 hormone receptors Proteins 0.000 description 1
- 102000058223 human VEGFA Human genes 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 1
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 1
- UFVKGYZPFZQRLF-UHFFFAOYSA-N hydroxypropyl methyl cellulose Chemical compound OC1C(O)C(OC)OC(CO)C1OC1C(O)C(O)C(OC2C(C(O)C(OC3C(C(O)C(O)C(CO)O3)O)C(CO)O2)O)C(CO)O1 UFVKGYZPFZQRLF-UHFFFAOYSA-N 0.000 description 1
- 229940031704 hydroxypropyl methylcellulose phthalate Drugs 0.000 description 1
- 229920003132 hydroxypropyl methylcellulose phthalate Polymers 0.000 description 1
- YLMAHDNUQAMNNX-UHFFFAOYSA-N imatinib methanesulfonate Chemical compound CS(O)(=O)=O.C1CN(C)CCN1CC1=CC=C(C(=O)NC=2C=C(NC=3N=C(C=CN=3)C=3C=NC=CC=3)C(C)=CC=2)C=C1 YLMAHDNUQAMNNX-UHFFFAOYSA-N 0.000 description 1
- JBFYUZGYRGXSFL-UHFFFAOYSA-N imidazolide Chemical compound C1=C[N-]C=N1 JBFYUZGYRGXSFL-UHFFFAOYSA-N 0.000 description 1
- 125000002632 imidazolidinyl group Chemical group 0.000 description 1
- 210000000987 immune system Anatomy 0.000 description 1
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 description 1
- 125000003406 indolizinyl group Chemical group C=1(C=CN2C=CC=CC12)* 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- ZPNFWUPYTFPOJU-LPYSRVMUSA-N iniprol Chemical compound C([C@H]1C(=O)NCC(=O)NCC(=O)N[C@H]2CSSC[C@H]3C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@H](C(N[C@H](C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC=4C=CC(O)=CC=4)C(=O)N[C@@H](CC=4C=CC=CC=4)C(=O)N[C@@H](CC=4C=CC(O)=CC=4)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CSSC[C@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C)NC(=O)[C@H](CO)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CC=4C=CC=CC=4)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CCCCN)NC(=O)[C@H](C)NC(=O)[C@H](CCCNC(N)=N)NC2=O)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CSSC[C@H](NC(=O)[C@H](CC=2C=CC=CC=2)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H]2N(CCC2)C(=O)[C@@H](N)CCCNC(N)=N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(O)=O)C(=O)N2[C@@H](CCC2)C(=O)N2[C@@H](CCC2)C(=O)N[C@@H](CC=2C=CC(O)=CC=2)C(=O)N[C@@H]([C@@H](C)O)C(=O)NCC(=O)N2[C@@H](CCC2)C(=O)N3)C(=O)NCC(=O)NCC(=O)N[C@@H](C)C(O)=O)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@H](C(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@H](C(=O)N1)C(C)C)[C@@H](C)O)[C@@H](C)CC)=O)[C@@H](C)CC)C1=CC=C(O)C=C1 ZPNFWUPYTFPOJU-LPYSRVMUSA-N 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000007912 intraperitoneal administration Methods 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- 125000001977 isobenzofuranyl group Chemical group C=1(OC=C2C=CC=CC12)* 0.000 description 1
- 125000003384 isochromanyl group Chemical group C1(OCCC2=CC=CC=C12)* 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 229960002725 isoflurane Drugs 0.000 description 1
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- FMKOJHQHASLBPH-UHFFFAOYSA-N isopropyl iodide Chemical compound CC(C)I FMKOJHQHASLBPH-UHFFFAOYSA-N 0.000 description 1
- XUGNVMKQXJXZCD-UHFFFAOYSA-N isopropyl palmitate Chemical compound CCCCCCCCCCCCCCCC(=O)OC(C)C XUGNVMKQXJXZCD-UHFFFAOYSA-N 0.000 description 1
- 125000005956 isoquinolyl group Chemical group 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- UHEBDUAFKQHUBV-UHFFFAOYSA-N jspy-st000261 Chemical compound C1=CC=C2C3=C(C(=O)NC4)C4=C(C=4C(=CC=C(C=4)COC(C)C)N4CCCOC(=O)CN(C)C)C4=C3CC2=C1 UHEBDUAFKQHUBV-UHFFFAOYSA-N 0.000 description 1
- 229940043355 kinase inhibitor Drugs 0.000 description 1
- GDBQQVLCIARPGH-ULQDDVLXSA-N leupeptin Chemical compound CC(C)C[C@H](NC(C)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C=O)CCCN=C(N)N GDBQQVLCIARPGH-ULQDDVLXSA-N 0.000 description 1
- 108010052968 leupeptin Proteins 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- YROQEQPFUCPDCP-UHFFFAOYSA-N losoxantrone Chemical compound OCCNCCN1N=C2C3=CC=CC(O)=C3C(=O)C3=C2C1=CC=C3NCCNCCO YROQEQPFUCPDCP-UHFFFAOYSA-N 0.000 description 1
- 229950008745 losoxantrone Drugs 0.000 description 1
- 229920001684 low density polyethylene Polymers 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 238000004020 luminiscence type Methods 0.000 description 1
- KHPKQFYUPIUARC-UHFFFAOYSA-N lumiracoxib Chemical compound OC(=O)CC1=CC(C)=CC=C1NC1=C(F)C=CC=C1Cl KHPKQFYUPIUARC-UHFFFAOYSA-N 0.000 description 1
- 201000005249 lung adenocarcinoma Diseases 0.000 description 1
- 210000004698 lymphocyte Anatomy 0.000 description 1
- 239000012139 lysis buffer Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- UEGPKNKPLBYCNK-UHFFFAOYSA-L magnesium acetate Chemical compound [Mg+2].CC([O-])=O.CC([O-])=O UEGPKNKPLBYCNK-UHFFFAOYSA-L 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 208000015486 malignant pancreatic neoplasm Diseases 0.000 description 1
- CGJMROBVSBIBKP-UHFFFAOYSA-N malonamic acid Chemical compound NC(=O)CC(O)=O CGJMROBVSBIBKP-UHFFFAOYSA-N 0.000 description 1
- 210000004962 mammalian cell Anatomy 0.000 description 1
- 229960002510 mandelic acid Drugs 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- SGDBTWWWUNNDEQ-LBPRGKRZSA-N melphalan Chemical compound OC(=O)[C@@H](N)CC1=CC=C(N(CCCl)CCCl)C=C1 SGDBTWWWUNNDEQ-LBPRGKRZSA-N 0.000 description 1
- 229960001924 melphalan Drugs 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229960001428 mercaptopurine Drugs 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- 229910000000 metal hydroxide Inorganic materials 0.000 description 1
- 150000004692 metal hydroxides Chemical class 0.000 description 1
- 230000009401 metastasis Effects 0.000 description 1
- TWXDDNPPQUTEOV-FVGYRXGTSA-N methamphetamine hydrochloride Chemical compound Cl.CN[C@@H](C)CC1=CC=CC=C1 TWXDDNPPQUTEOV-FVGYRXGTSA-N 0.000 description 1
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 1
- GXHMMDRXHUIUMN-UHFFFAOYSA-N methanesulfonic acid Chemical compound CS(O)(=O)=O.CS(O)(=O)=O GXHMMDRXHUIUMN-UHFFFAOYSA-N 0.000 description 1
- 229960000485 methotrexate Drugs 0.000 description 1
- JIQNWFBLYKVZFY-UHFFFAOYSA-N methoxycyclohexatriene Chemical compound COC1=C[C]=CC=C1 JIQNWFBLYKVZFY-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- WBYWAXJHAXSJNI-UHFFFAOYSA-N methyl p-hydroxycinnamate Natural products OC(=O)C=CC1=CC=CC=C1 WBYWAXJHAXSJNI-UHFFFAOYSA-N 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 229960002900 methylcellulose Drugs 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- 229960000907 methylthioninium chloride Drugs 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 230000005012 migration Effects 0.000 description 1
- 238000013508 migration Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 125000002950 monocyclic group Chemical group 0.000 description 1
- 230000024799 morphogenesis of a branching structure Effects 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- 230000035772 mutation Effects 0.000 description 1
- BLCLNMBMMGCOAS-UHFFFAOYSA-N n-[1-[[1-[[1-[[1-[[1-[[1-[[1-[2-[(carbamoylamino)carbamoyl]pyrrolidin-1-yl]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-3-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amin Chemical compound C1CCC(C(=O)NNC(N)=O)N1C(=O)C(CCCN=C(N)N)NC(=O)C(CC(C)C)NC(=O)C(COC(C)(C)C)NC(=O)C(NC(=O)C(CO)NC(=O)C(CC=1C2=CC=CC=C2NC=1)NC(=O)C(CC=1NC=NC=1)NC(=O)C1NC(=O)CC1)CC1=CC=C(O)C=C1 BLCLNMBMMGCOAS-UHFFFAOYSA-N 0.000 description 1
- OWXIEPANRNEJEU-UHFFFAOYSA-N n-[3-[8-chloro-1-(2-chlorophenyl)-2-oxoimidazo[4,5-c]quinolin-3-yl]phenyl]acetamide Chemical compound CC(=O)NC1=CC=CC(N2C(N(C=3C(=CC=CC=3)Cl)C3=C4C=C(Cl)C=CC4=NC=C32)=O)=C1 OWXIEPANRNEJEU-UHFFFAOYSA-N 0.000 description 1
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- KVBGVZZKJNLNJU-UHFFFAOYSA-N naphthalene-2-sulfonic acid Chemical compound C1=CC=CC2=CC(S(=O)(=O)O)=CC=C21 KVBGVZZKJNLNJU-UHFFFAOYSA-N 0.000 description 1
- 125000004593 naphthyridinyl group Chemical group N1=C(C=CC2=CC=CN=C12)* 0.000 description 1
- 239000013642 negative control Substances 0.000 description 1
- CTMCWCONSULRHO-UHQPFXKFSA-N nemorubicin Chemical compound C1CO[C@H](OC)CN1[C@@H]1[C@H](O)[C@H](C)O[C@@H](O[C@@H]2C3=C(O)C=4C(=O)C5=C(OC)C=CC=C5C(=O)C=4C(O)=C3C[C@](O)(C2)C(=O)CO)C1 CTMCWCONSULRHO-UHQPFXKFSA-N 0.000 description 1
- 229950010159 nemorubicin Drugs 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 229960003512 nicotinic acid Drugs 0.000 description 1
- 235000001968 nicotinic acid Nutrition 0.000 description 1
- 239000011664 nicotinic acid Substances 0.000 description 1
- 150000002826 nitrites Chemical class 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 229910000510 noble metal Inorganic materials 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 239000004006 olive oil Substances 0.000 description 1
- 235000008390 olive oil Nutrition 0.000 description 1
- 238000011275 oncology therapy Methods 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 150000002905 orthoesters Chemical class 0.000 description 1
- 230000003204 osmotic effect Effects 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 125000000466 oxiranyl group Chemical group 0.000 description 1
- 239000001301 oxygen Chemical group 0.000 description 1
- 229960001592 paclitaxel Drugs 0.000 description 1
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 description 1
- 201000002528 pancreatic cancer Diseases 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 230000036961 partial effect Effects 0.000 description 1
- 230000007170 pathology Effects 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- WBXPDJSOTKVWSJ-ZDUSSCGKSA-N pemetrexed Chemical compound C=1NC=2NC(N)=NC(=O)C=2C=1CCC1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 WBXPDJSOTKVWSJ-ZDUSSCGKSA-N 0.000 description 1
- 229950000964 pepstatin Drugs 0.000 description 1
- 108010091212 pepstatin Proteins 0.000 description 1
- FAXGPCHRFPCXOO-LXTPJMTPSA-N pepstatin A Chemical compound OC(=O)C[C@H](O)[C@H](CC(C)C)NC(=O)[C@H](C)NC(=O)C[C@H](O)[C@H](CC(C)C)NC(=O)[C@H](C(C)C)NC(=O)[C@H](C(C)C)NC(=O)CC(C)C FAXGPCHRFPCXOO-LXTPJMTPSA-N 0.000 description 1
- 125000005327 perimidinyl group Chemical group N1C(=NC2=CC=CC3=CC=CC1=C23)* 0.000 description 1
- 210000001428 peripheral nervous system Anatomy 0.000 description 1
- XCRBXWCUXJNEFX-UHFFFAOYSA-N peroxybenzoic acid Chemical class OOC(=O)C1=CC=CC=C1 XCRBXWCUXJNEFX-UHFFFAOYSA-N 0.000 description 1
- 239000002831 pharmacologic agent Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 125000004934 phenanthridinyl group Chemical group C1(=CC=CC2=NC=C3C=CC=CC3=C12)* 0.000 description 1
- 125000004625 phenanthrolinyl group Chemical group N1=C(C=CC2=CC=C3C=CC=NC3=C12)* 0.000 description 1
- 125000001791 phenazinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3N=C12)* 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 125000001484 phenothiazinyl group Chemical group C1(=CC=CC=2SC3=CC=CC=C3NC12)* 0.000 description 1
- 125000001644 phenoxazinyl group Chemical group C1(=CC=CC=2OC3=CC=CC=C3NC12)* 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 125000001476 phosphono group Chemical group [H]OP(*)(=O)O[H] 0.000 description 1
- 239000003757 phosphotransferase inhibitor Substances 0.000 description 1
- 238000006303 photolysis reaction Methods 0.000 description 1
- 230000015843 photosynthesis, light reaction Effects 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 description 1
- 125000004592 phthalazinyl group Chemical group C1(=NN=CC2=CC=CC=C12)* 0.000 description 1
- 230000004962 physiological condition Effects 0.000 description 1
- OXNIZHLAWKMVMX-UHFFFAOYSA-N picric acid Chemical class OC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-N 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 125000005936 piperidyl group Chemical group 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical class [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 1
- 239000003495 polar organic solvent Substances 0.000 description 1
- 235000010482 polyoxyethylene sorbitan monooleate Nutrition 0.000 description 1
- 229920000053 polysorbate 80 Polymers 0.000 description 1
- 229920002981 polyvinylidene fluoride Polymers 0.000 description 1
- 239000001253 polyvinylpolypyrrolidone Substances 0.000 description 1
- 235000013809 polyvinylpolypyrrolidone Nutrition 0.000 description 1
- 229920000523 polyvinylpolypyrrolidone Polymers 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 229940116317 potato starch Drugs 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000002335 preservative effect Effects 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000002731 protein assay Methods 0.000 description 1
- 238000000159 protein binding assay Methods 0.000 description 1
- 239000003881 protein kinase C inhibitor Substances 0.000 description 1
- 125000001042 pteridinyl group Chemical group N1=C(N=CC2=NC=CN=C12)* 0.000 description 1
- 150000003212 purines Chemical class 0.000 description 1
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 1
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 1
- 125000003072 pyrazolidinyl group Chemical group 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- 159000000018 pyrido[2,3-d]pyrimidines Chemical class 0.000 description 1
- 150000008518 pyridopyrimidines Chemical class 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 150000003230 pyrimidines Chemical class 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 125000001422 pyrrolinyl group Chemical group 0.000 description 1
- 150000004943 pyrrolo[2,3-d]pyrimidines Chemical class 0.000 description 1
- 150000004944 pyrrolopyrimidines Chemical class 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 125000004159 quinolin-2-yl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C([H])C(*)=NC2=C1[H] 0.000 description 1
- PMZDQRJGMBOQBF-UHFFFAOYSA-N quinolin-4-ol Chemical compound C1=CC=C2C(O)=CC=NC2=C1 PMZDQRJGMBOQBF-UHFFFAOYSA-N 0.000 description 1
- UTOMICFLROGMAE-UHFFFAOYSA-N quinoline-3,4-diamine Chemical class C1=CC=CC2=C(N)C(N)=CN=C21 UTOMICFLROGMAE-UHFFFAOYSA-N 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 239000002534 radiation-sensitizing agent Substances 0.000 description 1
- 238000001959 radiotherapy Methods 0.000 description 1
- 229960004622 raloxifene Drugs 0.000 description 1
- GZUITABIAKMVPG-UHFFFAOYSA-N raloxifene Chemical compound C1=CC(O)=CC=C1C1=C(C(=O)C=2C=CC(OCCN3CCCCC3)=CC=2)C2=CC=C(O)C=C2S1 GZUITABIAKMVPG-UHFFFAOYSA-N 0.000 description 1
- 229940099538 rapamune Drugs 0.000 description 1
- ZAHRKKWIAAJSAO-UHFFFAOYSA-N rapamycin Natural products COCC(O)C(=C/C(C)C(=O)CC(OC(=O)C1CCCCN1C(=O)C(=O)C2(O)OC(CC(OC)C(=CC=CC=CC(C)CC(C)C(=O)C)C)CCC2C)C(C)CC3CCC(O)C(C3)OC)C ZAHRKKWIAAJSAO-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000006268 reductive amination reaction Methods 0.000 description 1
- 238000000611 regression analysis Methods 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 239000013037 reversible inhibitor Substances 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 229940100486 rice starch Drugs 0.000 description 1
- 229960000371 rofecoxib Drugs 0.000 description 1
- 229950009213 rubitecan Drugs 0.000 description 1
- VHXNKPBCCMUMSW-FQEVSTJZSA-N rubitecan Chemical compound C1=CC([N+]([O-])=O)=C2C=C(CN3C4=CC5=C(C3=O)COC(=O)[C@]5(O)CC)C4=NC2=C1 VHXNKPBCCMUMSW-FQEVSTJZSA-N 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 238000003118 sandwich ELISA Methods 0.000 description 1
- 235000003441 saturated fatty acids Nutrition 0.000 description 1
- 150000004671 saturated fatty acids Chemical class 0.000 description 1
- 238000003345 scintillation counting Methods 0.000 description 1
- 238000007789 sealing Methods 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 description 1
- WUWDLXZGHZSWQZ-WQLSENKSSA-N semaxanib Chemical compound N1C(C)=CC(C)=C1\C=C/1C2=CC=CC=C2NC\1=O WUWDLXZGHZSWQZ-WQLSENKSSA-N 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000013207 serial dilution Methods 0.000 description 1
- 210000002966 serum Anatomy 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- XGVXKJKTISMIOW-ZDUSSCGKSA-N simurosertib Chemical compound N1N=CC(C=2SC=3C(=O)NC(=NC=3C=2)[C@H]2N3CCC(CC3)C2)=C1C XGVXKJKTISMIOW-ZDUSSCGKSA-N 0.000 description 1
- 229960002930 sirolimus Drugs 0.000 description 1
- 235000010413 sodium alginate Nutrition 0.000 description 1
- 239000000661 sodium alginate Substances 0.000 description 1
- 229940005550 sodium alginate Drugs 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229960001407 sodium bicarbonate Drugs 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- 239000007901 soft capsule Substances 0.000 description 1
- 239000002195 soluble material Substances 0.000 description 1
- 238000003797 solvolysis reaction Methods 0.000 description 1
- 239000003549 soybean oil Substances 0.000 description 1
- 235000012424 soybean oil Nutrition 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 102000009076 src-Family Kinases Human genes 0.000 description 1
- 108010087686 src-Family Kinases Proteins 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- CGPUWJWCVCFERF-UHFFFAOYSA-N staurosporine Natural products C12=C3N4C5=CC=CC=C5C3=C3CNC(=O)C3=C2C2=CC=CC=C2N1C1CC(NC)C(OC)C4(OC)O1 CGPUWJWCVCFERF-UHFFFAOYSA-N 0.000 description 1
- 230000002311 subsequent effect Effects 0.000 description 1
- 125000005415 substituted alkoxy group Chemical group 0.000 description 1
- 229960004793 sucrose Drugs 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 239000011593 sulfur Chemical group 0.000 description 1
- 239000001117 sulphuric acid Substances 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 238000003419 tautomerization reaction Methods 0.000 description 1
- RCINICONZNJXQF-MZXODVADSA-N taxol Chemical compound O([C@@H]1[C@@]2(C[C@@H](C(C)=C(C2(C)C)[C@H](C([C@]2(C)[C@@H](O)C[C@H]3OC[C@]3([C@H]21)OC(C)=O)=O)OC(=O)C)OC(=O)[C@H](O)[C@@H](NC(=O)C=1C=CC=CC=1)C=1C=CC=CC=1)O)C(=O)C1=CC=CC=C1 RCINICONZNJXQF-MZXODVADSA-N 0.000 description 1
- 229960001674 tegafur Drugs 0.000 description 1
- WFWLQNSHRPWKFK-ZCFIWIBFSA-N tegafur Chemical compound O=C1NC(=O)C(F)=CN1[C@@H]1OCCC1 WFWLQNSHRPWKFK-ZCFIWIBFSA-N 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 229960000235 temsirolimus Drugs 0.000 description 1
- 229960003604 testosterone Drugs 0.000 description 1
- TUNFSRHWOTWDNC-HKGQFRNVSA-N tetradecanoic acid Chemical compound CCCCCCCCCCCCC[14C](O)=O TUNFSRHWOTWDNC-HKGQFRNVSA-N 0.000 description 1
- CBXCPBUEXACCNR-UHFFFAOYSA-N tetraethylammonium Chemical compound CC[N+](CC)(CC)CC CBXCPBUEXACCNR-UHFFFAOYSA-N 0.000 description 1
- PCZOZSATUTWXIC-UHFFFAOYSA-N tetraethylazanium;cyanide Chemical compound N#[C-].CC[N+](CC)(CC)CC PCZOZSATUTWXIC-UHFFFAOYSA-N 0.000 description 1
- WHRNULOCNSKMGB-UHFFFAOYSA-N tetrahydrofuran thf Chemical compound C1CCOC1.C1CCOC1 WHRNULOCNSKMGB-UHFFFAOYSA-N 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 125000003831 tetrazolyl group Chemical group 0.000 description 1
- WROMPOXWARCANT-UHFFFAOYSA-N tfa trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.OC(=O)C(F)(F)F WROMPOXWARCANT-UHFFFAOYSA-N 0.000 description 1
- 125000004627 thianthrenyl group Chemical group C1(=CC=CC=2SC3=CC=CC=C3SC12)* 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 125000004568 thiomorpholinyl group Chemical group 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 125000005147 toluenesulfonyl group Chemical group C=1(C(=CC=CC1)S(=O)(=O)*)C 0.000 description 1
- 230000002110 toxicologic effect Effects 0.000 description 1
- 231100000027 toxicology Toxicity 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 238000010361 transduction Methods 0.000 description 1
- 230000026683 transduction Effects 0.000 description 1
- 230000005945 translocation Effects 0.000 description 1
- 238000002054 transplantation Methods 0.000 description 1
- 229960000575 trastuzumab Drugs 0.000 description 1
- 229960001612 trastuzumab emtansine Drugs 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- 229940078499 tricalcium phosphate Drugs 0.000 description 1
- 235000019731 tricalcium phosphate Nutrition 0.000 description 1
- 229910000391 tricalcium phosphate Inorganic materials 0.000 description 1
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 1
- UFTFJSFQGQCHQW-UHFFFAOYSA-N triformin Chemical compound O=COCC(OC=O)COC=O UFTFJSFQGQCHQW-UHFFFAOYSA-N 0.000 description 1
- 239000005051 trimethylchlorosilane Substances 0.000 description 1
- 238000010518 undesired secondary reaction Methods 0.000 description 1
- 208000010570 urinary bladder carcinoma Diseases 0.000 description 1
- UHTHHESEBZOYNR-UHFFFAOYSA-N vandetanib Chemical compound COC1=CC(C(/N=CN2)=N/C=3C(=CC(Br)=CC=3)F)=C2C=C1OCC1CCN(C)CC1 UHTHHESEBZOYNR-UHFFFAOYSA-N 0.000 description 1
- 229950000578 vatalanib Drugs 0.000 description 1
- YCOYDOIWSSHVCK-UHFFFAOYSA-N vatalanib Chemical compound C1=CC(Cl)=CC=C1NC(C1=CC=CC=C11)=NN=C1CC1=CC=NC=C1 YCOYDOIWSSHVCK-UHFFFAOYSA-N 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- JXLYSJRDGCGARV-CFWMRBGOSA-N vinblastine Chemical compound C([C@H](C[C@]1(C(=O)OC)C=2C(=CC3=C([C@]45[C@H]([C@@]([C@H](OC(C)=O)[C@]6(CC)C=CCN([C@H]56)CC4)(O)C(=O)OC)N3C)C=2)OC)C[C@@](C2)(O)CC)N2CCC2=C1NC1=CC=CC=C21 JXLYSJRDGCGARV-CFWMRBGOSA-N 0.000 description 1
- JXLYSJRDGCGARV-XQKSVPLYSA-N vincaleukoblastine Chemical compound C([C@@H](C[C@]1(C(=O)OC)C=2C(=CC3=C([C@]45[C@H]([C@@]([C@H](OC(C)=O)[C@]6(CC)C=CCN([C@H]56)CC4)(O)C(=O)OC)N3C)C=2)OC)C[C@@](C2)(O)CC)N2CCC2=C1NC1=CC=CC=C21 JXLYSJRDGCGARV-XQKSVPLYSA-N 0.000 description 1
- OGWKCGZFUXNPDA-XQKSVPLYSA-N vincristine Chemical compound C([N@]1C[C@@H](C[C@]2(C(=O)OC)C=3C(=CC4=C([C@]56[C@H]([C@@]([C@H](OC(C)=O)[C@]7(CC)C=CCN([C@H]67)CC5)(O)C(=O)OC)N4C=O)C=3)OC)C[C@@](C1)(O)CC)CC1=C2NC2=CC=CC=C12 OGWKCGZFUXNPDA-XQKSVPLYSA-N 0.000 description 1
- 229960004528 vincristine Drugs 0.000 description 1
- OGWKCGZFUXNPDA-UHFFFAOYSA-N vincristine Natural products C1C(CC)(O)CC(CC2(C(=O)OC)C=3C(=CC4=C(C56C(C(C(OC(C)=O)C7(CC)C=CCN(C67)CC5)(O)C(=O)OC)N4C=O)C=3)OC)CN1CCC1=C2NC2=CC=CC=C12 OGWKCGZFUXNPDA-UHFFFAOYSA-N 0.000 description 1
- GBABOYUKABKIAF-GHYRFKGUSA-N vinorelbine Chemical compound C1N(CC=2C3=CC=CC=C3NC=22)CC(CC)=C[C@H]1C[C@]2(C(=O)OC)C1=CC([C@]23[C@H]([C@]([C@H](OC(C)=O)[C@]4(CC)C=CCN([C@H]34)CC2)(O)C(=O)OC)N2C)=C2C=C1OC GBABOYUKABKIAF-GHYRFKGUSA-N 0.000 description 1
- 229960002066 vinorelbine Drugs 0.000 description 1
- 229940087652 vioxx Drugs 0.000 description 1
- 235000019165 vitamin E Nutrition 0.000 description 1
- 229940046009 vitamin E Drugs 0.000 description 1
- 239000011709 vitamin E Substances 0.000 description 1
- 229960001771 vorozole Drugs 0.000 description 1
- XLMPPFTZALNBFS-INIZCTEOSA-N vorozole Chemical compound C1([C@@H](C2=CC=C3N=NN(C3=C2)C)N2N=CN=C2)=CC=C(Cl)C=C1 XLMPPFTZALNBFS-INIZCTEOSA-N 0.000 description 1
- 238000001262 western blot Methods 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- CGTADGCBEXYWNE-JUKNQOCSSA-N zotarolimus Chemical compound N1([C@H]2CC[C@@H](C[C@@H](C)[C@H]3OC(=O)[C@@H]4CCCCN4C(=O)C(=O)[C@@]4(O)[C@H](C)CC[C@H](O4)C[C@@H](/C(C)=C/C=C/C=C/[C@@H](C)C[C@@H](C)C(=O)[C@H](OC)[C@H](O)/C(C)=C/[C@@H](C)C(=O)C3)OC)C[C@H]2OC)C=NN=N1 CGTADGCBEXYWNE-JUKNQOCSSA-N 0.000 description 1
- 229950009819 zotarolimus Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P13/00—Drugs for disorders of the urinary system
- A61P13/08—Drugs for disorders of the urinary system of the prostate
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P17/00—Drugs for dermatological disorders
- A61P17/06—Antipsoriatics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
- A61P35/02—Antineoplastic agents specific for leukemia
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
Landscapes
- Health & Medical Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Public Health (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Pharmacology & Pharmacy (AREA)
- Veterinary Medicine (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Hematology (AREA)
- Oncology (AREA)
- Urology & Nephrology (AREA)
- Dermatology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Enzymes And Modification Thereof (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GBGB0211649.9A GB0211649D0 (en) | 2002-05-21 | 2002-05-21 | Organic compounds |
| GB0211649.9 | 2002-05-21 | ||
| PCT/EP2003/005291 WO2003097641A2 (en) | 2002-05-21 | 2003-05-20 | 1h-imidazo[4,5-c] quinoline derivatives in the treatment of protein kinase dependent diseases |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA2485012A1 true CA2485012A1 (en) | 2003-11-27 |
Family
ID=9937093
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA002485012A Abandoned CA2485012A1 (en) | 2002-05-21 | 2003-05-20 | 1h-imidazo[4,5-c] quinoline derivatives in the treatment of protein kinase dependent diseases |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US7998972B2 (enExample) |
| EP (1) | EP1509521B8 (enExample) |
| JP (1) | JP4707389B2 (enExample) |
| CN (1) | CN100475207C (enExample) |
| AT (1) | ATE405564T1 (enExample) |
| AU (1) | AU2003240680A1 (enExample) |
| BR (1) | BR0311221A (enExample) |
| CA (1) | CA2485012A1 (enExample) |
| DE (1) | DE60323090D1 (enExample) |
| DK (1) | DK1509521T3 (enExample) |
| ES (1) | ES2312783T3 (enExample) |
| GB (1) | GB0211649D0 (enExample) |
| PT (1) | PT1509521E (enExample) |
| SI (1) | SI1509521T1 (enExample) |
| WO (1) | WO2003097641A2 (enExample) |
Families Citing this family (122)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| UA67760C2 (uk) | 1997-12-11 | 2004-07-15 | Міннесота Майнінг Енд Мануфакчурінг Компані | Імідазонафтиридин та тетрагідроімідазонафтиридин, фармацевтична композиція, спосіб індукування біосинтезу цитокінів та спосіб лікування вірусної інфекції, проміжні сполуки |
| US6667312B2 (en) | 2000-12-08 | 2003-12-23 | 3M Innovative Properties Company | Thioether substituted imidazoquinolines |
| UA74852C2 (en) | 2000-12-08 | 2006-02-15 | 3M Innovative Properties Co | Urea-substituted imidazoquinoline ethers |
| US6664265B2 (en) | 2000-12-08 | 2003-12-16 | 3M Innovative Properties Company | Amido ether substituted imidazoquinolines |
| US6545016B1 (en) | 2000-12-08 | 2003-04-08 | 3M Innovative Properties Company | Amide substituted imidazopyridines |
| US6664264B2 (en) | 2000-12-08 | 2003-12-16 | 3M Innovative Properties Company | Thioether substituted imidazoquinolines |
| US6660735B2 (en) | 2000-12-08 | 2003-12-09 | 3M Innovative Properties Company | Urea substituted imidazoquinoline ethers |
| US6677349B1 (en) | 2001-12-21 | 2004-01-13 | 3M Innovative Properties Company | Sulfonamide and sulfamide substituted imidazoquinolines |
| PT1478327E (pt) | 2002-02-22 | 2015-08-04 | Meda Ab | Método de redução e tratamento de imunossupressão induzida por uvb |
| JP2005538057A (ja) | 2002-06-07 | 2005-12-15 | スリーエム イノベイティブ プロパティズ カンパニー | エーテル置換イミダゾピリジン |
| PL374866A1 (en) * | 2002-07-26 | 2005-11-14 | Teva Gyogyszergyar Zartköruen Muködo Reszvenytarsasag | Preparation of 1h-imidazo [4,5-c] quinolin-4-amines via novel 1h-imidazo [4,5-c] quinolin-4-cyano and 1h-imidazo [4,5-c] quinolin-4-carboxamide intermediates |
| EP1590348A1 (en) | 2002-12-20 | 2005-11-02 | 3M Innovative Properties Company | Aryl / hetaryl substituted imidazoquinolines |
| US20040265351A1 (en) | 2003-04-10 | 2004-12-30 | Miller Richard L. | Methods and compositions for enhancing immune response |
| WO2004110991A2 (en) | 2003-06-06 | 2004-12-23 | 3M Innovative Properties Company | PROCESS FOR IMIDAZO[4,5-c]PYRIDIN-4-AMINES |
| WO2005016273A2 (en) | 2003-08-05 | 2005-02-24 | 3M Innovative Properties Company | Infection prophylaxis using immune response modifier compounds |
| MXPA06001669A (es) | 2003-08-12 | 2006-04-28 | 3M Innovative Properties Co | Compuestos que contienen imidazo-oxima sustituidos. |
| EP2939693A1 (en) * | 2003-08-14 | 2015-11-04 | 3M Innovative Properties Company | Lipid-modified immune response modifiers |
| JP2007503268A (ja) | 2003-08-25 | 2007-02-22 | スリーエム イノベイティブ プロパティズ カンパニー | 免疫応答修飾化合物の送達 |
| NZ545412A (en) | 2003-08-27 | 2008-12-24 | Coley Pharm Group Inc | Aryloxy and arylalkyleneoxy substituted imidazoquinolines |
| JP2007504269A (ja) | 2003-09-05 | 2007-03-01 | スリーエム イノベイティブ プロパティズ カンパニー | Cd5+b細胞リンパ腫の治療方法 |
| EP1673087B1 (en) | 2003-10-03 | 2015-05-13 | 3M Innovative Properties Company | Alkoxy substituted imidazoquinolines |
| US7544697B2 (en) | 2003-10-03 | 2009-06-09 | Coley Pharmaceutical Group, Inc. | Pyrazolopyridines and analogs thereof |
| KR101494056B1 (ko) | 2003-10-03 | 2015-02-16 | 쓰리엠 이노베이티브 프로퍼티즈 컴파니 | 피라졸로피리딘 및 그의 유사체 |
| CN1906192A (zh) | 2003-11-14 | 2007-01-31 | 3M创新有限公司 | 羟胺取代的咪唑环化合物 |
| WO2005048933A2 (en) * | 2003-11-14 | 2005-06-02 | 3M Innovative Properties Company | Oxime substituted imidazo ring compounds |
| AR046845A1 (es) * | 2003-11-21 | 2005-12-28 | Novartis Ag | Derivados de 1h-imidazo[4,5-c]quinolina para tratamiento de enfermedades dependientes de las proteino-quinasas |
| US8778963B2 (en) * | 2003-11-25 | 2014-07-15 | 3M Innovative Properties Company | Hydroxylamine and oxime substituted imidazoquinolines, imidazopyridines, and imidazonaphthyridines |
| AU2004293078B2 (en) | 2003-11-25 | 2012-01-19 | 3M Innovative Properties Company | Substituted imidazo ring systems and methods |
| JP2007513165A (ja) | 2003-12-02 | 2007-05-24 | スリーエム イノベイティブ プロパティズ カンパニー | Irm化合物を含む併用薬および治療方法 |
| WO2005076783A2 (en) * | 2003-12-04 | 2005-08-25 | 3M Innovative Properties Company | Sulfone substituted imidazo ring ethers |
| JP2007517035A (ja) | 2003-12-29 | 2007-06-28 | スリーエム イノベイティブ プロパティズ カンパニー | アリールアルケニルおよびアリールアルキニル置換されたイミダゾキノリン |
| CA2552101A1 (en) * | 2003-12-29 | 2005-07-21 | 3M Innovative Properties Company | Piperazine, [1,4]diazepane, [1,4]diazocane, and [1,5]diazocane fused imidazo ring compounds |
| EP1699788A2 (en) | 2003-12-30 | 2006-09-13 | 3M Innovative Properties Company | Imidazoquinolinyl, imidazopyridinyl and imidazonaphthyridinyl sulfonamides |
| US8697873B2 (en) | 2004-03-24 | 2014-04-15 | 3M Innovative Properties Company | Amide substituted imidazopyridines, imidazoquinolines, and imidazonaphthyridines |
| US20080015184A1 (en) * | 2004-06-14 | 2008-01-17 | 3M Innovative Properties Company | Urea Substituted Imidazopyridines, Imidazoquinolines, and Imidazonaphthyridines |
| US8017779B2 (en) | 2004-06-15 | 2011-09-13 | 3M Innovative Properties Company | Nitrogen containing heterocyclyl substituted imidazoquinolines and imidazonaphthyridines |
| WO2006009826A1 (en) | 2004-06-18 | 2006-01-26 | 3M Innovative Properties Company | Aryloxy and arylalkyleneoxy substituted thiazoloquinolines and thiazolonaphthyridines |
| US7915281B2 (en) | 2004-06-18 | 2011-03-29 | 3M Innovative Properties Company | Isoxazole, dihydroisoxazole, and oxadiazole substituted imidazo ring compounds and method |
| WO2006038923A2 (en) | 2004-06-18 | 2006-04-13 | 3M Innovative Properties Company | Aryl substituted imidazonaphthyridines |
| AU2005283085B2 (en) * | 2004-06-18 | 2012-06-21 | 3M Innovative Properties Company | Substituted imidazoquinolines, imidazopyridines, and imidazonaphthyridines |
| US8541438B2 (en) | 2004-06-18 | 2013-09-24 | 3M Innovative Properties Company | Substituted imidazoquinolines, imidazopyridines, and imidazonaphthyridines |
| AU2005282523A1 (en) | 2004-09-02 | 2006-03-16 | 3M Innovative Properties Company | 2-amino 1H imidazo ring systems and methods |
| JP5209312B2 (ja) * | 2004-09-02 | 2013-06-12 | スリーエム イノベイティブ プロパティズ カンパニー | 1−アルコキシ1h−イミダゾ環系および方法 |
| CN101048404A (zh) * | 2004-12-27 | 2007-10-03 | Usv有限公司 | 制备4-氨基-1-异丁基-1H-咪唑[4,5-c]-喹啉(咪喹莫特)的方法 |
| US8436176B2 (en) * | 2004-12-30 | 2013-05-07 | Medicis Pharmaceutical Corporation | Process for preparing 2-methyl-1-(2-methylpropyl)-1H-imidazo[4,5-c][1,5]naphthyridin-4-amine |
| CA2592897A1 (en) * | 2004-12-30 | 2006-07-13 | Takeda Pharmaceutical Company Limited | 1-(2-methylpropyl)-1h-imidazo[4,5-c][1,5]naphthyridin-4-amine ethanesulfonate and 1-(2-methylpropyl)-1h-imidazo[4,5-c][1,5]naphthyridin-4-amine methanesulfonate |
| JP2008526757A (ja) * | 2004-12-30 | 2008-07-24 | スリーエム イノベイティブ プロパティズ カンパニー | 免疫応答調節剤製剤および方法 |
| AU2005321912B2 (en) | 2004-12-30 | 2012-04-05 | 3M Innovative Properties Company | Treatment for cutaneous metastases |
| JP5313502B2 (ja) | 2004-12-30 | 2013-10-09 | スリーエム イノベイティブ プロパティズ カンパニー | 置換キラル縮合[1,2]イミダゾ[4,5−c]環状化合物 |
| CA2592904C (en) | 2004-12-30 | 2015-04-07 | 3M Innovative Properties Company | Chiral fused [1,2]imidazo[4,5-c] ring compounds |
| JP2008530022A (ja) | 2005-02-04 | 2008-08-07 | コーリー ファーマシューティカル グループ,インコーポレイテッド | 免疫反応調節物質を含む水性ゲル処方物 |
| US20080318998A1 (en) | 2005-02-09 | 2008-12-25 | Coley Pharmaceutical Group, Inc. | Alkyloxy Substituted Thiazoloquinolines and Thiazolonaphthyridines |
| CA2602083A1 (en) | 2005-02-09 | 2006-08-09 | Coley Pharmaceutical Group, Inc. | Oxime and hydroxylamine substituted thiazolo(4,5-c) ring compounds and methods |
| EP1846405A2 (en) | 2005-02-11 | 2007-10-24 | 3M Innovative Properties Company | Oxime and hydroxylamine substituted imidazo 4,5-c ring compounds and methods |
| CA2597446A1 (en) | 2005-02-11 | 2006-08-31 | Coley Pharmaceutical Group, Inc. | Substituted imidazoquinolines and imidazonaphthyridines |
| CA2598639A1 (en) | 2005-02-23 | 2006-08-31 | Coley Pharmaceutical Group, Inc. | Hydroxyalkyl substituted imidazonaphthyridines |
| EP1851218A2 (en) | 2005-02-23 | 2007-11-07 | 3M Innovative Properties Company | Hydroxyalkyl substituted imidazoquinoline compounds and methods |
| AU2006223634A1 (en) | 2005-02-23 | 2006-09-21 | Coley Pharmaceutical Group, Inc. | Hydroxyalkyl substituted imidazoquinolines |
| AU2006216686A1 (en) | 2005-02-23 | 2006-08-31 | Coley Pharmaceutical Group, Inc. | Method of preferentially inducing the biosynthesis of interferon |
| CA2602683A1 (en) | 2005-04-01 | 2006-10-12 | Coley Pharmaceutical Group, Inc. | Pyrazolopyridine-1,4-diamines and analogs thereof |
| CA2602590A1 (en) | 2005-04-01 | 2006-10-12 | Coley Pharmaceutical Group, Inc. | 1-substituted pyrazolo (3,4-c) ring compounds as modulators of cytokine biosynthesis for the treatment of viral infections and neoplastic diseases |
| GB0510390D0 (en) * | 2005-05-20 | 2005-06-29 | Novartis Ag | Organic compounds |
| ITMI20051292A1 (it) * | 2005-07-08 | 2007-01-09 | Dipharma Spa | Procedimento per la purificazione di imiquimod |
| ZA200803029B (en) | 2005-09-09 | 2009-02-25 | Coley Pharm Group Inc | Amide and carbamate derivatives of alkyl substituted /V-[4-(4-amino-1H-imidazo[4,5-c] quinolin-1-yl)butyl] methane-sulfonamides and methods |
| AU2006287270A1 (en) | 2005-09-09 | 2007-03-15 | Coley Pharmaceutical Group, Inc. | Amide and carbamate derivatives of N-{2-[4-amino-2- (ethoxymethyl)-1H-imidazo[4,5-c]quinolin-1-yl]-1,1-dimethylethyl}methanesulfonamide and methods |
| WO2007056112A2 (en) | 2005-11-04 | 2007-05-18 | Coley Pharmaceutical Group, Inc. | Hydroxy and alkoxy substituted 1h-imidazoquinolines and methods |
| US8022617B2 (en) | 2005-11-30 | 2011-09-20 | Mitsubishi Chemical Corporation | Organic compound, charge-transporting material, composition for charge-transporting material and organic electroluminescent device |
| EP1988896A4 (en) | 2006-02-22 | 2011-07-27 | 3M Innovative Properties Co | CONJUGATES TO MODIFY IMMUNE REACTIONS |
| MX2008011220A (es) | 2006-03-07 | 2008-09-11 | Array Biopharma Inc | Compuestos de pirazol heterobiciclicos y metodos de uso. |
| WO2007106854A2 (en) | 2006-03-15 | 2007-09-20 | Coley Pharmaceutical Group, Inc. | Hydroxy and alkoxy substituted 1h-imidazonaphthyridines and methods |
| WO2007109813A1 (en) | 2006-03-23 | 2007-09-27 | Novartis Ag | Imidazoquinoxaline compounds as immunomodulators |
| TW200813021A (en) * | 2006-07-10 | 2008-03-16 | Merck & Co Inc | Tyrosine kinase inhibitors |
| WO2008008432A2 (en) | 2006-07-12 | 2008-01-17 | Coley Pharmaceutical Group, Inc. | Substituted chiral fused( 1,2) imidazo (4,5-c) ring compounds and methods |
| CN101115224B (zh) * | 2006-07-28 | 2010-06-16 | 华为技术有限公司 | 用于ims网络的短信分叉方法及系统 |
| JP2010500365A (ja) | 2006-08-07 | 2010-01-07 | インサイト・コーポレイション | キナーゼ阻害剤としてのトリアゾロトリアジン |
| US8178539B2 (en) | 2006-09-06 | 2012-05-15 | 3M Innovative Properties Company | Substituted 3,4,6,7-tetrahydro-5H-1,2a,4a,8-tetraazacyclopenta[cd]phenalenes and methods |
| KR20090080530A (ko) | 2006-11-20 | 2009-07-24 | 노파르티스 아게 | 2-메틸-2-[4-(3-메틸-2-옥소-8-퀴놀린-3-일-2,3-디히드로-이미다조[4,5-c]퀴놀린-1-일)-페닐]-프로피오니트릴의 염 및 결정 형태 |
| ES2560435T3 (es) | 2006-11-22 | 2016-02-19 | Incyte Holdings Corporation | Imidazotriazinas e imidazopirimidinas como inhibidores de la quinasa |
| US20080149123A1 (en) | 2006-12-22 | 2008-06-26 | Mckay William D | Particulate material dispensing hairbrush with combination bristles |
| RU2478387C2 (ru) * | 2007-02-20 | 2013-04-10 | Новартис Аг | ИМИДАЗОХИНОЛИНЫ В КАЧЕСТВЕ ДВОЙНЫХ ИНГИБИТОРОВ ЛИПИДКИНАЗЫ И mTOR |
| EP2474323A3 (en) * | 2008-03-26 | 2012-10-10 | Novartis AG | Imidazoquinolines and pyrimidine derivatives as potent modulators of vegf-driven angiogenic processes |
| MX393622B (es) | 2008-05-21 | 2025-03-24 | Incyte Corp | Sales de 2-fluoro-n-metil-4-[7-(quinolin-6-il-metil)-imidazo[1,2-b][1,2,4]triazin-2-il]benzamida y procesos relacionados con la preparacion de las mismas. |
| WO2010076884A1 (ja) | 2008-12-29 | 2010-07-08 | 武田薬品工業株式会社 | 新規縮合環化合物およびその用途 |
| GEP20156267B (en) * | 2009-06-04 | 2015-04-14 | Novartis Ag | 1H-IMIDAZO[4,5-c]QUINOLINONE DERIVATIVES |
| CA2766967A1 (en) * | 2009-06-30 | 2011-01-06 | Piramal Life Sciences Limited | Imidazo [4,5-c]quinoline derivatives and their use in the treatment of tumors and/or inflammation |
| WO2011044185A2 (en) | 2009-10-08 | 2011-04-14 | Schering Corporation | Pentafluorosulfur imino heterocyclic compounds as bace-1 inhibitors, compositions, and their use |
| UA108363C2 (uk) | 2009-10-08 | 2015-04-27 | Похідні імінотіадіазиндіоксиду як інгібітори bace, композиція на їх основі і їх застосування | |
| WO2011044187A1 (en) | 2009-10-08 | 2011-04-14 | Schering Corporation | Iminothiadiazine dioxide compounds as bace inhibitors, compositions, and their use |
| WO2011044184A1 (en) | 2009-10-08 | 2011-04-14 | Schering Corporation | Pentafluorosulfur imino heterocyclic compounds as bace-1 inhibitors, compositions, and their use |
| JP5714030B2 (ja) | 2010-02-03 | 2015-05-07 | インサイト コーポレーションIncyte Corporation | C−Met阻害剤としてのイミダゾ[1,2−b][1,2,4]トリアジン |
| JP5863058B2 (ja) | 2010-05-17 | 2016-02-16 | ベーリンガー インゲルハイム インターナショナル ゲゼルシャフト ミット ベシュレンクテル ハフツング | 1H−イミダゾ[4,5−c]キノリン |
| DE102010025786A1 (de) * | 2010-07-01 | 2012-01-05 | Merck Patent Gmbh | Pyrazolochinoline |
| LT2606047T (lt) | 2010-08-17 | 2017-04-10 | 3M Innovative Properties Company | Imuninio atsako modifikatoriaus junginio lipidizuotos kompozicijos, sudėtys ir būdai |
| CN102372711B (zh) * | 2010-08-18 | 2014-09-17 | 山东轩竹医药科技有限公司 | 咪唑并喹啉类PI3K和mTOR双重抑制剂 |
| DE102010035744A1 (de) * | 2010-08-28 | 2012-03-01 | Merck Patent Gmbh | Imidazolonylchinoline |
| KR20140010009A (ko) * | 2010-12-03 | 2014-01-23 | 노파르티스 아게 | 제약 조성물 |
| KR20140014104A (ko) * | 2010-12-06 | 2014-02-05 | 피라말 엔터프라이지즈 리미티드 | 치환된 이미다조퀴놀린 유도체 |
| JO3003B1 (ar) | 2011-01-14 | 2016-09-05 | Lilly Co Eli | مركب أيميدازو [4، 5 -c ] كينولين-2- واحد واستخدامه كمثبط كيناز PI3/mtor |
| EP2717919B1 (en) | 2011-06-03 | 2016-08-03 | 3M Innovative Properties Company | Heterobifunctional linkers with polyethylene glycol segments and immune response modifier conjugates made therefrom |
| CA2838023C (en) | 2011-06-03 | 2019-08-13 | 3M Innovative Properties Company | Hydrazino 1h-imidazoquinolin-4-amines and conjugates made therefrom |
| WO2013007768A1 (en) * | 2011-07-13 | 2013-01-17 | F. Hoffmann-La Roche Ag | Tricyclic heterocyclic compounds, compositions and methods of use thereof as jak inhibitors |
| GB201114103D0 (en) | 2011-08-17 | 2011-09-28 | Glaxosmithkline Llc | Novel compounds |
| US20140309257A1 (en) * | 2011-11-11 | 2014-10-16 | The Regents Of The University Of Colorado, A Body Corporate | Topoisomerase inhibitors and methods of making and use as therapeutic agents |
| WO2013152252A1 (en) | 2012-04-06 | 2013-10-10 | OSI Pharmaceuticals, LLC | Combination anti-cancer therapy |
| AU2013302702A1 (en) * | 2012-08-16 | 2015-02-19 | Novartis Ag | Combination of Pl3K inhibitor and c-Met inhibitor |
| WO2014177915A1 (en) | 2013-05-01 | 2014-11-06 | Piramal Enterprises Limited | Cancer combination therapy using imidazo[4,5-c]quinoline derivatives |
| US9227969B2 (en) | 2013-08-14 | 2016-01-05 | Novartis Ag | Compounds and compositions as inhibitors of MEK |
| WO2015073804A2 (en) * | 2013-11-15 | 2015-05-21 | The United States Of America, As Represented By The Secretary, Department Of Health And Human Services | Method of blocking transmission of malarial parasite |
| MX2016012285A (es) | 2014-03-24 | 2017-01-23 | Genentech Inc | Tratamiento de cáncer con antagonista de c-met y correlación de estos con la expresión de hgf. |
| NO2714752T3 (enExample) * | 2014-05-08 | 2018-04-21 | ||
| CN105722840B (zh) * | 2014-07-14 | 2018-01-05 | 杭州爱德程医药科技有限公司 | 作为PI3K、mTOR抑制剂的稠合喹啉化合物 |
| DE102014226656A1 (de) | 2014-12-19 | 2016-06-23 | Robert Bosch Gmbh | Verfahren zum Betreiben eines Abgasnachbehandlungssystems für eine Brennkraftmaschine |
| FR3031105B1 (fr) * | 2014-12-31 | 2018-04-06 | Universite De Montpellier | Nouveaux imidazo[1,2-a]quinoxalines et derives pour le traitement des cancers |
| DK3560924T3 (da) | 2015-04-02 | 2021-06-28 | Merck Patent Gmbh | Imidazolonylquinoliner og deres anvendelse som atm-kinase-inhibitorer |
| CN114805351B (zh) * | 2015-07-11 | 2023-05-09 | 南京爱德程医药科技有限公司 | 作为pi3k/mtor抑制剂的带有酰胺基的吡啶基取代的稠合喹啉化合物 |
| GB201516504D0 (en) | 2015-09-17 | 2015-11-04 | Astrazeneca Ab | Imadazo(4,5-c)quinolin-2-one Compounds and their use in treating cancer |
| WO2017091757A1 (en) | 2015-11-24 | 2017-06-01 | Portola Pharmaceuticals, Inc. | Isotopically enriched betrixaban |
| CN106496036A (zh) * | 2016-09-29 | 2017-03-15 | 福建天富生物科技发展有限公司 | 一种抗凝血药物中间体5‑甲氧基‑2‑硝基苯甲酸的制备方法 |
| US10988472B2 (en) | 2016-10-13 | 2021-04-27 | The United States Of America, As Represented By The Secretary, Department Of Health And Human Services | Compounds and method for blocking transmission of malarial parasite |
| EP3728255B1 (en) | 2017-12-20 | 2022-01-26 | 3M Innovative Properties Company | Amide substituted imidazo[4,5-c]quinoline compounds with a branched chain linking group for use as an immune response modifier |
| CN118619944A (zh) | 2019-06-06 | 2024-09-10 | 北京泰德制药股份有限公司 | 作为atr激酶抑制剂的2,4,6-三取代的嘧啶化合物 |
| CN110606850A (zh) * | 2019-09-11 | 2019-12-24 | 中山大学 | 一种3-苯并[4,5]咪唑[1,2-a]吡嗪-1-胺类化合物及其制备方法和应用 |
Family Cites Families (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IL73534A (en) | 1983-11-18 | 1990-12-23 | Riker Laboratories Inc | 1h-imidazo(4,5-c)quinoline-4-amines,their preparation and pharmaceutical compositions containing certain such compounds |
| ZA848968B (en) | 1983-11-18 | 1986-06-25 | Riker Laboratories Inc | 1h-imidazo(4,5-c)quinolines and 1h-imidazo(4,5-c)quinolin-4-amines |
| CA1271477A (en) * | 1983-11-18 | 1990-07-10 | John F. Gerster | 1h-imidazo[4,5-c]quinolin-4-amines |
| GB8717644D0 (en) | 1987-07-24 | 1987-09-03 | Smithkline Beckman Intercredit | Compounds |
| DK0385630T3 (da) * | 1989-02-27 | 1997-05-12 | Riker Laboratories Inc | 1H-imidazo(4,5-c)quinolin-4-aminer som antivirale midler |
| CA2011504C (en) | 1989-03-07 | 1998-06-02 | Kenji Ohmori | Imidazoquinolone derivatives |
| US4929624A (en) * | 1989-03-23 | 1990-05-29 | Minnesota Mining And Manufacturing Company | Olefinic 1H-imidazo(4,5-c)quinolin-4-amines |
| US5037986A (en) * | 1989-03-23 | 1991-08-06 | Minnesota Mining And Manufacturing Company | Olefinic 1H-imidazo[4,5-c]quinolin-4-amines |
| GB8928281D0 (en) * | 1989-12-14 | 1990-02-21 | Smith Kline French Lab | Compounds |
| EP0872478B1 (en) * | 1991-03-01 | 2002-12-18 | Minnesota Mining And Manufacturing Company | Intermediates for the preparation of 1-substituted, 2-substituted 1H-imidazo[4,5-c]quinolin-4-amines |
| US5389640A (en) * | 1991-03-01 | 1995-02-14 | Minnesota Mining And Manufacturing Company | 1-substituted, 2-substituted 1H-imidazo[4,5-c]quinolin-4-amines |
| US5268376A (en) | 1991-09-04 | 1993-12-07 | Minnesota Mining And Manufacturing Company | 1-substituted 1H-imidazo[4,5-c]quinolin-4-amines |
| JPH05213754A (ja) * | 1992-02-03 | 1993-08-24 | Kyowa Hakko Kogyo Co Ltd | 抗潰瘍剤 |
| IL105325A (en) * | 1992-04-16 | 1996-11-14 | Minnesota Mining & Mfg | Immunogen/vaccine adjuvant composition |
| JP4101302B2 (ja) * | 1997-01-09 | 2008-06-18 | テルモ株式会社 | 新規アミド誘導体および合成中間体 |
| KR100251522B1 (ko) | 1997-08-13 | 2000-08-01 | 김충섭 | 할로알콕시기를 함유하는 피롤[3,2-c]퀴놀린 유도체 및 약학적으로 허용되는 그의 염 |
| JPH1180156A (ja) | 1997-09-04 | 1999-03-26 | Hokuriku Seiyaku Co Ltd | 1−(置換アリール)アルキル−1h−イミダゾピリジン−4−アミン誘導体 |
| JP2000119271A (ja) | 1998-08-12 | 2000-04-25 | Hokuriku Seiyaku Co Ltd | 1h―イミダゾピリジン誘導体 |
| DE19911039A1 (de) | 1999-03-12 | 2000-09-14 | Boehringer Ingelheim Pharma | Abgewandelte Aminosäureamide, diese Verbindungen enthaltende Arzneimittel und Verfahren zu ihrer Herstellung |
| US6331539B1 (en) * | 1999-06-10 | 2001-12-18 | 3M Innovative Properties Company | Sulfonamide and sulfamide substituted imidazoquinolines |
| US6541485B1 (en) * | 1999-06-10 | 2003-04-01 | 3M Innovative Properties Company | Urea substituted imidazoquinolines |
| US6451810B1 (en) * | 1999-06-10 | 2002-09-17 | 3M Innovative Properties Company | Amide substituted imidazoquinolines |
| AU2220801A (en) | 1999-12-22 | 2001-07-03 | Kyorin Pharmaceutical Co. Ltd. | Tricyclic compounds and addition salts thereof |
| EP1256582A1 (en) | 2000-02-09 | 2002-11-13 | Hokuriku Seiyaku Co., Ltd. | 1h-imidazopyridine derivatives |
| SK17812002A3 (sk) | 2000-06-22 | 2003-05-02 | 3M Innovative Properties Company | Systémy a spôsoby liečby povrchu sliznice |
| UA74852C2 (en) | 2000-12-08 | 2006-02-15 | 3M Innovative Properties Co | Urea-substituted imidazoquinoline ethers |
| DE60230340D1 (de) * | 2001-11-16 | 2009-01-22 | 3M Innovative Properties Co | N-Ä4-(4-Amino-2-ethyl-1H-imidazoÄ4,5-cÜchinolin-1-yl)butylÜmethanesulfonamide, diese enthaltende pharmazeutische Zusammensetzung und deren Verwendung |
-
2002
- 2002-05-21 GB GBGB0211649.9A patent/GB0211649D0/en not_active Ceased
-
2003
- 2003-05-20 SI SI200331434T patent/SI1509521T1/sl unknown
- 2003-05-20 AT AT03730079T patent/ATE405564T1/de active
- 2003-05-20 US US10/515,126 patent/US7998972B2/en not_active Expired - Fee Related
- 2003-05-20 PT PT03730079T patent/PT1509521E/pt unknown
- 2003-05-20 CN CNB038117053A patent/CN100475207C/zh not_active Expired - Fee Related
- 2003-05-20 BR BR0311221-7A patent/BR0311221A/pt not_active IP Right Cessation
- 2003-05-20 ES ES03730079T patent/ES2312783T3/es not_active Expired - Lifetime
- 2003-05-20 AU AU2003240680A patent/AU2003240680A1/en not_active Abandoned
- 2003-05-20 JP JP2004505373A patent/JP4707389B2/ja not_active Expired - Fee Related
- 2003-05-20 CA CA002485012A patent/CA2485012A1/en not_active Abandoned
- 2003-05-20 DK DK03730079T patent/DK1509521T3/da active
- 2003-05-20 EP EP03730079A patent/EP1509521B8/en not_active Expired - Lifetime
- 2003-05-20 WO PCT/EP2003/005291 patent/WO2003097641A2/en not_active Ceased
- 2003-05-20 DE DE60323090T patent/DE60323090D1/de not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| ES2312783T3 (es) | 2009-03-01 |
| WO2003097641A3 (en) | 2004-05-06 |
| US7998972B2 (en) | 2011-08-16 |
| US20050245562A1 (en) | 2005-11-03 |
| AU2003240680A1 (en) | 2003-12-02 |
| ATE405564T1 (de) | 2008-09-15 |
| JP4707389B2 (ja) | 2011-06-22 |
| EP1509521A2 (en) | 2005-03-02 |
| AU2003240680A8 (en) | 2003-12-02 |
| PT1509521E (pt) | 2008-11-25 |
| BR0311221A (pt) | 2005-03-01 |
| CN100475207C (zh) | 2009-04-08 |
| CN1655788A (zh) | 2005-08-17 |
| DK1509521T3 (da) | 2008-12-15 |
| SI1509521T1 (sl) | 2009-02-28 |
| DE60323090D1 (de) | 2008-10-02 |
| JP2005534636A (ja) | 2005-11-17 |
| EP1509521B8 (en) | 2009-02-18 |
| HK1074837A1 (en) | 2005-11-25 |
| GB0211649D0 (en) | 2002-07-03 |
| WO2003097641A2 (en) | 2003-11-27 |
| EP1509521B1 (en) | 2008-08-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP1509521B1 (en) | 1h-imidazo[4,5-c]quinoline derivatives for the treatment of protein kinase dependent diseases | |
| US12171739B2 (en) | N4-phenyl-quinazoline-4-amine derivatives and related compounds as ErbB type I receptor tyrosine kinase inhibitors for the treatment of hyperproliferative diseases | |
| EP1416935B1 (en) | 4-amino-6-phenyl-pyrrolo[2,3-d]pyrimidine derivatives | |
| CA2473796A1 (en) | Substituted quinazolin-4-ylamine analogues | |
| AU2002324029A1 (en) | 4-amino-6-phenyl-pyrrolo[2,3-d]pyrimidine derivatives | |
| CA2585660A1 (en) | 1,4 substituted pyrazolopyrimidines as kinase inhibitors | |
| BRPI0718269A2 (pt) | Derivados de pirazol fundido substituído por 3-aminocarbonila como moduladores de proteína cinase | |
| BRPI0619517A2 (pt) | ácidos pirazolo[1,5-a]piridina-3-carboxìlicos como inibidores de ephb e vegfr2 cinase | |
| JP2009532401A (ja) | キナーゼ阻害剤としての3−置換N−(アリール−またはヘテロアリール)−ピラゾロ[1,5−a]ピリミジン | |
| US7323469B2 (en) | 7H-pyrrolo[2,3-d]pyrimidine derivatives | |
| KR20090007391A (ko) | 키나제 억제제로서의 3-비치환된 N-(아릴- 또는 헤테로아릴)-피라졸로[1,5-a]피리미딘 | |
| KR20060124705A (ko) | 7h-피롤로피리미딘 유도체 | |
| HK1074837B (en) | 1h-imidazo[4,5-c]quinoline derivatives for the treatment of protein kinase dependent diseases | |
| HK1065483B (en) | 4-amino-6-phenyl-pyrrolo[2,3-d]pyrimidine derivatives | |
| HK1129678B (en) | Processes and intermediates for the preparation of n4-phenyl-quinazoline-4-amine derivatives |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| EEER | Examination request | ||
| FZDE | Discontinued |